Reset info logs back to print in sync

Bug: b/292704435
Change-Id: Ib4b4873de726888fc68e476167ff2dcd74ec9045
Reviewed-on: https://gerrit-review.googlesource.com/c/git-repo/+/387974
Tested-by: Aravind Vasudevan <aravindvasudev@google.com>
Commit-Queue: Aravind Vasudevan <aravindvasudev@google.com>
Reviewed-by: Jason Chang <jasonnc@google.com>

.flake8

@@ -1,15 +1,16 @@
 [flake8]
-max-line-length=100
+max-line-length = 80
-ignore=
+per-file-ignores =
-    # E111: Indentation is not a multiple of four
+    # E501: line too long
-    E111,
+    tests/test_git_superproject.py: E501
-    # E114: Indentation is not a multiple of four (comment)
+extend-ignore =
-    E114,
+    # E203: Whitespace before ':'
+    # See https://github.com/PyCQA/pycodestyle/issues/373
+    E203,
     # E402: Module level import not at top of file
     E402,
     # E731: do not assign a lambda expression, use a def
     E731,
-    # W503: Line break before binary operator
+exclude =
-    W503,
+    venv,
-    # W504: Line break after binary operator
+    .tox,
-    W504

.github/workflows/close-pull-request.yml

@@ -0,0 +1,22 @@
+# GitHub actions workflow.
+# https://docs.github.com/en/actions/learn-github-actions/workflow-syntax-for-github-actions
+
+# https://github.com/superbrothers/close-pull-request
+name: Close Pull Request
+
+on:
+  pull_request_target:
+    types: [opened]
+
+jobs:
+  run:
+    runs-on: ubuntu-latest
+    steps:
+    - uses: superbrothers/close-pull-request@v3
+      with:
+        comment: >
+          Thanks for your contribution!
+          Unfortunately, we don't use GitHub pull requests to manage code
+          contributions to this repository.
+          Instead, please see [README.md](../blob/HEAD/SUBMITTING_PATCHES.md)
+          which provides full instructions on how to get involved.

.github/workflows/flake8-postsubmit.yml

@@ -0,0 +1,23 @@
+# GitHub actions workflow.
+# https://help.github.com/en/actions/automating-your-workflow-with-github-actions/workflow-syntax-for-github-actions
+# https://github.com/marketplace/actions/python-flake8
+
+name: Flake8
+
+on:
+  push:
+    branches: [main]
+
+jobs:
+  lint:
+    name: Python Lint
+    runs-on: ubuntu-latest
+    steps:
+      - uses: actions/checkout@v3
+      - uses: actions/setup-python@v4
+        with:
+          python-version: "3.9"
+      - name: Run flake8
+        uses: julianwachholz/flake8-action@v2
+        with:
+          checkName: "Python Lint"

.github/workflows/test-ci.yml

@@ -14,18 +14,18 @@ jobs:
       fail-fast: false
       matrix:
         os: [ubuntu-latest, macos-latest, windows-latest]
-        python-version: [3.6, 3.7, 3.8, 3.9]
+        python-version: ['3.6', '3.7', '3.8', '3.9', '3.10']
     runs-on: ${{ matrix.os }}
 
     steps:
-    - uses: actions/checkout@v2
+    - uses: actions/checkout@v3
     - name: Set up Python ${{ matrix.python-version }}
-      uses: actions/setup-python@v1
+      uses: actions/setup-python@v4
       with:
         python-version: ${{ matrix.python-version }}
     - name: Install dependencies
       run: |
         python -m pip install --upgrade pip
-        pip install tox tox-gh-actions
+        python -m pip install tox tox-gh-actions
     - name: Test with tox
       run: tox

.isort.cfg

@@ -0,0 +1,41 @@
+# Copyright 2023 The Android Open Source Project
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#      http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+# Config file for the isort python module.
+# This is used to enforce import sorting standards.
+#
+# https://pycqa.github.io/isort/docs/configuration/options.html
+
+[settings]
+# Be compatible with `black` since it also matches what we want.
+profile = black
+
+line_length = 80
+length_sort = false
+force_single_line = true
+lines_after_imports = 2
+from_first = false
+case_sensitive = false
+force_sort_within_sections = true
+order_by_type = false
+
+# Ignore generated files.
+extend_skip_glob = *_pb2.py
+
+# Allow importing multiple classes on a single line from these modules.
+# https://google.github.io/styleguide/pyguide#s2.2-imports
+single_line_exclusions =
+    abc,
+    collections.abc,
+    typing,

README.md

@@ -8,7 +8,7 @@ that you can put anywhere in your path.
 
 * Homepage: <https://gerrit.googlesource.com/git-repo/>
 * Mailing list: [repo-discuss on Google Groups][repo-discuss]
-* Bug reports: <https://bugs.chromium.org/p/gerrit/issues/list?q=component:repo>
+* Bug reports: <https://issues.gerritcodereview.com/issues?q=is:open%20componentid:1370071>
 * Source: <https://gerrit.googlesource.com/git-repo/>
 * Overview: <https://source.android.com/source/developing.html>
 * Docs: <https://source.android.com/source/using-repo.html>
@@ -50,6 +50,6 @@ $ chmod a+rx ~/.bin/repo
 ```
 
 
-[new-bug]: https://bugs.chromium.org/p/gerrit/issues/entry?template=Repo+tool+issue
+[new-bug]: https://issues.gerritcodereview.com/issues/new?component=1370071
-[issue tracker]: https://bugs.chromium.org/p/gerrit/issues/list?q=component:repo
+[issue tracker]: https://issues.gerritcodereview.com/issues?q=is:open%20componentid:1370071
 [repo-discuss]: https://groups.google.com/forum/#!forum/repo-discuss

SUBMITTING_PATCHES.md

@@ -1,19 +1,19 @@
+# Submitting Changes
+
+Here's a short overview of the process.
+
+*   Make small logical changes.
+*   [Provide a meaningful commit message][commit-message-style].
+*   Make sure all code is under the Apache License, 2.0.
+*   Publish your changes for review.
+    *   `git push origin HEAD:refs/for/main`
+*   Make corrections if requested.
+*   [Verify your changes on Gerrit.](#verify)
+*   [Send to the commit queue for testing & merging.](#cq)
+
 [TOC]
 
-# Short Version
+## Long Version
-
- - Make small logical changes.
- - [Provide a meaningful commit message][commit-message-style].
- - Check for coding errors and style nits with flake8.
- - Make sure all code is under the Apache License, 2.0.
- - Publish your changes for review.
- - Make corrections if requested.
- - Verify your changes on gerrit so they can be submitted.
-
-   `git push https://gerrit-review.googlesource.com/git-repo HEAD:refs/for/main`
-
-
-# Long Version
 
 I wanted a file describing how to submit patches for repo,
 so I started with the one found in the core Git distribution
@@ -39,17 +39,26 @@ If your description starts to get too long, that's a sign that you
 probably need to split up your commit to finer grained pieces.
 
 
-## Check for coding errors and style violations with flake8
+## Linting and formatting code
 
-Run `flake8` on changed modules:
+Lint any changes by running:
+```sh
+$ tox -e lint -- file.py
+```
 
-    flake8 file.py
+And format with:
+```sh
+$ tox -e format -- file.py
+```
 
-Note that repo generally follows [Google's Python Style Guide] rather than
+Or format everything:
-[PEP 8], with a couple of notable exceptions:
+```sh
+$ tox -e format
+```
 
-* Indentation is at 2 columns rather than 4
+Repo uses [black](https://black.readthedocs.io/) with line length of 80 as its
-* The maximum line length is 100 columns rather than 80
+formatter and flake8 as its linter. Repo also follows
+[Google's Python Style Guide].
 
 There should be no new errors or warnings introduced.
 
@@ -166,12 +175,16 @@ commit. If you make the requested changes you will need to amend your commit
 and push it to the review server again.
 
 
-## Verify your changes on gerrit
+## Verify your changes on Gerrit {#verify}
 
 After you receive a Code-Review+2 from the maintainer, select the Verified
-button on the gerrit page for the change. This verifies that you have tested
+button on the Gerrit page for the change. This verifies that you have tested
 your changes and notifies the maintainer that they are ready to be submitted.
-The maintainer will then submit your changes to the repository.
 
+## Merge your changes via the commit queue {#cq}
+
+Once a change is ready to be merged, select the Commit-Queue+2 setting on the
+Gerrit page for it. This tells the CI system to test the change, and if it
+passes all the checks, automatically merges it.
 
 [commit-message-style]: https://chris.beams.io/posts/git-commit/

color.py

@@ -17,196 +17,201 @@ import sys
 
 import pager
 
-COLORS = {None: -1,
-          'normal': -1,
-          'black': 0,
-          'red': 1,
-          'green': 2,
-          'yellow': 3,
-          'blue': 4,
-          'magenta': 5,
-          'cyan': 6,
-          'white': 7}
 
-ATTRS = {None: -1,
+COLORS = {
-         'bold': 1,
+    None: -1,
-         'dim': 2,
+    "normal": -1,
-         'ul': 4,
+    "black": 0,
-         'blink': 5,
+    "red": 1,
-         'reverse': 7}
+    "green": 2,
+    "yellow": 3,
+    "blue": 4,
+    "magenta": 5,
+    "cyan": 6,
+    "white": 7,
+}
+
+ATTRS = {None: -1, "bold": 1, "dim": 2, "ul": 4, "blink": 5, "reverse": 7}
 
 RESET = "\033[m"
 
 
 def is_color(s):
-  return s in COLORS
+    return s in COLORS
 
 
 def is_attr(s):
-  return s in ATTRS
+    return s in ATTRS
 
 
 def _Color(fg=None, bg=None, attr=None):
-  fg = COLORS[fg]
+    fg = COLORS[fg]
-  bg = COLORS[bg]
+    bg = COLORS[bg]
-  attr = ATTRS[attr]
+    attr = ATTRS[attr]
 
-  if attr >= 0 or fg >= 0 or bg >= 0:
+    if attr >= 0 or fg >= 0 or bg >= 0:
-    need_sep = False
+        need_sep = False
-    code = "\033["
+        code = "\033["
 
-    if attr >= 0:
+        if attr >= 0:
-      code += chr(ord('0') + attr)
+            code += chr(ord("0") + attr)
-      need_sep = True
+            need_sep = True
 
-    if fg >= 0:
+        if fg >= 0:
-      if need_sep:
+            if need_sep:
-        code += ';'
+                code += ";"
-      need_sep = True
+            need_sep = True
 
-      if fg < 8:
+            if fg < 8:
-        code += '3%c' % (ord('0') + fg)
+                code += "3%c" % (ord("0") + fg)
-      else:
+            else:
-        code += '38;5;%d' % fg
+                code += "38;5;%d" % fg
 
-    if bg >= 0:
+        if bg >= 0:
-      if need_sep:
+            if need_sep:
-        code += ';'
+                code += ";"
 
-      if bg < 8:
+            if bg < 8:
-        code += '4%c' % (ord('0') + bg)
+                code += "4%c" % (ord("0") + bg)
-      else:
+            else:
-        code += '48;5;%d' % bg
+                code += "48;5;%d" % bg
-    code += 'm'
+        code += "m"
-  else:
+    else:
-    code = ''
+        code = ""
-  return code
+    return code
 
 
 DEFAULT = None
 
 
 def SetDefaultColoring(state):
-  """Set coloring behavior to |state|.
+    """Set coloring behavior to |state|.
 
-  This is useful for overriding config options via the command line.
+    This is useful for overriding config options via the command line.
-  """
+    """
-  if state is None:
+    if state is None:
-    # Leave it alone -- return quick!
+        # Leave it alone -- return quick!
-    return
+        return
 
-  global DEFAULT
+    global DEFAULT
-  state = state.lower()
+    state = state.lower()
-  if state in ('auto',):
+    if state in ("auto",):
-    DEFAULT = state
+        DEFAULT = state
-  elif state in ('always', 'yes', 'true', True):
+    elif state in ("always", "yes", "true", True):
-    DEFAULT = 'always'
+        DEFAULT = "always"
-  elif state in ('never', 'no', 'false', False):
+    elif state in ("never", "no", "false", False):
-    DEFAULT = 'never'
+        DEFAULT = "never"
 
 
 class Coloring(object):
-  def __init__(self, config, section_type):
+    def __init__(self, config, section_type):
-    self._section = 'color.%s' % section_type
+        self._section = "color.%s" % section_type
-    self._config = config
+        self._config = config
-    self._out = sys.stdout
+        self._out = sys.stdout
 
-    on = DEFAULT
+        on = DEFAULT
-    if on is None:
+        if on is None:
-      on = self._config.GetString(self._section)
+            on = self._config.GetString(self._section)
-      if on is None:
+            if on is None:
-        on = self._config.GetString('color.ui')
+                on = self._config.GetString("color.ui")
 
-    if on == 'auto':
+        if on == "auto":
-      if pager.active or os.isatty(1):
+            if pager.active or os.isatty(1):
-        self._on = True
+                self._on = True
-      else:
+            else:
-        self._on = False
+                self._on = False
-    elif on in ('true', 'always'):
+        elif on in ("true", "always"):
-      self._on = True
+            self._on = True
-    else:
-      self._on = False
-
-  def redirect(self, out):
-    self._out = out
-
-  @property
-  def is_on(self):
-    return self._on
-
-  def write(self, fmt, *args):
-    self._out.write(fmt % args)
-
-  def flush(self):
-    self._out.flush()
-
-  def nl(self):
-    self._out.write('\n')
-
-  def printer(self, opt=None, fg=None, bg=None, attr=None):
-    s = self
-    c = self.colorer(opt, fg, bg, attr)
-
-    def f(fmt, *args):
-      s._out.write(c(fmt, *args))
-    return f
-
-  def nofmt_printer(self, opt=None, fg=None, bg=None, attr=None):
-    s = self
-    c = self.nofmt_colorer(opt, fg, bg, attr)
-
-    def f(fmt):
-      s._out.write(c(fmt))
-    return f
-
-  def colorer(self, opt=None, fg=None, bg=None, attr=None):
-    if self._on:
-      c = self._parse(opt, fg, bg, attr)
-
-      def f(fmt, *args):
-        output = fmt % args
-        return ''.join([c, output, RESET])
-      return f
-    else:
-
-      def f(fmt, *args):
-        return fmt % args
-      return f
-
-  def nofmt_colorer(self, opt=None, fg=None, bg=None, attr=None):
-    if self._on:
-      c = self._parse(opt, fg, bg, attr)
-
-      def f(fmt):
-        return ''.join([c, fmt, RESET])
-      return f
-    else:
-      def f(fmt):
-        return fmt
-      return f
-
-  def _parse(self, opt, fg, bg, attr):
-    if not opt:
-      return _Color(fg, bg, attr)
-
-    v = self._config.GetString('%s.%s' % (self._section, opt))
-    if v is None:
-      return _Color(fg, bg, attr)
-
-    v = v.strip().lower()
-    if v == "reset":
-      return RESET
-    elif v == '':
-      return _Color(fg, bg, attr)
-
-    have_fg = False
-    for a in v.split(' '):
-      if is_color(a):
-        if have_fg:
-          bg = a
         else:
-          fg = a
+            self._on = False
-      elif is_attr(a):
-        attr = a
 
-    return _Color(fg, bg, attr)
+    def redirect(self, out):
+        self._out = out
+
+    @property
+    def is_on(self):
+        return self._on
+
+    def write(self, fmt, *args):
+        self._out.write(fmt % args)
+
+    def flush(self):
+        self._out.flush()
+
+    def nl(self):
+        self._out.write("\n")
+
+    def printer(self, opt=None, fg=None, bg=None, attr=None):
+        s = self
+        c = self.colorer(opt, fg, bg, attr)
+
+        def f(fmt, *args):
+            s._out.write(c(fmt, *args))
+
+        return f
+
+    def nofmt_printer(self, opt=None, fg=None, bg=None, attr=None):
+        s = self
+        c = self.nofmt_colorer(opt, fg, bg, attr)
+
+        def f(fmt):
+            s._out.write(c(fmt))
+
+        return f
+
+    def colorer(self, opt=None, fg=None, bg=None, attr=None):
+        if self._on:
+            c = self._parse(opt, fg, bg, attr)
+
+            def f(fmt, *args):
+                output = fmt % args
+                return "".join([c, output, RESET])
+
+            return f
+        else:
+
+            def f(fmt, *args):
+                return fmt % args
+
+            return f
+
+    def nofmt_colorer(self, opt=None, fg=None, bg=None, attr=None):
+        if self._on:
+            c = self._parse(opt, fg, bg, attr)
+
+            def f(fmt):
+                return "".join([c, fmt, RESET])
+
+            return f
+        else:
+
+            def f(fmt):
+                return fmt
+
+            return f
+
+    def _parse(self, opt, fg, bg, attr):
+        if not opt:
+            return _Color(fg, bg, attr)
+
+        v = self._config.GetString("%s.%s" % (self._section, opt))
+        if v is None:
+            return _Color(fg, bg, attr)
+
+        v = v.strip().lower()
+        if v == "reset":
+            return RESET
+        elif v == "":
+            return _Color(fg, bg, attr)
+
+        have_fg = False
+        for a in v.split(" "):
+            if is_color(a):
+                if have_fg:
+                    bg = a
+                else:
+                    fg = a
+            elif is_attr(a):
+                attr = a
+
+        return _Color(fg, bg, attr)

command.py

@@ -13,19 +13,19 @@
 # limitations under the License.
 
 import multiprocessing
-import os
 import optparse
+import os
 import re
-import sys
 
-from event_log import EventLog
-from error import NoSuchProjectError
 from error import InvalidProjectGroupsError
+from error import NoSuchProjectError
+from error import RepoExitError
+from event_log import EventLog
 import progress
 
 
 # Are we generating man-pages?
-GENERATE_MANPAGES = os.environ.get('_REPO_GENERATE_MANPAGES_') == ' indeed! '
+GENERATE_MANPAGES = os.environ.get("_REPO_GENERATE_MANPAGES_") == " indeed! "
 
 
 # Number of projects to submit to a single worker process at a time.
@@ -42,403 +42,467 @@ WORKER_BATCH_SIZE = 32
 DEFAULT_LOCAL_JOBS = min(os.cpu_count(), 8)
 
 
+class UsageError(RepoExitError):
+    """Exception thrown with invalid command usage."""
+
+
 class Command(object):
-  """Base class for any command line action in repo.
+    """Base class for any command line action in repo."""
-  """
 
-  # Singleton for all commands to track overall repo command execution and
+    # Singleton for all commands to track overall repo command execution and
-  # provide event summary to callers.  Only used by sync subcommand currently.
+    # provide event summary to callers. Only used by sync subcommand currently.
-  #
+    #
-  # NB: This is being replaced by git trace2 events.  See git_trace2_event_log.
+    # NB: This is being replaced by git trace2 events. See git_trace2_event_log.
-  event_log = EventLog()
+    event_log = EventLog()
 
-  # Whether this command is a "common" one, i.e. whether the user would commonly
+    # Whether this command is a "common" one, i.e. whether the user would
-  # use it or it's a more uncommon command.  This is used by the help command to
+    # commonly use it or it's a more uncommon command. This is used by the help
-  # show short-vs-full summaries.
+    # command to show short-vs-full summaries.
-  COMMON = False
+    COMMON = False
 
-  # Whether this command supports running in parallel.  If greater than 0,
+    # Whether this command supports running in parallel. If greater than 0,
-  # it is the number of parallel jobs to default to.
+    # it is the number of parallel jobs to default to.
-  PARALLEL_JOBS = None
+    PARALLEL_JOBS = None
 
-  # Whether this command supports Multi-manifest.  If False, then main.py will
+    # Whether this command supports Multi-manifest. If False, then main.py will
-  # iterate over the manifests and invoke the command once per (sub)manifest.
+    # iterate over the manifests and invoke the command once per (sub)manifest.
-  # This is only checked after calling ValidateOptions, so that partially
+    # This is only checked after calling ValidateOptions, so that partially
-  # migrated subcommands can set it to False.
+    # migrated subcommands can set it to False.
-  MULTI_MANIFEST_SUPPORT = True
+    MULTI_MANIFEST_SUPPORT = True
 
-  def __init__(self, repodir=None, client=None, manifest=None, gitc_manifest=None,
+    def __init__(
-               git_event_log=None, outer_client=None, outer_manifest=None):
+        self,
-    self.repodir = repodir
+        repodir=None,
-    self.client = client
+        client=None,
-    self.outer_client = outer_client or client
+        manifest=None,
-    self.manifest = manifest
+        git_event_log=None,
-    self.gitc_manifest = gitc_manifest
+        outer_client=None,
-    self.git_event_log = git_event_log
+        outer_manifest=None,
-    self.outer_manifest = outer_manifest
+    ):
+        self.repodir = repodir
+        self.client = client
+        self.outer_client = outer_client or client
+        self.manifest = manifest
+        self.git_event_log = git_event_log
+        self.outer_manifest = outer_manifest
 
-    # Cache for the OptionParser property.
+        # Cache for the OptionParser property.
-    self._optparse = None
+        self._optparse = None
 
-  def WantPager(self, _opt):
+    def WantPager(self, _opt):
-    return False
+        return False
 
-  def ReadEnvironmentOptions(self, opts):
+    def ReadEnvironmentOptions(self, opts):
-    """ Set options from environment variables. """
+        """Set options from environment variables."""
 
-    env_options = self._RegisteredEnvironmentOptions()
+        env_options = self._RegisteredEnvironmentOptions()
 
-    for env_key, opt_key in env_options.items():
+        for env_key, opt_key in env_options.items():
-      # Get the user-set option value if any
+            # Get the user-set option value if any
-      opt_value = getattr(opts, opt_key)
+            opt_value = getattr(opts, opt_key)
 
-      # If the value is set, it means the user has passed it as a command
+            # If the value is set, it means the user has passed it as a command
-      # line option, and we should use that.  Otherwise we can try to set it
+            # line option, and we should use that. Otherwise we can try to set
-      # with the value from the corresponding environment variable.
+            # it with the value from the corresponding environment variable.
-      if opt_value is not None:
+            if opt_value is not None:
-        continue
+                continue
 
-      env_value = os.environ.get(env_key)
+            env_value = os.environ.get(env_key)
-      if env_value is not None:
+            if env_value is not None:
-        setattr(opts, opt_key, env_value)
+                setattr(opts, opt_key, env_value)
 
-    return opts
+        return opts
 
-  @property
+    @property
-  def OptionParser(self):
+    def OptionParser(self):
-    if self._optparse is None:
+        if self._optparse is None:
-      try:
+            try:
-        me = 'repo %s' % self.NAME
+                me = "repo %s" % self.NAME
-        usage = self.helpUsage.strip().replace('%prog', me)
+                usage = self.helpUsage.strip().replace("%prog", me)
-      except AttributeError:
+            except AttributeError:
-        usage = 'repo %s' % self.NAME
+                usage = "repo %s" % self.NAME
-      epilog = 'Run `repo help %s` to view the detailed manual.' % self.NAME
+            epilog = (
-      self._optparse = optparse.OptionParser(usage=usage, epilog=epilog)
+                "Run `repo help %s` to view the detailed manual." % self.NAME
-      self._CommonOptions(self._optparse)
+            )
-      self._Options(self._optparse)
+            self._optparse = optparse.OptionParser(usage=usage, epilog=epilog)
-    return self._optparse
+            self._CommonOptions(self._optparse)
+            self._Options(self._optparse)
+        return self._optparse
 
-  def _CommonOptions(self, p, opt_v=True):
+    def _CommonOptions(self, p, opt_v=True):
-    """Initialize the option parser with common options.
+        """Initialize the option parser with common options.
 
-    These will show up for *all* subcommands, so use sparingly.
+        These will show up for *all* subcommands, so use sparingly.
-    NB: Keep in sync with repo:InitParser().
+        NB: Keep in sync with repo:InitParser().
-    """
+        """
-    g = p.add_option_group('Logging options')
+        g = p.add_option_group("Logging options")
-    opts = ['-v'] if opt_v else []
+        opts = ["-v"] if opt_v else []
-    g.add_option(*opts, '--verbose',
+        g.add_option(
-                 dest='output_mode', action='store_true',
+            *opts,
-                 help='show all output')
+            "--verbose",
-    g.add_option('-q', '--quiet',
+            dest="output_mode",
-                 dest='output_mode', action='store_false',
+            action="store_true",
-                 help='only show errors')
+            help="show all output",
+        )
+        g.add_option(
+            "-q",
+            "--quiet",
+            dest="output_mode",
+            action="store_false",
+            help="only show errors",
+        )
 
-    if self.PARALLEL_JOBS is not None:
+        if self.PARALLEL_JOBS is not None:
-      default = 'based on number of CPU cores'
+            default = "based on number of CPU cores"
-      if not GENERATE_MANPAGES:
+            if not GENERATE_MANPAGES:
-        # Only include active cpu count if we aren't generating man pages.
+                # Only include active cpu count if we aren't generating man
-        default = f'%default; {default}'
+                # pages.
-      p.add_option(
+                default = f"%default; {default}"
-          '-j', '--jobs',
+            p.add_option(
-          type=int, default=self.PARALLEL_JOBS,
+                "-j",
-          help=f'number of jobs to run in parallel (default: {default})')
+                "--jobs",
+                type=int,
+                default=self.PARALLEL_JOBS,
+                help=f"number of jobs to run in parallel (default: {default})",
+            )
 
-    m = p.add_option_group('Multi-manifest options')
+        m = p.add_option_group("Multi-manifest options")
-    m.add_option('--outer-manifest', action='store_true', default=None,
+        m.add_option(
-                 help='operate starting at the outermost manifest')
+            "--outer-manifest",
-    m.add_option('--no-outer-manifest', dest='outer_manifest',
+            action="store_true",
-                 action='store_false', help='do not operate on outer manifests')
+            default=None,
-    m.add_option('--this-manifest-only', action='store_true', default=None,
+            help="operate starting at the outermost manifest",
-                 help='only operate on this (sub)manifest')
+        )
-    m.add_option('--no-this-manifest-only', '--all-manifests',
+        m.add_option(
-                 dest='this_manifest_only', action='store_false',
+            "--no-outer-manifest",
-                 help='operate on this manifest and its submanifests')
+            dest="outer_manifest",
+            action="store_false",
+            help="do not operate on outer manifests",
+        )
+        m.add_option(
+            "--this-manifest-only",
+            action="store_true",
+            default=None,
+            help="only operate on this (sub)manifest",
+        )
+        m.add_option(
+            "--no-this-manifest-only",
+            "--all-manifests",
+            dest="this_manifest_only",
+            action="store_false",
+            help="operate on this manifest and its submanifests",
+        )
 
-  def _Options(self, p):
+    def _Options(self, p):
-    """Initialize the option parser with subcommand-specific options."""
+        """Initialize the option parser with subcommand-specific options."""
 
-  def _RegisteredEnvironmentOptions(self):
+    def _RegisteredEnvironmentOptions(self):
-    """Get options that can be set from environment variables.
+        """Get options that can be set from environment variables.
 
-    Return a dictionary mapping environment variable name
+        Return a dictionary mapping environment variable name
-    to option key name that it can override.
+        to option key name that it can override.
 
-    Example: {'REPO_MY_OPTION': 'my_option'}
+        Example: {'REPO_MY_OPTION': 'my_option'}
 
-    Will allow the option with key value 'my_option' to be set
+        Will allow the option with key value 'my_option' to be set
-    from the value in the environment variable named 'REPO_MY_OPTION'.
+        from the value in the environment variable named 'REPO_MY_OPTION'.
 
-    Note: This does not work properly for options that are explicitly
+        Note: This does not work properly for options that are explicitly
-    set to None by the user, or options that are defined with a
+        set to None by the user, or options that are defined with a
-    default value other than None.
+        default value other than None.
 
-    """
+        """
-    return {}
+        return {}
 
-  def Usage(self):
+    def Usage(self):
-    """Display usage and terminate.
+        """Display usage and terminate."""
-    """
+        self.OptionParser.print_usage()
-    self.OptionParser.print_usage()
+        raise UsageError()
-    sys.exit(1)
 
-  def CommonValidateOptions(self, opt, args):
+    def CommonValidateOptions(self, opt, args):
-    """Validate common options."""
+        """Validate common options."""
-    opt.quiet = opt.output_mode is False
+        opt.quiet = opt.output_mode is False
-    opt.verbose = opt.output_mode is True
+        opt.verbose = opt.output_mode is True
-    if opt.outer_manifest is None:
+        if opt.outer_manifest is None:
-      # By default, treat multi-manifest instances as a single manifest from
+            # By default, treat multi-manifest instances as a single manifest
-      # the user's perspective.
+            # from the user's perspective.
-      opt.outer_manifest = True
+            opt.outer_manifest = True
 
-  def ValidateOptions(self, opt, args):
+    def ValidateOptions(self, opt, args):
-    """Validate the user options & arguments before executing.
+        """Validate the user options & arguments before executing.
 
-    This is meant to help break the code up into logical steps.  Some tips:
+        This is meant to help break the code up into logical steps. Some tips:
-    * Use self.OptionParser.error to display CLI related errors.
+        * Use self.OptionParser.error to display CLI related errors.
-    * Adjust opt member defaults as makes sense.
+        * Adjust opt member defaults as makes sense.
-    * Adjust the args list, but do so inplace so the caller sees updates.
+        * Adjust the args list, but do so inplace so the caller sees updates.
-    * Try to avoid updating self state.  Leave that to Execute.
+        * Try to avoid updating self state. Leave that to Execute.
-    """
+        """
 
-  def Execute(self, opt, args):
+    def Execute(self, opt, args):
-    """Perform the action, after option parsing is complete.
+        """Perform the action, after option parsing is complete."""
-    """
+        raise NotImplementedError
-    raise NotImplementedError
 
-  @staticmethod
+    @staticmethod
-  def ExecuteInParallel(jobs, func, inputs, callback, output=None, ordered=False):
+    def ExecuteInParallel(
-    """Helper for managing parallel execution boiler plate.
+        jobs, func, inputs, callback, output=None, ordered=False
+    ):
+        """Helper for managing parallel execution boiler plate.
 
-    For subcommands that can easily split their work up.
+        For subcommands that can easily split their work up.
 
-    Args:
+        Args:
-      jobs: How many parallel processes to use.
+            jobs: How many parallel processes to use.
-      func: The function to apply to each of the |inputs|.  Usually a
+            func: The function to apply to each of the |inputs|. Usually a
-          functools.partial for wrapping additional arguments.  It will be run
+                functools.partial for wrapping additional arguments. It will be
-          in a separate process, so it must be pickalable, so nested functions
+                run in a separate process, so it must be pickalable, so nested
-          won't work.  Methods on the subcommand Command class should work.
+                functions won't work. Methods on the subcommand Command class
-      inputs: The list of items to process.  Must be a list.
+                should work.
-      callback: The function to pass the results to for processing.  It will be
+            inputs: The list of items to process. Must be a list.
-          executed in the main thread and process the results of |func| as they
+            callback: The function to pass the results to for processing. It
-          become available.  Thus it may be a local nested function.  Its return
+                will be executed in the main thread and process the results of
-          value is passed back directly.  It takes three arguments:
+                |func| as they become available. Thus it may be a local nested
-          - The processing pool (or None with one job).
+                function. Its return value is passed back directly. It takes
-          - The |output| argument.
+                three arguments:
-          - An iterator for the results.
+                - The processing pool (or None with one job).
-      output: An output manager.  May be progress.Progess or color.Coloring.
+                - The |output| argument.
-      ordered: Whether the jobs should be processed in order.
+                - An iterator for the results.
+            output: An output manager. May be progress.Progess or
+                color.Coloring.
+            ordered: Whether the jobs should be processed in order.
 
-    Returns:
+        Returns:
-      The |callback| function's results are returned.
+            The |callback| function's results are returned.
-    """
+        """
-    try:
-      # NB: Multiprocessing is heavy, so don't spin it up for one job.
-      if len(inputs) == 1 or jobs == 1:
-        return callback(None, output, (func(x) for x in inputs))
-      else:
-        with multiprocessing.Pool(jobs) as pool:
-          submit = pool.imap if ordered else pool.imap_unordered
-          return callback(pool, output, submit(func, inputs, chunksize=WORKER_BATCH_SIZE))
-    finally:
-      if isinstance(output, progress.Progress):
-        output.end()
-
-  def _ResetPathToProjectMap(self, projects):
-    self._by_path = dict((p.worktree, p) for p in projects)
-
-  def _UpdatePathToProjectMap(self, project):
-    self._by_path[project.worktree] = project
-
-  def _GetProjectByPath(self, manifest, path):
-    project = None
-    if os.path.exists(path):
-      oldpath = None
-      while (path and
-             path != oldpath and
-             path != manifest.topdir):
         try:
-          project = self._by_path[path]
+            # NB: Multiprocessing is heavy, so don't spin it up for one job.
-          break
+            if len(inputs) == 1 or jobs == 1:
-        except KeyError:
+                return callback(None, output, (func(x) for x in inputs))
-          oldpath = path
+            else:
-          path = os.path.dirname(path)
+                with multiprocessing.Pool(jobs) as pool:
-      if not project and path == manifest.topdir:
+                    submit = pool.imap if ordered else pool.imap_unordered
-        try:
+                    return callback(
-          project = self._by_path[path]
+                        pool,
-        except KeyError:
+                        output,
-          pass
+                        submit(func, inputs, chunksize=WORKER_BATCH_SIZE),
-    else:
+                    )
-      try:
+        finally:
-        project = self._by_path[path]
+            if isinstance(output, progress.Progress):
-      except KeyError:
+                output.end()
-        pass
-    return project
 
-  def GetProjects(self, args, manifest=None, groups='', missing_ok=False,
+    def _ResetPathToProjectMap(self, projects):
-                  submodules_ok=False, all_manifests=False):
+        self._by_path = dict((p.worktree, p) for p in projects)
-    """A list of projects that match the arguments.
 
-    Args:
+    def _UpdatePathToProjectMap(self, project):
-      args: a list of (case-insensitive) strings, projects to search for.
+        self._by_path[project.worktree] = project
-      manifest: an XmlManifest, the manifest to use, or None for default.
-      groups: a string, the manifest groups in use.
-      missing_ok: a boolean, whether to allow missing projects.
-      submodules_ok: a boolean, whether to allow submodules.
-      all_manifests: a boolean, if True then all manifests and submanifests are
-                     used.  If False, then only the local (sub)manifest is used.
 
-    Returns:
+    def _GetProjectByPath(self, manifest, path):
-      A list of matching Project instances.
+        project = None
-    """
+        if os.path.exists(path):
-    if all_manifests:
+            oldpath = None
-      if not manifest:
+            while path and path != oldpath and path != manifest.topdir:
-        manifest = self.manifest.outer_client
+                try:
-      all_projects_list = manifest.all_projects
+                    project = self._by_path[path]
-    else:
+                    break
-      if not manifest:
+                except KeyError:
-        manifest = self.manifest
+                    oldpath = path
-      all_projects_list = manifest.projects
+                    path = os.path.dirname(path)
-    result = []
+            if not project and path == manifest.topdir:
+                try:
+                    project = self._by_path[path]
+                except KeyError:
+                    pass
+        else:
+            try:
+                project = self._by_path[path]
+            except KeyError:
+                pass
+        return project
 
-    if not groups:
+    def GetProjects(
-      groups = manifest.GetGroupsStr()
+        self,
-    groups = [x for x in re.split(r'[,\s]+', groups) if x]
+        args,
+        manifest=None,
+        groups="",
+        missing_ok=False,
+        submodules_ok=False,
+        all_manifests=False,
+    ):
+        """A list of projects that match the arguments.
 
-    if not args:
+        Args:
-      derived_projects = {}
+            args: a list of (case-insensitive) strings, projects to search for.
-      for project in all_projects_list:
+            manifest: an XmlManifest, the manifest to use, or None for default.
-        if submodules_ok or project.sync_s:
+            groups: a string, the manifest groups in use.
-          derived_projects.update((p.name, p)
+            missing_ok: a boolean, whether to allow missing projects.
-                                  for p in project.GetDerivedSubprojects())
+            submodules_ok: a boolean, whether to allow submodules.
-      all_projects_list.extend(derived_projects.values())
+            all_manifests: a boolean, if True then all manifests and
-      for project in all_projects_list:
+                submanifests are used. If False, then only the local
-        if (missing_ok or project.Exists) and project.MatchesGroups(groups):
+                (sub)manifest is used.
-          result.append(project)
-    else:
-      self._ResetPathToProjectMap(all_projects_list)
 
-      for arg in args:
+        Returns:
-        # We have to filter by manifest groups in case the requested project is
+            A list of matching Project instances.
-        # checked out multiple times or differently based on them.
+        """
-        projects = [project for project in manifest.GetProjectsWithName(
+        if all_manifests:
-                        arg, all_manifests=all_manifests)
+            if not manifest:
-                    if project.MatchesGroups(groups)]
+                manifest = self.manifest.outer_client
+            all_projects_list = manifest.all_projects
+        else:
+            if not manifest:
+                manifest = self.manifest
+            all_projects_list = manifest.projects
+        result = []
 
-        if not projects:
+        if not groups:
-          path = os.path.abspath(arg).replace('\\', '/')
+            groups = manifest.GetGroupsStr()
-          tree = manifest
+        groups = [x for x in re.split(r"[,\s]+", groups) if x]
-          if all_manifests:
-            # Look for the deepest matching submanifest.
-            for tree in reversed(list(manifest.all_manifests)):
-              if path.startswith(tree.topdir):
-                break
-          project = self._GetProjectByPath(tree, path)
 
-          # If it's not a derived project, update path->project mapping and
+        if not args:
-          # search again, as arg might actually point to a derived subproject.
+            derived_projects = {}
-          if (project and not project.Derived and (submodules_ok or
+            for project in all_projects_list:
-                                                   project.sync_s)):
+                if submodules_ok or project.sync_s:
-            search_again = False
+                    derived_projects.update(
-            for subproject in project.GetDerivedSubprojects():
+                        (p.name, p) for p in project.GetDerivedSubprojects()
-              self._UpdatePathToProjectMap(subproject)
+                    )
-              search_again = True
+            all_projects_list.extend(derived_projects.values())
-            if search_again:
+            for project in all_projects_list:
-              project = self._GetProjectByPath(manifest, path) or project
+                if (missing_ok or project.Exists) and project.MatchesGroups(
+                    groups
+                ):
+                    result.append(project)
+        else:
+            self._ResetPathToProjectMap(all_projects_list)
 
-          if project:
+            for arg in args:
-            projects = [project]
+                # We have to filter by manifest groups in case the requested
+                # project is checked out multiple times or differently based on
+                # them.
+                projects = [
+                    project
+                    for project in manifest.GetProjectsWithName(
+                        arg, all_manifests=all_manifests
+                    )
+                    if project.MatchesGroups(groups)
+                ]
 
-        if not projects:
+                if not projects:
-          raise NoSuchProjectError(arg)
+                    path = os.path.abspath(arg).replace("\\", "/")
+                    tree = manifest
+                    if all_manifests:
+                        # Look for the deepest matching submanifest.
+                        for tree in reversed(list(manifest.all_manifests)):
+                            if path.startswith(tree.topdir):
+                                break
+                    project = self._GetProjectByPath(tree, path)
 
-        for project in projects:
+                    # If it's not a derived project, update path->project
-          if not missing_ok and not project.Exists:
+                    # mapping and search again, as arg might actually point to
-            raise NoSuchProjectError('%s (%s)' % (
+                    # a derived subproject.
-                arg, project.RelPath(local=not all_manifests)))
+                    if (
-          if not project.MatchesGroups(groups):
+                        project
-            raise InvalidProjectGroupsError(arg)
+                        and not project.Derived
+                        and (submodules_ok or project.sync_s)
+                    ):
+                        search_again = False
+                        for subproject in project.GetDerivedSubprojects():
+                            self._UpdatePathToProjectMap(subproject)
+                            search_again = True
+                        if search_again:
+                            project = (
+                                self._GetProjectByPath(manifest, path)
+                                or project
+                            )
 
-        result.extend(projects)
+                    if project:
+                        projects = [project]
 
-    def _getpath(x):
+                if not projects:
-      return x.relpath
+                    raise NoSuchProjectError(arg)
-    result.sort(key=_getpath)
-    return result
 
-  def FindProjects(self, args, inverse=False, all_manifests=False):
+                for project in projects:
-    """Find projects from command line arguments.
+                    if not missing_ok and not project.Exists:
+                        raise NoSuchProjectError(
+                            "%s (%s)"
+                            % (arg, project.RelPath(local=not all_manifests))
+                        )
+                    if not project.MatchesGroups(groups):
+                        raise InvalidProjectGroupsError(arg)
 
-    Args:
+                result.extend(projects)
-      args: a list of (case-insensitive) strings, projects to search for.
-      inverse: a boolean, if True, then projects not matching any |args| are
-               returned.
-      all_manifests: a boolean, if True then all manifests and submanifests are
-                     used.  If False, then only the local (sub)manifest is used.
-    """
-    result = []
-    patterns = [re.compile(r'%s' % a, re.IGNORECASE) for a in args]
-    for project in self.GetProjects('', all_manifests=all_manifests):
-      paths = [project.name, project.RelPath(local=not all_manifests)]
-      for pattern in patterns:
-        match = any(pattern.search(x) for x in paths)
-        if not inverse and match:
-          result.append(project)
-          break
-        if inverse and match:
-          break
-      else:
-        if inverse:
-          result.append(project)
-    result.sort(key=lambda project: (project.manifest.path_prefix,
-                                     project.relpath))
-    return result
 
-  def ManifestList(self, opt):
+        def _getpath(x):
-    """Yields all of the manifests to traverse.
+            return x.relpath
 
-    Args:
+        result.sort(key=_getpath)
-      opt: The command options.
+        return result
-    """
+
-    top = self.outer_manifest
+    def FindProjects(self, args, inverse=False, all_manifests=False):
-    if not opt.outer_manifest or opt.this_manifest_only:
+        """Find projects from command line arguments.
-      top = self.manifest
+
-    yield top
+        Args:
-    if not opt.this_manifest_only:
+            args: a list of (case-insensitive) strings, projects to search for.
-      for child in top.all_children:
+            inverse: a boolean, if True, then projects not matching any |args|
-        yield child
+                are returned.
+            all_manifests: a boolean, if True then all manifests and
+                submanifests are used. If False, then only the local
+                (sub)manifest is used.
+        """
+        result = []
+        patterns = [re.compile(r"%s" % a, re.IGNORECASE) for a in args]
+        for project in self.GetProjects("", all_manifests=all_manifests):
+            paths = [project.name, project.RelPath(local=not all_manifests)]
+            for pattern in patterns:
+                match = any(pattern.search(x) for x in paths)
+                if not inverse and match:
+                    result.append(project)
+                    break
+                if inverse and match:
+                    break
+            else:
+                if inverse:
+                    result.append(project)
+        result.sort(
+            key=lambda project: (project.manifest.path_prefix, project.relpath)
+        )
+        return result
+
+    def ManifestList(self, opt):
+        """Yields all of the manifests to traverse.
+
+        Args:
+            opt: The command options.
+        """
+        top = self.outer_manifest
+        if not opt.outer_manifest or opt.this_manifest_only:
+            top = self.manifest
+        yield top
+        if not opt.this_manifest_only:
+            for child in top.all_children:
+                yield child
 
 
 class InteractiveCommand(Command):
-  """Command which requires user interaction on the tty and
+    """Command which requires user interaction on the tty and must not run
-     must not run within a pager, even if the user asks to.
+    within a pager, even if the user asks to.
-  """
+    """
 
-  def WantPager(self, _opt):
+    def WantPager(self, _opt):
-    return False
+        return False
 
 
 class PagedCommand(Command):
-  """Command which defaults to output in a pager, as its
+    """Command which defaults to output in a pager, as its display tends to be
-     display tends to be larger than one screen full.
+    larger than one screen full.
-  """
+    """
 
-  def WantPager(self, _opt):
+    def WantPager(self, _opt):
-    return True
+        return True
 
 
 class MirrorSafeCommand(object):
-  """Command permits itself to run within a mirror,
+    """Command permits itself to run within a mirror, and does not require a
-     and does not require a working directory.
+    working directory.
-  """
+    """
-
-
-class GitcAvailableCommand(object):
-  """Command that requires GITC to be available, but does
-     not require the local client to be a GITC client.
-  """
 
 
 class GitcClientCommand(object):
-  """Command that requires the local client to be a GITC
+    """Command that requires the local client to be a GITC client."""
-     client.
-  """

docs/internal-fs-layout.md

@@ -42,8 +42,12 @@ For example, if you want to change the manifest branch, you can simply run
     change the git URL/branch that this tracks, re-run `repo init` with the new
     settings.
 
-*   `.repo_fetchtimes.json`: Used by `repo sync` to record stats when syncing
+*   `.repo_fetchtimes.json`: Used by `repo sync` to record fetch times when
-    the various projects.
+    syncing the various projects.
+
+*   `.repo_localsyncstate.json`: Used by `repo sync` to detect and warn on
+    on partial tree syncs.  Partial syncs are allowed by `repo` itself, but are
+    unsupported by many projects where `repo` is used.
 
 ### Manifests
 
@@ -222,27 +226,30 @@ The `[remote]` settings are automatically populated/updated from the manifest.
 
 The `[branch]` settings are updated by `repo start` and `git branch`.
 
-| Setting                       | Subcommands   | Use/Meaning |
+| Setting                               | Subcommands   | Use/Meaning |
-|-------------------------------|---------------|-------------|
+|---------------------------------------|---------------|-------------|
-| review.\<url\>.autocopy       | upload        | Automatically add to `--cc=<value>` |
+| review.\<url\>.autocopy               | upload        | Automatically add to `--cc=<value>` |
-| review.\<url\>.autoreviewer   | upload        | Automatically add to `--reviewers=<value>` |
+| review.\<url\>.autoreviewer           | upload        | Automatically add to `--reviewers=<value>` |
-| review.\<url\>.autoupload     | upload        | Automatically answer "yes" or "no" to all prompts |
+| review.\<url\>.autoupload             | upload        | Automatically answer "yes" or "no" to all prompts |
-| review.\<url\>.uploadhashtags | upload        | Automatically add to `--hashtag=<value>` |
+| review.\<url\>.uploadhashtags         | upload        | Automatically add to `--hashtag=<value>` |
-| review.\<url\>.uploadlabels   | upload        | Automatically add to `--label=<value>` |
+| review.\<url\>.uploadlabels           | upload        | Automatically add to `--label=<value>` |
-| review.\<url\>.uploadnotify   | upload        | [Notify setting][upload-notify] to use |
+| review.\<url\>.uploadnotify           | upload        | [Notify setting][upload-notify] to use |
-| review.\<url\>.uploadtopic    | upload        | Default [topic] to use |
+| review.\<url\>.uploadtopic            | upload        | Default [topic] to use |
-| review.\<url\>.username       | upload        | Override username with `ssh://` review URIs |
+| review.\<url\>.uploadwarningthreshold | upload        | Warn when attempting to upload more than this many CLs |
-| remote.\<remote\>.fetch       | sync          | Set of refs to fetch |
+| review.\<url\>.username               | upload        | Override username with `ssh://` review URIs |
-| remote.\<remote\>.projectname | \<network\>   | The name of the project as it exists in Gerrit review |
+| remote.\<remote\>.fetch               | sync          | Set of refs to fetch |
-| remote.\<remote\>.pushurl     | upload        | The base URI for pushing CLs |
+| remote.\<remote\>.projectname         | \<network\>   | The name of the project as it exists in Gerrit review |
-| remote.\<remote\>.review      | upload        | The URI of the Gerrit review server |
+| remote.\<remote\>.pushurl             | upload        | The base URI for pushing CLs |
-| remote.\<remote\>.url         | sync & upload | The URI of the git project to fetch |
+| remote.\<remote\>.review              | upload        | The URI of the Gerrit review server |
-| branch.\<branch\>.merge       | sync & upload | The branch to merge & upload & track |
+| remote.\<remote\>.url                 | sync & upload | The URI of the git project to fetch |
-| branch.\<branch\>.remote      | sync & upload | The remote to track |
+| branch.\<branch\>.merge               | sync & upload | The branch to merge & upload & track |
+| branch.\<branch\>.remote              | sync & upload | The remote to track |
 
 ## ~/ dotconfig layout
 
-Repo will create & maintain a few files in the user's home directory.
+Repo will create & maintain a few files under the `.repoconfig/` directory.
+This is placed in the user's home directory by default but can be changed by
+setting `REPO_CONFIG_DIR`.
 
 *   `.repoconfig/`: Repo's per-user directory for all random config files/state.
 *   `.repoconfig/config`: Per-user settings using [git-config] file format.

docs/manifest-format.md

@@ -109,8 +109,9 @@ following DTD:
   <!ATTLIST extend-project upstream CDATA #IMPLIED>
 
   <!ELEMENT remove-project EMPTY>
-  <!ATTLIST remove-project name  CDATA #REQUIRED>
+  <!ATTLIST remove-project name     CDATA #IMPLIED>
-  <!ATTLIST remove-project optional  CDATA #IMPLIED>
+  <!ATTLIST remove-project path     CDATA #IMPLIED>
+  <!ATTLIST remove-project optional CDATA #IMPLIED>
 
   <!ELEMENT repo-hooks EMPTY>
   <!ATTLIST repo-hooks in-project CDATA #REQUIRED>
@@ -125,8 +126,9 @@ following DTD:
   <!ATTLIST contactinfo bugurl  CDATA #REQUIRED>
 
   <!ELEMENT include EMPTY>
-  <!ATTLIST include name   CDATA #REQUIRED>
+  <!ATTLIST include name     CDATA #REQUIRED>
-  <!ATTLIST include groups CDATA #IMPLIED>
+  <!ATTLIST include groups   CDATA #IMPLIED>
+  <!ATTLIST include revision CDATA #IMPLIED>
 ]>
 ```
 
@@ -472,7 +474,7 @@ of the repo client.
 
 ### Element remove-project
 
-Deletes the named project from the internal manifest table, possibly
+Deletes a project from the internal manifest table, possibly
 allowing a subsequent project element in the same manifest file to
 replace the project with a different source.
 
@@ -480,6 +482,17 @@ This element is mostly useful in a local manifest file, where
 the user can remove a project, and possibly replace it with their
 own definition.
 
+The project `name` or project `path` can be used to specify the remove target
+meaning one of them is required. If only name is specified, all
+projects with that name are removed.
+
+If both name and path are specified, only projects with the same name and
+path are removed, meaning projects with the same name but in other
+locations are kept.
+
+If only path is specified, a matching project is removed regardless of its
+name. Logic otherwise behaves like both are specified.
+
 Attribute `optional`: Set to true to ignore remove-project elements with no
 matching `project` element.
 
@@ -553,6 +566,9 @@ in the included manifest belong. This appends and recurses, meaning
 all projects in included manifests carry all parent include groups.
 Same syntax as the corresponding element of `project`.
 
+Attribute `revision`: Name of a Git branch (e.g. `main` or `refs/heads/main`)
+default to which all projects in the included manifest belong.
+
 ## Local Manifests {#local-manifests}
 
 Additional remotes and projects may be added through local manifest

docs/release-process.md

@@ -143,23 +143,14 @@ internal processes for accessing the restricted keys.
 ***
 
 ```sh
-# Set the gpg key directory.
-$ export GNUPGHOME=~/.gnupg/repo/
-
-# Verify the listed key is “Repo Maintainer”.
-$ gpg -K
-
-# Pick whatever branch or commit you want to tag.
-$ r=main
-
 # Pick the new version.
-$ t=1.12.10
+$ t=v2.30
 
-# Create the signed tag.
+# Create a new signed tag with the current HEAD.
-$ git tag -s v$t -u "Repo Maintainer <repo@android.kernel.org>" -m "repo $t" $r
+$ ./release/sign-tag.py $t
 
 # Verify the signed tag.
-$ git show v$t
+$ git show $t
 ```
 
 ### Push the new release
@@ -168,11 +159,11 @@ Once you're ready to make the release available to everyone, push it to the
 `stable` branch.
 
 Make sure you never push the tag itself to the stable branch!
-Only push the commit -- notice the use of `$t` and `$r` below.
+Only push the commit -- note the use of `^0` below.
 
 ```sh
-$ git push https://gerrit-review.googlesource.com/git-repo v$t
+$ git push https://gerrit-review.googlesource.com/git-repo $t
-$ git push https://gerrit-review.googlesource.com/git-repo $r:stable
+$ git push https://gerrit-review.googlesource.com/git-repo $t^0:stable
 ```
 
 If something goes horribly wrong, you can force push the previous version to the
@@ -195,7 +186,9 @@ You can create a short changelog using the command:
 ```sh
 # If you haven't pushed to the stable branch yet, you can use origin/stable.
 # If you have pushed, change origin/stable to the previous release tag.
-$ git log --format="%h (%aN) %s" --no-merges origin/stable..$r
+# This assumes "main" is the current tagged release.  If it's newer, change it
+# to the current release tag too.
+$ git log --format="%h (%aN) %s" --no-merges origin/stable..main
 ```
 
 ## Project References
@@ -291,7 +284,7 @@ Things in italics are things we used to care about but probably don't anymore.
 | Apr 2018 |              |              |                 | 7.7          | 18.10 Cosmic |
 | Apr 2018 | **Apr 2028** |              |                 |              | **18.04 Bionic**     | 2.17.0   | 2.7.15 3.6.5 | 7.6 |
 | Jun 2018 | *Mar 2021*   | 2.18.0       |
-| Jun 2018 | **Jun 2023** |              | 3.7.0           |              | 19.04 Disco - **20.04 Focal** / **Buster** |
+| Jun 2018 | **Jun 2023** |              | 3.7.0           |              | 19.04 Disco - **Buster** |
 | Aug 2018 |              |              |                 | 7.8          |
 | Sep 2018 | *Mar 2021*   | 2.19.0       |                 |              | 18.10 Cosmic |
 | Oct 2018 |              |              |                 | 7.9          | 19.04 Disco / **Buster** |

editor.py

@@ -14,8 +14,8 @@
 
 import os
 import re
-import sys
 import subprocess
+import sys
 import tempfile
 
 from error import EditorError
@@ -23,93 +23,99 @@ import platform_utils
 
 
 class Editor(object):
-  """Manages the user's preferred text editor."""
+    """Manages the user's preferred text editor."""
 
-  _editor = None
+    _editor = None
-  globalConfig = None
+    globalConfig = None
 
-  @classmethod
+    @classmethod
-  def _GetEditor(cls):
+    def _GetEditor(cls):
-    if cls._editor is None:
+        if cls._editor is None:
-      cls._editor = cls._SelectEditor()
+            cls._editor = cls._SelectEditor()
-    return cls._editor
+        return cls._editor
 
-  @classmethod
+    @classmethod
-  def _SelectEditor(cls):
+    def _SelectEditor(cls):
-    e = os.getenv('GIT_EDITOR')
+        e = os.getenv("GIT_EDITOR")
-    if e:
+        if e:
-      return e
+            return e
 
-    if cls.globalConfig:
+        if cls.globalConfig:
-      e = cls.globalConfig.GetString('core.editor')
+            e = cls.globalConfig.GetString("core.editor")
-      if e:
+            if e:
-        return e
+                return e
 
-    e = os.getenv('VISUAL')
+        e = os.getenv("VISUAL")
-    if e:
+        if e:
-      return e
+            return e
 
-    e = os.getenv('EDITOR')
+        e = os.getenv("EDITOR")
-    if e:
+        if e:
-      return e
+            return e
 
-    if os.getenv('TERM') == 'dumb':
+        if os.getenv("TERM") == "dumb":
-      print(
+            print(
-          """No editor specified in GIT_EDITOR, core.editor, VISUAL or EDITOR.
+                """No editor specified in GIT_EDITOR, core.editor, VISUAL or EDITOR.
 Tried to fall back to vi but terminal is dumb.  Please configure at
-least one of these before using this command.""", file=sys.stderr)
+least one of these before using this command.""",  # noqa: E501
-      sys.exit(1)
+                file=sys.stderr,
+            )
+            sys.exit(1)
 
-    return 'vi'
+        return "vi"
 
-  @classmethod
+    @classmethod
-  def EditString(cls, data):
+    def EditString(cls, data):
-    """Opens an editor to edit the given content.
+        """Opens an editor to edit the given content.
 
-    Args:
+        Args:
-      data: The text to edit.
+            data: The text to edit.
 
-    Returns:
+        Returns:
-      New value of edited text.
+            New value of edited text.
 
-    Raises:
+        Raises:
-      EditorError: The editor failed to run.
+            EditorError: The editor failed to run.
-    """
+        """
-    editor = cls._GetEditor()
+        editor = cls._GetEditor()
-    if editor == ':':
+        if editor == ":":
-      return data
+            return data
 
-    fd, path = tempfile.mkstemp()
+        fd, path = tempfile.mkstemp()
-    try:
+        try:
-      os.write(fd, data.encode('utf-8'))
+            os.write(fd, data.encode("utf-8"))
-      os.close(fd)
+            os.close(fd)
-      fd = None
+            fd = None
 
-      if platform_utils.isWindows():
+            if platform_utils.isWindows():
-        # Split on spaces, respecting quoted strings
+                # Split on spaces, respecting quoted strings
-        import shlex
+                import shlex
-        args = shlex.split(editor)
-        shell = False
-      elif re.compile("^.*[$ \t'].*$").match(editor):
-        args = [editor + ' "$@"', 'sh']
-        shell = True
-      else:
-        args = [editor]
-        shell = False
-      args.append(path)
 
-      try:
+                args = shlex.split(editor)
-        rc = subprocess.Popen(args, shell=shell).wait()
+                shell = False
-      except OSError as e:
+            elif re.compile("^.*[$ \t'].*$").match(editor):
-        raise EditorError('editor failed, %s: %s %s'
+                args = [editor + ' "$@"', "sh"]
-                          % (str(e), editor, path))
+                shell = True
-      if rc != 0:
+            else:
-        raise EditorError('editor failed with exit status %d: %s %s'
+                args = [editor]
-                          % (rc, editor, path))
+                shell = False
+            args.append(path)
 
-      with open(path, mode='rb') as fd2:
+            try:
-        return fd2.read().decode('utf-8')
+                rc = subprocess.Popen(args, shell=shell).wait()
-    finally:
+            except OSError as e:
-      if fd:
+                raise EditorError(
-        os.close(fd)
+                    "editor failed, %s: %s %s" % (str(e), editor, path)
-      platform_utils.remove(path)
+                )
+            if rc != 0:
+                raise EditorError(
+                    "editor failed with exit status %d: %s %s"
+                    % (rc, editor, path)
+                )
+
+            with open(path, mode="rb") as fd2:
+                return fd2.read().decode("utf-8")
+        finally:
+            if fd:
+                os.close(fd)
+            platform_utils.remove(path)

error.py

@@ -12,124 +12,178 @@
 # See the License for the specific language governing permissions and
 # limitations under the License.
 
+from typing import List
 
-class ManifestParseError(Exception):
+
-  """Failed to parse the manifest file.
+class BaseRepoError(Exception):
-  """
+    """All repo specific exceptions derive from BaseRepoError."""
+
+
+class RepoError(BaseRepoError):
+    """Exceptions thrown inside repo that can be handled."""
+
+    def __init__(self, *args, project: str = None) -> None:
+        super().__init__(*args)
+        self.project = project
+
+
+class RepoExitError(BaseRepoError):
+    """Exception thrown that result in termination of repo program.
+    - Should only be handled in main.py
+    """
+
+    def __init__(
+        self,
+        *args,
+        exit_code: int = 1,
+        aggregate_errors: List[Exception] = None,
+        **kwargs,
+    ) -> None:
+        super().__init__(*args, **kwargs)
+        self.exit_code = exit_code
+        self.aggregate_errors = aggregate_errors
+
+
+class RepoUnhandledExceptionError(RepoExitError):
+    """Exception that maintains error as reason for program exit."""
+
+    def __init__(
+        self,
+        error: BaseException,
+        **kwargs,
+    ) -> None:
+        super().__init__(error, **kwargs)
+        self.error = error
+
+
+class SilentRepoExitError(RepoExitError):
+    """RepoExitError that should no include CLI logging of issue/issues."""
+
+
+class ManifestParseError(RepoExitError):
+    """Failed to parse the manifest file."""
 
 
 class ManifestInvalidRevisionError(ManifestParseError):
-  """The revision value in a project is incorrect.
+    """The revision value in a project is incorrect."""
-  """
 
 
 class ManifestInvalidPathError(ManifestParseError):
-  """A path used in <copyfile> or <linkfile> is incorrect.
+    """A path used in <copyfile> or <linkfile> is incorrect."""
-  """
 
 
-class NoManifestException(Exception):
+class NoManifestException(RepoExitError):
-  """The required manifest does not exist.
+    """The required manifest does not exist."""
-  """
 
-  def __init__(self, path, reason):
+    def __init__(self, path, reason, **kwargs):
-    super().__init__(path, reason)
+        super().__init__(path, reason, **kwargs)
-    self.path = path
+        self.path = path
-    self.reason = reason
+        self.reason = reason
 
-  def __str__(self):
+    def __str__(self):
-    return self.reason
+        return self.reason
 
 
-class EditorError(Exception):
+class EditorError(RepoError):
-  """Unspecified error from the user's text editor.
+    """Unspecified error from the user's text editor."""
-  """
 
-  def __init__(self, reason):
+    def __init__(self, reason, **kwargs):
-    super().__init__(reason)
+        super().__init__(reason, **kwargs)
-    self.reason = reason
+        self.reason = reason
 
-  def __str__(self):
+    def __str__(self):
-    return self.reason
+        return self.reason
 
 
-class GitError(Exception):
+class GitError(RepoError):
-  """Unspecified internal error from git.
+    """Unspecified git related error."""
-  """
 
-  def __init__(self, command):
+    def __init__(self, message, command_args=None, **kwargs):
-    super().__init__(command)
+        super().__init__(message, **kwargs)
-    self.command = command
+        self.message = message
+        self.command_args = command_args
 
-  def __str__(self):
+    def __str__(self):
-    return self.command
+        return self.message
 
 
-class UploadError(Exception):
+class GitcUnsupportedError(RepoExitError):
-  """A bundle upload to Gerrit did not succeed.
+    """Gitc no longer supported."""
-  """
-
-  def __init__(self, reason):
-    super().__init__(reason)
-    self.reason = reason
-
-  def __str__(self):
-    return self.reason
 
 
-class DownloadError(Exception):
+class UploadError(RepoError):
-  """Cannot download a repository.
+    """A bundle upload to Gerrit did not succeed."""
-  """
 
-  def __init__(self, reason):
+    def __init__(self, reason, **kwargs):
-    super().__init__(reason)
+        super().__init__(reason, **kwargs)
-    self.reason = reason
+        self.reason = reason
 
-  def __str__(self):
+    def __str__(self):
-    return self.reason
+        return self.reason
 
 
-class NoSuchProjectError(Exception):
+class DownloadError(RepoExitError):
-  """A specified project does not exist in the work tree.
+    """Cannot download a repository."""
-  """
 
-  def __init__(self, name=None):
+    def __init__(self, reason, **kwargs):
-    super().__init__(name)
+        super().__init__(reason, **kwargs)
-    self.name = name
+        self.reason = reason
 
-  def __str__(self):
+    def __str__(self):
-    if self.name is None:
+        return self.reason
-      return 'in current directory'
-    return self.name
 
 
-class InvalidProjectGroupsError(Exception):
+class InvalidArgumentsError(RepoExitError):
-  """A specified project is not suitable for the specified groups
+    """Invalid command Arguments."""
-  """
-
-  def __init__(self, name=None):
-    super().__init__(name)
-    self.name = name
-
-  def __str__(self):
-    if self.name is None:
-      return 'in current directory'
-    return self.name
 
 
-class RepoChangedException(Exception):
+class SyncError(RepoExitError):
-  """Thrown if 'repo sync' results in repo updating its internal
+    """Cannot sync repo."""
-     repo or manifest repositories.  In this special case we must
-     use exec to re-execute repo with the new code and manifest.
-  """
-
-  def __init__(self, extra_args=None):
-    super().__init__(extra_args)
-    self.extra_args = extra_args or []
 
 
-class HookError(Exception):
+class UpdateManifestError(RepoExitError):
-  """Thrown if a 'repo-hook' could not be run.
+    """Cannot update manifest."""
 
-  The common case is that the file wasn't present when we tried to run it.
+
-  """
+class NoSuchProjectError(RepoExitError):
+    """A specified project does not exist in the work tree."""
+
+    def __init__(self, name=None, **kwargs):
+        super().__init__(**kwargs)
+        self.name = name
+
+    def __str__(self):
+        if self.name is None:
+            return "in current directory"
+        return self.name
+
+
+class InvalidProjectGroupsError(RepoExitError):
+    """A specified project is not suitable for the specified groups"""
+
+    def __init__(self, name=None, **kwargs):
+        super().__init__(**kwargs)
+        self.name = name
+
+    def __str__(self):
+        if self.name is None:
+            return "in current directory"
+        return self.name
+
+
+class RepoChangedException(BaseRepoError):
+    """Thrown if 'repo sync' results in repo updating its internal
+    repo or manifest repositories.  In this special case we must
+    use exec to re-execute repo with the new code and manifest.
+    """
+
+    def __init__(self, extra_args=None):
+        super().__init__(extra_args)
+        self.extra_args = extra_args or []
+
+
+class HookError(RepoError):
+    """Thrown if a 'repo-hook' could not be run.
+
+    The common case is that the file wasn't present when we tried to run it.
+    """

event_log.py

@@ -15,161 +15,170 @@
 import json
 import multiprocessing
 
-TASK_COMMAND = 'command'
+
-TASK_SYNC_NETWORK = 'sync-network'
+TASK_COMMAND = "command"
-TASK_SYNC_LOCAL = 'sync-local'
+TASK_SYNC_NETWORK = "sync-network"
+TASK_SYNC_LOCAL = "sync-local"
 
 
 class EventLog(object):
-  """Event log that records events that occurred during a repo invocation.
+    """Event log that records events that occurred during a repo invocation.
 
-  Events are written to the log as a consecutive JSON entries, one per line.
+    Events are written to the log as a consecutive JSON entries, one per line.
-  Each entry contains the following keys:
+    Each entry contains the following keys:
-  - id: A ('RepoOp', ID) tuple, suitable for storing in a datastore.
+    - id: A ('RepoOp', ID) tuple, suitable for storing in a datastore.
-        The ID is only unique for the invocation of the repo command.
+          The ID is only unique for the invocation of the repo command.
-  - name: Name of the object being operated upon.
+    - name: Name of the object being operated upon.
-  - task_name: The task that was performed.
+    - task_name: The task that was performed.
-  - start: Timestamp of when the operation started.
+    - start: Timestamp of when the operation started.
-  - finish: Timestamp of when the operation finished.
+    - finish: Timestamp of when the operation finished.
-  - success: Boolean indicating if the operation was successful.
+    - success: Boolean indicating if the operation was successful.
-  - try_count: A counter indicating the try count of this task.
+    - try_count: A counter indicating the try count of this task.
 
-  Optionally:
+    Optionally:
-  - parent: A ('RepoOp', ID) tuple indicating the parent event for nested
+    - parent: A ('RepoOp', ID) tuple indicating the parent event for nested
-            events.
+        events.
 
-  Valid task_names include:
+    Valid task_names include:
-  - command: The invocation of a subcommand.
+    - command: The invocation of a subcommand.
-  - sync-network: The network component of a sync command.
+    - sync-network: The network component of a sync command.
-  - sync-local: The local component of a sync command.
+    - sync-local: The local component of a sync command.
 
-  Specific tasks may include additional informational properties.
+    Specific tasks may include additional informational properties.
-  """
-
-  def __init__(self):
-    """Initializes the event log."""
-    self._log = []
-    self._parent = None
-
-  def Add(self, name, task_name, start, finish=None, success=None,
-          try_count=1, kind='RepoOp'):
-    """Add an event to the log.
-
-    Args:
-      name: Name of the object being operated upon.
-      task_name: A sub-task that was performed for name.
-      start: Timestamp of when the operation started.
-      finish: Timestamp of when the operation finished.
-      success: Boolean indicating if the operation was successful.
-      try_count: A counter indicating the try count of this task.
-      kind: The kind of the object for the unique identifier.
-
-    Returns:
-      A dictionary of the event added to the log.
     """
-    event = {
-        'id': (kind, _NextEventId()),
-        'name': name,
-        'task_name': task_name,
-        'start_time': start,
-        'try': try_count,
-    }
 
-    if self._parent:
+    def __init__(self):
-      event['parent'] = self._parent['id']
+        """Initializes the event log."""
+        self._log = []
+        self._parent = None
 
-    if success is not None or finish is not None:
+    def Add(
-        self.FinishEvent(event, finish, success)
+        self,
+        name,
+        task_name,
+        start,
+        finish=None,
+        success=None,
+        try_count=1,
+        kind="RepoOp",
+    ):
+        """Add an event to the log.
 
-    self._log.append(event)
+        Args:
-    return event
+            name: Name of the object being operated upon.
+            task_name: A sub-task that was performed for name.
+            start: Timestamp of when the operation started.
+            finish: Timestamp of when the operation finished.
+            success: Boolean indicating if the operation was successful.
+            try_count: A counter indicating the try count of this task.
+            kind: The kind of the object for the unique identifier.
 
-  def AddSync(self, project, task_name, start, finish, success):
+        Returns:
-    """Add a event to the log for a sync command.
+            A dictionary of the event added to the log.
+        """
+        event = {
+            "id": (kind, _NextEventId()),
+            "name": name,
+            "task_name": task_name,
+            "start_time": start,
+            "try": try_count,
+        }
 
-    Args:
+        if self._parent:
-      project: Project being synced.
+            event["parent"] = self._parent["id"]
-      task_name: A sub-task that was performed for name.
-                 One of (TASK_SYNC_NETWORK, TASK_SYNC_LOCAL)
-      start: Timestamp of when the operation started.
-      finish: Timestamp of when the operation finished.
-      success: Boolean indicating if the operation was successful.
 
-    Returns:
+        if success is not None or finish is not None:
-      A dictionary of the event added to the log.
+            self.FinishEvent(event, finish, success)
-    """
-    event = self.Add(project.relpath, task_name, start, finish, success)
-    if event is not None:
-      event['project'] = project.name
-      if project.revisionExpr:
-        event['revision'] = project.revisionExpr
-      if project.remote.url:
-        event['project_url'] = project.remote.url
-      if project.remote.fetchUrl:
-        event['remote_url'] = project.remote.fetchUrl
-      try:
-        event['git_hash'] = project.GetCommitRevisionId()
-      except Exception:
-        pass
-    return event
 
-  def GetStatusString(self, success):
+        self._log.append(event)
-    """Converst a boolean success to a status string.
+        return event
 
-    Args:
+    def AddSync(self, project, task_name, start, finish, success):
-      success: Boolean indicating if the operation was successful.
+        """Add a event to the log for a sync command.
 
-    Returns:
+        Args:
-      status string.
+            project: Project being synced.
-    """
+            task_name: A sub-task that was performed for name.
-    return 'pass' if success else 'fail'
+                One of (TASK_SYNC_NETWORK, TASK_SYNC_LOCAL)
+            start: Timestamp of when the operation started.
+            finish: Timestamp of when the operation finished.
+            success: Boolean indicating if the operation was successful.
 
-  def FinishEvent(self, event, finish, success):
+        Returns:
-    """Finishes an incomplete event.
+            A dictionary of the event added to the log.
+        """
+        event = self.Add(project.relpath, task_name, start, finish, success)
+        if event is not None:
+            event["project"] = project.name
+            if project.revisionExpr:
+                event["revision"] = project.revisionExpr
+            if project.remote.url:
+                event["project_url"] = project.remote.url
+            if project.remote.fetchUrl:
+                event["remote_url"] = project.remote.fetchUrl
+            try:
+                event["git_hash"] = project.GetCommitRevisionId()
+            except Exception:
+                pass
+        return event
 
-    Args:
+    def GetStatusString(self, success):
-      event: An event that has been added to the log.
+        """Converst a boolean success to a status string.
-      finish: Timestamp of when the operation finished.
-      success: Boolean indicating if the operation was successful.
 
-    Returns:
+        Args:
-      A dictionary of the event added to the log.
+            success: Boolean indicating if the operation was successful.
-    """
-    event['status'] = self.GetStatusString(success)
-    event['finish_time'] = finish
-    return event
 
-  def SetParent(self, event):
+        Returns:
-    """Set a parent event for all new entities.
+            status string.
+        """
+        return "pass" if success else "fail"
 
-    Args:
+    def FinishEvent(self, event, finish, success):
-      event: The event to use as a parent.
+        """Finishes an incomplete event.
-    """
-    self._parent = event
 
-  def Write(self, filename):
+        Args:
-    """Writes the log out to a file.
+            event: An event that has been added to the log.
+            finish: Timestamp of when the operation finished.
+            success: Boolean indicating if the operation was successful.
 
-    Args:
+        Returns:
-      filename: The file to write the log to.
+            A dictionary of the event added to the log.
-    """
+        """
-    with open(filename, 'w+') as f:
+        event["status"] = self.GetStatusString(success)
-      for e in self._log:
+        event["finish_time"] = finish
-        json.dump(e, f, sort_keys=True)
+        return event
-        f.write('\n')
+
+    def SetParent(self, event):
+        """Set a parent event for all new entities.
+
+        Args:
+            event: The event to use as a parent.
+        """
+        self._parent = event
+
+    def Write(self, filename):
+        """Writes the log out to a file.
+
+        Args:
+            filename: The file to write the log to.
+        """
+        with open(filename, "w+") as f:
+            for e in self._log:
+                json.dump(e, f, sort_keys=True)
+                f.write("\n")
 
 
 # An integer id that is unique across this invocation of the program.
-_EVENT_ID = multiprocessing.Value('i', 1)
+_EVENT_ID = multiprocessing.Value("i", 1)
 
 
 def _NextEventId():
-  """Helper function for grabbing the next unique id.
+    """Helper function for grabbing the next unique id.
 
-  Returns:
+    Returns:
-    A unique, to this invocation of the program, integer id.
+        A unique, to this invocation of the program, integer id.
-  """
+    """
-  with _EVENT_ID.get_lock():
+    with _EVENT_ID.get_lock():
-    val = _EVENT_ID.value
+        val = _EVENT_ID.value
-    _EVENT_ID.value += 1
+        _EVENT_ID.value += 1
-  return val
+    return val

fetch.py

@@ -19,27 +19,39 @@ import sys
 from urllib.parse import urlparse
 from urllib.request import urlopen
 
+from error import RepoExitError
+
+
+class FetchFileError(RepoExitError):
+    """Exit error when fetch_file fails."""
+
 
 def fetch_file(url, verbose=False):
-  """Fetch a file from the specified source using the appropriate protocol.
+    """Fetch a file from the specified source using the appropriate protocol.
 
-  Returns:
+    Returns:
-    The contents of the file as bytes.
+        The contents of the file as bytes.
-  """
+    """
-  scheme = urlparse(url).scheme
+    scheme = urlparse(url).scheme
-  if scheme == 'gs':
+    if scheme == "gs":
-    cmd = ['gsutil', 'cat', url]
+        cmd = ["gsutil", "cat", url]
-    try:
+        errors = []
-      result = subprocess.run(
+        try:
-          cmd, stdout=subprocess.PIPE, stderr=subprocess.PIPE,
+            result = subprocess.run(
-          check=True)
+                cmd, stdout=subprocess.PIPE, stderr=subprocess.PIPE, check=True
-      if result.stderr and verbose:
+            )
-        print('warning: non-fatal error running "gsutil": %s' % result.stderr,
+            if result.stderr and verbose:
-              file=sys.stderr)
+                print(
-      return result.stdout
+                    'warning: non-fatal error running "gsutil": %s'
-    except subprocess.CalledProcessError as e:
+                    % result.stderr,
-      print('fatal: error running "gsutil": %s' % e.stderr,
+                    file=sys.stderr,
-            file=sys.stderr)
+                )
-    sys.exit(1)
+            return result.stdout
-  with urlopen(url) as f:
+        except subprocess.CalledProcessError as e:
-    return f.read()
+            errors.append(e)
+            print(
+                'fatal: error running "gsutil": %s' % e.stderr, file=sys.stderr
+            )
+        raise FetchFileError(aggregate_errors=errors)
+    with urlopen(url) as f:
+        return f.read()

git_command.py

@@ -13,17 +13,24 @@
 # limitations under the License.
 
 import functools
+import json
 import os
-import sys
 import subprocess
+import sys
+from typing import Any, Optional
 
 from error import GitError
+from error import RepoExitError
 from git_refs import HEAD
+from git_trace2_event_log_base import BaseEventLog
 import platform_utils
-from repo_trace import REPO_TRACE, IsTrace, Trace
+from repo_trace import IsTrace
+from repo_trace import REPO_TRACE
+from repo_trace import Trace
 from wrapper import Wrapper
 
-GIT = 'git'
+
+GIT = "git"
 # NB: These do not need to be kept in sync with the repo launcher script.
 # These may be much newer as it allows the repo launcher to roll between
 # different repo releases while source versions might require a newer git.
@@ -35,276 +42,510 @@ GIT = 'git'
 # git-1.7 is in (EOL) Ubuntu Precise.  git-1.9 is in Ubuntu Trusty.
 MIN_GIT_VERSION_SOFT = (1, 9, 1)
 MIN_GIT_VERSION_HARD = (1, 7, 2)
-GIT_DIR = 'GIT_DIR'
+GIT_DIR = "GIT_DIR"
 
 LAST_GITDIR = None
 LAST_CWD = None
+DEFAULT_GIT_FAIL_MESSAGE = "git command failure"
+ERROR_EVENT_LOGGING_PREFIX = "RepoGitCommandError"
+# Common line length limit
+GIT_ERROR_STDOUT_LINES = 1
+GIT_ERROR_STDERR_LINES = 1
+INVALID_GIT_EXIT_CODE = 126
 
 
 class _GitCall(object):
-  @functools.lru_cache(maxsize=None)
+    @functools.lru_cache(maxsize=None)
-  def version_tuple(self):
+    def version_tuple(self):
-    ret = Wrapper().ParseGitVersion()
+        ret = Wrapper().ParseGitVersion()
-    if ret is None:
+        if ret is None:
-      print('fatal: unable to detect git version', file=sys.stderr)
+            msg = "fatal: unable to detect git version"
-      sys.exit(1)
+            print(msg, file=sys.stderr)
-    return ret
+            raise GitRequireError(msg)
+        return ret
 
-  def __getattr__(self, name):
+    def __getattr__(self, name):
-    name = name.replace('_', '-')
+        name = name.replace("_", "-")
 
-    def fun(*cmdv):
+        def fun(*cmdv):
-      command = [name]
+            command = [name]
-      command.extend(cmdv)
+            command.extend(cmdv)
-      return GitCommand(None, command).Wait() == 0
+            return GitCommand(None, command, add_event_log=False).Wait() == 0
-    return fun
+
+        return fun
 
 
 git = _GitCall()
 
 
 def RepoSourceVersion():
-  """Return the version of the repo.git tree."""
+    """Return the version of the repo.git tree."""
-  ver = getattr(RepoSourceVersion, 'version', None)
+    ver = getattr(RepoSourceVersion, "version", None)
 
-  # We avoid GitCommand so we don't run into circular deps -- GitCommand needs
+    # We avoid GitCommand so we don't run into circular deps -- GitCommand needs
-  # to initialize version info we provide.
+    # to initialize version info we provide.
-  if ver is None:
+    if ver is None:
-    env = GitCommand._GetBasicEnv()
+        env = GitCommand._GetBasicEnv()
 
-    proj = os.path.dirname(os.path.abspath(__file__))
+        proj = os.path.dirname(os.path.abspath(__file__))
-    env[GIT_DIR] = os.path.join(proj, '.git')
+        env[GIT_DIR] = os.path.join(proj, ".git")
-    result = subprocess.run([GIT, 'describe', HEAD], stdout=subprocess.PIPE,
+        result = subprocess.run(
-                            stderr=subprocess.DEVNULL, encoding='utf-8',
+            [GIT, "describe", HEAD],
-                            env=env, check=False)
+            stdout=subprocess.PIPE,
-    if result.returncode == 0:
+            stderr=subprocess.DEVNULL,
-      ver = result.stdout.strip()
+            encoding="utf-8",
-      if ver.startswith('v'):
+            env=env,
-        ver = ver[1:]
+            check=False,
-    else:
+        )
-      ver = 'unknown'
+        if result.returncode == 0:
-    setattr(RepoSourceVersion, 'version', ver)
+            ver = result.stdout.strip()
+            if ver.startswith("v"):
+                ver = ver[1:]
+        else:
+            ver = "unknown"
+        setattr(RepoSourceVersion, "version", ver)
 
-  return ver
+    return ver
+
+
+@functools.lru_cache(maxsize=None)
+def GetEventTargetPath():
+    """Get the 'trace2.eventtarget' path from git configuration.
+
+    Returns:
+        path: git config's 'trace2.eventtarget' path if it exists, or None
+    """
+    path = None
+    cmd = ["config", "--get", "trace2.eventtarget"]
+    # TODO(https://crbug.com/gerrit/13706): Use GitConfig when it supports
+    # system git config variables.
+    p = GitCommand(
+        None,
+        cmd,
+        capture_stdout=True,
+        capture_stderr=True,
+        bare=True,
+        add_event_log=False,
+    )
+    retval = p.Wait()
+    if retval == 0:
+        # Strip trailing carriage-return in path.
+        path = p.stdout.rstrip("\n")
+    elif retval != 1:
+        # `git config --get` is documented to produce an exit status of `1`
+        # if the requested variable is not present in the configuration.
+        # Report any other return value as an error.
+        print(
+            "repo: error: 'git config --get' call failed with return code: "
+            "%r, stderr: %r" % (retval, p.stderr),
+            file=sys.stderr,
+        )
+    return path
 
 
 class UserAgent(object):
-  """Mange User-Agent settings when talking to external services
+    """Mange User-Agent settings when talking to external services
 
-  We follow the style as documented here:
+    We follow the style as documented here:
-  https://developer.mozilla.org/en-US/docs/Web/HTTP/Headers/User-Agent
+    https://developer.mozilla.org/en-US/docs/Web/HTTP/Headers/User-Agent
-  """
+    """
 
-  _os = None
+    _os = None
-  _repo_ua = None
+    _repo_ua = None
-  _git_ua = None
+    _git_ua = None
 
-  @property
+    @property
-  def os(self):
+    def os(self):
-    """The operating system name."""
+        """The operating system name."""
-    if self._os is None:
+        if self._os is None:
-      os_name = sys.platform
+            os_name = sys.platform
-      if os_name.lower().startswith('linux'):
+            if os_name.lower().startswith("linux"):
-        os_name = 'Linux'
+                os_name = "Linux"
-      elif os_name == 'win32':
+            elif os_name == "win32":
-        os_name = 'Win32'
+                os_name = "Win32"
-      elif os_name == 'cygwin':
+            elif os_name == "cygwin":
-        os_name = 'Cygwin'
+                os_name = "Cygwin"
-      elif os_name == 'darwin':
+            elif os_name == "darwin":
-        os_name = 'Darwin'
+                os_name = "Darwin"
-      self._os = os_name
+            self._os = os_name
 
-    return self._os
+        return self._os
 
-  @property
+    @property
-  def repo(self):
+    def repo(self):
-    """The UA when connecting directly from repo."""
+        """The UA when connecting directly from repo."""
-    if self._repo_ua is None:
+        if self._repo_ua is None:
-      py_version = sys.version_info
+            py_version = sys.version_info
-      self._repo_ua = 'git-repo/%s (%s) git/%s Python/%d.%d.%d' % (
+            self._repo_ua = "git-repo/%s (%s) git/%s Python/%d.%d.%d" % (
-          RepoSourceVersion(),
+                RepoSourceVersion(),
-          self.os,
+                self.os,
-          git.version_tuple().full,
+                git.version_tuple().full,
-          py_version.major, py_version.minor, py_version.micro)
+                py_version.major,
+                py_version.minor,
+                py_version.micro,
+            )
 
-    return self._repo_ua
+        return self._repo_ua
 
-  @property
+    @property
-  def git(self):
+    def git(self):
-    """The UA when running git."""
+        """The UA when running git."""
-    if self._git_ua is None:
+        if self._git_ua is None:
-      self._git_ua = 'git/%s (%s) git-repo/%s' % (
+            self._git_ua = "git/%s (%s) git-repo/%s" % (
-          git.version_tuple().full,
+                git.version_tuple().full,
-          self.os,
+                self.os,
-          RepoSourceVersion())
+                RepoSourceVersion(),
+            )
 
-    return self._git_ua
+        return self._git_ua
 
 
 user_agent = UserAgent()
 
 
-def git_require(min_version, fail=False, msg=''):
+def git_require(min_version, fail=False, msg=""):
-  git_version = git.version_tuple()
+    git_version = git.version_tuple()
-  if min_version <= git_version:
+    if min_version <= git_version:
-    return True
+        return True
-  if fail:
+    if fail:
-    need = '.'.join(map(str, min_version))
+        need = ".".join(map(str, min_version))
-    if msg:
+        if msg:
-      msg = ' for ' + msg
+            msg = " for " + msg
-    print('fatal: git %s or later required%s' % (need, msg), file=sys.stderr)
+        error_msg = "fatal: git %s or later required%s" % (need, msg)
-    sys.exit(1)
+        print(error_msg, file=sys.stderr)
-  return False
+        raise GitRequireError(error_msg)
+    return False
+
+
+def _build_env(
+    _kwargs_only=(),
+    bare: Optional[bool] = False,
+    disable_editor: Optional[bool] = False,
+    ssh_proxy: Optional[Any] = None,
+    gitdir: Optional[str] = None,
+    objdir: Optional[str] = None,
+):
+    """Constucts an env dict for command execution."""
+
+    assert _kwargs_only == (), "_build_env only accepts keyword arguments."
+
+    env = GitCommand._GetBasicEnv()
+
+    if disable_editor:
+        env["GIT_EDITOR"] = ":"
+    if ssh_proxy:
+        env["REPO_SSH_SOCK"] = ssh_proxy.sock()
+        env["GIT_SSH"] = ssh_proxy.proxy
+        env["GIT_SSH_VARIANT"] = "ssh"
+    if "http_proxy" in env and "darwin" == sys.platform:
+        s = "'http.proxy=%s'" % (env["http_proxy"],)
+        p = env.get("GIT_CONFIG_PARAMETERS")
+        if p is not None:
+            s = p + " " + s
+        env["GIT_CONFIG_PARAMETERS"] = s
+    if "GIT_ALLOW_PROTOCOL" not in env:
+        env[
+            "GIT_ALLOW_PROTOCOL"
+        ] = "file:git:http:https:ssh:persistent-http:persistent-https:sso:rpc"
+    env["GIT_HTTP_USER_AGENT"] = user_agent.git
+
+    if objdir:
+        # Set to the place we want to save the objects.
+        env["GIT_OBJECT_DIRECTORY"] = objdir
+
+        alt_objects = os.path.join(gitdir, "objects") if gitdir else None
+        if alt_objects and os.path.realpath(alt_objects) != os.path.realpath(
+            objdir
+        ):
+            # Allow git to search the original place in case of local or unique
+            # refs that git will attempt to resolve even if we aren't fetching
+            # them.
+            env["GIT_ALTERNATE_OBJECT_DIRECTORIES"] = alt_objects
+    if bare and gitdir is not None:
+        env[GIT_DIR] = gitdir
+
+    return env
 
 
 class GitCommand(object):
-  """Wrapper around a single git invocation."""
+    """Wrapper around a single git invocation."""
 
-  def __init__(self,
+    def __init__(
-               project,
+        self,
-               cmdv,
+        project,
-               bare=False,
+        cmdv,
-               input=None,
+        bare=False,
-               capture_stdout=False,
+        input=None,
-               capture_stderr=False,
+        capture_stdout=False,
-               merge_output=False,
+        capture_stderr=False,
-               disable_editor=False,
+        merge_output=False,
-               ssh_proxy=None,
+        disable_editor=False,
-               cwd=None,
+        ssh_proxy=None,
-               gitdir=None,
+        cwd=None,
-               objdir=None):
+        gitdir=None,
-    env = self._GetBasicEnv()
+        objdir=None,
+        verify_command=False,
+        add_event_log=True,
+        log_as_error=True,
+    ):
+        if project:
+            if not cwd:
+                cwd = project.worktree
+            if not gitdir:
+                gitdir = project.gitdir
 
-    if disable_editor:
+        self.project = project
-      env['GIT_EDITOR'] = ':'
+        self.cmdv = cmdv
-    if ssh_proxy:
+        self.verify_command = verify_command
-      env['REPO_SSH_SOCK'] = ssh_proxy.sock()
-      env['GIT_SSH'] = ssh_proxy.proxy
-      env['GIT_SSH_VARIANT'] = 'ssh'
-    if 'http_proxy' in env and 'darwin' == sys.platform:
-      s = "'http.proxy=%s'" % (env['http_proxy'],)
-      p = env.get('GIT_CONFIG_PARAMETERS')
-      if p is not None:
-        s = p + ' ' + s
-      env['GIT_CONFIG_PARAMETERS'] = s
-    if 'GIT_ALLOW_PROTOCOL' not in env:
-      env['GIT_ALLOW_PROTOCOL'] = (
-          'file:git:http:https:ssh:persistent-http:persistent-https:sso:rpc')
-    env['GIT_HTTP_USER_AGENT'] = user_agent.git
 
-    if project:
+        # Git on Windows wants its paths only using / for reliability.
-      if not cwd:
+        if platform_utils.isWindows():
-        cwd = project.worktree
+            if objdir:
-      if not gitdir:
+                objdir = objdir.replace("\\", "/")
-        gitdir = project.gitdir
+            if gitdir:
-    # Git on Windows wants its paths only using / for reliability.
+                gitdir = gitdir.replace("\\", "/")
-    if platform_utils.isWindows():
-      if objdir:
-        objdir = objdir.replace('\\', '/')
-      if gitdir:
-        gitdir = gitdir.replace('\\', '/')
 
-    if objdir:
+        env = _build_env(
-      # Set to the place we want to save the objects.
+            disable_editor=disable_editor,
-      env['GIT_OBJECT_DIRECTORY'] = objdir
+            ssh_proxy=ssh_proxy,
-      if gitdir:
+            objdir=objdir,
-        # Allow git to search the original place in case of local or unique refs
+            gitdir=gitdir,
-        # that git will attempt to resolve even if we aren't fetching them.
+            bare=bare,
-        env['GIT_ALTERNATE_OBJECT_DIRECTORIES'] = gitdir + '/objects'
+        )
 
-    command = [GIT]
+        command = [GIT]
-    if bare:
+        if bare:
-      if gitdir:
+            cwd = None
-        env[GIT_DIR] = gitdir
+        command_name = cmdv[0]
-      cwd = None
+        command.append(command_name)
-    command.append(cmdv[0])
+        # Need to use the --progress flag for fetch/clone so output will be
-    # Need to use the --progress flag for fetch/clone so output will be
+        # displayed as by default git only does progress output if stderr is a
-    # displayed as by default git only does progress output if stderr is a TTY.
+        # TTY.
-    if sys.stderr.isatty() and cmdv[0] in ('fetch', 'clone'):
+        if sys.stderr.isatty() and command_name in ("fetch", "clone"):
-      if '--progress' not in cmdv and '--quiet' not in cmdv:
+            if "--progress" not in cmdv and "--quiet" not in cmdv:
-        command.append('--progress')
+                command.append("--progress")
-    command.extend(cmdv[1:])
+        command.extend(cmdv[1:])
 
-    stdin = subprocess.PIPE if input else None
+        stdin = subprocess.PIPE if input else None
-    stdout = subprocess.PIPE if capture_stdout else None
+        stdout = subprocess.PIPE if capture_stdout else None
-    stderr = (subprocess.STDOUT if merge_output else
+        stderr = (
-              (subprocess.PIPE if capture_stderr else None))
+            subprocess.STDOUT
+            if merge_output
+            else (subprocess.PIPE if capture_stderr else None)
+        )
 
-    if IsTrace():
+        event_log = (
-      global LAST_CWD
+            BaseEventLog(env=env, add_init_count=True)
-      global LAST_GITDIR
+            if add_event_log
+            else None
+        )
 
-      dbg = ''
+        try:
+            self._RunCommand(
+                command,
+                env,
+                stdin=stdin,
+                stdout=stdout,
+                stderr=stderr,
+                ssh_proxy=ssh_proxy,
+                cwd=cwd,
+                input=input,
+            )
+            self.VerifyCommand()
+        except GitCommandError as e:
+            if event_log is not None:
+                error_info = json.dumps(
+                    {
+                        "ErrorType": type(e).__name__,
+                        "Project": e.project,
+                        "CommandName": command_name,
+                        "Message": str(e),
+                        "ReturnCode": str(e.git_rc)
+                        if e.git_rc is not None
+                        else None,
+                        "IsError": log_as_error,
+                    }
+                )
+                event_log.ErrorEvent(
+                    f"{ERROR_EVENT_LOGGING_PREFIX}:{error_info}"
+                )
+                event_log.Write(GetEventTargetPath())
+            if isinstance(e, GitPopenCommandError):
+                raise
 
-      if cwd and LAST_CWD != cwd:
+    def _RunCommand(
-        if LAST_GITDIR or LAST_CWD:
+        self,
-          dbg += '\n'
+        command,
-        dbg += ': cd %s\n' % cwd
+        env,
-        LAST_CWD = cwd
+        stdin=None,
+        stdout=None,
+        stderr=None,
+        ssh_proxy=None,
+        cwd=None,
+        input=None,
+    ):
+        dbg = ""
+        if IsTrace():
+            global LAST_CWD
+            global LAST_GITDIR
 
-      if GIT_DIR in env and LAST_GITDIR != env[GIT_DIR]:
+            if cwd and LAST_CWD != cwd:
-        if LAST_GITDIR or LAST_CWD:
+                if LAST_GITDIR or LAST_CWD:
-          dbg += '\n'
+                    dbg += "\n"
-        dbg += ': export GIT_DIR=%s\n' % env[GIT_DIR]
+                dbg += ": cd %s\n" % cwd
-        LAST_GITDIR = env[GIT_DIR]
+                LAST_CWD = cwd
 
-      if 'GIT_OBJECT_DIRECTORY' in env:
+            if GIT_DIR in env and LAST_GITDIR != env[GIT_DIR]:
-        dbg += ': export GIT_OBJECT_DIRECTORY=%s\n' % env['GIT_OBJECT_DIRECTORY']
+                if LAST_GITDIR or LAST_CWD:
-      if 'GIT_ALTERNATE_OBJECT_DIRECTORIES' in env:
+                    dbg += "\n"
-        dbg += ': export GIT_ALTERNATE_OBJECT_DIRECTORIES=%s\n' % env['GIT_ALTERNATE_OBJECT_DIRECTORIES']
+                dbg += ": export GIT_DIR=%s\n" % env[GIT_DIR]
+                LAST_GITDIR = env[GIT_DIR]
 
-      dbg += ': '
+            if "GIT_OBJECT_DIRECTORY" in env:
-      dbg += ' '.join(command)
+                dbg += (
-      if stdin == subprocess.PIPE:
+                    ": export GIT_OBJECT_DIRECTORY=%s\n"
-        dbg += ' 0<|'
+                    % env["GIT_OBJECT_DIRECTORY"]
-      if stdout == subprocess.PIPE:
+                )
-        dbg += ' 1>|'
+            if "GIT_ALTERNATE_OBJECT_DIRECTORIES" in env:
-      if stderr == subprocess.PIPE:
+                dbg += ": export GIT_ALTERNATE_OBJECT_DIRECTORIES=%s\n" % (
-        dbg += ' 2>|'
+                    env["GIT_ALTERNATE_OBJECT_DIRECTORIES"]
-      elif stderr == subprocess.STDOUT:
+                )
-        dbg += ' 2>&1'
-      Trace('%s', dbg)
 
-    try:
+            dbg += ": "
-      p = subprocess.Popen(command,
+            dbg += " ".join(command)
-                           cwd=cwd,
+            if stdin == subprocess.PIPE:
-                           env=env,
+                dbg += " 0<|"
-                           encoding='utf-8',
+            if stdout == subprocess.PIPE:
-                           errors='backslashreplace',
+                dbg += " 1>|"
-                           stdin=stdin,
+            if stderr == subprocess.PIPE:
-                           stdout=stdout,
+                dbg += " 2>|"
-                           stderr=stderr)
+            elif stderr == subprocess.STDOUT:
-    except Exception as e:
+                dbg += " 2>&1"
-      raise GitError('%s: %s' % (command[1], e))
 
-    if ssh_proxy:
+        with Trace(
-      ssh_proxy.add_client(p)
+            "git command %s %s with debug: %s", LAST_GITDIR, command, dbg
+        ):
+            try:
+                p = subprocess.Popen(
+                    command,
+                    cwd=cwd,
+                    env=env,
+                    encoding="utf-8",
+                    errors="backslashreplace",
+                    stdin=stdin,
+                    stdout=stdout,
+                    stderr=stderr,
+                )
+            except Exception as e:
+                raise GitPopenCommandError(
+                    message="%s: %s" % (command[1], e),
+                    project=self.project.name if self.project else None,
+                    command_args=self.cmdv,
+                )
 
-    self.process = p
+            if ssh_proxy:
+                ssh_proxy.add_client(p)
 
-    try:
+            self.process = p
-      self.stdout, self.stderr = p.communicate(input=input)
-    finally:
-      if ssh_proxy:
-        ssh_proxy.remove_client(p)
-    self.rc = p.wait()
 
-  @staticmethod
+            try:
-  def _GetBasicEnv():
+                self.stdout, self.stderr = p.communicate(input=input)
-    """Return a basic env for running git under.
+            finally:
+                if ssh_proxy:
+                    ssh_proxy.remove_client(p)
+            self.rc = p.wait()
 
-    This is guaranteed to be side-effect free.
+    @staticmethod
+    def _GetBasicEnv():
+        """Return a basic env for running git under.
+
+        This is guaranteed to be side-effect free.
+        """
+        env = os.environ.copy()
+        for key in (
+            REPO_TRACE,
+            GIT_DIR,
+            "GIT_ALTERNATE_OBJECT_DIRECTORIES",
+            "GIT_OBJECT_DIRECTORY",
+            "GIT_WORK_TREE",
+            "GIT_GRAFT_FILE",
+            "GIT_INDEX_FILE",
+        ):
+            env.pop(key, None)
+        return env
+
+    def VerifyCommand(self):
+        if self.rc == 0:
+            return None
+        stdout = (
+            "\n".join(self.stdout.split("\n")[:GIT_ERROR_STDOUT_LINES])
+            if self.stdout
+            else None
+        )
+        stderr = (
+            "\n".join(self.stderr.split("\n")[:GIT_ERROR_STDERR_LINES])
+            if self.stderr
+            else None
+        )
+        project = self.project.name if self.project else None
+        raise GitCommandError(
+            project=project,
+            command_args=self.cmdv,
+            git_rc=self.rc,
+            git_stdout=stdout,
+            git_stderr=stderr,
+        )
+
+    def Wait(self):
+        if self.verify_command:
+            self.VerifyCommand()
+        return self.rc
+
+
+class GitRequireError(RepoExitError):
+    """Error raised when git version is unavailable or invalid."""
+
+    def __init__(self, message, exit_code: int = INVALID_GIT_EXIT_CODE):
+        super().__init__(message, exit_code=exit_code)
+
+
+class GitCommandError(GitError):
+    """
+    Error raised from a failed git command.
+    Note that GitError can refer to any Git related error (e.g. branch not
+    specified for project.py 'UploadForReview'), while GitCommandError is
+    raised exclusively from non-zero exit codes returned from git commands.
     """
-    env = os.environ.copy()
-    for key in (REPO_TRACE,
-                GIT_DIR,
-                'GIT_ALTERNATE_OBJECT_DIRECTORIES',
-                'GIT_OBJECT_DIRECTORY',
-                'GIT_WORK_TREE',
-                'GIT_GRAFT_FILE',
-                'GIT_INDEX_FILE'):
-      env.pop(key, None)
-    return env
 
-  def Wait(self):
+    def __init__(
-    return self.rc
+        self,
+        message: str = DEFAULT_GIT_FAIL_MESSAGE,
+        git_rc: int = None,
+        git_stdout: str = None,
+        git_stderr: str = None,
+        **kwargs,
+    ):
+        super().__init__(
+            message,
+            **kwargs,
+        )
+        self.git_rc = git_rc
+        self.git_stdout = git_stdout
+        self.git_stderr = git_stderr
+
+    def __str__(self):
+        args = "[]" if not self.command_args else " ".join(self.command_args)
+        error_type = type(self).__name__
+        return f"""{error_type}: {self.message}
+    Project: {self.project}
+    Args: {args}
+    Stdout:
+{self.git_stdout}
+    Stderr:
+{self.git_stderr}"""
+
+
+class GitPopenCommandError(GitError):
+    """
+    Error raised when subprocess.Popen fails for a GitCommand
+    """

git_refs.py

@@ -13,153 +13,155 @@
 # limitations under the License.
 
 import os
-from repo_trace import Trace
-import platform_utils
 
-HEAD = 'HEAD'
+import platform_utils
-R_CHANGES = 'refs/changes/'
+from repo_trace import Trace
-R_HEADS = 'refs/heads/'
+
-R_TAGS = 'refs/tags/'
+
-R_PUB = 'refs/published/'
+HEAD = "HEAD"
-R_WORKTREE = 'refs/worktree/'
+R_CHANGES = "refs/changes/"
-R_WORKTREE_M = R_WORKTREE + 'm/'
+R_HEADS = "refs/heads/"
-R_M = 'refs/remotes/m/'
+R_TAGS = "refs/tags/"
+R_PUB = "refs/published/"
+R_WORKTREE = "refs/worktree/"
+R_WORKTREE_M = R_WORKTREE + "m/"
+R_M = "refs/remotes/m/"
 
 
 class GitRefs(object):
-  def __init__(self, gitdir):
+    def __init__(self, gitdir):
-    self._gitdir = gitdir
+        self._gitdir = gitdir
-    self._phyref = None
+        self._phyref = None
-    self._symref = None
+        self._symref = None
-    self._mtime = {}
+        self._mtime = {}
 
-  @property
+    @property
-  def all(self):
+    def all(self):
-    self._EnsureLoaded()
+        self._EnsureLoaded()
-    return self._phyref
+        return self._phyref
 
-  def get(self, name):
+    def get(self, name):
-    try:
+        try:
-      return self.all[name]
+            return self.all[name]
-    except KeyError:
+        except KeyError:
-      return ''
+            return ""
 
-  def deleted(self, name):
+    def deleted(self, name):
-    if self._phyref is not None:
+        if self._phyref is not None:
-      if name in self._phyref:
+            if name in self._phyref:
-        del self._phyref[name]
+                del self._phyref[name]
 
-      if name in self._symref:
+            if name in self._symref:
-        del self._symref[name]
+                del self._symref[name]
 
-      if name in self._mtime:
+            if name in self._mtime:
-        del self._mtime[name]
+                del self._mtime[name]
 
-  def symref(self, name):
+    def symref(self, name):
-    try:
+        try:
-      self._EnsureLoaded()
+            self._EnsureLoaded()
-      return self._symref[name]
+            return self._symref[name]
-    except KeyError:
+        except KeyError:
-      return ''
+            return ""
 
-  def _EnsureLoaded(self):
+    def _EnsureLoaded(self):
-    if self._phyref is None or self._NeedUpdate():
+        if self._phyref is None or self._NeedUpdate():
-      self._LoadAll()
+            self._LoadAll()
 
-  def _NeedUpdate(self):
+    def _NeedUpdate(self):
-    Trace(': scan refs %s', self._gitdir)
+        with Trace(": scan refs %s", self._gitdir):
+            for name, mtime in self._mtime.items():
+                try:
+                    if mtime != os.path.getmtime(
+                        os.path.join(self._gitdir, name)
+                    ):
+                        return True
+                except OSError:
+                    return True
+            return False
 
-    for name, mtime in self._mtime.items():
+    def _LoadAll(self):
-      try:
+        with Trace(": load refs %s", self._gitdir):
-        if mtime != os.path.getmtime(os.path.join(self._gitdir, name)):
+            self._phyref = {}
-          return True
+            self._symref = {}
-      except OSError:
+            self._mtime = {}
-        return True
-    return False
 
-  def _LoadAll(self):
+            self._ReadPackedRefs()
-    Trace(': load refs %s', self._gitdir)
+            self._ReadLoose("refs/")
+            self._ReadLoose1(os.path.join(self._gitdir, HEAD), HEAD)
 
-    self._phyref = {}
+            scan = self._symref
-    self._symref = {}
+            attempts = 0
-    self._mtime = {}
+            while scan and attempts < 5:
+                scan_next = {}
+                for name, dest in scan.items():
+                    if dest in self._phyref:
+                        self._phyref[name] = self._phyref[dest]
+                    else:
+                        scan_next[name] = dest
+                scan = scan_next
+                attempts += 1
 
-    self._ReadPackedRefs()
+    def _ReadPackedRefs(self):
-    self._ReadLoose('refs/')
+        path = os.path.join(self._gitdir, "packed-refs")
-    self._ReadLoose1(os.path.join(self._gitdir, HEAD), HEAD)
+        try:
+            fd = open(path, "r")
+            mtime = os.path.getmtime(path)
+        except IOError:
+            return
+        except OSError:
+            return
+        try:
+            for line in fd:
+                line = str(line)
+                if line[0] == "#":
+                    continue
+                if line[0] == "^":
+                    continue
 
-    scan = self._symref
+                line = line[:-1]
-    attempts = 0
+                p = line.split(" ")
-    while scan and attempts < 5:
+                ref_id = p[0]
-      scan_next = {}
+                name = p[1]
-      for name, dest in scan.items():
+
-        if dest in self._phyref:
+                self._phyref[name] = ref_id
-          self._phyref[name] = self._phyref[dest]
+        finally:
+            fd.close()
+        self._mtime["packed-refs"] = mtime
+
+    def _ReadLoose(self, prefix):
+        base = os.path.join(self._gitdir, prefix)
+        for name in platform_utils.listdir(base):
+            p = os.path.join(base, name)
+            # We don't implement the full ref validation algorithm, just the
+            # simple rules that would show up in local filesystems.
+            # https://git-scm.com/docs/git-check-ref-format
+            if name.startswith(".") or name.endswith(".lock"):
+                pass
+            elif platform_utils.isdir(p):
+                self._mtime[prefix] = os.path.getmtime(base)
+                self._ReadLoose(prefix + name + "/")
+            else:
+                self._ReadLoose1(p, prefix + name)
+
+    def _ReadLoose1(self, path, name):
+        try:
+            with open(path) as fd:
+                mtime = os.path.getmtime(path)
+                ref_id = fd.readline()
+        except (OSError, UnicodeError):
+            return
+
+        try:
+            ref_id = ref_id.decode()
+        except AttributeError:
+            pass
+        if not ref_id:
+            return
+        ref_id = ref_id[:-1]
+
+        if ref_id.startswith("ref: "):
+            self._symref[name] = ref_id[5:]
         else:
-          scan_next[name] = dest
+            self._phyref[name] = ref_id
-      scan = scan_next
+        self._mtime[name] = mtime
-      attempts += 1
-
-  def _ReadPackedRefs(self):
-    path = os.path.join(self._gitdir, 'packed-refs')
-    try:
-      fd = open(path, 'r')
-      mtime = os.path.getmtime(path)
-    except IOError:
-      return
-    except OSError:
-      return
-    try:
-      for line in fd:
-        line = str(line)
-        if line[0] == '#':
-          continue
-        if line[0] == '^':
-          continue
-
-        line = line[:-1]
-        p = line.split(' ')
-        ref_id = p[0]
-        name = p[1]
-
-        self._phyref[name] = ref_id
-    finally:
-      fd.close()
-    self._mtime['packed-refs'] = mtime
-
-  def _ReadLoose(self, prefix):
-    base = os.path.join(self._gitdir, prefix)
-    for name in platform_utils.listdir(base):
-      p = os.path.join(base, name)
-      # We don't implement the full ref validation algorithm, just the simple
-      # rules that would show up in local filesystems.
-      # https://git-scm.com/docs/git-check-ref-format
-      if name.startswith('.') or name.endswith('.lock'):
-        pass
-      elif platform_utils.isdir(p):
-        self._mtime[prefix] = os.path.getmtime(base)
-        self._ReadLoose(prefix + name + '/')
-      else:
-        self._ReadLoose1(p, prefix + name)
-
-  def _ReadLoose1(self, path, name):
-    try:
-      with open(path) as fd:
-        mtime = os.path.getmtime(path)
-        ref_id = fd.readline()
-    except (OSError, UnicodeError):
-      return
-
-    try:
-      ref_id = ref_id.decode()
-    except AttributeError:
-      pass
-    if not ref_id:
-      return
-    ref_id = ref_id[:-1]
-
-    if ref_id.startswith('ref: '):
-      self._symref[name] = ref_id[5:]
-    else:
-      self._phyref[name] = ref_id
-    self._mtime[name] = mtime

git_superproject.py

@@ -12,7 +12,7 @@
 # See the License for the specific language governing permissions and
 # limitations under the License.
 
-"""Provide functionality to get all projects and their commit ids from Superproject.
+"""Provide functionality to get projects and their commit ids from Superproject.
 
 For more information on superproject, check out:
 https://en.wikibooks.org/wiki/Git/Submodules_and_Superprojects
@@ -22,432 +22,537 @@ Examples:
   UpdateProjectsResult = superproject.UpdateProjectsRevisionId(projects)
 """
 
-import hashlib
 import functools
+import hashlib
 import os
 import sys
 import time
 from typing import NamedTuple
 
-from git_command import git_require, GitCommand
+from git_command import git_require
+from git_command import GitCommand
 from git_config import RepoConfig
-from git_refs import R_HEADS
+from git_refs import GitRefs
 
-_SUPERPROJECT_GIT_NAME = 'superproject.git'
+
-_SUPERPROJECT_MANIFEST_NAME = 'superproject_override.xml'
+_SUPERPROJECT_GIT_NAME = "superproject.git"
+_SUPERPROJECT_MANIFEST_NAME = "superproject_override.xml"
 
 
 class SyncResult(NamedTuple):
-  """Return the status of sync and whether caller should exit."""
+    """Return the status of sync and whether caller should exit."""
 
-  # Whether the superproject sync was successful.
+    # Whether the superproject sync was successful.
-  success: bool
+    success: bool
-  # Whether the caller should exit.
+    # Whether the caller should exit.
-  fatal: bool
+    fatal: bool
 
 
 class CommitIdsResult(NamedTuple):
-  """Return the commit ids and whether caller should exit."""
+    """Return the commit ids and whether caller should exit."""
 
-  # A dictionary with the projects/commit ids on success, otherwise None.
+    # A dictionary with the projects/commit ids on success, otherwise None.
-  commit_ids: dict
+    commit_ids: dict
-  # Whether the caller should exit.
+    # Whether the caller should exit.
-  fatal: bool
+    fatal: bool
 
 
 class UpdateProjectsResult(NamedTuple):
-  """Return the overriding manifest file and whether caller should exit."""
+    """Return the overriding manifest file and whether caller should exit."""
 
-  # Path name of the overriding manifest file if successful, otherwise None.
+    # Path name of the overriding manifest file if successful, otherwise None.
-  manifest_path: str
+    manifest_path: str
-  # Whether the caller should exit.
+    # Whether the caller should exit.
-  fatal: bool
+    fatal: bool
 
 
 class Superproject(object):
-  """Get commit ids from superproject.
+    """Get commit ids from superproject.
 
-  Initializes a local copy of a superproject for the manifest. This allows
+    Initializes a local copy of a superproject for the manifest. This allows
-  lookup of commit ids for all projects. It contains _project_commit_ids which
+    lookup of commit ids for all projects. It contains _project_commit_ids which
-  is a dictionary with project/commit id entries.
+    is a dictionary with project/commit id entries.
-  """
-  def __init__(self, manifest, name, remote, revision,
-               superproject_dir='exp-superproject'):
-    """Initializes superproject.
-
-    Args:
-      manifest: A Manifest object that is to be written to a file.
-      name: The unique name of the superproject
-      remote: The RemoteSpec for the remote.
-      revision: The name of the git branch to track.
-      superproject_dir: Relative path under |manifest.subdir| to checkout
-          superproject.
     """
-    self._project_commit_ids = None
-    self._manifest = manifest
-    self.name = name
-    self.remote = remote
-    self.revision = self._branch = revision
-    self._repodir = manifest.repodir
-    self._superproject_dir = superproject_dir
-    self._superproject_path = manifest.SubmanifestInfoDir(manifest.path_prefix,
-                                                          superproject_dir)
-    self._manifest_path = os.path.join(self._superproject_path,
-                                       _SUPERPROJECT_MANIFEST_NAME)
-    git_name = hashlib.md5(remote.name.encode('utf8')).hexdigest() + '-'
-    self._remote_url = remote.url
-    self._work_git_name = git_name + _SUPERPROJECT_GIT_NAME
-    self._work_git = os.path.join(self._superproject_path, self._work_git_name)
 
-    # The following are command arguemnts, rather than superproject attributes,
+    def __init__(
-    # and were included here originally.  They should eventually become
+        self,
-    # arguments that are passed down from the public methods, instead of being
+        manifest,
-    # treated as attributes.
+        name,
-    self._git_event_log = None
+        remote,
-    self._quiet = False
+        revision,
-    self._print_messages = False
+        superproject_dir="exp-superproject",
+    ):
+        """Initializes superproject.
 
-  def SetQuiet(self, value):
+        Args:
-    """Set the _quiet attribute."""
+            manifest: A Manifest object that is to be written to a file.
-    self._quiet = value
+            name: The unique name of the superproject
+            remote: The RemoteSpec for the remote.
+            revision: The name of the git branch to track.
+            superproject_dir: Relative path under |manifest.subdir| to checkout
+                superproject.
+        """
+        self._project_commit_ids = None
+        self._manifest = manifest
+        self.name = name
+        self.remote = remote
+        self.revision = self._branch = revision
+        self._repodir = manifest.repodir
+        self._superproject_dir = superproject_dir
+        self._superproject_path = manifest.SubmanifestInfoDir(
+            manifest.path_prefix, superproject_dir
+        )
+        self._manifest_path = os.path.join(
+            self._superproject_path, _SUPERPROJECT_MANIFEST_NAME
+        )
+        git_name = hashlib.md5(remote.name.encode("utf8")).hexdigest() + "-"
+        self._remote_url = remote.url
+        self._work_git_name = git_name + _SUPERPROJECT_GIT_NAME
+        self._work_git = os.path.join(
+            self._superproject_path, self._work_git_name
+        )
 
-  def SetPrintMessages(self, value):
+        # The following are command arguemnts, rather than superproject
-    """Set the _print_messages attribute."""
+        # attributes, and were included here originally.  They should eventually
-    self._print_messages = value
+        # become arguments that are passed down from the public methods, instead
+        # of being treated as attributes.
+        self._git_event_log = None
+        self._quiet = False
+        self._print_messages = False
 
-  @property
+    def SetQuiet(self, value):
-  def project_commit_ids(self):
+        """Set the _quiet attribute."""
-    """Returns a dictionary of projects and their commit ids."""
+        self._quiet = value
-    return self._project_commit_ids
 
-  @property
+    def SetPrintMessages(self, value):
-  def manifest_path(self):
+        """Set the _print_messages attribute."""
-    """Returns the manifest path if the path exists or None."""
+        self._print_messages = value
-    return self._manifest_path if os.path.exists(self._manifest_path) else None
 
-  def _LogMessage(self, message):
+    @property
-    """Logs message to stderr and _git_event_log."""
+    def project_commit_ids(self):
-    if self._print_messages:
+        """Returns a dictionary of projects and their commit ids."""
-      print(message, file=sys.stderr)
+        return self._project_commit_ids
-    self._git_event_log.ErrorEvent(message, f'{message}')
 
-  def _LogMessagePrefix(self):
+    @property
-    """Returns the prefix string to be logged in each log message"""
+    def manifest_path(self):
-    return f'repo superproject branch: {self._branch} url: {self._remote_url}'
+        """Returns the manifest path if the path exists or None."""
+        return (
+            self._manifest_path if os.path.exists(self._manifest_path) else None
+        )
 
-  def _LogError(self, message):
+    def _LogMessage(self, fmt, *inputs):
-    """Logs error message to stderr and _git_event_log."""
+        """Logs message to stderr and _git_event_log."""
-    self._LogMessage(f'{self._LogMessagePrefix()} error: {message}')
+        message = f"{self._LogMessagePrefix()} {fmt.format(*inputs)}"
+        if self._print_messages:
+            print(message, file=sys.stderr)
+        self._git_event_log.ErrorEvent(message, fmt)
 
-  def _LogWarning(self, message):
+    def _LogMessagePrefix(self):
-    """Logs warning message to stderr and _git_event_log."""
+        """Returns the prefix string to be logged in each log message"""
-    self._LogMessage(f'{self._LogMessagePrefix()} warning: {message}')
+        return (
+            f"repo superproject branch: {self._branch} url: {self._remote_url}"
+        )
 
-  def _Init(self):
+    def _LogError(self, fmt, *inputs):
-    """Sets up a local Git repository to get a copy of a superproject.
+        """Logs error message to stderr and _git_event_log."""
+        self._LogMessage(f"error: {fmt}", *inputs)
 
-    Returns:
+    def _LogWarning(self, fmt, *inputs):
-      True if initialization is successful, or False.
+        """Logs warning message to stderr and _git_event_log."""
-    """
+        self._LogMessage(f"warning: {fmt}", *inputs)
-    if not os.path.exists(self._superproject_path):
-      os.mkdir(self._superproject_path)
-    if not self._quiet and not os.path.exists(self._work_git):
-      print('%s: Performing initial setup for superproject; this might take '
-            'several minutes.' % self._work_git)
-    cmd = ['init', '--bare', self._work_git_name]
-    p = GitCommand(None,
-                   cmd,
-                   cwd=self._superproject_path,
-                   capture_stdout=True,
-                   capture_stderr=True)
-    retval = p.Wait()
-    if retval:
-      self._LogWarning(f'git init call failed, command: git {cmd}, '
-                       f'return code: {retval}, stderr: {p.stderr}')
-      return False
-    return True
 
-  def _Fetch(self):
+    def _Init(self):
-    """Fetches a local copy of a superproject for the manifest based on |_remote_url|.
+        """Sets up a local Git repository to get a copy of a superproject.
 
-    Returns:
+        Returns:
-      True if fetch is successful, or False.
+            True if initialization is successful, or False.
-    """
+        """
-    if not os.path.exists(self._work_git):
+        if not os.path.exists(self._superproject_path):
-      self._LogWarning(f'git fetch missing directory: {self._work_git}')
+            os.mkdir(self._superproject_path)
-      return False
+        if not self._quiet and not os.path.exists(self._work_git):
-    if not git_require((2, 28, 0)):
+            print(
-      self._LogWarning('superproject requires a git version 2.28 or later')
+                "%s: Performing initial setup for superproject; this might "
-      return False
+                "take several minutes." % self._work_git
-    cmd = ['fetch', self._remote_url, '--depth', '1', '--force', '--no-tags',
+            )
-           '--filter', 'blob:none']
+        cmd = ["init", "--bare", self._work_git_name]
-    if self._branch:
+        p = GitCommand(
-      cmd += [self._branch + ':' + self._branch]
+            None,
-    p = GitCommand(None,
+            cmd,
-                   cmd,
+            cwd=self._superproject_path,
-                   cwd=self._work_git,
+            capture_stdout=True,
-                   capture_stdout=True,
+            capture_stderr=True,
-                   capture_stderr=True)
+        )
-    retval = p.Wait()
+        retval = p.Wait()
-    if retval:
+        if retval:
-      self._LogWarning(f'git fetch call failed, command: git {cmd}, '
+            self._LogWarning(
-                       f'return code: {retval}, stderr: {p.stderr}')
+                "git init call failed, command: git {}, "
-      return False
+                "return code: {}, stderr: {}",
-    return True
+                cmd,
+                retval,
+                p.stderr,
+            )
+            return False
+        return True
 
-  def _LsTree(self):
+    def _Fetch(self):
-    """Gets the commit ids for all projects.
+        """Fetches a superproject for the manifest based on |_remote_url|.
 
-    Works only in git repositories.
+        This runs git fetch which stores a local copy the superproject.
 
-    Returns:
+        Returns:
-      data: data returned from 'git ls-tree ...' instead of None.
+            True if fetch is successful, or False.
-    """
+        """
-    if not os.path.exists(self._work_git):
+        if not os.path.exists(self._work_git):
-      self._LogWarning(f'git ls-tree missing directory: {self._work_git}')
+            self._LogWarning("git fetch missing directory: {}", self._work_git)
-      return None
+            return False
-    data = None
+        if not git_require((2, 28, 0)):
-    branch = 'HEAD' if not self._branch else self._branch
+            self._LogWarning(
-    cmd = ['ls-tree', '-z', '-r', branch]
+                "superproject requires a git version 2.28 or later"
+            )
+            return False
+        cmd = [
+            "fetch",
+            self._remote_url,
+            "--depth",
+            "1",
+            "--force",
+            "--no-tags",
+            "--filter",
+            "blob:none",
+        ]
 
-    p = GitCommand(None,
+        # Check if there is a local ref that we can pass to --negotiation-tip.
-                   cmd,
+        # If this is the first fetch, it does not exist yet.
-                   cwd=self._work_git,
+        # We use --negotiation-tip to speed up the fetch. Superproject branches
-                   capture_stdout=True,
+        # do not share commits. So this lets git know it only needs to send
-                   capture_stderr=True)
+        # commits reachable from the specified local refs.
-    retval = p.Wait()
+        rev_commit = GitRefs(self._work_git).get(f"refs/heads/{self.revision}")
-    if retval == 0:
+        if rev_commit:
-      data = p.stdout
+            cmd.extend(["--negotiation-tip", rev_commit])
-    else:
-      self._LogWarning(f'git ls-tree call failed, command: git {cmd}, '
-                       f'return code: {retval}, stderr: {p.stderr}')
-    return data
 
-  def Sync(self, git_event_log):
+        if self._branch:
-    """Gets a local copy of a superproject for the manifest.
+            cmd += [self._branch + ":" + self._branch]
+        p = GitCommand(
+            None,
+            cmd,
+            cwd=self._work_git,
+            capture_stdout=True,
+            capture_stderr=True,
+        )
+        retval = p.Wait()
+        if retval:
+            self._LogWarning(
+                "git fetch call failed, command: git {}, "
+                "return code: {}, stderr: {}",
+                cmd,
+                retval,
+                p.stderr,
+            )
+            return False
+        return True
 
-    Args:
+    def _LsTree(self):
-      git_event_log: an EventLog, for git tracing.
+        """Gets the commit ids for all projects.
 
-    Returns:
+        Works only in git repositories.
-      SyncResult
-    """
-    self._git_event_log = git_event_log
-    if not self._manifest.superproject:
-      self._LogWarning(f'superproject tag is not defined in manifest: '
-                       f'{self._manifest.manifestFile}')
-      return SyncResult(False, False)
 
-    _PrintBetaNotice()
+        Returns:
+            data: data returned from 'git ls-tree ...' instead of None.
+        """
+        if not os.path.exists(self._work_git):
+            self._LogWarning(
+                "git ls-tree missing directory: {}", self._work_git
+            )
+            return None
+        data = None
+        branch = "HEAD" if not self._branch else self._branch
+        cmd = ["ls-tree", "-z", "-r", branch]
 
-    should_exit = True
+        p = GitCommand(
-    if not self._remote_url:
+            None,
-      self._LogWarning(f'superproject URL is not defined in manifest: '
+            cmd,
-                       f'{self._manifest.manifestFile}')
+            cwd=self._work_git,
-      return SyncResult(False, should_exit)
+            capture_stdout=True,
+            capture_stderr=True,
+        )
+        retval = p.Wait()
+        if retval == 0:
+            data = p.stdout
+        else:
+            self._LogWarning(
+                "git ls-tree call failed, command: git {}, "
+                "return code: {}, stderr: {}",
+                cmd,
+                retval,
+                p.stderr,
+            )
+        return data
 
-    if not self._Init():
+    def Sync(self, git_event_log):
-      return SyncResult(False, should_exit)
+        """Gets a local copy of a superproject for the manifest.
-    if not self._Fetch():
-      return SyncResult(False, should_exit)
-    if not self._quiet:
-      print('%s: Initial setup for superproject completed.' % self._work_git)
-    return SyncResult(True, False)
 
-  def _GetAllProjectsCommitIds(self):
+        Args:
-    """Get commit ids for all projects from superproject and save them in _project_commit_ids.
+            git_event_log: an EventLog, for git tracing.
 
-    Returns:
+        Returns:
-      CommitIdsResult
+            SyncResult
-    """
+        """
-    sync_result = self.Sync(self._git_event_log)
+        self._git_event_log = git_event_log
-    if not sync_result.success:
+        if not self._manifest.superproject:
-      return CommitIdsResult(None, sync_result.fatal)
+            self._LogWarning(
+                "superproject tag is not defined in manifest: {}",
+                self._manifest.manifestFile,
+            )
+            return SyncResult(False, False)
 
-    data = self._LsTree()
+        _PrintBetaNotice()
-    if not data:
-      self._LogWarning(f'git ls-tree failed to return data for manifest: '
-                       f'{self._manifest.manifestFile}')
-      return CommitIdsResult(None, True)
 
-    # Parse lines like the following to select lines starting with '160000' and
+        should_exit = True
-    # build a dictionary with project path (last element) and its commit id (3rd element).
+        if not self._remote_url:
-    #
+            self._LogWarning(
-    # 160000 commit 2c2724cb36cd5a9cec6c852c681efc3b7c6b86ea\tart\x00
+                "superproject URL is not defined in manifest: {}",
-    # 120000 blob acc2cbdf438f9d2141f0ae424cec1d8fc4b5d97f\tbootstrap.bash\x00
+                self._manifest.manifestFile,
-    commit_ids = {}
+            )
-    for line in data.split('\x00'):
+            return SyncResult(False, should_exit)
-      ls_data = line.split(None, 3)
-      if not ls_data:
-        break
-      if ls_data[0] == '160000':
-        commit_ids[ls_data[3]] = ls_data[2]
 
-    self._project_commit_ids = commit_ids
+        if not self._Init():
-    return CommitIdsResult(commit_ids, False)
+            return SyncResult(False, should_exit)
+        if not self._Fetch():
+            return SyncResult(False, should_exit)
+        if not self._quiet:
+            print(
+                "%s: Initial setup for superproject completed." % self._work_git
+            )
+        return SyncResult(True, False)
 
-  def _WriteManifestFile(self):
+    def _GetAllProjectsCommitIds(self):
-    """Writes manifest to a file.
+        """Get commit ids for all projects from superproject and save them.
 
-    Returns:
+        Commit ids are saved in _project_commit_ids.
-      manifest_path: Path name of the file into which manifest is written instead of None.
-    """
-    if not os.path.exists(self._superproject_path):
-      self._LogWarning(f'missing superproject directory: {self._superproject_path}')
-      return None
-    manifest_str = self._manifest.ToXml(groups=self._manifest.GetGroupsStr(),
-                                        omit_local=True).toxml()
-    manifest_path = self._manifest_path
-    try:
-      with open(manifest_path, 'w', encoding='utf-8') as fp:
-        fp.write(manifest_str)
-    except IOError as e:
-      self._LogError(f'cannot write manifest to : {manifest_path} {e}')
-      return None
-    return manifest_path
 
-  def _SkipUpdatingProjectRevisionId(self, project):
+        Returns:
-    """Checks if a project's revision id needs to be updated or not.
+            CommitIdsResult
+        """
+        sync_result = self.Sync(self._git_event_log)
+        if not sync_result.success:
+            return CommitIdsResult(None, sync_result.fatal)
 
-    Revision id for projects from local manifest will not be updated.
+        data = self._LsTree()
+        if not data:
+            self._LogWarning(
+                "git ls-tree failed to return data for manifest: {}",
+                self._manifest.manifestFile,
+            )
+            return CommitIdsResult(None, True)
 
-    Args:
+        # Parse lines like the following to select lines starting with '160000'
-      project: project whose revision id is being updated.
+        # and build a dictionary with project path (last element) and its commit
+        # id (3rd element).
+        #
+        # 160000 commit 2c2724cb36cd5a9cec6c852c681efc3b7c6b86ea\tart\x00
+        # 120000 blob acc2cbdf438f9d2141f0ae424cec1d8fc4b5d97f\tbootstrap.bash\x00  # noqa: E501
+        commit_ids = {}
+        for line in data.split("\x00"):
+            ls_data = line.split(None, 3)
+            if not ls_data:
+                break
+            if ls_data[0] == "160000":
+                commit_ids[ls_data[3]] = ls_data[2]
 
-    Returns:
+        self._project_commit_ids = commit_ids
-      True if a project's revision id should not be updated, or False,
+        return CommitIdsResult(commit_ids, False)
-    """
-    path = project.relpath
-    if not path:
-      return True
-    # Skip the project with revisionId.
-    if project.revisionId:
-      return True
-    # Skip the project if it comes from the local manifest.
-    return project.manifest.IsFromLocalManifest(project)
 
-  def UpdateProjectsRevisionId(self, projects, git_event_log):
+    def _WriteManifestFile(self):
-    """Update revisionId of every project in projects with the commit id.
+        """Writes manifest to a file.
 
-    Args:
+        Returns:
-      projects: a list of projects whose revisionId needs to be updated.
+            manifest_path: Path name of the file into which manifest is written
-      git_event_log: an EventLog, for git tracing.
+                instead of None.
+        """
+        if not os.path.exists(self._superproject_path):
+            self._LogWarning(
+                "missing superproject directory: {}", self._superproject_path
+            )
+            return None
+        manifest_str = self._manifest.ToXml(
+            groups=self._manifest.GetGroupsStr(), omit_local=True
+        ).toxml()
+        manifest_path = self._manifest_path
+        try:
+            with open(manifest_path, "w", encoding="utf-8") as fp:
+                fp.write(manifest_str)
+        except IOError as e:
+            self._LogError("cannot write manifest to : {} {}", manifest_path, e)
+            return None
+        return manifest_path
 
-    Returns:
+    def _SkipUpdatingProjectRevisionId(self, project):
-      UpdateProjectsResult
+        """Checks if a project's revision id needs to be updated or not.
-    """
-    self._git_event_log = git_event_log
-    commit_ids_result = self._GetAllProjectsCommitIds()
-    commit_ids = commit_ids_result.commit_ids
-    if not commit_ids:
-      return UpdateProjectsResult(None, commit_ids_result.fatal)
 
-    projects_missing_commit_ids = []
+        Revision id for projects from local manifest will not be updated.
-    for project in projects:
-      if self._SkipUpdatingProjectRevisionId(project):
-        continue
-      path = project.relpath
-      commit_id = commit_ids.get(path)
-      if not commit_id:
-        projects_missing_commit_ids.append(path)
 
-    # If superproject doesn't have a commit id for a project, then report an
+        Args:
-    # error event and continue as if do not use superproject is specified.
+            project: project whose revision id is being updated.
-    if projects_missing_commit_ids:
-      self._LogWarning(f'please file a bug using {self._manifest.contactinfo.bugurl} '
-                       f'to report missing commit_ids for: {projects_missing_commit_ids}')
-      return UpdateProjectsResult(None, False)
 
-    for project in projects:
+        Returns:
-      if not self._SkipUpdatingProjectRevisionId(project):
+            True if a project's revision id should not be updated, or False,
-        project.SetRevisionId(commit_ids.get(project.relpath))
+        """
+        path = project.relpath
+        if not path:
+            return True
+        # Skip the project with revisionId.
+        if project.revisionId:
+            return True
+        # Skip the project if it comes from the local manifest.
+        return project.manifest.IsFromLocalManifest(project)
 
-    manifest_path = self._WriteManifestFile()
+    def UpdateProjectsRevisionId(self, projects, git_event_log):
-    return UpdateProjectsResult(manifest_path, False)
+        """Update revisionId of every project in projects with the commit id.
+
+        Args:
+            projects: a list of projects whose revisionId needs to be updated.
+            git_event_log: an EventLog, for git tracing.
+
+        Returns:
+            UpdateProjectsResult
+        """
+        self._git_event_log = git_event_log
+        commit_ids_result = self._GetAllProjectsCommitIds()
+        commit_ids = commit_ids_result.commit_ids
+        if not commit_ids:
+            return UpdateProjectsResult(None, commit_ids_result.fatal)
+
+        projects_missing_commit_ids = []
+        for project in projects:
+            if self._SkipUpdatingProjectRevisionId(project):
+                continue
+            path = project.relpath
+            commit_id = commit_ids.get(path)
+            if not commit_id:
+                projects_missing_commit_ids.append(path)
+
+        # If superproject doesn't have a commit id for a project, then report an
+        # error event and continue as if do not use superproject is specified.
+        if projects_missing_commit_ids:
+            self._LogWarning(
+                "please file a bug using {} to report missing "
+                "commit_ids for: {}",
+                self._manifest.contactinfo.bugurl,
+                projects_missing_commit_ids,
+            )
+            return UpdateProjectsResult(None, False)
+
+        for project in projects:
+            if not self._SkipUpdatingProjectRevisionId(project):
+                project.SetRevisionId(commit_ids.get(project.relpath))
+
+        manifest_path = self._WriteManifestFile()
+        return UpdateProjectsResult(manifest_path, False)
 
 
 @functools.lru_cache(maxsize=10)
 def _PrintBetaNotice():
-  """Print the notice of beta status."""
+    """Print the notice of beta status."""
-  print('NOTICE: --use-superproject is in beta; report any issues to the '
+    print(
-        'address described in `repo version`', file=sys.stderr)
+        "NOTICE: --use-superproject is in beta; report any issues to the "
+        "address described in `repo version`",
+        file=sys.stderr,
+    )
 
 
 @functools.lru_cache(maxsize=None)
 def _UseSuperprojectFromConfiguration():
-  """Returns the user choice of whether to use superproject."""
+    """Returns the user choice of whether to use superproject."""
-  user_cfg = RepoConfig.ForUser()
+    user_cfg = RepoConfig.ForUser()
-  time_now = int(time.time())
+    time_now = int(time.time())
 
-  user_value = user_cfg.GetBoolean('repo.superprojectChoice')
+    user_value = user_cfg.GetBoolean("repo.superprojectChoice")
-  if user_value is not None:
+    if user_value is not None:
-    user_expiration = user_cfg.GetInt('repo.superprojectChoiceExpire')
+        user_expiration = user_cfg.GetInt("repo.superprojectChoiceExpire")
-    if user_expiration is None or user_expiration <= 0 or user_expiration >= time_now:
+        if (
-      # TODO(b/190688390) - Remove prompt when we are comfortable with the new
+            user_expiration is None
-      # default value.
+            or user_expiration <= 0
-      if user_value:
+            or user_expiration >= time_now
-        print(('You are currently enrolled in Git submodules experiment '
+        ):
-               '(go/android-submodules-quickstart).  Use --no-use-superproject '
+            # TODO(b/190688390) - Remove prompt when we are comfortable with the
-               'to override.\n'), file=sys.stderr)
+            # new default value.
-      else:
+            if user_value:
-        print(('You are not currently enrolled in Git submodules experiment '
+                print(
-               '(go/android-submodules-quickstart).  Use --use-superproject '
+                    (
-               'to override.\n'), file=sys.stderr)
+                        "You are currently enrolled in Git submodules "
-      return user_value
+                        "experiment (go/android-submodules-quickstart).  Use "
+                        "--no-use-superproject to override.\n"
+                    ),
+                    file=sys.stderr,
+                )
+            else:
+                print(
+                    (
+                        "You are not currently enrolled in Git submodules "
+                        "experiment (go/android-submodules-quickstart).  Use "
+                        "--use-superproject to override.\n"
+                    ),
+                    file=sys.stderr,
+                )
+            return user_value
 
-  # We don't have an unexpired choice, ask for one.
+    # We don't have an unexpired choice, ask for one.
-  system_cfg = RepoConfig.ForSystem()
+    system_cfg = RepoConfig.ForSystem()
-  system_value = system_cfg.GetBoolean('repo.superprojectChoice')
+    system_value = system_cfg.GetBoolean("repo.superprojectChoice")
-  if system_value:
+    if system_value:
-    # The system configuration is proposing that we should enable the
+        # The system configuration is proposing that we should enable the
-    # use of superproject. Treat the user as enrolled for two weeks.
+        # use of superproject. Treat the user as enrolled for two weeks.
-    #
+        #
-    # TODO(b/190688390) - Remove prompt when we are comfortable with the new
+        # TODO(b/190688390) - Remove prompt when we are comfortable with the new
-    # default value.
+        # default value.
-    userchoice = True
+        userchoice = True
-    time_choiceexpire = time_now + (86400 * 14)
+        time_choiceexpire = time_now + (86400 * 14)
-    user_cfg.SetString('repo.superprojectChoiceExpire', str(time_choiceexpire))
+        user_cfg.SetString(
-    user_cfg.SetBoolean('repo.superprojectChoice', userchoice)
+            "repo.superprojectChoiceExpire", str(time_choiceexpire)
-    print('You are automatically enrolled in Git submodules experiment '
+        )
-          '(go/android-submodules-quickstart) for another two weeks.\n',
+        user_cfg.SetBoolean("repo.superprojectChoice", userchoice)
-          file=sys.stderr)
+        print(
-    return True
+            "You are automatically enrolled in Git submodules experiment "
+            "(go/android-submodules-quickstart) for another two weeks.\n",
+            file=sys.stderr,
+        )
+        return True
 
-  # For all other cases, we would not use superproject by default.
+    # For all other cases, we would not use superproject by default.
-  return False
+    return False
 
 
 def PrintMessages(use_superproject, manifest):
-  """Returns a boolean if error/warning messages are to be printed.
+    """Returns a boolean if error/warning messages are to be printed.
 
-  Args:
+    Args:
-    use_superproject: option value from optparse.
+        use_superproject: option value from optparse.
-    manifest: manifest to use.
+        manifest: manifest to use.
-  """
+    """
-  return use_superproject is not None or bool(manifest.superproject)
+    return use_superproject is not None or bool(manifest.superproject)
 
 
 def UseSuperproject(use_superproject, manifest):
-  """Returns a boolean if use-superproject option is enabled.
+    """Returns a boolean if use-superproject option is enabled.
 
-  Args:
+    Args:
-    use_superproject: option value from optparse.
+        use_superproject: option value from optparse.
-    manifest: manifest to use.
+        manifest: manifest to use.
 
-  Returns:
+    Returns:
-    Whether the superproject should be used.
+        Whether the superproject should be used.
-  """
+    """
 
-  if not manifest.superproject:
+    if not manifest.superproject:
-    # This (sub) manifest does not have a superproject definition.
+        # This (sub) manifest does not have a superproject definition.
-    return False
+        return False
-  elif use_superproject is not None:
+    elif use_superproject is not None:
-    return use_superproject
+        return use_superproject
-  else:
-    client_value = manifest.manifestProject.use_superproject
-    if client_value is not None:
-      return client_value
-    elif manifest.superproject:
-      return _UseSuperprojectFromConfiguration()
     else:
-      return False
+        client_value = manifest.manifestProject.use_superproject
+        if client_value is not None:
+            return client_value
+        elif manifest.superproject:
+            return _UseSuperprojectFromConfiguration()
+        else:
+            return False

git_trace2_event_log.py

@@ -1,331 +1,32 @@
-# Copyright (C) 2020 The Android Open Source Project
+from git_command import GetEventTargetPath
-#
+from git_command import RepoSourceVersion
-# Licensed under the Apache License, Version 2.0 (the "License");
+from git_trace2_event_log_base import BaseEventLog
-# you may not use this file except in compliance with the License.
-# You may obtain a copy of the License at
-#
-#      http://www.apache.org/licenses/LICENSE-2.0
-#
-# Unless required by applicable law or agreed to in writing, software
-# distributed under the License is distributed on an "AS IS" BASIS,
-# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
-# See the License for the specific language governing permissions and
-# limitations under the License.
-
-"""Provide event logging in the git trace2 EVENT format.
-
-The git trace2 EVENT format is defined at:
-https://www.kernel.org/pub/software/scm/git/docs/technical/api-trace2.html#_event_format
-https://git-scm.com/docs/api-trace2#_the_event_format_target
-
-  Usage:
-
-  git_trace_log = EventLog()
-  git_trace_log.StartEvent()
-  ...
-  git_trace_log.ExitEvent()
-  git_trace_log.Write()
-"""
 
 
-import datetime
+class EventLog(BaseEventLog):
-import errno
+    """Event log that records events that occurred during a repo invocation.
-import json
-import os
-import socket
-import sys
-import tempfile
-import threading
 
-from git_command import GitCommand, RepoSourceVersion
+    Events are written to the log as a consecutive JSON entries, one per line.
+    Entries follow the git trace2 EVENT format.
 
+    Each entry contains the following common keys:
+    - event: The event name
+    - sid: session-id - Unique string to allow process instance to be
+          identified.
+    - thread: The thread name.
+    - time: is the UTC time of the event.
 
-class EventLog(object):
+    Valid 'event' names and event specific fields are documented here:
-  """Event log that records events that occurred during a repo invocation.
+    https://git-scm.com/docs/api-trace2#_event_format
-
-  Events are written to the log as a consecutive JSON entries, one per line.
-  Entries follow the git trace2 EVENT format.
-
-  Each entry contains the following common keys:
-  - event: The event name
-  - sid: session-id - Unique string to allow process instance to be identified.
-  - thread: The thread name.
-  - time: is the UTC time of the event.
-
-  Valid 'event' names and event specific fields are documented here:
-  https://git-scm.com/docs/api-trace2#_event_format
-  """
-
-  def __init__(self, env=None):
-    """Initializes the event log."""
-    self._log = []
-    # Try to get session-id (sid) from environment (setup in repo launcher).
-    KEY = 'GIT_TRACE2_PARENT_SID'
-    if env is None:
-      env = os.environ
-
-    now = datetime.datetime.utcnow()
-
-    # Save both our sid component and the complete sid.
-    # We use our sid component (self._sid) as the unique filename prefix and
-    # the full sid (self._full_sid) in the log itself.
-    self._sid = 'repo-%s-P%08x' % (now.strftime('%Y%m%dT%H%M%SZ'), os.getpid())
-    parent_sid = env.get(KEY)
-    # Append our sid component to the parent sid (if it exists).
-    if parent_sid is not None:
-      self._full_sid = parent_sid + '/' + self._sid
-    else:
-      self._full_sid = self._sid
-
-    # Set/update the environment variable.
-    # Environment handling across systems is messy.
-    try:
-      env[KEY] = self._full_sid
-    except UnicodeEncodeError:
-      env[KEY] = self._full_sid.encode()
-
-    # Add a version event to front of the log.
-    self._AddVersionEvent()
-
-  @property
-  def full_sid(self):
-    return self._full_sid
-
-  def _AddVersionEvent(self):
-    """Adds a 'version' event at the beginning of current log."""
-    version_event = self._CreateEventDict('version')
-    version_event['evt'] = "2"
-    version_event['exe'] = RepoSourceVersion()
-    self._log.insert(0, version_event)
-
-  def _CreateEventDict(self, event_name):
-    """Returns a dictionary with the common keys/values for git trace2 events.
-
-    Args:
-      event_name: The event name.
-
-    Returns:
-      Dictionary with the common event fields populated.
-    """
-    return {
-        'event': event_name,
-        'sid': self._full_sid,
-        'thread': threading.currentThread().getName(),
-        'time': datetime.datetime.utcnow().isoformat() + 'Z',
-    }
-
-  def StartEvent(self):
-    """Append a 'start' event to the current log."""
-    start_event = self._CreateEventDict('start')
-    start_event['argv'] = sys.argv
-    self._log.append(start_event)
-
-  def ExitEvent(self, result):
-    """Append an 'exit' event to the current log.
-
-    Args:
-      result: Exit code of the event
-    """
-    exit_event = self._CreateEventDict('exit')
-
-    # Consider 'None' success (consistent with event_log result handling).
-    if result is None:
-      result = 0
-    exit_event['code'] = result
-    self._log.append(exit_event)
-
-  def CommandEvent(self, name, subcommands):
-    """Append a 'command' event to the current log.
-
-    Args:
-      name: Name of the primary command (ex: repo, git)
-      subcommands: List of the sub-commands (ex: version, init, sync)
-    """
-    command_event = self._CreateEventDict('command')
-    command_event['name'] = name
-    command_event['subcommands'] = subcommands
-    self._log.append(command_event)
-
-  def LogConfigEvents(self, config, event_dict_name):
-    """Append a |event_dict_name| event for each config key in |config|.
-
-    Args:
-      config: Configuration dictionary.
-      event_dict_name: Name of the event dictionary for items to be logged under.
-    """
-    for param, value in config.items():
-      event = self._CreateEventDict(event_dict_name)
-      event['param'] = param
-      event['value'] = value
-      self._log.append(event)
-
-  def DefParamRepoEvents(self, config):
-    """Append a 'def_param' event for each repo.* config key to the current log.
-
-    Args:
-      config: Repo configuration dictionary
-    """
-    # Only output the repo.* config parameters.
-    repo_config = {k: v for k, v in config.items() if k.startswith('repo.')}
-    self.LogConfigEvents(repo_config, 'def_param')
-
-  def GetDataEventName(self, value):
-    """Returns 'data-json' if the value is an array else returns 'data'."""
-    return 'data-json' if value[0] == '[' and value[-1] == ']' else 'data'
-
-  def LogDataConfigEvents(self, config, prefix):
-    """Append a 'data' event for each config key/value in |config| to the current log.
-
-    For each keyX and valueX of the config, "key" field of the event is '|prefix|/keyX'
-    and the "value" of the "key" field is valueX.
-
-    Args:
-      config: Configuration dictionary.
-      prefix: Prefix for each key that is logged.
-    """
-    for key, value in config.items():
-      event = self._CreateEventDict(self.GetDataEventName(value))
-      event['key'] = f'{prefix}/{key}'
-      event['value'] = value
-      self._log.append(event)
-
-  def ErrorEvent(self, msg, fmt):
-    """Append a 'error' event to the current log."""
-    error_event = self._CreateEventDict('error')
-    error_event['msg'] = msg
-    error_event['fmt'] = fmt
-    self._log.append(error_event)
-
-  def _GetEventTargetPath(self):
-    """Get the 'trace2.eventtarget' path from git configuration.
-
-    Returns:
-      path: git config's 'trace2.eventtarget' path if it exists, or None
-    """
-    path = None
-    cmd = ['config', '--get', 'trace2.eventtarget']
-    # TODO(https://crbug.com/gerrit/13706): Use GitConfig when it supports
-    # system git config variables.
-    p = GitCommand(None, cmd, capture_stdout=True, capture_stderr=True,
-                   bare=True)
-    retval = p.Wait()
-    if retval == 0:
-      # Strip trailing carriage-return in path.
-      path = p.stdout.rstrip('\n')
-    elif retval != 1:
-      # `git config --get` is documented to produce an exit status of `1` if
-      # the requested variable is not present in the configuration. Report any
-      # other return value as an error.
-      print("repo: error: 'git config --get' call failed with return code: %r, stderr: %r" % (
-          retval, p.stderr), file=sys.stderr)
-    return path
-
-  def _WriteLog(self, write_fn):
-    """Writes the log out using a provided writer function.
-
-    Generate compact JSON output for each item in the log, and write it using
-    write_fn.
-
-    Args:
-      write_fn: A function that accepts byts and writes them to a destination.
     """
 
-    for e in self._log:
+    def __init__(self, **kwargs):
-      # Dump in compact encoding mode.
+        super().__init__(repo_source_version=RepoSourceVersion(), **kwargs)
-      # See 'Compact encoding' in Python docs:
-      # https://docs.python.org/3/library/json.html#module-json
-      write_fn(json.dumps(e, indent=None, separators=(',', ':')).encode('utf-8') + b'\n')
 
-  def Write(self, path=None):
+    def Write(self, path=None, **kwargs):
-    """Writes the log out to a file or socket.
+        if path is None:
+            path = self._GetEventTargetPath()
+        return super().Write(path=path, **kwargs)
 
-    Log is only written if 'path' or 'git config --get trace2.eventtarget'
+    def _GetEventTargetPath(self):
-    provide a valid path (or socket) to write logs to.
+        return GetEventTargetPath()
-
-    Logging filename format follows the git trace2 style of being a unique
-    (exclusive writable) file.
-
-    Args:
-      path: Path to where logs should be written. The path may have a prefix of
-          the form "af_unix:[{stream|dgram}:]", in which case the path is
-          treated as a Unix domain socket. See
-          https://git-scm.com/docs/api-trace2#_enabling_a_target for details.
-
-    Returns:
-      log_path: Path to the log file or socket if log is written, otherwise None
-    """
-    log_path = None
-    # If no logging path is specified, get the path from 'trace2.eventtarget'.
-    if path is None:
-      path = self._GetEventTargetPath()
-
-    # If no logging path is specified, exit.
-    if path is None:
-      return None
-
-    path_is_socket = False
-    socket_type = None
-    if isinstance(path, str):
-      parts = path.split(':', 1)
-      if parts[0] == 'af_unix' and len(parts) == 2:
-        path_is_socket = True
-        path = parts[1]
-        parts = path.split(':', 1)
-        if parts[0] == 'stream' and len(parts) == 2:
-          socket_type = socket.SOCK_STREAM
-          path = parts[1]
-        elif parts[0] == 'dgram' and len(parts) == 2:
-          socket_type = socket.SOCK_DGRAM
-          path = parts[1]
-      else:
-        # Get absolute path.
-        path = os.path.abspath(os.path.expanduser(path))
-    else:
-      raise TypeError('path: str required but got %s.' % type(path))
-
-    # Git trace2 requires a directory to write log to.
-
-    # TODO(https://crbug.com/gerrit/13706): Support file (append) mode also.
-    if not (path_is_socket or os.path.isdir(path)):
-      return None
-
-    if path_is_socket:
-      if socket_type == socket.SOCK_STREAM or socket_type is None:
-        try:
-          with socket.socket(socket.AF_UNIX, socket.SOCK_STREAM) as sock:
-            sock.connect(path)
-            self._WriteLog(sock.sendall)
-          return f'af_unix:stream:{path}'
-        except OSError as err:
-          # If we tried to connect to a DGRAM socket using STREAM, ignore the
-          # attempt and continue to DGRAM below. Otherwise, issue a warning.
-          if err.errno != errno.EPROTOTYPE:
-            print(f'repo: warning: git trace2 logging failed: {err}', file=sys.stderr)
-            return None
-      if socket_type == socket.SOCK_DGRAM or socket_type is None:
-        try:
-          with socket.socket(socket.AF_UNIX, socket.SOCK_DGRAM) as sock:
-            self._WriteLog(lambda bs: sock.sendto(bs, path))
-            return f'af_unix:dgram:{path}'
-        except OSError as err:
-          print(f'repo: warning: git trace2 logging failed: {err}', file=sys.stderr)
-          return None
-      # Tried to open a socket but couldn't connect (SOCK_STREAM) or write
-      # (SOCK_DGRAM).
-      print('repo: warning: git trace2 logging failed: could not write to socket', file=sys.stderr)
-      return None
-
-    # Path is an absolute path
-    # Use NamedTemporaryFile to generate a unique filename as required by git trace2.
-    try:
-      with tempfile.NamedTemporaryFile(mode='xb', prefix=self._sid, dir=path,
-                                       delete=False) as f:
-        # TODO(https://crbug.com/gerrit/13706): Support writing events as they
-        # occur.
-        self._WriteLog(f.write)
-        log_path = f.name
-    except FileExistsError as err:
-      print('repo: warning: git trace2 logging failed: %r' % err,
-            file=sys.stderr)
-      return None
-    return log_path

git_trace2_event_log_base.py

@@ -0,0 +1,352 @@
+# Copyright (C) 2020 The Android Open Source Project
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#      http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+"""Provide event logging in the git trace2 EVENT format.
+
+The git trace2 EVENT format is defined at:
+https://www.kernel.org/pub/software/scm/git/docs/technical/api-trace2.html#_event_format
+https://git-scm.com/docs/api-trace2#_the_event_format_target
+
+  Usage:
+
+  git_trace_log = EventLog()
+  git_trace_log.StartEvent()
+  ...
+  git_trace_log.ExitEvent()
+  git_trace_log.Write()
+"""
+
+
+import datetime
+import errno
+import json
+import os
+import socket
+import sys
+import tempfile
+import threading
+
+
+# BaseEventLog __init__ Counter that is consistent within the same process
+p_init_count = 0
+
+
+class BaseEventLog(object):
+    """Event log that records events that occurred during a repo invocation.
+
+    Events are written to the log as a consecutive JSON entries, one per line.
+    Entries follow the git trace2 EVENT format.
+
+    Each entry contains the following common keys:
+    - event: The event name
+    - sid: session-id - Unique string to allow process instance to be
+          identified.
+    - thread: The thread name.
+    - time: is the UTC time of the event.
+
+    Valid 'event' names and event specific fields are documented here:
+    https://git-scm.com/docs/api-trace2#_event_format
+    """
+
+    def __init__(
+        self, env=None, repo_source_version=None, add_init_count=False
+    ):
+        """Initializes the event log."""
+        global p_init_count
+        p_init_count += 1
+        self._log = []
+        # Try to get session-id (sid) from environment (setup in repo launcher).
+        KEY = "GIT_TRACE2_PARENT_SID"
+        if env is None:
+            env = os.environ
+
+        self.start = datetime.datetime.now(datetime.timezone.utc)
+
+        # Save both our sid component and the complete sid.
+        # We use our sid component (self._sid) as the unique filename prefix and
+        # the full sid (self._full_sid) in the log itself.
+        self._sid = "repo-%s-P%08x" % (
+            self.start.strftime("%Y%m%dT%H%M%SZ"),
+            os.getpid(),
+        )
+
+        if add_init_count:
+            self._sid = f"{self._sid}-{p_init_count}"
+
+        parent_sid = env.get(KEY)
+        # Append our sid component to the parent sid (if it exists).
+        if parent_sid is not None:
+            self._full_sid = parent_sid + "/" + self._sid
+        else:
+            self._full_sid = self._sid
+
+        # Set/update the environment variable.
+        # Environment handling across systems is messy.
+        try:
+            env[KEY] = self._full_sid
+        except UnicodeEncodeError:
+            env[KEY] = self._full_sid.encode()
+
+        if repo_source_version is not None:
+            # Add a version event to front of the log.
+            self._AddVersionEvent(repo_source_version)
+
+    @property
+    def full_sid(self):
+        return self._full_sid
+
+    def _AddVersionEvent(self, repo_source_version):
+        """Adds a 'version' event at the beginning of current log."""
+        version_event = self._CreateEventDict("version")
+        version_event["evt"] = "2"
+        version_event["exe"] = repo_source_version
+        self._log.insert(0, version_event)
+
+    def _CreateEventDict(self, event_name):
+        """Returns a dictionary with common keys/values for git trace2 events.
+
+        Args:
+            event_name: The event name.
+
+        Returns:
+            Dictionary with the common event fields populated.
+        """
+        return {
+            "event": event_name,
+            "sid": self._full_sid,
+            "thread": threading.current_thread().name,
+            "time": datetime.datetime.now(datetime.timezone.utc).isoformat(),
+        }
+
+    def StartEvent(self):
+        """Append a 'start' event to the current log."""
+        start_event = self._CreateEventDict("start")
+        start_event["argv"] = sys.argv
+        self._log.append(start_event)
+
+    def ExitEvent(self, result):
+        """Append an 'exit' event to the current log.
+
+        Args:
+            result: Exit code of the event
+        """
+        exit_event = self._CreateEventDict("exit")
+
+        # Consider 'None' success (consistent with event_log result handling).
+        if result is None:
+            result = 0
+        exit_event["code"] = result
+        time_delta = datetime.datetime.now(datetime.timezone.utc) - self.start
+        exit_event["t_abs"] = time_delta.total_seconds()
+        self._log.append(exit_event)
+
+    def CommandEvent(self, name, subcommands):
+        """Append a 'command' event to the current log.
+
+        Args:
+            name: Name of the primary command (ex: repo, git)
+            subcommands: List of the sub-commands (ex: version, init, sync)
+        """
+        command_event = self._CreateEventDict("command")
+        command_event["name"] = name
+        command_event["subcommands"] = subcommands
+        self._log.append(command_event)
+
+    def LogConfigEvents(self, config, event_dict_name):
+        """Append a |event_dict_name| event for each config key in |config|.
+
+        Args:
+            config: Configuration dictionary.
+            event_dict_name: Name of the event dictionary for items to be logged
+                under.
+        """
+        for param, value in config.items():
+            event = self._CreateEventDict(event_dict_name)
+            event["param"] = param
+            event["value"] = value
+            self._log.append(event)
+
+    def DefParamRepoEvents(self, config):
+        """Append 'def_param' events for repo config keys to the current log.
+
+        This appends one event for each repo.* config key.
+
+        Args:
+            config: Repo configuration dictionary
+        """
+        # Only output the repo.* config parameters.
+        repo_config = {k: v for k, v in config.items() if k.startswith("repo.")}
+        self.LogConfigEvents(repo_config, "def_param")
+
+    def GetDataEventName(self, value):
+        """Returns 'data-json' if the value is an array else returns 'data'."""
+        return "data-json" if value[0] == "[" and value[-1] == "]" else "data"
+
+    def LogDataConfigEvents(self, config, prefix):
+        """Append a 'data' event for each entry in |config| to the current log.
+
+        For each keyX and valueX of the config, "key" field of the event is
+        '|prefix|/keyX' and the "value" of the "key" field is valueX.
+
+        Args:
+            config: Configuration dictionary.
+            prefix: Prefix for each key that is logged.
+        """
+        for key, value in config.items():
+            event = self._CreateEventDict(self.GetDataEventName(value))
+            event["key"] = f"{prefix}/{key}"
+            event["value"] = value
+            self._log.append(event)
+
+    def ErrorEvent(self, msg, fmt=None):
+        """Append a 'error' event to the current log."""
+        error_event = self._CreateEventDict("error")
+        if fmt is None:
+            fmt = msg
+        error_event["msg"] = f"RepoErrorEvent:{msg}"
+        error_event["fmt"] = f"RepoErrorEvent:{fmt}"
+        self._log.append(error_event)
+
+    def _WriteLog(self, write_fn):
+        """Writes the log out using a provided writer function.
+
+        Generate compact JSON output for each item in the log, and write it
+        using write_fn.
+
+        Args:
+            write_fn: A function that accepts byts and writes them to a
+                destination.
+        """
+
+        for e in self._log:
+            # Dump in compact encoding mode.
+            # See 'Compact encoding' in Python docs:
+            # https://docs.python.org/3/library/json.html#module-json
+            write_fn(
+                json.dumps(e, indent=None, separators=(",", ":")).encode(
+                    "utf-8"
+                )
+                + b"\n"
+            )
+
+    def Write(self, path=None):
+        """Writes the log out to a file or socket.
+
+        Log is only written if 'path' or 'git config --get trace2.eventtarget'
+        provide a valid path (or socket) to write logs to.
+
+        Logging filename format follows the git trace2 style of being a unique
+        (exclusive writable) file.
+
+        Args:
+            path: Path to where logs should be written. The path may have a
+                prefix of the form "af_unix:[{stream|dgram}:]", in which case
+                the path is treated as a Unix domain socket. See
+                https://git-scm.com/docs/api-trace2#_enabling_a_target for
+                details.
+
+        Returns:
+            log_path: Path to the log file or socket if log is written,
+                otherwise None
+        """
+        log_path = None
+        # If no logging path is specified, exit.
+        if path is None:
+            return None
+
+        path_is_socket = False
+        socket_type = None
+        if isinstance(path, str):
+            parts = path.split(":", 1)
+            if parts[0] == "af_unix" and len(parts) == 2:
+                path_is_socket = True
+                path = parts[1]
+                parts = path.split(":", 1)
+                if parts[0] == "stream" and len(parts) == 2:
+                    socket_type = socket.SOCK_STREAM
+                    path = parts[1]
+                elif parts[0] == "dgram" and len(parts) == 2:
+                    socket_type = socket.SOCK_DGRAM
+                    path = parts[1]
+            else:
+                # Get absolute path.
+                path = os.path.abspath(os.path.expanduser(path))
+        else:
+            raise TypeError("path: str required but got %s." % type(path))
+
+        # Git trace2 requires a directory to write log to.
+
+        # TODO(https://crbug.com/gerrit/13706): Support file (append) mode also.
+        if not (path_is_socket or os.path.isdir(path)):
+            return None
+
+        if path_is_socket:
+            if socket_type == socket.SOCK_STREAM or socket_type is None:
+                try:
+                    with socket.socket(
+                        socket.AF_UNIX, socket.SOCK_STREAM
+                    ) as sock:
+                        sock.connect(path)
+                        self._WriteLog(sock.sendall)
+                    return f"af_unix:stream:{path}"
+                except OSError as err:
+                    # If we tried to connect to a DGRAM socket using STREAM,
+                    # ignore the attempt and continue to DGRAM below. Otherwise,
+                    # issue a warning.
+                    if err.errno != errno.EPROTOTYPE:
+                        print(
+                            f"repo: warning: git trace2 logging failed: {err}",
+                            file=sys.stderr,
+                        )
+                        return None
+            if socket_type == socket.SOCK_DGRAM or socket_type is None:
+                try:
+                    with socket.socket(
+                        socket.AF_UNIX, socket.SOCK_DGRAM
+                    ) as sock:
+                        self._WriteLog(lambda bs: sock.sendto(bs, path))
+                        return f"af_unix:dgram:{path}"
+                except OSError as err:
+                    print(
+                        f"repo: warning: git trace2 logging failed: {err}",
+                        file=sys.stderr,
+                    )
+                    return None
+            # Tried to open a socket but couldn't connect (SOCK_STREAM) or write
+            # (SOCK_DGRAM).
+            print(
+                "repo: warning: git trace2 logging failed: could not write to "
+                "socket",
+                file=sys.stderr,
+            )
+            return None
+
+        # Path is an absolute path
+        # Use NamedTemporaryFile to generate a unique filename as required by
+        # git trace2.
+        try:
+            with tempfile.NamedTemporaryFile(
+                mode="xb", prefix=self._sid, dir=path, delete=False
+            ) as f:
+                # TODO(https://crbug.com/gerrit/13706): Support writing events
+                # as they occur.
+                self._WriteLog(f.write)
+                log_path = f.name
+        except FileExistsError as err:
+            print(
+                "repo: warning: git trace2 logging failed: %r" % err,
+                file=sys.stderr,
+            )
+            return None
+        return log_path

gitc_utils.py

@@ -1,156 +0,0 @@
-# Copyright (C) 2015 The Android Open Source Project
-#
-# Licensed under the Apache License, Version 2.0 (the "License");
-# you may not use this file except in compliance with the License.
-# You may obtain a copy of the License at
-#
-#      http://www.apache.org/licenses/LICENSE-2.0
-#
-# Unless required by applicable law or agreed to in writing, software
-# distributed under the License is distributed on an "AS IS" BASIS,
-# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
-# See the License for the specific language governing permissions and
-# limitations under the License.
-
-import os
-import multiprocessing
-import platform
-import re
-import sys
-import time
-
-import git_command
-import git_config
-import wrapper
-
-from error import ManifestParseError
-
-NUM_BATCH_RETRIEVE_REVISIONID = 32
-
-
-def get_gitc_manifest_dir():
-  return wrapper.Wrapper().get_gitc_manifest_dir()
-
-
-def parse_clientdir(gitc_fs_path):
-  return wrapper.Wrapper().gitc_parse_clientdir(gitc_fs_path)
-
-
-def _get_project_revision(args):
-  """Worker for _set_project_revisions to lookup one project remote."""
-  (i, url, expr) = args
-  gitcmd = git_command.GitCommand(
-      None, ['ls-remote', url, expr], capture_stdout=True, cwd='/tmp')
-  rc = gitcmd.Wait()
-  return (i, rc, gitcmd.stdout.split('\t', 1)[0])
-
-
-def _set_project_revisions(projects):
-  """Sets the revisionExpr for a list of projects.
-
-  Because of the limit of open file descriptors allowed, length of projects
-  should not be overly large. Recommend calling this function multiple times
-  with each call not exceeding NUM_BATCH_RETRIEVE_REVISIONID projects.
-
-  Args:
-    projects: List of project objects to set the revionExpr for.
-  """
-  # Retrieve the commit id for each project based off of it's current
-  # revisionExpr and it is not already a commit id.
-  with multiprocessing.Pool(NUM_BATCH_RETRIEVE_REVISIONID) as pool:
-    results_iter = pool.imap_unordered(
-        _get_project_revision,
-        ((i, project.remote.url, project.revisionExpr)
-         for i, project in enumerate(projects)
-         if not git_config.IsId(project.revisionExpr)),
-        chunksize=8)
-    for (i, rc, revisionExpr) in results_iter:
-      project = projects[i]
-      if rc:
-        print('FATAL: Failed to retrieve revisionExpr for %s' % project.name)
-        pool.terminate()
-        sys.exit(1)
-      if not revisionExpr:
-        pool.terminate()
-        raise ManifestParseError('Invalid SHA-1 revision project %s (%s)' %
-                                 (project.remote.url, project.revisionExpr))
-      project.revisionExpr = revisionExpr
-
-
-def generate_gitc_manifest(gitc_manifest, manifest, paths=None):
-  """Generate a manifest for shafsd to use for this GITC client.
-
-  Args:
-    gitc_manifest: Current gitc manifest, or None if there isn't one yet.
-    manifest: A GitcManifest object loaded with the current repo manifest.
-    paths: List of project paths we want to update.
-  """
-
-  print('Generating GITC Manifest by fetching revision SHAs for each '
-        'project.')
-  if paths is None:
-    paths = list(manifest.paths.keys())
-
-  groups = [x for x in re.split(r'[,\s]+', manifest.GetGroupsStr()) if x]
-
-  # Convert the paths to projects, and filter them to the matched groups.
-  projects = [manifest.paths[p] for p in paths]
-  projects = [p for p in projects if p.MatchesGroups(groups)]
-
-  if gitc_manifest is not None:
-    for path, proj in manifest.paths.items():
-      if not proj.MatchesGroups(groups):
-        continue
-
-      if not proj.upstream and not git_config.IsId(proj.revisionExpr):
-        proj.upstream = proj.revisionExpr
-
-      if path not in gitc_manifest.paths:
-        # Any new projects need their first revision, even if we weren't asked
-        # for them.
-        projects.append(proj)
-      elif path not in paths:
-        # And copy revisions from the previous manifest if we're not updating
-        # them now.
-        gitc_proj = gitc_manifest.paths[path]
-        if gitc_proj.old_revision:
-          proj.revisionExpr = None
-          proj.old_revision = gitc_proj.old_revision
-        else:
-          proj.revisionExpr = gitc_proj.revisionExpr
-
-  _set_project_revisions(projects)
-
-  if gitc_manifest is not None:
-    for path, proj in gitc_manifest.paths.items():
-      if proj.old_revision and path in paths:
-        # If we updated a project that has been started, keep the old-revision
-        # updated.
-        repo_proj = manifest.paths[path]
-        repo_proj.old_revision = repo_proj.revisionExpr
-        repo_proj.revisionExpr = None
-
-  # Convert URLs from relative to absolute.
-  for _name, remote in manifest.remotes.items():
-    remote.fetchUrl = remote.resolvedFetchUrl
-
-  # Save the manifest.
-  save_manifest(manifest)
-
-
-def save_manifest(manifest, client_dir=None):
-  """Save the manifest file in the client_dir.
-
-  Args:
-    manifest: Manifest object to save.
-    client_dir: Client directory to save the manifest in.
-  """
-  if not client_dir:
-    manifest_file = manifest.manifestFile
-  else:
-    manifest_file = os.path.join(client_dir, '.manifest')
-  with open(manifest_file, 'w') as f:
-    manifest.Save(f, groups=manifest.GetGroupsStr())
-  # TODO(sbasi/jorg): Come up with a solution to remove the sleep below.
-  # Give the GITC filesystem time to register the manifest changes.
-  time.sleep(3)

hooks.py

@@ -26,271 +26,293 @@ from git_refs import HEAD
 
 
 class RepoHook(object):
-  """A RepoHook contains information about a script to run as a hook.
+    """A RepoHook contains information about a script to run as a hook.
 
-  Hooks are used to run a python script before running an upload (for instance,
+    Hooks are used to run a python script before running an upload (for
-  to run presubmit checks).  Eventually, we may have hooks for other actions.
+    instance, to run presubmit checks).  Eventually, we may have hooks for other
+    actions.
 
-  This shouldn't be confused with files in the 'repo/hooks' directory.  Those
+    This shouldn't be confused with files in the 'repo/hooks' directory.  Those
-  files are copied into each '.git/hooks' folder for each project.  Repo-level
+    files are copied into each '.git/hooks' folder for each project.  Repo-level
-  hooks are associated instead with repo actions.
+    hooks are associated instead with repo actions.
 
-  Hooks are always python.  When a hook is run, we will load the hook into the
+    Hooks are always python.  When a hook is run, we will load the hook into the
-  interpreter and execute its main() function.
+    interpreter and execute its main() function.
 
-  Combinations of hook option flags:
+    Combinations of hook option flags:
-  - no-verify=False, verify=False (DEFAULT):
+    - no-verify=False, verify=False (DEFAULT):
-    If stdout is a tty, can prompt about running hooks if needed.
+      If stdout is a tty, can prompt about running hooks if needed.
-    If user denies running hooks, the action is cancelled. If stdout is
+      If user denies running hooks, the action is cancelled. If stdout is
-    not a tty and we would need to prompt about hooks, action is
+      not a tty and we would need to prompt about hooks, action is
-    cancelled.
+      cancelled.
-  - no-verify=False, verify=True:
+    - no-verify=False, verify=True:
-    Always run hooks with no prompt.
+      Always run hooks with no prompt.
-  - no-verify=True, verify=False:
+    - no-verify=True, verify=False:
-    Never run hooks, but run action anyway (AKA bypass hooks).
+      Never run hooks, but run action anyway (AKA bypass hooks).
-  - no-verify=True, verify=True:
+    - no-verify=True, verify=True:
-    Invalid
+      Invalid
-  """
-
-  def __init__(self,
-               hook_type,
-               hooks_project,
-               repo_topdir,
-               manifest_url,
-               bypass_hooks=False,
-               allow_all_hooks=False,
-               ignore_hooks=False,
-               abort_if_user_denies=False):
-    """RepoHook constructor.
-
-    Params:
-      hook_type: A string representing the type of hook.  This is also used
-          to figure out the name of the file containing the hook.  For
-          example: 'pre-upload'.
-      hooks_project: The project containing the repo hooks.
-          If you have a manifest, this is manifest.repo_hooks_project.
-          OK if this is None, which will make the hook a no-op.
-      repo_topdir: The top directory of the repo client checkout.
-          This is the one containing the .repo directory. Scripts will
-          run with CWD as this directory.
-          If you have a manifest, this is manifest.topdir.
-      manifest_url: The URL to the manifest git repo.
-      bypass_hooks: If True, then 'Do not run the hook'.
-      allow_all_hooks: If True, then 'Run the hook without prompting'.
-      ignore_hooks: If True, then 'Do not abort action if hooks fail'.
-      abort_if_user_denies: If True, we'll abort running the hook if the user
-          doesn't allow us to run the hook.
     """
-    self._hook_type = hook_type
-    self._hooks_project = hooks_project
-    self._repo_topdir = repo_topdir
-    self._manifest_url = manifest_url
-    self._bypass_hooks = bypass_hooks
-    self._allow_all_hooks = allow_all_hooks
-    self._ignore_hooks = ignore_hooks
-    self._abort_if_user_denies = abort_if_user_denies
 
-    # Store the full path to the script for convenience.
+    def __init__(
-    if self._hooks_project:
+        self,
-      self._script_fullpath = os.path.join(self._hooks_project.worktree,
+        hook_type,
-                                           self._hook_type + '.py')
+        hooks_project,
-    else:
+        repo_topdir,
-      self._script_fullpath = None
+        manifest_url,
+        bypass_hooks=False,
+        allow_all_hooks=False,
+        ignore_hooks=False,
+        abort_if_user_denies=False,
+    ):
+        """RepoHook constructor.
 
-  def _GetHash(self):
+        Params:
-    """Return a hash of the contents of the hooks directory.
+            hook_type: A string representing the type of hook. This is also used
+                to figure out the name of the file containing the hook. For
+                example: 'pre-upload'.
+            hooks_project: The project containing the repo hooks.
+                If you have a manifest, this is manifest.repo_hooks_project.
+                OK if this is None, which will make the hook a no-op.
+            repo_topdir: The top directory of the repo client checkout.
+                This is the one containing the .repo directory. Scripts will
+                run with CWD as this directory.
+                If you have a manifest, this is manifest.topdir.
+            manifest_url: The URL to the manifest git repo.
+            bypass_hooks: If True, then 'Do not run the hook'.
+            allow_all_hooks: If True, then 'Run the hook without prompting'.
+            ignore_hooks: If True, then 'Do not abort action if hooks fail'.
+            abort_if_user_denies: If True, we'll abort running the hook if the
+                user doesn't allow us to run the hook.
+        """
+        self._hook_type = hook_type
+        self._hooks_project = hooks_project
+        self._repo_topdir = repo_topdir
+        self._manifest_url = manifest_url
+        self._bypass_hooks = bypass_hooks
+        self._allow_all_hooks = allow_all_hooks
+        self._ignore_hooks = ignore_hooks
+        self._abort_if_user_denies = abort_if_user_denies
 
-    We'll just use git to do this.  This hash has the property that if anything
+        # Store the full path to the script for convenience.
-    changes in the directory we will return a different has.
+        if self._hooks_project:
+            self._script_fullpath = os.path.join(
+                self._hooks_project.worktree, self._hook_type + ".py"
+            )
+        else:
+            self._script_fullpath = None
 
-    SECURITY CONSIDERATION:
+    def _GetHash(self):
-      This hash only represents the contents of files in the hook directory, not
+        """Return a hash of the contents of the hooks directory.
-      any other files imported or called by hooks.  Changes to imported files
-      can change the script behavior without affecting the hash.
 
-    Returns:
+        We'll just use git to do this.  This hash has the property that if
-      A string representing the hash.  This will always be ASCII so that it can
+        anything changes in the directory we will return a different has.
-      be printed to the user easily.
-    """
-    assert self._hooks_project, "Must have hooks to calculate their hash."
 
-    # We will use the work_git object rather than just calling GetRevisionId().
+        SECURITY CONSIDERATION:
-    # That gives us a hash of the latest checked in version of the files that
+            This hash only represents the contents of files in the hook
-    # the user will actually be executing.  Specifically, GetRevisionId()
+            directory, not any other files imported or called by hooks.  Changes
-    # doesn't appear to change even if a user checks out a different version
+            to imported files can change the script behavior without affecting
-    # of the hooks repo (via git checkout) nor if a user commits their own revs.
+            the hash.
-    #
-    # NOTE: Local (non-committed) changes will not be factored into this hash.
-    # I think this is OK, since we're really only worried about warning the user
-    # about upstream changes.
-    return self._hooks_project.work_git.rev_parse(HEAD)
 
-  def _GetMustVerb(self):
+        Returns:
-    """Return 'must' if the hook is required; 'should' if not."""
+            A string representing the hash.  This will always be ASCII so that
-    if self._abort_if_user_denies:
+            it can be printed to the user easily.
-      return 'must'
+        """
-    else:
+        assert self._hooks_project, "Must have hooks to calculate their hash."
-      return 'should'
 
-  def _CheckForHookApproval(self):
+        # We will use the work_git object rather than just calling
-    """Check to see whether this hook has been approved.
+        # GetRevisionId(). That gives us a hash of the latest checked in version
+        # of the files that the user will actually be executing.  Specifically,
+        # GetRevisionId() doesn't appear to change even if a user checks out a
+        # different version of the hooks repo (via git checkout) nor if a user
+        # commits their own revs.
+        #
+        # NOTE: Local (non-committed) changes will not be factored into this
+        # hash. I think this is OK, since we're really only worried about
+        # warning the user about upstream changes.
+        return self._hooks_project.work_git.rev_parse(HEAD)
 
-    We'll accept approval of manifest URLs if they're using secure transports.
+    def _GetMustVerb(self):
-    This way the user can say they trust the manifest hoster.  For insecure
+        """Return 'must' if the hook is required; 'should' if not."""
-    hosts, we fall back to checking the hash of the hooks repo.
+        if self._abort_if_user_denies:
+            return "must"
+        else:
+            return "should"
 
-    Note that we ask permission for each individual hook even though we use
+    def _CheckForHookApproval(self):
-    the hash of all hooks when detecting changes.  We'd like the user to be
+        """Check to see whether this hook has been approved.
-    able to approve / deny each hook individually.  We only use the hash of all
-    hooks because there is no other easy way to detect changes to local imports.
 
-    Returns:
+        We'll accept approval of manifest URLs if they're using secure
-      True if this hook is approved to run; False otherwise.
+        transports. This way the user can say they trust the manifest hoster.
+        For insecure hosts, we fall back to checking the hash of the hooks repo.
 
-    Raises:
+        Note that we ask permission for each individual hook even though we use
-      HookError: Raised if the user doesn't approve and abort_if_user_denies
+        the hash of all hooks when detecting changes.  We'd like the user to be
-          was passed to the consturctor.
+        able to approve / deny each hook individually.  We only use the hash of
-    """
+        all hooks because there is no other easy way to detect changes to local
-    if self._ManifestUrlHasSecureScheme():
+        imports.
-      return self._CheckForHookApprovalManifest()
-    else:
-      return self._CheckForHookApprovalHash()
 
-  def _CheckForHookApprovalHelper(self, subkey, new_val, main_prompt,
+        Returns:
-                                  changed_prompt):
+            True if this hook is approved to run; False otherwise.
-    """Check for approval for a particular attribute and hook.
 
-    Args:
+        Raises:
-      subkey: The git config key under [repo.hooks.<hook_type>] to store the
+            HookError: Raised if the user doesn't approve and
-          last approved string.
+                abort_if_user_denies was passed to the consturctor.
-      new_val: The new value to compare against the last approved one.
+        """
-      main_prompt: Message to display to the user to ask for approval.
+        if self._ManifestUrlHasSecureScheme():
-      changed_prompt: Message explaining why we're re-asking for approval.
+            return self._CheckForHookApprovalManifest()
+        else:
+            return self._CheckForHookApprovalHash()
 
-    Returns:
+    def _CheckForHookApprovalHelper(
-      True if this hook is approved to run; False otherwise.
+        self, subkey, new_val, main_prompt, changed_prompt
+    ):
+        """Check for approval for a particular attribute and hook.
 
-    Raises:
+        Args:
-      HookError: Raised if the user doesn't approve and abort_if_user_denies
+            subkey: The git config key under [repo.hooks.<hook_type>] to store
-          was passed to the consturctor.
+                the last approved string.
-    """
+            new_val: The new value to compare against the last approved one.
-    hooks_config = self._hooks_project.config
+            main_prompt: Message to display to the user to ask for approval.
-    git_approval_key = 'repo.hooks.%s.%s' % (self._hook_type, subkey)
+            changed_prompt: Message explaining why we're re-asking for approval.
 
-    # Get the last value that the user approved for this hook; may be None.
+        Returns:
-    old_val = hooks_config.GetString(git_approval_key)
+            True if this hook is approved to run; False otherwise.
 
-    if old_val is not None:
+        Raises:
-      # User previously approved hook and asked not to be prompted again.
+            HookError: Raised if the user doesn't approve and
-      if new_val == old_val:
+                abort_if_user_denies was passed to the consturctor.
-        # Approval matched.  We're done.
+        """
-        return True
+        hooks_config = self._hooks_project.config
-      else:
+        git_approval_key = "repo.hooks.%s.%s" % (self._hook_type, subkey)
-        # Give the user a reason why we're prompting, since they last told
-        # us to "never ask again".
-        prompt = 'WARNING: %s\n\n' % (changed_prompt,)
-    else:
-      prompt = ''
 
-    # Prompt the user if we're not on a tty; on a tty we'll assume "no".
+        # Get the last value that the user approved for this hook; may be None.
-    if sys.stdout.isatty():
+        old_val = hooks_config.GetString(git_approval_key)
-      prompt += main_prompt + ' (yes/always/NO)? '
-      response = input(prompt).lower()
-      print()
 
-      # User is doing a one-time approval.
+        if old_val is not None:
-      if response in ('y', 'yes'):
+            # User previously approved hook and asked not to be prompted again.
-        return True
+            if new_val == old_val:
-      elif response == 'always':
+                # Approval matched.  We're done.
-        hooks_config.SetString(git_approval_key, new_val)
+                return True
-        return True
+            else:
+                # Give the user a reason why we're prompting, since they last
+                # told us to "never ask again".
+                prompt = "WARNING: %s\n\n" % (changed_prompt,)
+        else:
+            prompt = ""
 
-    # For anything else, we'll assume no approval.
+        # Prompt the user if we're not on a tty; on a tty we'll assume "no".
-    if self._abort_if_user_denies:
+        if sys.stdout.isatty():
-      raise HookError('You must allow the %s hook or use --no-verify.' %
+            prompt += main_prompt + " (yes/always/NO)? "
-                      self._hook_type)
+            response = input(prompt).lower()
+            print()
 
-    return False
+            # User is doing a one-time approval.
+            if response in ("y", "yes"):
+                return True
+            elif response == "always":
+                hooks_config.SetString(git_approval_key, new_val)
+                return True
 
-  def _ManifestUrlHasSecureScheme(self):
+        # For anything else, we'll assume no approval.
-    """Check if the URI for the manifest is a secure transport."""
+        if self._abort_if_user_denies:
-    secure_schemes = ('file', 'https', 'ssh', 'persistent-https', 'sso', 'rpc')
+            raise HookError(
-    parse_results = urllib.parse.urlparse(self._manifest_url)
+                "You must allow the %s hook or use --no-verify."
-    return parse_results.scheme in secure_schemes
+                % self._hook_type
+            )
 
-  def _CheckForHookApprovalManifest(self):
+        return False
-    """Check whether the user has approved this manifest host.
 
-    Returns:
+    def _ManifestUrlHasSecureScheme(self):
-      True if this hook is approved to run; False otherwise.
+        """Check if the URI for the manifest is a secure transport."""
-    """
+        secure_schemes = (
-    return self._CheckForHookApprovalHelper(
+            "file",
-        'approvedmanifest',
+            "https",
-        self._manifest_url,
+            "ssh",
-        'Run hook scripts from %s' % (self._manifest_url,),
+            "persistent-https",
-        'Manifest URL has changed since %s was allowed.' % (self._hook_type,))
+            "sso",
+            "rpc",
+        )
+        parse_results = urllib.parse.urlparse(self._manifest_url)
+        return parse_results.scheme in secure_schemes
 
-  def _CheckForHookApprovalHash(self):
+    def _CheckForHookApprovalManifest(self):
-    """Check whether the user has approved the hooks repo.
+        """Check whether the user has approved this manifest host.
 
-    Returns:
+        Returns:
-      True if this hook is approved to run; False otherwise.
+            True if this hook is approved to run; False otherwise.
-    """
+        """
-    prompt = ('Repo %s run the script:\n'
+        return self._CheckForHookApprovalHelper(
-              '  %s\n'
+            "approvedmanifest",
-              '\n'
+            self._manifest_url,
-              'Do you want to allow this script to run')
+            "Run hook scripts from %s" % (self._manifest_url,),
-    return self._CheckForHookApprovalHelper(
+            "Manifest URL has changed since %s was allowed."
-        'approvedhash',
+            % (self._hook_type,),
-        self._GetHash(),
+        )
-        prompt % (self._GetMustVerb(), self._script_fullpath),
-        'Scripts have changed since %s was allowed.' % (self._hook_type,))
 
-  @staticmethod
+    def _CheckForHookApprovalHash(self):
-  def _ExtractInterpFromShebang(data):
+        """Check whether the user has approved the hooks repo.
-    """Extract the interpreter used in the shebang.
 
-    Try to locate the interpreter the script is using (ignoring `env`).
+        Returns:
+            True if this hook is approved to run; False otherwise.
+        """
+        prompt = (
+            "Repo %s run the script:\n"
+            "  %s\n"
+            "\n"
+            "Do you want to allow this script to run"
+        )
+        return self._CheckForHookApprovalHelper(
+            "approvedhash",
+            self._GetHash(),
+            prompt % (self._GetMustVerb(), self._script_fullpath),
+            "Scripts have changed since %s was allowed." % (self._hook_type,),
+        )
 
-    Args:
+    @staticmethod
-      data: The file content of the script.
+    def _ExtractInterpFromShebang(data):
+        """Extract the interpreter used in the shebang.
 
-    Returns:
+        Try to locate the interpreter the script is using (ignoring `env`).
-      The basename of the main script interpreter, or None if a shebang is not
-      used or could not be parsed out.
-    """
-    firstline = data.splitlines()[:1]
-    if not firstline:
-      return None
 
-    # The format here can be tricky.
+        Args:
-    shebang = firstline[0].strip()
+            data: The file content of the script.
-    m = re.match(r'^#!\s*([^\s]+)(?:\s+([^\s]+))?', shebang)
-    if not m:
-      return None
 
-    # If the using `env`, find the target program.
+        Returns:
-    interp = m.group(1)
+            The basename of the main script interpreter, or None if a shebang is
-    if os.path.basename(interp) == 'env':
+            not used or could not be parsed out.
-      interp = m.group(2)
+        """
+        firstline = data.splitlines()[:1]
+        if not firstline:
+            return None
 
-    return interp
+        # The format here can be tricky.
+        shebang = firstline[0].strip()
+        m = re.match(r"^#!\s*([^\s]+)(?:\s+([^\s]+))?", shebang)
+        if not m:
+            return None
 
-  def _ExecuteHookViaReexec(self, interp, context, **kwargs):
+        # If the using `env`, find the target program.
-    """Execute the hook script through |interp|.
+        interp = m.group(1)
+        if os.path.basename(interp) == "env":
+            interp = m.group(2)
 
-    Note: Support for this feature should be dropped ~Jun 2021.
+        return interp
 
-    Args:
+    def _ExecuteHookViaReexec(self, interp, context, **kwargs):
-      interp: The Python program to run.
+        """Execute the hook script through |interp|.
-      context: Basic Python context to execute the hook inside.
-      kwargs: Arbitrary arguments to pass to the hook script.
 
-    Raises:
+        Note: Support for this feature should be dropped ~Jun 2021.
-      HookError: When the hooks failed for any reason.
+
-    """
+        Args:
-    # This logic needs to be kept in sync with _ExecuteHookViaImport below.
+            interp: The Python program to run.
-    script = """
+            context: Basic Python context to execute the hook inside.
+            kwargs: Arbitrary arguments to pass to the hook script.
+
+        Raises:
+            HookError: When the hooks failed for any reason.
+        """
+        # This logic needs to be kept in sync with _ExecuteHookViaImport below.
+        script = """
 import json, os, sys
 path = '''%(path)s'''
 kwargs = json.loads('''%(kwargs)s''')
@@ -300,210 +322,240 @@ data = open(path).read()
 exec(compile(data, path, 'exec'), context)
 context['main'](**kwargs)
 """ % {
-        'path': self._script_fullpath,
+            "path": self._script_fullpath,
-        'kwargs': json.dumps(kwargs),
+            "kwargs": json.dumps(kwargs),
-        'context': json.dumps(context),
+            "context": json.dumps(context),
-    }
+        }
 
-    # We pass the script via stdin to avoid OS argv limits.  It also makes
+        # We pass the script via stdin to avoid OS argv limits.  It also makes
-    # unhandled exception tracebacks less verbose/confusing for users.
+        # unhandled exception tracebacks less verbose/confusing for users.
-    cmd = [interp, '-c', 'import sys; exec(sys.stdin.read())']
+        cmd = [interp, "-c", "import sys; exec(sys.stdin.read())"]
-    proc = subprocess.Popen(cmd, stdin=subprocess.PIPE)
+        proc = subprocess.Popen(cmd, stdin=subprocess.PIPE)
-    proc.communicate(input=script.encode('utf-8'))
+        proc.communicate(input=script.encode("utf-8"))
-    if proc.returncode:
+        if proc.returncode:
-      raise HookError('Failed to run %s hook.' % (self._hook_type,))
+            raise HookError("Failed to run %s hook." % (self._hook_type,))
 
-  def _ExecuteHookViaImport(self, data, context, **kwargs):
+    def _ExecuteHookViaImport(self, data, context, **kwargs):
-    """Execute the hook code in |data| directly.
+        """Execute the hook code in |data| directly.
 
-    Args:
+        Args:
-      data: The code of the hook to execute.
+            data: The code of the hook to execute.
-      context: Basic Python context to execute the hook inside.
+            context: Basic Python context to execute the hook inside.
-      kwargs: Arbitrary arguments to pass to the hook script.
+            kwargs: Arbitrary arguments to pass to the hook script.
 
-    Raises:
+        Raises:
-      HookError: When the hooks failed for any reason.
+            HookError: When the hooks failed for any reason.
-    """
+        """
-    # Exec, storing global context in the context dict.  We catch exceptions
+        # Exec, storing global context in the context dict.  We catch exceptions
-    # and convert to a HookError w/ just the failing traceback.
+        # and convert to a HookError w/ just the failing traceback.
-    try:
-      exec(compile(data, self._script_fullpath, 'exec'), context)
-    except Exception:
-      raise HookError('%s\nFailed to import %s hook; see traceback above.' %
-                      (traceback.format_exc(), self._hook_type))
-
-    # Running the script should have defined a main() function.
-    if 'main' not in context:
-      raise HookError('Missing main() in: "%s"' % self._script_fullpath)
-
-    # Call the main function in the hook.  If the hook should cause the
-    # build to fail, it will raise an Exception.  We'll catch that convert
-    # to a HookError w/ just the failing traceback.
-    try:
-      context['main'](**kwargs)
-    except Exception:
-      raise HookError('%s\nFailed to run main() for %s hook; see traceback '
-                      'above.' % (traceback.format_exc(), self._hook_type))
-
-  def _ExecuteHook(self, **kwargs):
-    """Actually execute the given hook.
-
-    This will run the hook's 'main' function in our python interpreter.
-
-    Args:
-      kwargs: Keyword arguments to pass to the hook.  These are often specific
-          to the hook type.  For instance, pre-upload hooks will contain
-          a project_list.
-    """
-    # Keep sys.path and CWD stashed away so that we can always restore them
-    # upon function exit.
-    orig_path = os.getcwd()
-    orig_syspath = sys.path
-
-    try:
-      # Always run hooks with CWD as topdir.
-      os.chdir(self._repo_topdir)
-
-      # Put the hook dir as the first item of sys.path so hooks can do
-      # relative imports.  We want to replace the repo dir as [0] so
-      # hooks can't import repo files.
-      sys.path = [os.path.dirname(self._script_fullpath)] + sys.path[1:]
-
-      # Initial global context for the hook to run within.
-      context = {'__file__': self._script_fullpath}
-
-      # Add 'hook_should_take_kwargs' to the arguments to be passed to main.
-      # We don't actually want hooks to define their main with this argument--
-      # it's there to remind them that their hook should always take **kwargs.
-      # For instance, a pre-upload hook should be defined like:
-      #   def main(project_list, **kwargs):
-      #
-      # This allows us to later expand the API without breaking old hooks.
-      kwargs = kwargs.copy()
-      kwargs['hook_should_take_kwargs'] = True
-
-      # See what version of python the hook has been written against.
-      data = open(self._script_fullpath).read()
-      interp = self._ExtractInterpFromShebang(data)
-      reexec = False
-      if interp:
-        prog = os.path.basename(interp)
-        if prog.startswith('python2') and sys.version_info.major != 2:
-          reexec = True
-        elif prog.startswith('python3') and sys.version_info.major == 2:
-          reexec = True
-
-      # Attempt to execute the hooks through the requested version of Python.
-      if reexec:
         try:
-          self._ExecuteHookViaReexec(interp, context, **kwargs)
+            exec(compile(data, self._script_fullpath, "exec"), context)
-        except OSError as e:
+        except Exception:
-          if e.errno == errno.ENOENT:
+            raise HookError(
-            # We couldn't find the interpreter, so fallback to importing.
+                "%s\nFailed to import %s hook; see traceback above."
+                % (traceback.format_exc(), self._hook_type)
+            )
+
+        # Running the script should have defined a main() function.
+        if "main" not in context:
+            raise HookError('Missing main() in: "%s"' % self._script_fullpath)
+
+        # Call the main function in the hook.  If the hook should cause the
+        # build to fail, it will raise an Exception.  We'll catch that convert
+        # to a HookError w/ just the failing traceback.
+        try:
+            context["main"](**kwargs)
+        except Exception:
+            raise HookError(
+                "%s\nFailed to run main() for %s hook; see traceback "
+                "above." % (traceback.format_exc(), self._hook_type)
+            )
+
+    def _ExecuteHook(self, **kwargs):
+        """Actually execute the given hook.
+
+        This will run the hook's 'main' function in our python interpreter.
+
+        Args:
+            kwargs: Keyword arguments to pass to the hook.  These are often
+                specific to the hook type.  For instance, pre-upload hooks will
+                contain a project_list.
+        """
+        # Keep sys.path and CWD stashed away so that we can always restore them
+        # upon function exit.
+        orig_path = os.getcwd()
+        orig_syspath = sys.path
+
+        try:
+            # Always run hooks with CWD as topdir.
+            os.chdir(self._repo_topdir)
+
+            # Put the hook dir as the first item of sys.path so hooks can do
+            # relative imports.  We want to replace the repo dir as [0] so
+            # hooks can't import repo files.
+            sys.path = [os.path.dirname(self._script_fullpath)] + sys.path[1:]
+
+            # Initial global context for the hook to run within.
+            context = {"__file__": self._script_fullpath}
+
+            # Add 'hook_should_take_kwargs' to the arguments to be passed to
+            # main. We don't actually want hooks to define their main with this
+            # argument--it's there to remind them that their hook should always
+            # take **kwargs.
+            # For instance, a pre-upload hook should be defined like:
+            #   def main(project_list, **kwargs):
+            #
+            # This allows us to later expand the API without breaking old hooks.
+            kwargs = kwargs.copy()
+            kwargs["hook_should_take_kwargs"] = True
+
+            # See what version of python the hook has been written against.
+            data = open(self._script_fullpath).read()
+            interp = self._ExtractInterpFromShebang(data)
             reexec = False
-          else:
+            if interp:
-            raise
+                prog = os.path.basename(interp)
+                if prog.startswith("python2") and sys.version_info.major != 2:
+                    reexec = True
+                elif prog.startswith("python3") and sys.version_info.major == 2:
+                    reexec = True
 
-      # Run the hook by importing directly.
+            # Attempt to execute the hooks through the requested version of
-      if not reexec:
+            # Python.
-        self._ExecuteHookViaImport(data, context, **kwargs)
+            if reexec:
-    finally:
+                try:
-      # Restore sys.path and CWD.
+                    self._ExecuteHookViaReexec(interp, context, **kwargs)
-      sys.path = orig_syspath
+                except OSError as e:
-      os.chdir(orig_path)
+                    if e.errno == errno.ENOENT:
+                        # We couldn't find the interpreter, so fallback to
+                        # importing.
+                        reexec = False
+                    else:
+                        raise
 
-  def _CheckHook(self):
+            # Run the hook by importing directly.
-    # Bail with a nice error if we can't find the hook.
+            if not reexec:
-    if not os.path.isfile(self._script_fullpath):
+                self._ExecuteHookViaImport(data, context, **kwargs)
-      raise HookError('Couldn\'t find repo hook: %s' % self._script_fullpath)
+        finally:
+            # Restore sys.path and CWD.
+            sys.path = orig_syspath
+            os.chdir(orig_path)
 
-  def Run(self, **kwargs):
+    def _CheckHook(self):
-    """Run the hook.
+        # Bail with a nice error if we can't find the hook.
+        if not os.path.isfile(self._script_fullpath):
+            raise HookError(
+                "Couldn't find repo hook: %s" % self._script_fullpath
+            )
 
-    If the hook doesn't exist (because there is no hooks project or because
+    def Run(self, **kwargs):
-    this particular hook is not enabled), this is a no-op.
+        """Run the hook.
 
-    Args:
+        If the hook doesn't exist (because there is no hooks project or because
-      user_allows_all_hooks: If True, we will never prompt about running the
+        this particular hook is not enabled), this is a no-op.
-          hook--we'll just assume it's OK to run it.
-      kwargs: Keyword arguments to pass to the hook.  These are often specific
-          to the hook type.  For instance, pre-upload hooks will contain
-          a project_list.
 
-    Returns:
+        Args:
-      True: On success or ignore hooks by user-request
+            user_allows_all_hooks: If True, we will never prompt about running
-      False: The hook failed. The caller should respond with aborting the action.
+                the hook--we'll just assume it's OK to run it.
-        Some examples in which False is returned:
+            kwargs: Keyword arguments to pass to the hook.  These are often
-        * Finding the hook failed while it was enabled, or
+                specific to the hook type.  For instance, pre-upload hooks will
-        * the user declined to run a required hook (from _CheckForHookApproval)
+                contain a project_list.
-        In all these cases the user did not pass the proper arguments to
-        ignore the result through the option combinations as listed in
-        AddHookOptionGroup().
-    """
-    # Do not do anything in case bypass_hooks is set, or
-    # no-op if there is no hooks project or if hook is disabled.
-    if (self._bypass_hooks or
-        not self._hooks_project or
-        self._hook_type not in self._hooks_project.enabled_repo_hooks):
-      return True
 
-    passed = True
+        Returns:
-    try:
+            True: On success or ignore hooks by user-request
-      self._CheckHook()
+            False: The hook failed. The caller should respond with aborting the
+                action. Some examples in which False is returned:
+                * Finding the hook failed while it was enabled, or
+                * the user declined to run a required hook (from
+                    _CheckForHookApproval)
+                In all these cases the user did not pass the proper arguments to
+                ignore the result through the option combinations as listed in
+                AddHookOptionGroup().
+        """
+        # Do not do anything in case bypass_hooks is set, or
+        # no-op if there is no hooks project or if hook is disabled.
+        if (
+            self._bypass_hooks
+            or not self._hooks_project
+            or self._hook_type not in self._hooks_project.enabled_repo_hooks
+        ):
+            return True
 
-      # Make sure the user is OK with running the hook.
+        passed = True
-      if self._allow_all_hooks or self._CheckForHookApproval():
+        try:
-        # Run the hook with the same version of python we're using.
+            self._CheckHook()
-        self._ExecuteHook(**kwargs)
-    except SystemExit as e:
-      passed = False
-      print('ERROR: %s hooks exited with exit code: %s' % (self._hook_type, str(e)),
-            file=sys.stderr)
-    except HookError as e:
-      passed = False
-      print('ERROR: %s' % str(e), file=sys.stderr)
 
-    if not passed and self._ignore_hooks:
+            # Make sure the user is OK with running the hook.
-      print('\nWARNING: %s hooks failed, but continuing anyways.' % self._hook_type,
+            if self._allow_all_hooks or self._CheckForHookApproval():
-            file=sys.stderr)
+                # Run the hook with the same version of python we're using.
-      passed = True
+                self._ExecuteHook(**kwargs)
+        except SystemExit as e:
+            passed = False
+            print(
+                "ERROR: %s hooks exited with exit code: %s"
+                % (self._hook_type, str(e)),
+                file=sys.stderr,
+            )
+        except HookError as e:
+            passed = False
+            print("ERROR: %s" % str(e), file=sys.stderr)
 
-    return passed
+        if not passed and self._ignore_hooks:
+            print(
+                "\nWARNING: %s hooks failed, but continuing anyways."
+                % self._hook_type,
+                file=sys.stderr,
+            )
+            passed = True
 
-  @classmethod
+        return passed
-  def FromSubcmd(cls, manifest, opt, *args, **kwargs):
-    """Method to construct the repo hook class
 
-    Args:
+    @classmethod
-      manifest: The current active manifest for this command from which we
+    def FromSubcmd(cls, manifest, opt, *args, **kwargs):
-          extract a couple of fields.
+        """Method to construct the repo hook class
-      opt: Contains the commandline options for the action of this hook.
-          It should contain the options added by AddHookOptionGroup() in which
-          we are interested in RepoHook execution.
-    """
-    for key in ('bypass_hooks', 'allow_all_hooks', 'ignore_hooks'):
-      kwargs.setdefault(key, getattr(opt, key))
-    kwargs.update({
-        'hooks_project': manifest.repo_hooks_project,
-        'repo_topdir': manifest.topdir,
-        'manifest_url': manifest.manifestProject.GetRemote('origin').url,
-    })
-    return cls(*args, **kwargs)
 
-  @staticmethod
+        Args:
-  def AddOptionGroup(parser, name):
+            manifest: The current active manifest for this command from which we
-    """Help options relating to the various hooks."""
+                extract a couple of fields.
+            opt: Contains the commandline options for the action of this hook.
+                It should contain the options added by AddHookOptionGroup() in
+                which we are interested in RepoHook execution.
+        """
+        for key in ("bypass_hooks", "allow_all_hooks", "ignore_hooks"):
+            kwargs.setdefault(key, getattr(opt, key))
+        kwargs.update(
+            {
+                "hooks_project": manifest.repo_hooks_project,
+                "repo_topdir": manifest.topdir,
+                "manifest_url": manifest.manifestProject.GetRemote(
+                    "origin"
+                ).url,
+            }
+        )
+        return cls(*args, **kwargs)
 
-    # Note that verify and no-verify are NOT opposites of each other, which
+    @staticmethod
-    # is why they store to different locations. We are using them to match
+    def AddOptionGroup(parser, name):
-    # 'git commit' syntax.
+        """Help options relating to the various hooks."""
-    group = parser.add_option_group(name + ' hooks')
+
-    group.add_option('--no-verify',
+        # Note that verify and no-verify are NOT opposites of each other, which
-                     dest='bypass_hooks', action='store_true',
+        # is why they store to different locations. We are using them to match
-                     help='Do not run the %s hook.' % name)
+        # 'git commit' syntax.
-    group.add_option('--verify',
+        group = parser.add_option_group(name + " hooks")
-                     dest='allow_all_hooks', action='store_true',
+        group.add_option(
-                     help='Run the %s hook without prompting.' % name)
+            "--no-verify",
-    group.add_option('--ignore-hooks',
+            dest="bypass_hooks",
-                     action='store_true',
+            action="store_true",
-                     help='Do not abort if %s hooks fail.' % name)
+            help="Do not run the %s hook." % name,
+        )
+        group.add_option(
+            "--verify",
+            dest="allow_all_hooks",
+            action="store_true",
+            help="Run the %s hook without prompting." % name,
+        )
+        group.add_option(
+            "--ignore-hooks",
+            action="store_true",
+            help="Do not abort if %s hooks fail." % name,
+        )

man/repo-smartsync.1

@@ -1,5 +1,5 @@
 .\" DO NOT MODIFY THIS FILE!  It was generated by help2man.
-.TH REPO "1" "August 2022" "repo smartsync" "Repo Manual"
+.TH REPO "1" "November 2022" "repo smartsync" "Repo Manual"
 .SH NAME
 repo \- repo smartsync - manual page for repo smartsync
 .SH SYNOPSIS
@@ -105,6 +105,13 @@ delete refs that no longer exist on the remote
 .TP
 \fB\-\-no\-prune\fR
 do not delete refs that no longer exist on the remote
+.TP
+\fB\-\-auto\-gc\fR
+run garbage collection on all synced projects
+.TP
+\fB\-\-no\-auto\-gc\fR
+do not run garbage collection on any projects
+(default)
 .SS Logging options:
 .TP
 \fB\-v\fR, \fB\-\-verbose\fR

man/repo-sync.1

@@ -1,5 +1,5 @@
 .\" DO NOT MODIFY THIS FILE!  It was generated by help2man.
-.TH REPO "1" "August 2022" "repo sync" "Repo Manual"
+.TH REPO "1" "November 2022" "repo sync" "Repo Manual"
 .SH NAME
 repo \- repo sync - manual page for repo sync
 .SH SYNOPSIS
@@ -106,6 +106,13 @@ delete refs that no longer exist on the remote
 \fB\-\-no\-prune\fR
 do not delete refs that no longer exist on the remote
 .TP
+\fB\-\-auto\-gc\fR
+run garbage collection on all synced projects
+.TP
+\fB\-\-no\-auto\-gc\fR
+do not run garbage collection on any projects
+(default)
+.TP
 \fB\-s\fR, \fB\-\-smart\-sync\fR
 smart sync using manifest from the latest known good
 build
@@ -200,6 +207,9 @@ to a sha1 revision if the sha1 revision does not already exist locally.
 The \fB\-\-prune\fR option can be used to remove any refs that no longer exist on the
 remote.
 .PP
+The \fB\-\-auto\-gc\fR option can be used to trigger garbage collection on all projects.
+By default, repo does not run garbage collection.
+.PP
 SSH Connections
 .PP
 If at least one project remote URL uses an SSH connection (ssh://, git+ssh://,

man/repo.1

@@ -1,5 +1,5 @@
 .\" DO NOT MODIFY THIS FILE!  It was generated by help2man.
-.TH REPO "1" "July 2022" "repo" "Repo Manual"
+.TH REPO "1" "June 2023" "repo" "Repo Manual"
 .SH NAME
 repo \- repository management tool built on top of git
 .SH SYNOPSIS
@@ -25,6 +25,10 @@ control color usage: auto, always, never
 \fB\-\-trace\fR
 trace git command execution (REPO_TRACE=1)
 .TP
+\fB\-\-trace\-to\-stderr\fR
+trace outputs go to stderr in addition to
+\&.repo/TRACE_FILE
+.TP
 \fB\-\-trace\-python\fR
 trace python command execution
 .TP
@@ -133,4 +137,4 @@ version
 Display the version of repo
 .PP
 See 'repo help <command>' for more information on a specific command.
-Bug reports: https://bugs.chromium.org/p/gerrit/issues/entry?template=Repo+tool+issue
+Bug reports: https://issues.gerritcodereview.com/issues/new?component=1370071

pager.py

@@ -19,6 +19,7 @@ import sys
 
 import platform_utils
 
+
 active = False
 pager_process = None
 old_stdout = None
@@ -26,102 +27,104 @@ old_stderr = None
 
 
 def RunPager(globalConfig):
-  if not os.isatty(0) or not os.isatty(1):
+    if not os.isatty(0) or not os.isatty(1):
-    return
+        return
-  pager = _SelectPager(globalConfig)
+    pager = _SelectPager(globalConfig)
-  if pager == '' or pager == 'cat':
+    if pager == "" or pager == "cat":
-    return
+        return
 
-  if platform_utils.isWindows():
+    if platform_utils.isWindows():
-    _PipePager(pager)
+        _PipePager(pager)
-  else:
+    else:
-    _ForkPager(pager)
+        _ForkPager(pager)
 
 
 def TerminatePager():
-  global pager_process, old_stdout, old_stderr
+    global pager_process, old_stdout, old_stderr
-  if pager_process:
+    if pager_process:
-    sys.stdout.flush()
+        sys.stdout.flush()
-    sys.stderr.flush()
+        sys.stderr.flush()
-    pager_process.stdin.close()
+        pager_process.stdin.close()
-    pager_process.wait()
+        pager_process.wait()
-    pager_process = None
+        pager_process = None
-    # Restore initial stdout/err in case there is more output in this process
+        # Restore initial stdout/err in case there is more output in this
-    # after shutting down the pager process
+        # process after shutting down the pager process.
-    sys.stdout = old_stdout
+        sys.stdout = old_stdout
-    sys.stderr = old_stderr
+        sys.stderr = old_stderr
 
 
 def _PipePager(pager):
-  global pager_process, old_stdout, old_stderr
+    global pager_process, old_stdout, old_stderr
-  assert pager_process is None, "Only one active pager process at a time"
+    assert pager_process is None, "Only one active pager process at a time"
-  # Create pager process, piping stdout/err into its stdin
+    # Create pager process, piping stdout/err into its stdin.
-  try:
+    try:
-    pager_process = subprocess.Popen([pager], stdin=subprocess.PIPE, stdout=sys.stdout,
+        pager_process = subprocess.Popen(
-                                     stderr=sys.stderr)
+            [pager], stdin=subprocess.PIPE, stdout=sys.stdout, stderr=sys.stderr
-  except FileNotFoundError:
+        )
-    sys.exit(f'fatal: cannot start pager "{pager}"')
+    except FileNotFoundError:
-  old_stdout = sys.stdout
+        sys.exit(f'fatal: cannot start pager "{pager}"')
-  old_stderr = sys.stderr
+    old_stdout = sys.stdout
-  sys.stdout = pager_process.stdin
+    old_stderr = sys.stderr
-  sys.stderr = pager_process.stdin
+    sys.stdout = pager_process.stdin
+    sys.stderr = pager_process.stdin
 
 
 def _ForkPager(pager):
-  global active
+    global active
-  # This process turns into the pager; a child it forks will
+    # This process turns into the pager; a child it forks will
-  # do the real processing and output back to the pager. This
+    # do the real processing and output back to the pager. This
-  # is necessary to keep the pager in control of the tty.
+    # is necessary to keep the pager in control of the tty.
-  #
+    try:
-  try:
+        r, w = os.pipe()
-    r, w = os.pipe()
+        pid = os.fork()
-    pid = os.fork()
+        if not pid:
-    if not pid:
+            os.dup2(w, 1)
-      os.dup2(w, 1)
+            os.dup2(w, 2)
-      os.dup2(w, 2)
+            os.close(r)
-      os.close(r)
+            os.close(w)
-      os.close(w)
+            active = True
-      active = True
+            return
-      return
 
-    os.dup2(r, 0)
+        os.dup2(r, 0)
-    os.close(r)
+        os.close(r)
-    os.close(w)
+        os.close(w)
 
-    _BecomePager(pager)
+        _BecomePager(pager)
-  except Exception:
+    except Exception:
-    print("fatal: cannot start pager '%s'" % pager, file=sys.stderr)
+        print("fatal: cannot start pager '%s'" % pager, file=sys.stderr)
-    sys.exit(255)
+        sys.exit(255)
 
 
 def _SelectPager(globalConfig):
-  try:
+    try:
-    return os.environ['GIT_PAGER']
+        return os.environ["GIT_PAGER"]
-  except KeyError:
+    except KeyError:
-    pass
+        pass
 
-  pager = globalConfig.GetString('core.pager')
+    pager = globalConfig.GetString("core.pager")
-  if pager:
+    if pager:
-    return pager
+        return pager
 
-  try:
+    try:
-    return os.environ['PAGER']
+        return os.environ["PAGER"]
-  except KeyError:
+    except KeyError:
-    pass
+        pass
 
-  return 'less'
+    return "less"
 
 
 def _BecomePager(pager):
-  # Delaying execution of the pager until we have output
+    # Delaying execution of the pager until we have output
-  # ready works around a long-standing bug in popularly
+    # ready works around a long-standing bug in popularly
-  # available versions of 'less', a better 'more'.
+    # available versions of 'less', a better 'more'.
-  #
+    _a, _b, _c = select.select([0], [], [0])
-  _a, _b, _c = select.select([0], [], [0])
 
-  os.environ['LESS'] = 'FRSX'
+    # This matches the behavior of git, which sets $LESS to `FRX` if it is not
+    # set. See:
+    # https://git-scm.com/docs/git-config#Documentation/git-config.txt-corepager
+    os.environ.setdefault("LESS", "FRX")
 
-  try:
+    try:
-    os.execvp(pager, [pager])
+        os.execvp(pager, [pager])
-  except OSError:
+    except OSError:
-    os.execv('/bin/sh', ['sh', '-c', pager])
+        os.execv("/bin/sh", ["sh", "-c", pager])

platform_utils.py

@@ -20,246 +20,264 @@ import stat
 
 
 def isWindows():
-  """ Returns True when running with the native port of Python for Windows,
+    """Returns True when running with the native port of Python for Windows,
-  False when running on any other platform (including the Cygwin port of
+    False when running on any other platform (including the Cygwin port of
-  Python).
+    Python).
-  """
+    """
-  # Note: The cygwin port of Python returns "CYGWIN_NT_xxx"
+    # Note: The cygwin port of Python returns "CYGWIN_NT_xxx"
-  return platform.system() == "Windows"
+    return platform.system() == "Windows"
 
 
 def symlink(source, link_name):
-  """Creates a symbolic link pointing to source named link_name.
+    """Creates a symbolic link pointing to source named link_name.
-  Note: On Windows, source must exist on disk, as the implementation needs
+
-  to know whether to create a "File" or a "Directory" symbolic link.
+    Note: On Windows, source must exist on disk, as the implementation needs
-  """
+    to know whether to create a "File" or a "Directory" symbolic link.
-  if isWindows():
+    """
-    import platform_utils_win32
+    if isWindows():
-    source = _validate_winpath(source)
+        import platform_utils_win32
-    link_name = _validate_winpath(link_name)
+
-    target = os.path.join(os.path.dirname(link_name), source)
+        source = _validate_winpath(source)
-    if isdir(target):
+        link_name = _validate_winpath(link_name)
-      platform_utils_win32.create_dirsymlink(_makelongpath(source), link_name)
+        target = os.path.join(os.path.dirname(link_name), source)
+        if isdir(target):
+            platform_utils_win32.create_dirsymlink(
+                _makelongpath(source), link_name
+            )
+        else:
+            platform_utils_win32.create_filesymlink(
+                _makelongpath(source), link_name
+            )
     else:
-      platform_utils_win32.create_filesymlink(_makelongpath(source), link_name)
+        return os.symlink(source, link_name)
-  else:
-    return os.symlink(source, link_name)
 
 
 def _validate_winpath(path):
-  path = os.path.normpath(path)
+    path = os.path.normpath(path)
-  if _winpath_is_valid(path):
+    if _winpath_is_valid(path):
-    return path
+        return path
-  raise ValueError("Path \"%s\" must be a relative path or an absolute "
+    raise ValueError(
-                   "path starting with a drive letter".format(path))
+        'Path "{}" must be a relative path or an absolute '
+        "path starting with a drive letter".format(path)
+    )
 
 
 def _winpath_is_valid(path):
-  """Windows only: returns True if path is relative (e.g. ".\\foo") or is
+    """Windows only: returns True if path is relative (e.g. ".\\foo") or is
-  absolute including a drive letter (e.g. "c:\\foo"). Returns False if path
+    absolute including a drive letter (e.g. "c:\\foo"). Returns False if path
-  is ambiguous (e.g. "x:foo" or "\\foo").
+    is ambiguous (e.g. "x:foo" or "\\foo").
-  """
+    """
-  assert isWindows()
+    assert isWindows()
-  path = os.path.normpath(path)
+    path = os.path.normpath(path)
-  drive, tail = os.path.splitdrive(path)
+    drive, tail = os.path.splitdrive(path)
-  if tail:
+    if tail:
-    if not drive:
+        if not drive:
-      return tail[0] != os.sep  # "\\foo" is invalid
+            return tail[0] != os.sep  # "\\foo" is invalid
+        else:
+            return tail[0] == os.sep  # "x:foo" is invalid
     else:
-      return tail[0] == os.sep  # "x:foo" is invalid
+        return not drive  # "x:" is invalid
-  else:
-    return not drive  # "x:" is invalid
 
 
 def _makelongpath(path):
-  """Return the input path normalized to support the Windows long path syntax
+    """Return the input path normalized to support the Windows long path syntax
-  ("\\\\?\\" prefix) if needed, i.e. if the input path is longer than the
+    ("\\\\?\\" prefix) if needed, i.e. if the input path is longer than the
-  MAX_PATH limit.
+    MAX_PATH limit.
-  """
+    """
-  if isWindows():
+    if isWindows():
-    # Note: MAX_PATH is 260, but, for directories, the maximum value is actually 246.
+        # Note: MAX_PATH is 260, but, for directories, the maximum value is
-    if len(path) < 246:
+        # actually 246.
-      return path
+        if len(path) < 246:
-    if path.startswith(u"\\\\?\\"):
+            return path
-      return path
+        if path.startswith("\\\\?\\"):
-    if not os.path.isabs(path):
+            return path
-      return path
+        if not os.path.isabs(path):
-    # Append prefix and ensure unicode so that the special longpath syntax
+            return path
-    # is supported by underlying Win32 API calls
+        # Append prefix and ensure unicode so that the special longpath syntax
-    return u"\\\\?\\" + os.path.normpath(path)
+        # is supported by underlying Win32 API calls
-  else:
+        return "\\\\?\\" + os.path.normpath(path)
-    return path
+    else:
+        return path
 
 
 def rmtree(path, ignore_errors=False):
-  """shutil.rmtree(path) wrapper with support for long paths on Windows.
+    """shutil.rmtree(path) wrapper with support for long paths on Windows.
 
-  Availability: Unix, Windows."""
+    Availability: Unix, Windows.
-  onerror = None
+    """
-  if isWindows():
+    onerror = None
-    path = _makelongpath(path)
+    if isWindows():
-    onerror = handle_rmtree_error
+        path = _makelongpath(path)
-  shutil.rmtree(path, ignore_errors=ignore_errors, onerror=onerror)
+        onerror = handle_rmtree_error
+    shutil.rmtree(path, ignore_errors=ignore_errors, onerror=onerror)
 
 
 def handle_rmtree_error(function, path, excinfo):
-  # Allow deleting read-only files
+    # Allow deleting read-only files.
-  os.chmod(path, stat.S_IWRITE)
+    os.chmod(path, stat.S_IWRITE)
-  function(path)
+    function(path)
 
 
 def rename(src, dst):
-  """os.rename(src, dst) wrapper with support for long paths on Windows.
+    """os.rename(src, dst) wrapper with support for long paths on Windows.
 
-  Availability: Unix, Windows."""
+    Availability: Unix, Windows.
-  if isWindows():
+    """
-    # On Windows, rename fails if destination exists, see
+    if isWindows():
-    # https://docs.python.org/2/library/os.html#os.rename
+        # On Windows, rename fails if destination exists, see
-    try:
+        # https://docs.python.org/2/library/os.html#os.rename
-      os.rename(_makelongpath(src), _makelongpath(dst))
+        try:
-    except OSError as e:
+            os.rename(_makelongpath(src), _makelongpath(dst))
-      if e.errno == errno.EEXIST:
+        except OSError as e:
-        os.remove(_makelongpath(dst))
+            if e.errno == errno.EEXIST:
-        os.rename(_makelongpath(src), _makelongpath(dst))
+                os.remove(_makelongpath(dst))
-      else:
+                os.rename(_makelongpath(src), _makelongpath(dst))
-        raise
+            else:
-  else:
+                raise
-    shutil.move(src, dst)
+    else:
+        shutil.move(src, dst)
 
 
 def remove(path, missing_ok=False):
-  """Remove (delete) the file path. This is a replacement for os.remove that
+    """Remove (delete) the file path. This is a replacement for os.remove that
-  allows deleting read-only files on Windows, with support for long paths and
+    allows deleting read-only files on Windows, with support for long paths and
-  for deleting directory symbolic links.
+    for deleting directory symbolic links.
 
-  Availability: Unix, Windows."""
+    Availability: Unix, Windows.
-  longpath = _makelongpath(path) if isWindows() else path
+    """
-  try:
+    longpath = _makelongpath(path) if isWindows() else path
-    os.remove(longpath)
+    try:
-  except OSError as e:
-    if e.errno == errno.EACCES:
-      os.chmod(longpath, stat.S_IWRITE)
-      # Directory symbolic links must be deleted with 'rmdir'.
-      if islink(longpath) and isdir(longpath):
-        os.rmdir(longpath)
-      else:
         os.remove(longpath)
-    elif missing_ok and e.errno == errno.ENOENT:
+    except OSError as e:
-      pass
+        if e.errno == errno.EACCES:
-    else:
+            os.chmod(longpath, stat.S_IWRITE)
-      raise
+            # Directory symbolic links must be deleted with 'rmdir'.
+            if islink(longpath) and isdir(longpath):
+                os.rmdir(longpath)
+            else:
+                os.remove(longpath)
+        elif missing_ok and e.errno == errno.ENOENT:
+            pass
+        else:
+            raise
 
 
 def walk(top, topdown=True, onerror=None, followlinks=False):
-  """os.walk(path) wrapper with support for long paths on Windows.
+    """os.walk(path) wrapper with support for long paths on Windows.
 
-  Availability: Windows, Unix.
+    Availability: Windows, Unix.
-  """
+    """
-  if isWindows():
+    if isWindows():
-    return _walk_windows_impl(top, topdown, onerror, followlinks)
+        return _walk_windows_impl(top, topdown, onerror, followlinks)
-  else:
+    else:
-    return os.walk(top, topdown, onerror, followlinks)
+        return os.walk(top, topdown, onerror, followlinks)
 
 
 def _walk_windows_impl(top, topdown, onerror, followlinks):
-  try:
+    try:
-    names = listdir(top)
+        names = listdir(top)
-  except Exception as err:
+    except Exception as err:
-    if onerror is not None:
+        if onerror is not None:
-      onerror(err)
+            onerror(err)
-    return
+        return
 
-  dirs, nondirs = [], []
+    dirs, nondirs = [], []
-  for name in names:
+    for name in names:
-    if isdir(os.path.join(top, name)):
+        if isdir(os.path.join(top, name)):
-      dirs.append(name)
+            dirs.append(name)
-    else:
+        else:
-      nondirs.append(name)
+            nondirs.append(name)
 
-  if topdown:
+    if topdown:
-    yield top, dirs, nondirs
+        yield top, dirs, nondirs
-  for name in dirs:
+    for name in dirs:
-    new_path = os.path.join(top, name)
+        new_path = os.path.join(top, name)
-    if followlinks or not islink(new_path):
+        if followlinks or not islink(new_path):
-      for x in _walk_windows_impl(new_path, topdown, onerror, followlinks):
+            for x in _walk_windows_impl(
-        yield x
+                new_path, topdown, onerror, followlinks
-  if not topdown:
+            ):
-    yield top, dirs, nondirs
+                yield x
+    if not topdown:
+        yield top, dirs, nondirs
 
 
 def listdir(path):
-  """os.listdir(path) wrapper with support for long paths on Windows.
+    """os.listdir(path) wrapper with support for long paths on Windows.
 
-  Availability: Windows, Unix.
+    Availability: Windows, Unix.
-  """
+    """
-  return os.listdir(_makelongpath(path))
+    return os.listdir(_makelongpath(path))
 
 
 def rmdir(path):
-  """os.rmdir(path) wrapper with support for long paths on Windows.
+    """os.rmdir(path) wrapper with support for long paths on Windows.
 
-  Availability: Windows, Unix.
+    Availability: Windows, Unix.
-  """
+    """
-  os.rmdir(_makelongpath(path))
+    os.rmdir(_makelongpath(path))
 
 
 def isdir(path):
-  """os.path.isdir(path) wrapper with support for long paths on Windows.
+    """os.path.isdir(path) wrapper with support for long paths on Windows.
 
-  Availability: Windows, Unix.
+    Availability: Windows, Unix.
-  """
+    """
-  return os.path.isdir(_makelongpath(path))
+    return os.path.isdir(_makelongpath(path))
 
 
 def islink(path):
-  """os.path.islink(path) wrapper with support for long paths on Windows.
+    """os.path.islink(path) wrapper with support for long paths on Windows.
 
-  Availability: Windows, Unix.
+    Availability: Windows, Unix.
-  """
+    """
-  if isWindows():
+    if isWindows():
-    import platform_utils_win32
+        import platform_utils_win32
-    return platform_utils_win32.islink(_makelongpath(path))
+
-  else:
+        return platform_utils_win32.islink(_makelongpath(path))
-    return os.path.islink(path)
+    else:
+        return os.path.islink(path)
 
 
 def readlink(path):
-  """Return a string representing the path to which the symbolic link
+    """Return a string representing the path to which the symbolic link
-  points. The result may be either an absolute or relative pathname;
+    points. The result may be either an absolute or relative pathname;
-  if it is relative, it may be converted to an absolute pathname using
+    if it is relative, it may be converted to an absolute pathname using
-  os.path.join(os.path.dirname(path), result).
+    os.path.join(os.path.dirname(path), result).
 
-  Availability: Windows, Unix.
+    Availability: Windows, Unix.
-  """
+    """
-  if isWindows():
+    if isWindows():
-    import platform_utils_win32
+        import platform_utils_win32
-    return platform_utils_win32.readlink(_makelongpath(path))
+
-  else:
+        return platform_utils_win32.readlink(_makelongpath(path))
-    return os.readlink(path)
+    else:
+        return os.readlink(path)
 
 
 def realpath(path):
-  """Return the canonical path of the specified filename, eliminating
+    """Return the canonical path of the specified filename, eliminating
-  any symbolic links encountered in the path.
+    any symbolic links encountered in the path.
 
-  Availability: Windows, Unix.
+    Availability: Windows, Unix.
-  """
+    """
-  if isWindows():
+    if isWindows():
-    current_path = os.path.abspath(path)
+        current_path = os.path.abspath(path)
-    path_tail = []
+        path_tail = []
-    for c in range(0, 100):  # Avoid cycles
+        for c in range(0, 100):  # Avoid cycles
-      if islink(current_path):
+            if islink(current_path):
-        target = readlink(current_path)
+                target = readlink(current_path)
-        current_path = os.path.join(os.path.dirname(current_path), target)
+                current_path = os.path.join(
-      else:
+                    os.path.dirname(current_path), target
-        basename = os.path.basename(current_path)
+                )
-        if basename == '':
+            else:
-          path_tail.append(current_path)
+                basename = os.path.basename(current_path)
-          break
+                if basename == "":
-        path_tail.append(basename)
+                    path_tail.append(current_path)
-        current_path = os.path.dirname(current_path)
+                    break
-    path_tail.reverse()
+                path_tail.append(basename)
-    result = os.path.normpath(os.path.join(*path_tail))
+                current_path = os.path.dirname(current_path)
-    return result
+        path_tail.reverse()
-  else:
+        result = os.path.normpath(os.path.join(*path_tail))
-    return os.path.realpath(path)
+        return result
+    else:
+        return os.path.realpath(path)

platform_utils_win32.py

@@ -12,14 +12,30 @@
 # See the License for the specific language governing permissions and
 # limitations under the License.
 
+from ctypes import addressof
+from ctypes import byref
+from ctypes import c_buffer
+from ctypes import c_ubyte
+from ctypes import FormatError
+from ctypes import get_last_error
+from ctypes import Structure
+from ctypes import Union
+from ctypes import WinDLL
+from ctypes import WinError
+from ctypes.wintypes import BOOL
+from ctypes.wintypes import BOOLEAN
+from ctypes.wintypes import DWORD
+from ctypes.wintypes import HANDLE
+from ctypes.wintypes import LPCWSTR
+from ctypes.wintypes import LPDWORD
+from ctypes.wintypes import LPVOID
+from ctypes.wintypes import ULONG
+from ctypes.wintypes import USHORT
+from ctypes.wintypes import WCHAR
 import errno
 
-from ctypes import WinDLL, get_last_error, FormatError, WinError, addressof
-from ctypes import c_buffer, c_ubyte, Structure, Union, byref
-from ctypes.wintypes import BOOL, BOOLEAN, LPCWSTR, DWORD, HANDLE
-from ctypes.wintypes import WCHAR, USHORT, LPVOID, ULONG, LPDWORD
 
-kernel32 = WinDLL('kernel32', use_last_error=True)
+kernel32 = WinDLL("kernel32", use_last_error=True)
 
 UCHAR = c_ubyte
 
@@ -31,14 +47,17 @@ ERROR_PRIVILEGE_NOT_HELD = 1314
 # Win32 API entry points
 CreateSymbolicLinkW = kernel32.CreateSymbolicLinkW
 CreateSymbolicLinkW.restype = BOOLEAN
-CreateSymbolicLinkW.argtypes = (LPCWSTR,  # lpSymlinkFileName In
+CreateSymbolicLinkW.argtypes = (
-                                LPCWSTR,  # lpTargetFileName In
+    LPCWSTR,  # lpSymlinkFileName In
-                                DWORD)    # dwFlags In
+    LPCWSTR,  # lpTargetFileName In
+    DWORD,  # dwFlags In
+)
 
 # Symbolic link creation flags
 SYMBOLIC_LINK_FLAG_FILE = 0x00
 SYMBOLIC_LINK_FLAG_DIRECTORY = 0x01
-# symlink support for CreateSymbolicLink() starting with Windows 10 (1703, v10.0.14972)
+# symlink support for CreateSymbolicLink() starting with Windows 10 (1703,
+# v10.0.14972)
 SYMBOLIC_LINK_FLAG_ALLOW_UNPRIVILEGED_CREATE = 0x02
 
 GetFileAttributesW = kernel32.GetFileAttributesW
@@ -50,13 +69,15 @@ FILE_ATTRIBUTE_REPARSE_POINT = 0x00400
 
 CreateFileW = kernel32.CreateFileW
 CreateFileW.restype = HANDLE
-CreateFileW.argtypes = (LPCWSTR,  # lpFileName In
+CreateFileW.argtypes = (
-                        DWORD,    # dwDesiredAccess In
+    LPCWSTR,  # lpFileName In
-                        DWORD,    # dwShareMode In
+    DWORD,  # dwDesiredAccess In
-                        LPVOID,   # lpSecurityAttributes In_opt
+    DWORD,  # dwShareMode In
-                        DWORD,    # dwCreationDisposition In
+    LPVOID,  # lpSecurityAttributes In_opt
-                        DWORD,    # dwFlagsAndAttributes In
+    DWORD,  # dwCreationDisposition In
-                        HANDLE)   # hTemplateFile In_opt
+    DWORD,  # dwFlagsAndAttributes In
+    HANDLE,  # hTemplateFile In_opt
+)
 
 CloseHandle = kernel32.CloseHandle
 CloseHandle.restype = BOOL
@@ -69,14 +90,16 @@ FILE_FLAG_OPEN_REPARSE_POINT = 0x00200000
 
 DeviceIoControl = kernel32.DeviceIoControl
 DeviceIoControl.restype = BOOL
-DeviceIoControl.argtypes = (HANDLE,   # hDevice In
+DeviceIoControl.argtypes = (
-                            DWORD,    # dwIoControlCode In
+    HANDLE,  # hDevice In
-                            LPVOID,   # lpInBuffer In_opt
+    DWORD,  # dwIoControlCode In
-                            DWORD,    # nInBufferSize In
+    LPVOID,  # lpInBuffer In_opt
-                            LPVOID,   # lpOutBuffer Out_opt
+    DWORD,  # nInBufferSize In
-                            DWORD,    # nOutBufferSize In
+    LPVOID,  # lpOutBuffer Out_opt
-                            LPDWORD,  # lpBytesReturned Out_opt
+    DWORD,  # nOutBufferSize In
-                            LPVOID)   # lpOverlapped Inout_opt
+    LPDWORD,  # lpBytesReturned Out_opt
+    LPVOID,  # lpOverlapped Inout_opt
+)
 
 # Device I/O control flags and options
 FSCTL_GET_REPARSE_POINT = 0x000900A8
@@ -86,124 +109,138 @@ MAXIMUM_REPARSE_DATA_BUFFER_SIZE = 0x4000
 
 
 class GENERIC_REPARSE_BUFFER(Structure):
-  _fields_ = (('DataBuffer', UCHAR * 1),)
+    _fields_ = (("DataBuffer", UCHAR * 1),)
 
 
 class SYMBOLIC_LINK_REPARSE_BUFFER(Structure):
-  _fields_ = (('SubstituteNameOffset', USHORT),
+    _fields_ = (
-              ('SubstituteNameLength', USHORT),
+        ("SubstituteNameOffset", USHORT),
-              ('PrintNameOffset', USHORT),
+        ("SubstituteNameLength", USHORT),
-              ('PrintNameLength', USHORT),
+        ("PrintNameOffset", USHORT),
-              ('Flags', ULONG),
+        ("PrintNameLength", USHORT),
-              ('PathBuffer', WCHAR * 1))
+        ("Flags", ULONG),
+        ("PathBuffer", WCHAR * 1),
+    )
 
-  @property
+    @property
-  def PrintName(self):
+    def PrintName(self):
-    arrayt = WCHAR * (self.PrintNameLength // 2)
+        arrayt = WCHAR * (self.PrintNameLength // 2)
-    offset = type(self).PathBuffer.offset + self.PrintNameOffset
+        offset = type(self).PathBuffer.offset + self.PrintNameOffset
-    return arrayt.from_address(addressof(self) + offset).value
+        return arrayt.from_address(addressof(self) + offset).value
 
 
 class MOUNT_POINT_REPARSE_BUFFER(Structure):
-  _fields_ = (('SubstituteNameOffset', USHORT),
+    _fields_ = (
-              ('SubstituteNameLength', USHORT),
+        ("SubstituteNameOffset", USHORT),
-              ('PrintNameOffset', USHORT),
+        ("SubstituteNameLength", USHORT),
-              ('PrintNameLength', USHORT),
+        ("PrintNameOffset", USHORT),
-              ('PathBuffer', WCHAR * 1))
+        ("PrintNameLength", USHORT),
+        ("PathBuffer", WCHAR * 1),
+    )
 
-  @property
+    @property
-  def PrintName(self):
+    def PrintName(self):
-    arrayt = WCHAR * (self.PrintNameLength // 2)
+        arrayt = WCHAR * (self.PrintNameLength // 2)
-    offset = type(self).PathBuffer.offset + self.PrintNameOffset
+        offset = type(self).PathBuffer.offset + self.PrintNameOffset
-    return arrayt.from_address(addressof(self) + offset).value
+        return arrayt.from_address(addressof(self) + offset).value
 
 
 class REPARSE_DATA_BUFFER(Structure):
-  class REPARSE_BUFFER(Union):
+    class REPARSE_BUFFER(Union):
-    _fields_ = (('SymbolicLinkReparseBuffer', SYMBOLIC_LINK_REPARSE_BUFFER),
+        _fields_ = (
-                ('MountPointReparseBuffer', MOUNT_POINT_REPARSE_BUFFER),
+            ("SymbolicLinkReparseBuffer", SYMBOLIC_LINK_REPARSE_BUFFER),
-                ('GenericReparseBuffer', GENERIC_REPARSE_BUFFER))
+            ("MountPointReparseBuffer", MOUNT_POINT_REPARSE_BUFFER),
-  _fields_ = (('ReparseTag', ULONG),
+            ("GenericReparseBuffer", GENERIC_REPARSE_BUFFER),
-              ('ReparseDataLength', USHORT),
+        )
-              ('Reserved', USHORT),
+
-              ('ReparseBuffer', REPARSE_BUFFER))
+    _fields_ = (
-  _anonymous_ = ('ReparseBuffer',)
+        ("ReparseTag", ULONG),
+        ("ReparseDataLength", USHORT),
+        ("Reserved", USHORT),
+        ("ReparseBuffer", REPARSE_BUFFER),
+    )
+    _anonymous_ = ("ReparseBuffer",)
 
 
 def create_filesymlink(source, link_name):
-  """Creates a Windows file symbolic link source pointing to link_name."""
+    """Creates a Windows file symbolic link source pointing to link_name."""
-  _create_symlink(source, link_name, SYMBOLIC_LINK_FLAG_FILE)
+    _create_symlink(source, link_name, SYMBOLIC_LINK_FLAG_FILE)
 
 
 def create_dirsymlink(source, link_name):
-  """Creates a Windows directory symbolic link source pointing to link_name.
+    """Creates a Windows directory symbolic link source pointing to link_name."""  # noqa: E501
-  """
+    _create_symlink(source, link_name, SYMBOLIC_LINK_FLAG_DIRECTORY)
-  _create_symlink(source, link_name, SYMBOLIC_LINK_FLAG_DIRECTORY)
 
 
 def _create_symlink(source, link_name, dwFlags):
-  if not CreateSymbolicLinkW(link_name, source,
+    if not CreateSymbolicLinkW(
-                             dwFlags | SYMBOLIC_LINK_FLAG_ALLOW_UNPRIVILEGED_CREATE):
+        link_name,
-    # See https://github.com/golang/go/pull/24307/files#diff-b87bc12e4da2497308f9ef746086e4f0
+        source,
-    # "the unprivileged create flag is unsupported below Windows 10 (1703, v10.0.14972).
+        dwFlags | SYMBOLIC_LINK_FLAG_ALLOW_UNPRIVILEGED_CREATE,
-    # retry without it."
+    ):
-    if not CreateSymbolicLinkW(link_name, source, dwFlags):
+        # See https://github.com/golang/go/pull/24307/files#diff-b87bc12e4da2497308f9ef746086e4f0  # noqa: E501
-      code = get_last_error()
+        # "the unprivileged create flag is unsupported below Windows 10 (1703,
-      error_desc = FormatError(code).strip()
+        # v10.0.14972). retry without it."
-      if code == ERROR_PRIVILEGE_NOT_HELD:
+        if not CreateSymbolicLinkW(link_name, source, dwFlags):
-        raise OSError(errno.EPERM, error_desc, link_name)
+            code = get_last_error()
-      _raise_winerror(
+            error_desc = FormatError(code).strip()
-          code,
+            if code == ERROR_PRIVILEGE_NOT_HELD:
-          'Error creating symbolic link \"%s\"'.format(link_name))
+                raise OSError(errno.EPERM, error_desc, link_name)
+            _raise_winerror(
+                code, 'Error creating symbolic link "{}"'.format(link_name)
+            )
 
 
 def islink(path):
-  result = GetFileAttributesW(path)
+    result = GetFileAttributesW(path)
-  if result == INVALID_FILE_ATTRIBUTES:
+    if result == INVALID_FILE_ATTRIBUTES:
-    return False
+        return False
-  return bool(result & FILE_ATTRIBUTE_REPARSE_POINT)
+    return bool(result & FILE_ATTRIBUTE_REPARSE_POINT)
 
 
 def readlink(path):
-  reparse_point_handle = CreateFileW(path,
+    reparse_point_handle = CreateFileW(
-                                     0,
+        path,
-                                     0,
+        0,
-                                     None,
+        0,
-                                     OPEN_EXISTING,
+        None,
-                                     FILE_FLAG_OPEN_REPARSE_POINT |
+        OPEN_EXISTING,
-                                     FILE_FLAG_BACKUP_SEMANTICS,
+        FILE_FLAG_OPEN_REPARSE_POINT | FILE_FLAG_BACKUP_SEMANTICS,
-                                     None)
+        None,
-  if reparse_point_handle == INVALID_HANDLE_VALUE:
+    )
+    if reparse_point_handle == INVALID_HANDLE_VALUE:
+        _raise_winerror(
+            get_last_error(), 'Error opening symbolic link "{}"'.format(path)
+        )
+    target_buffer = c_buffer(MAXIMUM_REPARSE_DATA_BUFFER_SIZE)
+    n_bytes_returned = DWORD()
+    io_result = DeviceIoControl(
+        reparse_point_handle,
+        FSCTL_GET_REPARSE_POINT,
+        None,
+        0,
+        target_buffer,
+        len(target_buffer),
+        byref(n_bytes_returned),
+        None,
+    )
+    CloseHandle(reparse_point_handle)
+    if not io_result:
+        _raise_winerror(
+            get_last_error(), 'Error reading symbolic link "{}"'.format(path)
+        )
+    rdb = REPARSE_DATA_BUFFER.from_buffer(target_buffer)
+    if rdb.ReparseTag == IO_REPARSE_TAG_SYMLINK:
+        return rdb.SymbolicLinkReparseBuffer.PrintName
+    elif rdb.ReparseTag == IO_REPARSE_TAG_MOUNT_POINT:
+        return rdb.MountPointReparseBuffer.PrintName
+    # Unsupported reparse point type.
     _raise_winerror(
-        get_last_error(),
+        ERROR_NOT_SUPPORTED, 'Error reading symbolic link "{}"'.format(path)
-        'Error opening symbolic link \"%s\"'.format(path))
+    )
-  target_buffer = c_buffer(MAXIMUM_REPARSE_DATA_BUFFER_SIZE)
-  n_bytes_returned = DWORD()
-  io_result = DeviceIoControl(reparse_point_handle,
-                              FSCTL_GET_REPARSE_POINT,
-                              None,
-                              0,
-                              target_buffer,
-                              len(target_buffer),
-                              byref(n_bytes_returned),
-                              None)
-  CloseHandle(reparse_point_handle)
-  if not io_result:
-    _raise_winerror(
-        get_last_error(),
-        'Error reading symbolic link \"%s\"'.format(path))
-  rdb = REPARSE_DATA_BUFFER.from_buffer(target_buffer)
-  if rdb.ReparseTag == IO_REPARSE_TAG_SYMLINK:
-    return rdb.SymbolicLinkReparseBuffer.PrintName
-  elif rdb.ReparseTag == IO_REPARSE_TAG_MOUNT_POINT:
-    return rdb.MountPointReparseBuffer.PrintName
-  # Unsupported reparse point type
-  _raise_winerror(
-      ERROR_NOT_SUPPORTED,
-      'Error reading symbolic link \"%s\"'.format(path))
 
 
 def _raise_winerror(code, error_desc):
-  win_error_desc = FormatError(code).strip()
+    win_error_desc = FormatError(code).strip()
-  error_desc = "%s: %s".format(error_desc, win_error_desc)
+    error_desc = "{0}: {1}".format(error_desc, win_error_desc)
-  raise WinError(code, error_desc)
+    raise WinError(code, error_desc)

progress.py

@@ -14,123 +14,215 @@
 
 import os
 import sys
-from time import time
+import time
-from repo_trace import IsTrace
 
-_NOT_TTY = not os.isatty(2)
+
+try:
+    import threading as _threading
+except ImportError:
+    import dummy_threading as _threading
+
+from repo_trace import IsTraceToStderr
+
+
+_TTY = sys.stderr.isatty()
 
 # This will erase all content in the current line (wherever the cursor is).
 # It does not move the cursor, so this is usually followed by \r to move to
 # column 0.
-CSI_ERASE_LINE = '\x1b[2K'
+CSI_ERASE_LINE = "\x1b[2K"
 
 # This will erase all content in the current line after the cursor.  This is
 # useful for partial updates & progress messages as the terminal can display
 # it better.
-CSI_ERASE_LINE_AFTER = '\x1b[K'
+CSI_ERASE_LINE_AFTER = "\x1b[K"
+
+
+def convert_to_hms(total):
+    """Converts a period of seconds to hours, minutes, and seconds."""
+    hours, rem = divmod(total, 3600)
+    mins, secs = divmod(rem, 60)
+    return int(hours), int(mins), secs
 
 
 def duration_str(total):
-  """A less noisy timedelta.__str__.
+    """A less noisy timedelta.__str__.
 
-  The default timedelta stringification contains a lot of leading zeros and
+    The default timedelta stringification contains a lot of leading zeros and
-  uses microsecond resolution.  This makes for noisy output.
+    uses microsecond resolution.  This makes for noisy output.
-  """
+    """
-  hours, rem = divmod(total, 3600)
+    hours, mins, secs = convert_to_hms(total)
-  mins, secs = divmod(rem, 60)
+    ret = "%.3fs" % (secs,)
-  ret = '%.3fs' % (secs,)
+    if mins:
-  if mins:
+        ret = "%im%s" % (mins, ret)
-    ret = '%im%s' % (mins, ret)
+    if hours:
-  if hours:
+        ret = "%ih%s" % (hours, ret)
-    ret = '%ih%s' % (hours, ret)
+    return ret
-  return ret
+
+
+def elapsed_str(total):
+    """Returns seconds in the format [H:]MM:SS.
+
+    Does not display a leading zero for minutes if under 10 minutes. This should
+    be used when displaying elapsed time in a progress indicator.
+    """
+    hours, mins, secs = convert_to_hms(total)
+    ret = f"{int(secs):>02d}"
+    if total >= 3600:
+        # Show leading zeroes if over an hour.
+        ret = f"{mins:>02d}:{ret}"
+    else:
+        ret = f"{mins}:{ret}"
+    if hours:
+        ret = f"{hours}:{ret}"
+    return ret
+
+
+def jobs_str(total):
+    return f"{total} job{'s' if total > 1 else ''}"
 
 
 class Progress(object):
-  def __init__(self, title, total=0, units='', print_newline=False, delay=True,
+    def __init__(
-               quiet=False):
+        self,
-    self._title = title
+        title,
-    self._total = total
+        total=0,
-    self._done = 0
+        units="",
-    self._start = time()
+        delay=True,
-    self._show = not delay
+        quiet=False,
-    self._units = units
+        show_elapsed=False,
-    self._print_newline = print_newline
+        elide=False,
-    # Only show the active jobs section if we run more than one in parallel.
+    ):
-    self._show_jobs = False
+        self._title = title
-    self._active = 0
+        self._total = total
+        self._done = 0
+        self._start = time.time()
+        self._show = not delay
+        self._units = units
+        self._elide = elide and _TTY
 
-    # When quiet, never show any output.  It's a bit hacky, but reusing the
+        # Only show the active jobs section if we run more than one in parallel.
-    # existing logic that delays initial output keeps the rest of the class
+        self._show_jobs = False
-    # clean.  Basically we set the start time to years in the future.
+        self._active = 0
-    if quiet:
-      self._show = False
-      self._start += 2**32
 
-  def start(self, name):
+        # Save the last message for displaying on refresh.
-    self._active += 1
+        self._last_msg = None
-    if not self._show_jobs:
+        self._show_elapsed = show_elapsed
-      self._show_jobs = self._active > 1
+        self._update_event = _threading.Event()
-    self.update(inc=0, msg='started ' + name)
+        self._update_thread = _threading.Thread(
+            target=self._update_loop,
+        )
+        self._update_thread.daemon = True
 
-  def finish(self, name):
+        # When quiet, never show any output.  It's a bit hacky, but reusing the
-    self.update(msg='finished ' + name)
+        # existing logic that delays initial output keeps the rest of the class
-    self._active -= 1
+        # clean.  Basically we set the start time to years in the future.
+        if quiet:
+            self._show = False
+            self._start += 2**32
+        elif show_elapsed:
+            self._update_thread.start()
 
-  def update(self, inc=1, msg=''):
+    def _update_loop(self):
-    self._done += inc
+        while True:
+            self.update(inc=0)
+            if self._update_event.wait(timeout=1):
+                return
 
-    if _NOT_TTY or IsTrace():
+    def _write(self, s):
-      return
+        s = "\r" + s
+        if self._elide:
+            col = os.get_terminal_size(sys.stderr.fileno()).columns
+            if len(s) > col:
+                s = s[: col - 1] + ".."
+        sys.stderr.write(s)
+        sys.stderr.flush()
 
-    if not self._show:
+    def start(self, name):
-      if 0.5 <= time() - self._start:
+        self._active += 1
-        self._show = True
+        if not self._show_jobs:
-      else:
+            self._show_jobs = self._active > 1
-        return
+        self.update(inc=0, msg="started " + name)
 
-    if self._total <= 0:
+    def finish(self, name):
-      sys.stderr.write('\r%s: %d,%s' % (
+        self.update(msg="finished " + name)
-          self._title,
+        self._active -= 1
-          self._done,
-          CSI_ERASE_LINE_AFTER))
-      sys.stderr.flush()
-    else:
-      p = (100 * self._done) / self._total
-      if self._show_jobs:
-        jobs = '[%d job%s] ' % (self._active, 's' if self._active > 1 else '')
-      else:
-        jobs = ''
-      sys.stderr.write('\r%s: %2d%% %s(%d%s/%d%s)%s%s%s%s' % (
-          self._title,
-          p,
-          jobs,
-          self._done, self._units,
-          self._total, self._units,
-          ' ' if msg else '', msg,
-          CSI_ERASE_LINE_AFTER,
-          '\n' if self._print_newline else ''))
-      sys.stderr.flush()
 
-  def end(self):
+    def update(self, inc=1, msg=None):
-    if _NOT_TTY or IsTrace() or not self._show:
+        """Updates the progress indicator.
-      return
 
-    duration = duration_str(time() - self._start)
+        Args:
-    if self._total <= 0:
+            inc: The number of items completed.
-      sys.stderr.write('\r%s: %d, done in %s%s\n' % (
+            msg: The message to display. If None, use the last message.
-          self._title,
+        """
-          self._done,
+        self._done += inc
-          duration,
+        if msg is None:
-          CSI_ERASE_LINE_AFTER))
+            msg = self._last_msg
-      sys.stderr.flush()
+        self._last_msg = msg
-    else:
+
-      p = (100 * self._done) / self._total
+        if not _TTY or IsTraceToStderr():
-      sys.stderr.write('\r%s: %3d%% (%d%s/%d%s), done in %s%s\n' % (
+            return
-          self._title,
+
-          p,
+        elapsed_sec = time.time() - self._start
-          self._done, self._units,
+        if not self._show:
-          self._total, self._units,
+            if 0.5 <= elapsed_sec:
-          duration,
+                self._show = True
-          CSI_ERASE_LINE_AFTER))
+            else:
-      sys.stderr.flush()
+                return
+
+        if self._total <= 0:
+            self._write(
+                "%s: %d,%s" % (self._title, self._done, CSI_ERASE_LINE_AFTER)
+            )
+        else:
+            p = (100 * self._done) / self._total
+            if self._show_jobs:
+                jobs = f"[{jobs_str(self._active)}] "
+            else:
+                jobs = ""
+            if self._show_elapsed:
+                elapsed = f" {elapsed_str(elapsed_sec)} |"
+            else:
+                elapsed = ""
+            self._write(
+                "%s: %2d%% %s(%d%s/%d%s)%s %s%s"
+                % (
+                    self._title,
+                    p,
+                    jobs,
+                    self._done,
+                    self._units,
+                    self._total,
+                    self._units,
+                    elapsed,
+                    msg,
+                    CSI_ERASE_LINE_AFTER,
+                )
+            )
+
+    def end(self):
+        self._update_event.set()
+        if not _TTY or IsTraceToStderr() or not self._show:
+            return
+
+        duration = duration_str(time.time() - self._start)
+        if self._total <= 0:
+            self._write(
+                "%s: %d, done in %s%s\n"
+                % (self._title, self._done, duration, CSI_ERASE_LINE_AFTER)
+            )
+        else:
+            p = (100 * self._done) / self._total
+            self._write(
+                "%s: %3d%% (%d%s/%d%s), done in %s%s\n"
+                % (
+                    self._title,
+                    p,
+                    self._done,
+                    self._units,
+                    self._total,
+                    self._units,
+                    duration,
+                    CSI_ERASE_LINE_AFTER,
+                )
+            )

pyproject.toml

@@ -0,0 +1,18 @@
+# Copyright 2023 The Android Open Source Project
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#      http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+[tool.black]
+line-length = 80
+# NB: Keep in sync with tox.ini.
+target-version = ['py36', 'py37', 'py38', 'py39', 'py310', 'py311']

release/sign-launcher.py

@@ -28,43 +28,56 @@ import util
 
 
 def sign(opts):
-  """Sign the launcher!"""
+    """Sign the launcher!"""
-  output = ''
+    output = ""
-  for key in opts.keys:
+    for key in opts.keys:
-    # We use ! at the end of the key so that gpg uses this specific key.
+        # We use ! at the end of the key so that gpg uses this specific key.
-    # Otherwise it uses the key as a lookup into the overall key and uses the
+        # Otherwise it uses the key as a lookup into the overall key and uses
-    # default signing key.  i.e. It will see that KEYID_RSA is a subkey of
+        # the default signing key.  i.e. It will see that KEYID_RSA is a subkey
-    # another key, and use the primary key to sign instead of the subkey.
+        # of another key, and use the primary key to sign instead of the subkey.
-    cmd = ['gpg', '--homedir', opts.gpgdir, '-u', f'{key}!', '--batch', '--yes',
+        cmd = [
-           '--armor', '--detach-sign', '--output', '-', opts.launcher]
+            "gpg",
-    ret = util.run(opts, cmd, encoding='utf-8', stdout=subprocess.PIPE)
+            "--homedir",
-    output += ret.stdout
+            opts.gpgdir,
+            "-u",
+            f"{key}!",
+            "--batch",
+            "--yes",
+            "--armor",
+            "--detach-sign",
+            "--output",
+            "-",
+            opts.launcher,
+        ]
+        ret = util.run(opts, cmd, encoding="utf-8", stdout=subprocess.PIPE)
+        output += ret.stdout
 
-  # Save the combined signatures into one file.
+    # Save the combined signatures into one file.
-  with open(f'{opts.launcher}.asc', 'w', encoding='utf-8') as fp:
+    with open(f"{opts.launcher}.asc", "w", encoding="utf-8") as fp:
-    fp.write(output)
+        fp.write(output)
 
 
 def check(opts):
-  """Check the signature."""
+    """Check the signature."""
-  util.run(opts, ['gpg', '--verify', f'{opts.launcher}.asc'])
+    util.run(opts, ["gpg", "--verify", f"{opts.launcher}.asc"])
 
 
 def get_version(opts):
-  """Get the version from |launcher|."""
+    """Get the version from |launcher|."""
-  # Make sure we don't search $PATH when signing the "repo" file in the cwd.
+    # Make sure we don't search $PATH when signing the "repo" file in the cwd.
-  launcher = os.path.join('.', opts.launcher)
+    launcher = os.path.join(".", opts.launcher)
-  cmd = [launcher, '--version']
+    cmd = [launcher, "--version"]
-  ret = util.run(opts, cmd, encoding='utf-8', stdout=subprocess.PIPE)
+    ret = util.run(opts, cmd, encoding="utf-8", stdout=subprocess.PIPE)
-  m = re.search(r'repo launcher version ([0-9.]+)', ret.stdout)
+    m = re.search(r"repo launcher version ([0-9.]+)", ret.stdout)
-  if not m:
+    if not m:
-    sys.exit(f'{opts.launcher}: unable to detect repo version')
+        sys.exit(f"{opts.launcher}: unable to detect repo version")
-  return m.group(1)
+    return m.group(1)
 
 
 def postmsg(opts, version):
-  """Helpful info to show at the end for release manager."""
+    """Helpful info to show at the end for release manager."""
-  print(f"""
+    print(
+        f"""
 Repo launcher bucket:
   gs://git-repo-downloads/
 
@@ -81,55 +94,72 @@ NB: If a rollback is necessary, the GS bucket archives old versions, and may be
   gsutil ls -la gs://git-repo-downloads/repo gs://git-repo-downloads/repo.asc
   gsutil cp -a public-read gs://git-repo-downloads/repo#<unique id> gs://git-repo-downloads/repo
   gsutil cp -a public-read gs://git-repo-downloads/repo.asc#<unique id> gs://git-repo-downloads/repo.asc
-""")
+"""  # noqa: E501
+    )
 
 
 def get_parser():
-  """Get a CLI parser."""
+    """Get a CLI parser."""
-  parser = argparse.ArgumentParser(description=__doc__)
+    parser = argparse.ArgumentParser(description=__doc__)
-  parser.add_argument('-n', '--dry-run',
+    parser.add_argument(
-                      dest='dryrun', action='store_true',
+        "-n",
-                      help='show everything that would be done')
+        "--dry-run",
-  parser.add_argument('--gpgdir',
+        dest="dryrun",
-                      default=os.path.join(util.HOMEDIR, '.gnupg', 'repo'),
+        action="store_true",
-                      help='path to dedicated gpg dir with release keys '
+        help="show everything that would be done",
-                           '(default: ~/.gnupg/repo/)')
+    )
-  parser.add_argument('--keyid', dest='keys', default=[], action='append',
+    parser.add_argument(
-                      help='alternative signing keys to use')
+        "--gpgdir",
-  parser.add_argument('launcher',
+        default=os.path.join(util.HOMEDIR, ".gnupg", "repo"),
-                      default=os.path.join(util.TOPDIR, 'repo'), nargs='?',
+        help="path to dedicated gpg dir with release keys "
-                      help='the launcher script to sign')
+        "(default: ~/.gnupg/repo/)",
-  return parser
+    )
+    parser.add_argument(
+        "--keyid",
+        dest="keys",
+        default=[],
+        action="append",
+        help="alternative signing keys to use",
+    )
+    parser.add_argument(
+        "launcher",
+        default=os.path.join(util.TOPDIR, "repo"),
+        nargs="?",
+        help="the launcher script to sign",
+    )
+    return parser
 
 
 def main(argv):
-  """The main func!"""
+    """The main func!"""
-  parser = get_parser()
+    parser = get_parser()
-  opts = parser.parse_args(argv)
+    opts = parser.parse_args(argv)
 
-  if not os.path.exists(opts.gpgdir):
+    if not os.path.exists(opts.gpgdir):
-    parser.error(f'--gpgdir does not exist: {opts.gpgdir}')
+        parser.error(f"--gpgdir does not exist: {opts.gpgdir}")
-  if not os.path.exists(opts.launcher):
+    if not os.path.exists(opts.launcher):
-    parser.error(f'launcher does not exist: {opts.launcher}')
+        parser.error(f"launcher does not exist: {opts.launcher}")
 
-  opts.launcher = os.path.relpath(opts.launcher)
+    opts.launcher = os.path.relpath(opts.launcher)
-  print(f'Signing "{opts.launcher}" launcher script and saving to '
+    print(
-        f'"{opts.launcher}.asc"')
+        f'Signing "{opts.launcher}" launcher script and saving to '
+        f'"{opts.launcher}.asc"'
+    )
 
-  if opts.keys:
+    if opts.keys:
-    print(f'Using custom keys to sign: {" ".join(opts.keys)}')
+        print(f'Using custom keys to sign: {" ".join(opts.keys)}')
-  else:
+    else:
-    print('Using official Repo release keys to sign')
+        print("Using official Repo release keys to sign")
-    opts.keys = [util.KEYID_DSA, util.KEYID_RSA, util.KEYID_ECC]
+        opts.keys = [util.KEYID_DSA, util.KEYID_RSA, util.KEYID_ECC]
-    util.import_release_key(opts)
+        util.import_release_key(opts)
 
-  version = get_version(opts)
+    version = get_version(opts)
-  sign(opts)
+    sign(opts)
-  check(opts)
+    check(opts)
-  postmsg(opts, version)
+    postmsg(opts, version)
 
-  return 0
+    return 0
 
 
-if __name__ == '__main__':
+if __name__ == "__main__":
-  sys.exit(main(sys.argv[1:]))
+    sys.exit(main(sys.argv[1:]))

release/sign-tag.py

@@ -35,46 +35,61 @@ import util
 KEYID = util.KEYID_DSA
 
 # Regular expression to validate tag names.
-RE_VALID_TAG = r'^v([0-9]+[.])+[0-9]+$'
+RE_VALID_TAG = r"^v([0-9]+[.])+[0-9]+$"
 
 
 def sign(opts):
-  """Tag the commit & sign it!"""
+    """Tag the commit & sign it!"""
-  # We use ! at the end of the key so that gpg uses this specific key.
+    # We use ! at the end of the key so that gpg uses this specific key.
-  # Otherwise it uses the key as a lookup into the overall key and uses the
+    # Otherwise it uses the key as a lookup into the overall key and uses the
-  # default signing key.  i.e. It will see that KEYID_RSA is a subkey of
+    # default signing key.  i.e. It will see that KEYID_RSA is a subkey of
-  # another key, and use the primary key to sign instead of the subkey.
+    # another key, and use the primary key to sign instead of the subkey.
-  cmd = ['git', 'tag', '-s', opts.tag, '-u', f'{opts.key}!',
+    cmd = [
-         '-m', f'repo {opts.tag}', opts.commit]
+        "git",
+        "tag",
+        "-s",
+        opts.tag,
+        "-u",
+        f"{opts.key}!",
+        "-m",
+        f"repo {opts.tag}",
+        opts.commit,
+    ]
 
-  key = 'GNUPGHOME'
+    key = "GNUPGHOME"
-  print('+', f'export {key}="{opts.gpgdir}"')
+    print("+", f'export {key}="{opts.gpgdir}"')
-  oldvalue = os.getenv(key)
+    oldvalue = os.getenv(key)
-  os.putenv(key, opts.gpgdir)
+    os.putenv(key, opts.gpgdir)
-  util.run(opts, cmd)
+    util.run(opts, cmd)
-  if oldvalue is None:
+    if oldvalue is None:
-    os.unsetenv(key)
+        os.unsetenv(key)
-  else:
+    else:
-    os.putenv(key, oldvalue)
+        os.putenv(key, oldvalue)
 
 
 def check(opts):
-  """Check the signature."""
+    """Check the signature."""
-  util.run(opts, ['git', 'tag', '--verify', opts.tag])
+    util.run(opts, ["git", "tag", "--verify", opts.tag])
 
 
 def postmsg(opts):
-  """Helpful info to show at the end for release manager."""
+    """Helpful info to show at the end for release manager."""
-  cmd = ['git', 'rev-parse', 'remotes/origin/stable']
+    cmd = ["git", "rev-parse", "remotes/origin/stable"]
-  ret = util.run(opts, cmd, encoding='utf-8', stdout=subprocess.PIPE)
+    ret = util.run(opts, cmd, encoding="utf-8", stdout=subprocess.PIPE)
-  current_release = ret.stdout.strip()
+    current_release = ret.stdout.strip()
 
-  cmd = ['git', 'log', '--format=%h (%aN) %s', '--no-merges',
+    cmd = [
-         f'remotes/origin/stable..{opts.tag}']
+        "git",
-  ret = util.run(opts, cmd, encoding='utf-8', stdout=subprocess.PIPE)
+        "log",
-  shortlog = ret.stdout.strip()
+        "--format=%h (%aN) %s",
+        "--no-merges",
+        f"remotes/origin/stable..{opts.tag}",
+    ]
+    ret = util.run(opts, cmd, encoding="utf-8", stdout=subprocess.PIPE)
+    shortlog = ret.stdout.strip()
 
-  print(f"""
+    print(
+        f"""
 Here's the short log since the last release.
 {shortlog}
 
@@ -84,57 +99,69 @@ NB: People will start upgrading to this version immediately.
 
 To roll back a release:
   git push origin --force {current_release}:stable -n
-""")
+"""
+    )
 
 
 def get_parser():
-  """Get a CLI parser."""
+    """Get a CLI parser."""
-  parser = argparse.ArgumentParser(
+    parser = argparse.ArgumentParser(
-      description=__doc__,
+        description=__doc__,
-      formatter_class=argparse.RawDescriptionHelpFormatter)
+        formatter_class=argparse.RawDescriptionHelpFormatter,
-  parser.add_argument('-n', '--dry-run',
+    )
-                      dest='dryrun', action='store_true',
+    parser.add_argument(
-                      help='show everything that would be done')
+        "-n",
-  parser.add_argument('--gpgdir',
+        "--dry-run",
-                      default=os.path.join(util.HOMEDIR, '.gnupg', 'repo'),
+        dest="dryrun",
-                      help='path to dedicated gpg dir with release keys '
+        action="store_true",
-                           '(default: ~/.gnupg/repo/)')
+        help="show everything that would be done",
-  parser.add_argument('-f', '--force', action='store_true',
+    )
-                      help='force signing of any tag')
+    parser.add_argument(
-  parser.add_argument('--keyid', dest='key',
+        "--gpgdir",
-                      help='alternative signing key to use')
+        default=os.path.join(util.HOMEDIR, ".gnupg", "repo"),
-  parser.add_argument('tag',
+        help="path to dedicated gpg dir with release keys "
-                      help='the tag to create (e.g. "v2.0")')
+        "(default: ~/.gnupg/repo/)",
-  parser.add_argument('commit', default='HEAD', nargs='?',
+    )
-                      help='the commit to tag')
+    parser.add_argument(
-  return parser
+        "-f", "--force", action="store_true", help="force signing of any tag"
+    )
+    parser.add_argument(
+        "--keyid", dest="key", help="alternative signing key to use"
+    )
+    parser.add_argument("tag", help='the tag to create (e.g. "v2.0")')
+    parser.add_argument(
+        "commit", default="HEAD", nargs="?", help="the commit to tag"
+    )
+    return parser
 
 
 def main(argv):
-  """The main func!"""
+    """The main func!"""
-  parser = get_parser()
+    parser = get_parser()
-  opts = parser.parse_args(argv)
+    opts = parser.parse_args(argv)
 
-  if not os.path.exists(opts.gpgdir):
+    if not os.path.exists(opts.gpgdir):
-    parser.error(f'--gpgdir does not exist: {opts.gpgdir}')
+        parser.error(f"--gpgdir does not exist: {opts.gpgdir}")
 
-  if not opts.force and not re.match(RE_VALID_TAG, opts.tag):
+    if not opts.force and not re.match(RE_VALID_TAG, opts.tag):
-    parser.error(f'tag "{opts.tag}" does not match regex "{RE_VALID_TAG}"; '
+        parser.error(
-                 'use --force to sign anyways')
+            f'tag "{opts.tag}" does not match regex "{RE_VALID_TAG}"; '
+            "use --force to sign anyways"
+        )
 
-  if opts.key:
+    if opts.key:
-    print(f'Using custom key to sign: {opts.key}')
+        print(f"Using custom key to sign: {opts.key}")
-  else:
+    else:
-    print('Using official Repo release key to sign')
+        print("Using official Repo release key to sign")
-    opts.key = KEYID
+        opts.key = KEYID
-    util.import_release_key(opts)
+        util.import_release_key(opts)
 
-  sign(opts)
+    sign(opts)
-  check(opts)
+    check(opts)
-  postmsg(opts)
+    postmsg(opts)
 
-  return 0
+    return 0
 
 
-if __name__ == '__main__':
+if __name__ == "__main__":
-  sys.exit(main(sys.argv[1:]))
+    sys.exit(main(sys.argv[1:]))

release/update-manpages

@@ -18,93 +18,9 @@
 This is intended to be run before every official Repo release.
 """
 
-from pathlib import Path
-from functools import partial
-import argparse
-import multiprocessing
-import os
-import re
-import shutil
-import subprocess
 import sys
-import tempfile
 
-TOPDIR = Path(__file__).resolve().parent.parent
+import update_manpages
-MANDIR = TOPDIR.joinpath('man')
-
-# Load repo local modules.
-sys.path.insert(0, str(TOPDIR))
-from git_command import RepoSourceVersion
-import subcmds
-
-def worker(cmd, **kwargs):
-  subprocess.run(cmd, **kwargs)
-
-def main(argv):
-  parser = argparse.ArgumentParser(description=__doc__)
-  opts = parser.parse_args(argv)
-
-  if not shutil.which('help2man'):
-    sys.exit('Please install help2man to continue.')
-
-  # Let repo know we're generating man pages so it can avoid some dynamic
-  # behavior (like probing active number of CPUs).  We use a weird name &
-  # value to make it less likely for users to set this var themselves.
-  os.environ['_REPO_GENERATE_MANPAGES_'] = ' indeed! '
-
-  # "repo branch" is an alias for "repo branches".
-  del subcmds.all_commands['branch']
-  (MANDIR / 'repo-branch.1').write_text('.so man1/repo-branches.1')
-
-  version = RepoSourceVersion()
-  cmdlist = [['help2man', '-N', '-n', f'repo {cmd} - manual page for repo {cmd}',
-    '-S', f'repo {cmd}', '-m', 'Repo Manual', f'--version-string={version}',
-    '-o', MANDIR.joinpath(f'repo-{cmd}.1.tmp'), './repo',
-    '-h', f'help {cmd}'] for cmd in subcmds.all_commands]
-  cmdlist.append(['help2man', '-N', '-n', 'repository management tool built on top of git',
-    '-S', 'repo', '-m', 'Repo Manual', f'--version-string={version}',
-    '-o', MANDIR.joinpath('repo.1.tmp'), './repo',
-    '-h', '--help-all'])
-
-  with tempfile.TemporaryDirectory() as tempdir:
-    tempdir = Path(tempdir)
-    repo_dir = tempdir / '.repo'
-    repo_dir.mkdir()
-    (repo_dir / 'repo').symlink_to(TOPDIR)
-
-    # Create a repo wrapper using the active Python executable.  We can't pass
-    # this directly to help2man as it's too simple, so insert it via shebang.
-    data = (TOPDIR / 'repo').read_text(encoding='utf-8')
-    tempbin = tempdir / 'repo'
-    tempbin.write_text(f'#!{sys.executable}\n' + data, encoding='utf-8')
-    tempbin.chmod(0o755)
-
-    # Run all cmd in parallel, and wait for them to finish.
-    with multiprocessing.Pool() as pool:
-      pool.map(partial(worker, cwd=tempdir, check=True), cmdlist)
-
-  regex = (
-      (r'(It was generated by help2man) [0-9.]+', '\g<1>.'),
-      (r'^\.IP\n(.*:)\n', '.SS \g<1>\n'),
-      (r'^\.PP\nDescription', '.SH DETAILS'),
-  )
-  for tmp_path in MANDIR.glob('*.1.tmp'):
-    path = tmp_path.parent / tmp_path.stem
-    old_data = path.read_text() if path.exists() else ''
-
-    data = tmp_path.read_text()
-    tmp_path.unlink()
-
-    for pattern, replacement in regex:
-      data = re.sub(pattern, replacement, data, flags=re.M)
-
-    # If the only thing that changed was the date, don't refresh.  This avoids
-    # a lot of noise when only one file actually updates.
-    old_data = re.sub(r'^(\.TH REPO "1" ")([^"]+)', r'\1', old_data, flags=re.M)
-    new_data = re.sub(r'^(\.TH REPO "1" ")([^"]+)', r'\1', data, flags=re.M)
-    if old_data != new_data:
-      path.write_text(data)
 
 
-if __name__ == '__main__':
+sys.exit(update_manpages.main(sys.argv[1:]))
-  sys.exit(main(sys.argv[1:]))

release/update_manpages.py

@@ -0,0 +1,156 @@
+# Copyright (C) 2021 The Android Open Source Project
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#      http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+"""Helper tool for generating manual page for all repo commands.
+
+Most code lives in this module so it can be unittested.
+"""
+
+import argparse
+import functools
+import multiprocessing
+import os
+from pathlib import Path
+import re
+import shutil
+import subprocess
+import sys
+import tempfile
+
+
+TOPDIR = Path(__file__).resolve().parent.parent
+MANDIR = TOPDIR.joinpath("man")
+
+# Load repo local modules.
+sys.path.insert(0, str(TOPDIR))
+from git_command import RepoSourceVersion
+import subcmds
+
+
+def worker(cmd, **kwargs):
+    subprocess.run(cmd, **kwargs)
+
+
+def main(argv):
+    parser = argparse.ArgumentParser(description=__doc__)
+    parser.parse_args(argv)
+
+    if not shutil.which("help2man"):
+        sys.exit("Please install help2man to continue.")
+
+    # Let repo know we're generating man pages so it can avoid some dynamic
+    # behavior (like probing active number of CPUs).  We use a weird name &
+    # value to make it less likely for users to set this var themselves.
+    os.environ["_REPO_GENERATE_MANPAGES_"] = " indeed! "
+
+    # "repo branch" is an alias for "repo branches".
+    del subcmds.all_commands["branch"]
+    (MANDIR / "repo-branch.1").write_text(".so man1/repo-branches.1")
+
+    version = RepoSourceVersion()
+    cmdlist = [
+        [
+            "help2man",
+            "-N",
+            "-n",
+            f"repo {cmd} - manual page for repo {cmd}",
+            "-S",
+            f"repo {cmd}",
+            "-m",
+            "Repo Manual",
+            f"--version-string={version}",
+            "-o",
+            MANDIR.joinpath(f"repo-{cmd}.1.tmp"),
+            "./repo",
+            "-h",
+            f"help {cmd}",
+        ]
+        for cmd in subcmds.all_commands
+    ]
+    cmdlist.append(
+        [
+            "help2man",
+            "-N",
+            "-n",
+            "repository management tool built on top of git",
+            "-S",
+            "repo",
+            "-m",
+            "Repo Manual",
+            f"--version-string={version}",
+            "-o",
+            MANDIR.joinpath("repo.1.tmp"),
+            "./repo",
+            "-h",
+            "--help-all",
+        ]
+    )
+
+    with tempfile.TemporaryDirectory() as tempdir:
+        tempdir = Path(tempdir)
+        repo_dir = tempdir / ".repo"
+        repo_dir.mkdir()
+        (repo_dir / "repo").symlink_to(TOPDIR)
+
+        # Create a repo wrapper using the active Python executable.  We can't
+        # pass this directly to help2man as it's too simple, so insert it via
+        # shebang.
+        data = (TOPDIR / "repo").read_text(encoding="utf-8")
+        tempbin = tempdir / "repo"
+        tempbin.write_text(f"#!{sys.executable}\n" + data, encoding="utf-8")
+        tempbin.chmod(0o755)
+
+        # Run all cmd in parallel, and wait for them to finish.
+        with multiprocessing.Pool() as pool:
+            pool.map(
+                functools.partial(worker, cwd=tempdir, check=True), cmdlist
+            )
+
+    for tmp_path in MANDIR.glob("*.1.tmp"):
+        path = tmp_path.parent / tmp_path.stem
+        old_data = path.read_text() if path.exists() else ""
+
+        data = tmp_path.read_text()
+        tmp_path.unlink()
+
+        data = replace_regex(data)
+
+        # If the only thing that changed was the date, don't refresh.  This
+        # avoids a lot of noise when only one file actually updates.
+        old_data = re.sub(
+            r'^(\.TH REPO "1" ")([^"]+)', r"\1", old_data, flags=re.M
+        )
+        new_data = re.sub(r'^(\.TH REPO "1" ")([^"]+)', r"\1", data, flags=re.M)
+        if old_data != new_data:
+            path.write_text(data)
+
+
+def replace_regex(data):
+    """Replace semantically null regexes in the data.
+
+    Args:
+        data: manpage text.
+
+    Returns:
+        Updated manpage text.
+    """
+    regex = (
+        (r"(It was generated by help2man) [0-9.]+", r"\g<1>."),
+        (r"^\033\[[0-9;]*m([^\033]*)\033\[m", r"\g<1>"),
+        (r"^\.IP\n(.*:)\n", r".SS \g<1>\n"),
+        (r"^\.PP\nDescription", r".SH DETAILS"),
+    )
+    for pattern, replacement in regex:
+        data = re.sub(pattern, replacement, data, flags=re.M)
+    return data

release/util.py

@@ -20,54 +20,60 @@ import subprocess
 import sys
 
 
-assert sys.version_info >= (3, 6), 'This module requires Python 3.6+'
+assert sys.version_info >= (3, 6), "This module requires Python 3.6+"
 
 
 TOPDIR = os.path.dirname(os.path.dirname(os.path.abspath(__file__)))
-HOMEDIR = os.path.expanduser('~')
+HOMEDIR = os.path.expanduser("~")
 
 
 # These are the release keys we sign with.
-KEYID_DSA = '8BB9AD793E8E6153AF0F9A4416530D5E920F5C65'
+KEYID_DSA = "8BB9AD793E8E6153AF0F9A4416530D5E920F5C65"
-KEYID_RSA = 'A34A13BE8E76BFF46A0C022DA2E75A824AAB9624'
+KEYID_RSA = "A34A13BE8E76BFF46A0C022DA2E75A824AAB9624"
-KEYID_ECC = 'E1F9040D7A3F6DAFAC897CD3D3B95DA243E48A39'
+KEYID_ECC = "E1F9040D7A3F6DAFAC897CD3D3B95DA243E48A39"
 
 
 def cmdstr(cmd):
-  """Get a nicely quoted shell command."""
+    """Get a nicely quoted shell command."""
-  ret = []
+    ret = []
-  for arg in cmd:
+    for arg in cmd:
-    if not re.match(r'^[a-zA-Z0-9/_.=-]+$', arg):
+        if not re.match(r"^[a-zA-Z0-9/_.=-]+$", arg):
-      arg = f'"{arg}"'
+            arg = f'"{arg}"'
-    ret.append(arg)
+        ret.append(arg)
-  return ' '.join(ret)
+    return " ".join(ret)
 
 
 def run(opts, cmd, check=True, **kwargs):
-  """Helper around subprocess.run to include logging."""
+    """Helper around subprocess.run to include logging."""
-  print('+', cmdstr(cmd))
+    print("+", cmdstr(cmd))
-  if opts.dryrun:
+    if opts.dryrun:
-    cmd = ['true', '--'] + cmd
+        cmd = ["true", "--"] + cmd
-  try:
+    try:
-    return subprocess.run(cmd, check=check, **kwargs)
+        return subprocess.run(cmd, check=check, **kwargs)
-  except subprocess.CalledProcessError as e:
+    except subprocess.CalledProcessError as e:
-    print(f'aborting: {e}', file=sys.stderr)
+        print(f"aborting: {e}", file=sys.stderr)
-    sys.exit(1)
+        sys.exit(1)
 
 
 def import_release_key(opts):
-  """Import the public key of the official release repo signing key."""
+    """Import the public key of the official release repo signing key."""
-  # Extract the key from our repo launcher.
+    # Extract the key from our repo launcher.
-  launcher = getattr(opts, 'launcher', os.path.join(TOPDIR, 'repo'))
+    launcher = getattr(opts, "launcher", os.path.join(TOPDIR, "repo"))
-  print(f'Importing keys from "{launcher}" launcher script')
+    print(f'Importing keys from "{launcher}" launcher script')
-  with open(launcher, encoding='utf-8') as fp:
+    with open(launcher, encoding="utf-8") as fp:
-    data = fp.read()
+        data = fp.read()
 
-  keys = re.findall(
+    keys = re.findall(
-      r'\n-----BEGIN PGP PUBLIC KEY BLOCK-----\n[^-]*'
+        r"\n-----BEGIN PGP PUBLIC KEY BLOCK-----\n[^-]*"
-      r'\n-----END PGP PUBLIC KEY BLOCK-----\n', data, flags=re.M)
+        r"\n-----END PGP PUBLIC KEY BLOCK-----\n",
-  run(opts, ['gpg', '--import'], input='\n'.join(keys).encode('utf-8'))
+        data,
+        flags=re.M,
+    )
+    run(opts, ["gpg", "--import"], input="\n".join(keys).encode("utf-8"))
 
-  print('Marking keys as fully trusted')
+    print("Marking keys as fully trusted")
-  run(opts, ['gpg', '--import-ownertrust'],
+    run(
-      input=f'{KEYID_DSA}:6:\n'.encode('utf-8'))
+        opts,
+        ["gpg", "--import-ownertrust"],
+        input=f"{KEYID_DSA}:6:\n".encode("utf-8"),
+    )

repo_logging.py

@@ -0,0 +1,92 @@
+# Copyright (C) 2023 The Android Open Source Project
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#      http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+"""Logic for printing user-friendly logs in repo."""
+
+import logging
+
+from color import Coloring
+from error import RepoExitError
+
+
+SEPARATOR = "=" * 80
+MAX_PRINT_ERRORS = 5
+
+
+class _ConfigMock:
+    """Default coloring config to use when Logging.config is not set."""
+
+    def __init__(self):
+        self.default_values = {"color.ui": "auto"}
+
+    def GetString(self, x):
+        return self.default_values.get(x, None)
+
+
+class _LogColoring(Coloring):
+    """Coloring outstream for logging."""
+
+    def __init__(self, config):
+        super().__init__(config, "logs")
+        self.error = self.colorer("error", fg="red")
+        self.warning = self.colorer("warn", fg="yellow")
+        self.levelMap = {
+            "WARNING": self.warning,
+            "ERROR": self.error,
+        }
+
+
+class _LogColoringFormatter(logging.Formatter):
+    """Coloring formatter for logging."""
+
+    def __init__(self, config=None, *args, **kwargs):
+        self.config = config if config else _ConfigMock()
+        self.colorer = _LogColoring(self.config)
+        super().__init__(*args, **kwargs)
+
+    def format(self, record):
+        """Formats |record| with color."""
+        msg = super().format(record)
+        colorer = self.colorer.levelMap.get(record.levelname)
+        return msg if not colorer else colorer(msg)
+
+
+class RepoLogger(logging.Logger):
+    """Repo Logging Module."""
+
+    def __init__(self, name: str, config=None, **kwargs):
+        super().__init__(name, **kwargs)
+        handler = logging.StreamHandler()
+        handler.setFormatter(_LogColoringFormatter(config))
+        self.addHandler(handler)
+
+    def log_aggregated_errors(self, err: RepoExitError):
+        """Print all aggregated logs."""
+        self.error(SEPARATOR)
+
+        if not err.aggregate_errors:
+            self.error("Repo command failed: %s", type(err).__name__)
+            return
+
+        self.error(
+            "Repo command failed due to the following `%s` errors:",
+            type(err).__name__,
+        )
+        self.error(
+            "\n".join(str(e) for e in err.aggregate_errors[:MAX_PRINT_ERRORS])
+        )
+
+        diff = len(err.aggregate_errors) - MAX_PRINT_ERRORS
+        if diff > 0:
+            self.error("+%d additional errors...", diff)

repo_trace.py

@@ -15,26 +15,157 @@
 """Logic for tracing repo interactions.
 
 Activated via `repo --trace ...` or `REPO_TRACE=1 repo ...`.
+
+Temporary: Tracing is always on. Set `REPO_TRACE=0` to turn off.
+To also include trace outputs in stderr do `repo --trace_to_stderr ...`
 """
 
-import sys
+import contextlib
 import os
+import sys
+import tempfile
+import time
+
+import platform_utils
+
 
 # Env var to implicitly turn on tracing.
-REPO_TRACE = 'REPO_TRACE'
+REPO_TRACE = "REPO_TRACE"
 
-_TRACE = os.environ.get(REPO_TRACE) == '1'
+# Temporarily set tracing to always on unless user expicitly sets to 0.
+_TRACE = os.environ.get(REPO_TRACE) != "0"
+_TRACE_TO_STDERR = False
+_TRACE_FILE = None
+_TRACE_FILE_NAME = "TRACE_FILE"
+_MAX_SIZE = 70  # in MiB
+_NEW_COMMAND_SEP = "+++++++++++++++NEW COMMAND+++++++++++++++++++"
+
+
+def IsTraceToStderr():
+    """Whether traces are written to stderr."""
+    return _TRACE_TO_STDERR
 
 
 def IsTrace():
-  return _TRACE
+    """Whether tracing is enabled."""
+    return _TRACE
+
+
+def SetTraceToStderr():
+    """Enables tracing logging to stderr."""
+    global _TRACE_TO_STDERR
+    _TRACE_TO_STDERR = True
 
 
 def SetTrace():
-  global _TRACE
+    """Enables tracing."""
-  _TRACE = True
+    global _TRACE
+    _TRACE = True
 
 
-def Trace(fmt, *args):
+def _SetTraceFile(quiet):
-  if IsTrace():
+    """Sets the trace file location."""
-    print(fmt % args, file=sys.stderr)
+    global _TRACE_FILE
+    _TRACE_FILE = _GetTraceFile(quiet)
+
+
+class Trace(contextlib.ContextDecorator):
+    """Used to capture and save git traces."""
+
+    def _time(self):
+        """Generate nanoseconds of time in a py3.6 safe way"""
+        return int(time.time() * 1e9)
+
+    def __init__(self, fmt, *args, first_trace=False, quiet=True):
+        """Initialize the object.
+
+        Args:
+            fmt: The format string for the trace.
+            *args: Arguments to pass to formatting.
+            first_trace: Whether this is the first trace of a `repo` invocation.
+            quiet: Whether to suppress notification of trace file location.
+        """
+        if not IsTrace():
+            return
+        self._trace_msg = fmt % args
+
+        if not _TRACE_FILE:
+            _SetTraceFile(quiet)
+
+        if first_trace:
+            _ClearOldTraces()
+            self._trace_msg = f"{_NEW_COMMAND_SEP} {self._trace_msg}"
+
+    def __enter__(self):
+        if not IsTrace():
+            return self
+
+        print_msg = (
+            f"PID: {os.getpid()} START: {self._time()} :{self._trace_msg}\n"
+        )
+
+        with open(_TRACE_FILE, "a") as f:
+            print(print_msg, file=f)
+
+        if _TRACE_TO_STDERR:
+            print(print_msg, file=sys.stderr)
+
+        return self
+
+    def __exit__(self, *exc):
+        if not IsTrace():
+            return False
+
+        print_msg = (
+            f"PID: {os.getpid()} END: {self._time()} :{self._trace_msg}\n"
+        )
+
+        with open(_TRACE_FILE, "a") as f:
+            print(print_msg, file=f)
+
+        if _TRACE_TO_STDERR:
+            print(print_msg, file=sys.stderr)
+
+        return False
+
+
+def _GetTraceFile(quiet):
+    """Get the trace file or create one."""
+    # TODO: refactor to pass repodir to Trace.
+    repo_dir = os.path.dirname(os.path.dirname(__file__))
+    trace_file = os.path.join(repo_dir, _TRACE_FILE_NAME)
+    if not quiet:
+        print(f"Trace outputs in {trace_file}", file=sys.stderr)
+    return trace_file
+
+
+def _ClearOldTraces():
+    """Clear the oldest commands if trace file is too big."""
+    try:
+        with open(_TRACE_FILE, "r", errors="ignore") as f:
+            if os.path.getsize(f.name) / (1024 * 1024) <= _MAX_SIZE:
+                return
+            trace_lines = f.readlines()
+    except FileNotFoundError:
+        return
+
+    while sum(len(x) for x in trace_lines) / (1024 * 1024) > _MAX_SIZE:
+        for i, line in enumerate(trace_lines):
+            if "END:" in line and _NEW_COMMAND_SEP in line:
+                trace_lines = trace_lines[i + 1 :]
+                break
+        else:
+            # The last chunk is bigger than _MAX_SIZE, so just throw everything
+            # away.
+            trace_lines = []
+
+    while trace_lines and trace_lines[-1] == "\n":
+        trace_lines = trace_lines[:-1]
+    # Write to a temporary file with a unique name in the same filesystem
+    # before replacing the original trace file.
+    temp_dir, temp_prefix = os.path.split(_TRACE_FILE)
+    with tempfile.NamedTemporaryFile(
+        "w", dir=temp_dir, prefix=temp_prefix, delete=False
+    ) as f:
+        f.writelines(trace_lines)
+    platform_utils.rename(f.name, _TRACE_FILE)

run_tests

@@ -13,49 +13,57 @@
 # See the License for the specific language governing permissions and
 # limitations under the License.
 
-"""Wrapper to run pytest with the right settings."""
+"""Wrapper to run linters and pytest with the right settings."""
 
-import errno
 import os
-import shutil
 import subprocess
 import sys
 
+import pytest
 
-def find_pytest():
-  """Try to locate a good version of pytest."""
-  # If we're in a virtualenv, assume that it's provided the right pytest.
-  if 'VIRTUAL_ENV' in os.environ:
-    return 'pytest'
 
-  # Use the Python 3 version if available.
+ROOT_DIR = os.path.dirname(os.path.realpath(__file__))
-  ret = shutil.which('pytest-3')
-  if ret:
-    return ret
 
-  # Hopefully this is a Python 3 version.
-  ret = shutil.which('pytest')
-  if ret:
-    return ret
 
-  print('%s: unable to find pytest.' % (__file__,), file=sys.stderr)
+def run_black():
-  print('%s: Try installing: sudo apt-get install python-pytest' % (__file__,),
+    """Returns the exit code from black."""
-        file=sys.stderr)
+    # Black by default only matches .py files.  We have to list standalone
+    # scripts manually.
+    extra_programs = [
+        "repo",
+        "run_tests",
+        "release/update-manpages",
+    ]
+    return subprocess.run(
+        [sys.executable, "-m", "black", "--check", ROOT_DIR] + extra_programs,
+        check=False,
+    ).returncode
+
+
+def run_flake8():
+    """Returns the exit code from flake8."""
+    return subprocess.run(
+        [sys.executable, "-m", "flake8", ROOT_DIR], check=False
+    ).returncode
+
+
+def run_isort():
+    """Returns the exit code from isort."""
+    return subprocess.run(
+        [sys.executable, "-m", "isort", "--check", ROOT_DIR], check=False
+    ).returncode
 
 
 def main(argv):
-  """The main entry."""
+    """The main entry."""
-  # Add the repo tree to PYTHONPATH as the tests expect to be able to import
+    checks = (
-  # modules directly.
+        lambda: pytest.main(argv),
-  pythonpath = os.path.dirname(os.path.realpath(__file__))
+        run_black,
-  oldpythonpath = os.environ.get('PYTHONPATH', None)
+        run_flake8,
-  if oldpythonpath is not None:
+        run_isort,
-    pythonpath += os.pathsep + oldpythonpath
+    )
-  os.environ['PYTHONPATH'] = pythonpath
+    return 0 if all(not c() for c in checks) else 1
-
-  pytest = find_pytest()
-  return subprocess.run([pytest] + argv, check=False).returncode
 
 
-if __name__ == '__main__':
+if __name__ == "__main__":
-  sys.exit(main(sys.argv[1:]))
+    sys.exit(main(sys.argv[1:]))

run_tests.vpython3

@@ -0,0 +1,130 @@
+# This is a vpython "spec" file.
+#
+# Read more about `vpython` and how to modify this file here:
+#   https://chromium.googlesource.com/infra/infra/+/main/doc/users/vpython.md
+# List of available wheels:
+#   https://chromium.googlesource.com/infra/infra/+/main/infra/tools/dockerbuild/wheels.md
+
+python_version: "3.8"
+
+wheel: <
+  name: "infra/python/wheels/pytest-py3"
+  version: "version:6.2.2"
+>
+
+# Required by pytest==6.2.2
+wheel: <
+  name: "infra/python/wheels/py-py2_py3"
+  version: "version:1.10.0"
+>
+
+# Required by pytest==6.2.2
+wheel: <
+  name: "infra/python/wheels/iniconfig-py3"
+  version: "version:1.1.1"
+>
+
+# Required by pytest==6.2.2
+wheel: <
+  name: "infra/python/wheels/packaging-py3"
+  version: "version:23.0"
+>
+
+# Required by pytest==6.2.2
+wheel: <
+  name: "infra/python/wheels/pluggy-py3"
+  version: "version:0.13.1"
+>
+
+# Required by pytest==6.2.2
+wheel: <
+  name: "infra/python/wheels/toml-py3"
+  version: "version:0.10.1"
+>
+
+# Required by pytest==6.2.2
+wheel: <
+  name: "infra/python/wheels/pyparsing-py3"
+  version: "version:3.0.7"
+>
+
+# Required by pytest==6.2.2
+wheel: <
+  name: "infra/python/wheels/attrs-py2_py3"
+  version: "version:21.4.0"
+>
+
+# Required by packaging==16.8
+wheel: <
+  name: "infra/python/wheels/six-py2_py3"
+  version: "version:1.16.0"
+>
+
+wheel: <
+  name: "infra/python/wheels/black-py3"
+  version: "version:23.1.0"
+>
+
+# Required by black==23.1.0
+wheel: <
+  name: "infra/python/wheels/mypy-extensions-py3"
+  version: "version:0.4.3"
+>
+
+# Required by black==23.1.0
+wheel: <
+  name: "infra/python/wheels/tomli-py3"
+  version: "version:2.0.1"
+>
+
+# Required by black==23.1.0
+wheel: <
+  name: "infra/python/wheels/platformdirs-py3"
+  version: "version:2.5.2"
+>
+
+# Required by black==23.1.0
+wheel: <
+  name: "infra/python/wheels/pathspec-py3"
+  version: "version:0.9.0"
+>
+
+# Required by black==23.1.0
+wheel: <
+  name: "infra/python/wheels/typing-extensions-py3"
+  version: "version:4.3.0"
+>
+
+# Required by black==23.1.0
+wheel: <
+  name: "infra/python/wheels/click-py3"
+  version: "version:8.0.3"
+>
+
+wheel: <
+  name: "infra/python/wheels/flake8-py2_py3"
+  version: "version:6.0.0"
+>
+
+# Required by flake8==6.0.0
+wheel: <
+  name: "infra/python/wheels/mccabe-py2_py3"
+  version: "version:0.7.0"
+>
+
+# Required by flake8==6.0.0
+wheel: <
+  name: "infra/python/wheels/pyflakes-py2_py3"
+  version: "version:3.0.1"
+>
+
+# Required by flake8==6.0.0
+wheel: <
+  name: "infra/python/wheels/pycodestyle-py2_py3"
+  version: "version:2.10.0"
+>
+
+wheel: <
+  name: "infra/python/wheels/isort-py3"
+  version: "version:5.10.1"
+>

setup.py

@@ -16,6 +16,7 @@
 """Python packaging for repo."""
 
 import os
+
 import setuptools
 
 
@@ -23,39 +24,39 @@ TOPDIR = os.path.dirname(os.path.abspath(__file__))
 
 
 # Rip out the first intro paragraph.
-with open(os.path.join(TOPDIR, 'README.md')) as fp:
+with open(os.path.join(TOPDIR, "README.md")) as fp:
     lines = fp.read().splitlines()[2:]
-    end = lines.index('')
+    end = lines.index("")
-    long_description = ' '.join(lines[0:end])
+    long_description = " ".join(lines[0:end])
 
 
 # https://packaging.python.org/tutorials/packaging-projects/
 setuptools.setup(
-    name='repo',
+    name="repo",
-    version='2',
+    version="2",
-    maintainer='Various',
+    maintainer="Various",
-    maintainer_email='repo-discuss@googlegroups.com',
+    maintainer_email="repo-discuss@googlegroups.com",
-    description='Repo helps manage many Git repositories',
+    description="Repo helps manage many Git repositories",
     long_description=long_description,
-    long_description_content_type='text/plain',
+    long_description_content_type="text/plain",
-    url='https://gerrit.googlesource.com/git-repo/',
+    url="https://gerrit.googlesource.com/git-repo/",
     project_urls={
-        'Bug Tracker': 'https://bugs.chromium.org/p/gerrit/issues/list?q=component:repo',
+        "Bug Tracker": "https://issues.gerritcodereview.com/issues?q=is:open%20componentid:1370071",  # noqa: E501
     },
     # https://pypi.org/classifiers/
     classifiers=[
-        'Development Status :: 6 - Mature',
+        "Development Status :: 6 - Mature",
-        'Environment :: Console',
+        "Environment :: Console",
-        'Intended Audience :: Developers',
+        "Intended Audience :: Developers",
-        'License :: OSI Approved :: Apache Software License',
+        "License :: OSI Approved :: Apache Software License",
-        'Natural Language :: English',
+        "Natural Language :: English",
-        'Operating System :: MacOS :: MacOS X',
+        "Operating System :: MacOS :: MacOS X",
-        'Operating System :: Microsoft :: Windows :: Windows 10',
+        "Operating System :: Microsoft :: Windows :: Windows 10",
-        'Operating System :: POSIX :: Linux',
+        "Operating System :: POSIX :: Linux",
-        'Programming Language :: Python :: 3',
+        "Programming Language :: Python :: 3",
-        'Programming Language :: Python :: 3 :: Only',
+        "Programming Language :: Python :: 3 :: Only",
-        'Topic :: Software Development :: Version Control :: Git',
+        "Topic :: Software Development :: Version Control :: Git",
     ],
-    python_requires='>=3.6',
+    python_requires=">=3.6",
-    packages=['subcmds'],
+    packages=["subcmds"],
 )

ssh.py

@@ -28,253 +28,264 @@ import platform_utils
 from repo_trace import Trace
 
 
-PROXY_PATH = os.path.join(os.path.dirname(__file__), 'git_ssh')
+PROXY_PATH = os.path.join(os.path.dirname(__file__), "git_ssh")
 
 
 def _run_ssh_version():
-  """run ssh -V to display the version number"""
+    """run ssh -V to display the version number"""
-  return subprocess.check_output(['ssh', '-V'], stderr=subprocess.STDOUT).decode()
+    return subprocess.check_output(
+        ["ssh", "-V"], stderr=subprocess.STDOUT
+    ).decode()
 
 
 def _parse_ssh_version(ver_str=None):
-  """parse a ssh version string into a tuple"""
+    """parse a ssh version string into a tuple"""
-  if ver_str is None:
+    if ver_str is None:
-    ver_str = _run_ssh_version()
+        ver_str = _run_ssh_version()
-  m = re.match(r'^OpenSSH_([0-9.]+)(p[0-9]+)?\s', ver_str)
+    m = re.match(r"^OpenSSH_([0-9.]+)(p[0-9]+)?[\s,]", ver_str)
-  if m:
+    if m:
-    return tuple(int(x) for x in m.group(1).split('.'))
+        return tuple(int(x) for x in m.group(1).split("."))
-  else:
+    else:
-    return ()
+        return ()
 
 
 @functools.lru_cache(maxsize=None)
 def version():
-  """return ssh version as a tuple"""
+    """return ssh version as a tuple"""
-  try:
+    try:
-    return _parse_ssh_version()
+        return _parse_ssh_version()
-  except FileNotFoundError:
+    except FileNotFoundError:
-    print('fatal: ssh not installed', file=sys.stderr)
+        print("fatal: ssh not installed", file=sys.stderr)
-    sys.exit(1)
+        sys.exit(1)
-  except subprocess.CalledProcessError:
+    except subprocess.CalledProcessError:
-    print('fatal: unable to detect ssh version', file=sys.stderr)
+        print("fatal: unable to detect ssh version", file=sys.stderr)
-    sys.exit(1)
+        sys.exit(1)
 
 
-URI_SCP = re.compile(r'^([^@:]*@?[^:/]{1,}):')
+URI_SCP = re.compile(r"^([^@:]*@?[^:/]{1,}):")
-URI_ALL = re.compile(r'^([a-z][a-z+-]*)://([^@/]*@?[^/]*)/')
+URI_ALL = re.compile(r"^([a-z][a-z+-]*)://([^@/]*@?[^/]*)/")
 
 
 class ProxyManager:
-  """Manage various ssh clients & masters that we spawn.
+    """Manage various ssh clients & masters that we spawn.
 
-  This will take care of sharing state between multiprocessing children, and
+    This will take care of sharing state between multiprocessing children, and
-  make sure that if we crash, we don't leak any of the ssh sessions.
+    make sure that if we crash, we don't leak any of the ssh sessions.
 
-  The code should work with a single-process scenario too, and not add too much
+    The code should work with a single-process scenario too, and not add too
-  overhead due to the manager.
+    much overhead due to the manager.
-  """
-
-  # Path to the ssh program to run which will pass our master settings along.
-  # Set here more as a convenience API.
-  proxy = PROXY_PATH
-
-  def __init__(self, manager):
-    # Protect access to the list of active masters.
-    self._lock = multiprocessing.Lock()
-    # List of active masters (pid).  These will be spawned on demand, and we are
-    # responsible for shutting them all down at the end.
-    self._masters = manager.list()
-    # Set of active masters indexed by "host:port" information.
-    # The value isn't used, but multiprocessing doesn't provide a set class.
-    self._master_keys = manager.dict()
-    # Whether ssh masters are known to be broken, so we give up entirely.
-    self._master_broken = manager.Value('b', False)
-    # List of active ssh sesssions.  Clients will be added & removed as
-    # connections finish, so this list is just for safety & cleanup if we crash.
-    self._clients = manager.list()
-    # Path to directory for holding master sockets.
-    self._sock_path = None
-
-  def __enter__(self):
-    """Enter a new context."""
-    return self
-
-  def __exit__(self, exc_type, exc_value, traceback):
-    """Exit a context & clean up all resources."""
-    self.close()
-
-  def add_client(self, proc):
-    """Track a new ssh session."""
-    self._clients.append(proc.pid)
-
-  def remove_client(self, proc):
-    """Remove a completed ssh session."""
-    try:
-      self._clients.remove(proc.pid)
-    except ValueError:
-      pass
-
-  def add_master(self, proc):
-    """Track a new master connection."""
-    self._masters.append(proc.pid)
-
-  def _terminate(self, procs):
-    """Kill all |procs|."""
-    for pid in procs:
-      try:
-        os.kill(pid, signal.SIGTERM)
-        os.waitpid(pid, 0)
-      except OSError:
-        pass
-
-    # The multiprocessing.list() API doesn't provide many standard list()
-    # methods, so we have to manually clear the list.
-    while True:
-      try:
-        procs.pop(0)
-      except:
-        break
-
-  def close(self):
-    """Close this active ssh session.
-
-    Kill all ssh clients & masters we created, and nuke the socket dir.
     """
-    self._terminate(self._clients)
-    self._terminate(self._masters)
 
-    d = self.sock(create=False)
+    # Path to the ssh program to run which will pass our master settings along.
-    if d:
+    # Set here more as a convenience API.
-      try:
+    proxy = PROXY_PATH
-        platform_utils.rmdir(os.path.dirname(d))
-      except OSError:
-        pass
 
-  def _open_unlocked(self, host, port=None):
+    def __init__(self, manager):
-    """Make sure a ssh master session exists for |host| & |port|.
+        # Protect access to the list of active masters.
+        self._lock = multiprocessing.Lock()
+        # List of active masters (pid).  These will be spawned on demand, and we
+        # are responsible for shutting them all down at the end.
+        self._masters = manager.list()
+        # Set of active masters indexed by "host:port" information.
+        # The value isn't used, but multiprocessing doesn't provide a set class.
+        self._master_keys = manager.dict()
+        # Whether ssh masters are known to be broken, so we give up entirely.
+        self._master_broken = manager.Value("b", False)
+        # List of active ssh sesssions.  Clients will be added & removed as
+        # connections finish, so this list is just for safety & cleanup if we
+        # crash.
+        self._clients = manager.list()
+        # Path to directory for holding master sockets.
+        self._sock_path = None
 
-    If one doesn't exist already, we'll create it.
+    def __enter__(self):
+        """Enter a new context."""
+        return self
 
-    We won't grab any locks, so the caller has to do that.  This helps keep the
+    def __exit__(self, exc_type, exc_value, traceback):
-    business logic of actually creating the master separate from grabbing locks.
+        """Exit a context & clean up all resources."""
-    """
+        self.close()
-    # Check to see whether we already think that the master is running; if we
-    # think it's already running, return right away.
-    if port is not None:
-      key = '%s:%s' % (host, port)
-    else:
-      key = host
 
-    if key in self._master_keys:
+    def add_client(self, proc):
-      return True
+        """Track a new ssh session."""
+        self._clients.append(proc.pid)
 
-    if self._master_broken.value or 'GIT_SSH' in os.environ:
+    def remove_client(self, proc):
-      # Failed earlier, so don't retry.
+        """Remove a completed ssh session."""
-      return False
+        try:
+            self._clients.remove(proc.pid)
+        except ValueError:
+            pass
 
-    # We will make two calls to ssh; this is the common part of both calls.
+    def add_master(self, proc):
-    command_base = ['ssh', '-o', 'ControlPath %s' % self.sock(), host]
+        """Track a new master connection."""
-    if port is not None:
+        self._masters.append(proc.pid)
-      command_base[1:1] = ['-p', str(port)]
 
-    # Since the key wasn't in _master_keys, we think that master isn't running.
+    def _terminate(self, procs):
-    # ...but before actually starting a master, we'll double-check.  This can
+        """Kill all |procs|."""
-    # be important because we can't tell that that 'git@myhost.com' is the same
+        for pid in procs:
-    # as 'myhost.com' where "User git" is setup in the user's ~/.ssh/config file.
+            try:
-    check_command = command_base + ['-O', 'check']
+                os.kill(pid, signal.SIGTERM)
-    try:
+                os.waitpid(pid, 0)
-      Trace(': %s', ' '.join(check_command))
+            except OSError:
-      check_process = subprocess.Popen(check_command,
+                pass
-                                       stdout=subprocess.PIPE,
-                                       stderr=subprocess.PIPE)
-      check_process.communicate()  # read output, but ignore it...
-      isnt_running = check_process.wait()
 
-      if not isnt_running:
+        # The multiprocessing.list() API doesn't provide many standard list()
-        # Our double-check found that the master _was_ infact running.  Add to
+        # methods, so we have to manually clear the list.
-        # the list of keys.
+        while True:
+            try:
+                procs.pop(0)
+            except:  # noqa: E722
+                break
+
+    def close(self):
+        """Close this active ssh session.
+
+        Kill all ssh clients & masters we created, and nuke the socket dir.
+        """
+        self._terminate(self._clients)
+        self._terminate(self._masters)
+
+        d = self.sock(create=False)
+        if d:
+            try:
+                platform_utils.rmdir(os.path.dirname(d))
+            except OSError:
+                pass
+
+    def _open_unlocked(self, host, port=None):
+        """Make sure a ssh master session exists for |host| & |port|.
+
+        If one doesn't exist already, we'll create it.
+
+        We won't grab any locks, so the caller has to do that.  This helps keep
+        the business logic of actually creating the master separate from
+        grabbing locks.
+        """
+        # Check to see whether we already think that the master is running; if
+        # we think it's already running, return right away.
+        if port is not None:
+            key = "%s:%s" % (host, port)
+        else:
+            key = host
+
+        if key in self._master_keys:
+            return True
+
+        if self._master_broken.value or "GIT_SSH" in os.environ:
+            # Failed earlier, so don't retry.
+            return False
+
+        # We will make two calls to ssh; this is the common part of both calls.
+        command_base = ["ssh", "-o", "ControlPath %s" % self.sock(), host]
+        if port is not None:
+            command_base[1:1] = ["-p", str(port)]
+
+        # Since the key wasn't in _master_keys, we think that master isn't
+        # running... but before actually starting a master, we'll double-check.
+        # This can be important because we can't tell that that 'git@myhost.com'
+        # is the same as 'myhost.com' where "User git" is setup in the user's
+        # ~/.ssh/config file.
+        check_command = command_base + ["-O", "check"]
+        with Trace("Call to ssh (check call): %s", " ".join(check_command)):
+            try:
+                check_process = subprocess.Popen(
+                    check_command,
+                    stdout=subprocess.PIPE,
+                    stderr=subprocess.PIPE,
+                )
+                check_process.communicate()  # read output, but ignore it...
+                isnt_running = check_process.wait()
+
+                if not isnt_running:
+                    # Our double-check found that the master _was_ infact
+                    # running.  Add to the list of keys.
+                    self._master_keys[key] = True
+                    return True
+            except Exception:
+                # Ignore excpetions.  We we will fall back to the normal command
+                # and print to the log there.
+                pass
+
+        command = command_base[:1] + ["-M", "-N"] + command_base[1:]
+        p = None
+        try:
+            with Trace("Call to ssh: %s", " ".join(command)):
+                p = subprocess.Popen(command)
+        except Exception as e:
+            self._master_broken.value = True
+            print(
+                "\nwarn: cannot enable ssh control master for %s:%s\n%s"
+                % (host, port, str(e)),
+                file=sys.stderr,
+            )
+            return False
+
+        time.sleep(1)
+        ssh_died = p.poll() is not None
+        if ssh_died:
+            return False
+
+        self.add_master(p)
         self._master_keys[key] = True
         return True
-    except Exception:
-      # Ignore excpetions.  We we will fall back to the normal command and print
-      # to the log there.
-      pass
 
-    command = command_base[:1] + ['-M', '-N'] + command_base[1:]
+    def _open(self, host, port=None):
-    try:
+        """Make sure a ssh master session exists for |host| & |port|.
-      Trace(': %s', ' '.join(command))
-      p = subprocess.Popen(command)
-    except Exception as e:
-      self._master_broken.value = True
-      print('\nwarn: cannot enable ssh control master for %s:%s\n%s'
-            % (host, port, str(e)), file=sys.stderr)
-      return False
 
-    time.sleep(1)
+        If one doesn't exist already, we'll create it.
-    ssh_died = (p.poll() is not None)
-    if ssh_died:
-      return False
 
-    self.add_master(p)
+        This will obtain any necessary locks to avoid inter-process races.
-    self._master_keys[key] = True
+        """
-    return True
+        # Bail before grabbing the lock if we already know that we aren't going
+        # to try creating new masters below.
+        if sys.platform in ("win32", "cygwin"):
+            return False
 
-  def _open(self, host, port=None):
+        # Acquire the lock.  This is needed to prevent opening multiple masters
-    """Make sure a ssh master session exists for |host| & |port|.
+        # for the same host when we're running "repo sync -jN" (for N > 1) _and_
+        # the manifest <remote fetch="ssh://xyz"> specifies a different host
+        # from the one that was passed to repo init.
+        with self._lock:
+            return self._open_unlocked(host, port)
 
-    If one doesn't exist already, we'll create it.
+    def preconnect(self, url):
+        """If |uri| will create a ssh connection, setup the ssh master for it."""  # noqa: E501
+        m = URI_ALL.match(url)
+        if m:
+            scheme = m.group(1)
+            host = m.group(2)
+            if ":" in host:
+                host, port = host.split(":")
+            else:
+                port = None
+            if scheme in ("ssh", "git+ssh", "ssh+git"):
+                return self._open(host, port)
+            return False
 
-    This will obtain any necessary locks to avoid inter-process races.
+        m = URI_SCP.match(url)
-    """
+        if m:
-    # Bail before grabbing the lock if we already know that we aren't going to
+            host = m.group(1)
-    # try creating new masters below.
+            return self._open(host)
-    if sys.platform in ('win32', 'cygwin'):
-      return False
 
-    # Acquire the lock.  This is needed to prevent opening multiple masters for
+        return False
-    # the same host when we're running "repo sync -jN" (for N > 1) _and_ the
-    # manifest <remote fetch="ssh://xyz"> specifies a different host from the
-    # one that was passed to repo init.
-    with self._lock:
-      return self._open_unlocked(host, port)
 
-  def preconnect(self, url):
+    def sock(self, create=True):
-    """If |uri| will create a ssh connection, setup the ssh master for it."""
+        """Return the path to the ssh socket dir.
-    m = URI_ALL.match(url)
-    if m:
-      scheme = m.group(1)
-      host = m.group(2)
-      if ':' in host:
-        host, port = host.split(':')
-      else:
-        port = None
-      if scheme in ('ssh', 'git+ssh', 'ssh+git'):
-        return self._open(host, port)
-      return False
 
-    m = URI_SCP.match(url)
+        This has all the master sockets so clients can talk to them.
-    if m:
+        """
-      host = m.group(1)
+        if self._sock_path is None:
-      return self._open(host)
+            if not create:
-
+                return None
-    return False
+            tmp_dir = "/tmp"
-
+            if not os.path.exists(tmp_dir):
-  def sock(self, create=True):
+                tmp_dir = tempfile.gettempdir()
-    """Return the path to the ssh socket dir.
+            if version() < (6, 7):
-
+                tokens = "%r@%h:%p"
-    This has all the master sockets so clients can talk to them.
+            else:
-    """
+                tokens = "%C"  # hash of %l%h%p%r
-    if self._sock_path is None:
+            self._sock_path = os.path.join(
-      if not create:
+                tempfile.mkdtemp("", "ssh-", tmp_dir), "master-" + tokens
-        return None
+            )
-      tmp_dir = '/tmp'
+        return self._sock_path
-      if not os.path.exists(tmp_dir):
-        tmp_dir = tempfile.gettempdir()
-      if version() < (6, 7):
-        tokens = '%r@%h:%p'
-      else:
-        tokens = '%C'  # hash of %l%h%p%r
-      self._sock_path = os.path.join(
-          tempfile.mkdtemp('', 'ssh-', tmp_dir),
-          'master-' + tokens)
-    return self._sock_path

subcmds/__init__.py

@@ -14,36 +14,37 @@
 
 import os
 
+
 # A mapping of the subcommand name to the class that implements it.
 all_commands = {}
+all_modules = []
 
 my_dir = os.path.dirname(__file__)
 for py in os.listdir(my_dir):
-  if py == '__init__.py':
+    if py == "__init__.py":
-    continue
+        continue
 
-  if py.endswith('.py'):
+    if py.endswith(".py"):
-    name = py[:-3]
+        name = py[:-3]
 
-    clsn = name.capitalize()
+        clsn = name.capitalize()
-    while clsn.find('_') > 0:
+        while clsn.find("_") > 0:
-      h = clsn.index('_')
+            h = clsn.index("_")
-      clsn = clsn[0:h] + clsn[h + 1:].capitalize()
+            clsn = clsn[0:h] + clsn[h + 1 :].capitalize()
 
-    mod = __import__(__name__,
+        mod = __import__(__name__, globals(), locals(), ["%s" % name])
-                     globals(),
+        mod = getattr(mod, name)
-                     locals(),
+        try:
-                     ['%s' % name])
+            cmd = getattr(mod, clsn)
-    mod = getattr(mod, name)
+        except AttributeError:
-    try:
+            raise SyntaxError(
-      cmd = getattr(mod, clsn)
+                "%s/%s does not define class %s" % (__name__, py, clsn)
-    except AttributeError:
+            )
-      raise SyntaxError('%s/%s does not define class %s' % (
-          __name__, py, clsn))
 
-    name = name.replace('_', '-')
+        name = name.replace("_", "-")
-    cmd.NAME = name
+        cmd.NAME = name
-    all_commands[name] = cmd
+        all_commands[name] = cmd
+        all_modules.append(mod)
 
 # Add 'branch' as an alias for 'branches'.
-all_commands['branch'] = all_commands['branches']
+all_commands["branch"] = all_commands["branches"]

subcmds/abandon.py

@@ -12,20 +12,30 @@
 # See the License for the specific language governing permissions and
 # limitations under the License.
 
-from collections import defaultdict
+import collections
 import functools
 import itertools
-import sys
 
-from command import Command, DEFAULT_LOCAL_JOBS
+from command import Command
+from command import DEFAULT_LOCAL_JOBS
+from error import RepoError
+from error import RepoExitError
 from git_command import git
 from progress import Progress
+from repo_logging import RepoLogger
+
+
+logger = RepoLogger(__file__)
+
+
+class AbandonError(RepoExitError):
+    """Exit error when abandon command fails."""
 
 
 class Abandon(Command):
-  COMMON = True
+    COMMON = True
-  helpSummary = "Permanently abandon a development branch"
+    helpSummary = "Permanently abandon a development branch"
-  helpUsage = """
+    helpUsage = """
 %prog [--all | <branchname>] [<project>...]
 
 This subcommand permanently abandons a development branch by
@@ -33,83 +43,113 @@ deleting it (and all its history) from your local repository.
 
 It is equivalent to "git branch -D <branchname>".
 """
-  PARALLEL_JOBS = DEFAULT_LOCAL_JOBS
+    PARALLEL_JOBS = DEFAULT_LOCAL_JOBS
 
-  def _Options(self, p):
+    def _Options(self, p):
-    p.add_option('--all',
+        p.add_option(
-                 dest='all', action='store_true',
+            "--all",
-                 help='delete all branches in all projects')
+            dest="all",
+            action="store_true",
+            help="delete all branches in all projects",
+        )
 
-  def ValidateOptions(self, opt, args):
+    def ValidateOptions(self, opt, args):
-    if not opt.all and not args:
+        if not opt.all and not args:
-      self.Usage()
+            self.Usage()
 
-    if not opt.all:
+        if not opt.all:
-      nb = args[0]
+            branches = args[0].split()
-      if not git.check_ref_format('heads/%s' % nb):
+            invalid_branches = [
-        self.OptionParser.error("'%s' is not a valid branch name" % nb)
+                x for x in branches if not git.check_ref_format(f"heads/{x}")
-    else:
+            ]
-      args.insert(0, "'All local branches'")
 
-  def _ExecuteOne(self, all_branches, nb, project):
+            if invalid_branches:
-    """Abandon one project."""
+                self.OptionParser.error(
-    if all_branches:
+                    f"{invalid_branches} are not valid branch names"
-      branches = project.GetBranches()
+                )
-    else:
-      branches = [nb]
-
-    ret = {}
-    for name in branches:
-      status = project.AbandonBranch(name)
-      if status is not None:
-        ret[name] = status
-    return (ret, project)
-
-  def Execute(self, opt, args):
-    nb = args[0]
-    err = defaultdict(list)
-    success = defaultdict(list)
-    all_projects = self.GetProjects(args[1:], all_manifests=not opt.this_manifest_only)
-    _RelPath = lambda p: p.RelPath(local=opt.this_manifest_only)
-
-    def _ProcessResults(_pool, pm, states):
-      for (results, project) in states:
-        for branch, status in results.items():
-          if status:
-            success[branch].append(project)
-          else:
-            err[branch].append(project)
-        pm.update()
-
-    self.ExecuteInParallel(
-        opt.jobs,
-        functools.partial(self._ExecuteOne, opt.all, nb),
-        all_projects,
-        callback=_ProcessResults,
-        output=Progress('Abandon %s' % (nb,), len(all_projects), quiet=opt.quiet))
-
-    width = max(itertools.chain(
-        [25], (len(x) for x in itertools.chain(success, err))))
-    if err:
-      for br in err.keys():
-        err_msg = "error: cannot abandon %s" % br
-        print(err_msg, file=sys.stderr)
-        for proj in err[br]:
-          print(' ' * len(err_msg) + " | %s" % _RelPath(proj), file=sys.stderr)
-      sys.exit(1)
-    elif not success:
-      print('error: no project has local branch(es) : %s' % nb,
-            file=sys.stderr)
-      sys.exit(1)
-    else:
-      # Everything below here is displaying status.
-      if opt.quiet:
-        return
-      print('Abandoned branches:')
-      for br in success.keys():
-        if len(all_projects) > 1 and len(all_projects) == len(success[br]):
-          result = "all project"
         else:
-          result = "%s" % (
+            args.insert(0, "'All local branches'")
-              ('\n' + ' ' * width + '| ').join(_RelPath(p) for p in success[br]))
+
-        print("%s%s| %s\n" % (br, ' ' * (width - len(br)), result))
+    def _ExecuteOne(self, all_branches, nb, project):
+        """Abandon one project."""
+        if all_branches:
+            branches = project.GetBranches()
+        else:
+            branches = nb
+
+        ret = {}
+        errors = []
+        for name in branches:
+            status = None
+            try:
+                status = project.AbandonBranch(name)
+            except RepoError as e:
+                status = False
+                errors.append(e)
+            if status is not None:
+                ret[name] = status
+
+        return (ret, project, errors)
+
+    def Execute(self, opt, args):
+        nb = args[0].split()
+        err = collections.defaultdict(list)
+        success = collections.defaultdict(list)
+        aggregate_errors = []
+        all_projects = self.GetProjects(
+            args[1:], all_manifests=not opt.this_manifest_only
+        )
+        _RelPath = lambda p: p.RelPath(local=opt.this_manifest_only)
+
+        def _ProcessResults(_pool, pm, states):
+            for results, project, errors in states:
+                for branch, status in results.items():
+                    if status:
+                        success[branch].append(project)
+                    else:
+                        err[branch].append(project)
+                aggregate_errors.extend(errors)
+                pm.update(msg="")
+
+        self.ExecuteInParallel(
+            opt.jobs,
+            functools.partial(self._ExecuteOne, opt.all, nb),
+            all_projects,
+            callback=_ProcessResults,
+            output=Progress(
+                "Abandon %s" % (nb,), len(all_projects), quiet=opt.quiet
+            ),
+        )
+
+        width = max(
+            itertools.chain(
+                [25], (len(x) for x in itertools.chain(success, err))
+            )
+        )
+        if err:
+            for br in err.keys():
+                err_msg = "error: cannot abandon %s" % br
+                logger.error(err_msg)
+                for proj in err[br]:
+                    logger.error(" " * len(err_msg) + " | %s", _RelPath(proj))
+            raise AbandonError(aggregate_errors=aggregate_errors)
+        elif not success:
+            logger.error("error: no project has local branch(es) : %s", nb)
+            raise AbandonError(aggregate_errors=aggregate_errors)
+        else:
+            # Everything below here is displaying status.
+            if opt.quiet:
+                return
+            print("Abandoned branches:")
+            for br in success.keys():
+                if len(all_projects) > 1 and len(all_projects) == len(
+                    success[br]
+                ):
+                    result = "all project"
+                else:
+                    result = "%s" % (
+                        ("\n" + " " * width + "| ").join(
+                            _RelPath(p) for p in success[br]
+                        )
+                    )
+                print("%s%s| %s\n" % (br, " " * (width - len(br)), result))

subcmds/branches.py

@@ -16,55 +16,56 @@ import itertools
 import sys
 
 from color import Coloring
-from command import Command, DEFAULT_LOCAL_JOBS
+from command import Command
+from command import DEFAULT_LOCAL_JOBS
 
 
 class BranchColoring(Coloring):
-  def __init__(self, config):
+    def __init__(self, config):
-    Coloring.__init__(self, config, 'branch')
+        Coloring.__init__(self, config, "branch")
-    self.current = self.printer('current', fg='green')
+        self.current = self.printer("current", fg="green")
-    self.local = self.printer('local')
+        self.local = self.printer("local")
-    self.notinproject = self.printer('notinproject', fg='red')
+        self.notinproject = self.printer("notinproject", fg="red")
 
 
 class BranchInfo(object):
-  def __init__(self, name):
+    def __init__(self, name):
-    self.name = name
+        self.name = name
-    self.current = 0
+        self.current = 0
-    self.published = 0
+        self.published = 0
-    self.published_equal = 0
+        self.published_equal = 0
-    self.projects = []
+        self.projects = []
 
-  def add(self, b):
+    def add(self, b):
-    if b.current:
+        if b.current:
-      self.current += 1
+            self.current += 1
-    if b.published:
+        if b.published:
-      self.published += 1
+            self.published += 1
-    if b.revision == b.published:
+        if b.revision == b.published:
-      self.published_equal += 1
+            self.published_equal += 1
-    self.projects.append(b)
+        self.projects.append(b)
 
-  @property
+    @property
-  def IsCurrent(self):
+    def IsCurrent(self):
-    return self.current > 0
+        return self.current > 0
 
-  @property
+    @property
-  def IsSplitCurrent(self):
+    def IsSplitCurrent(self):
-    return self.current != 0 and self.current != len(self.projects)
+        return self.current != 0 and self.current != len(self.projects)
 
-  @property
+    @property
-  def IsPublished(self):
+    def IsPublished(self):
-    return self.published > 0
+        return self.published > 0
 
-  @property
+    @property
-  def IsPublishedEqual(self):
+    def IsPublishedEqual(self):
-    return self.published_equal == len(self.projects)
+        return self.published_equal == len(self.projects)
 
 
 class Branches(Command):
-  COMMON = True
+    COMMON = True
-  helpSummary = "View current topic branches"
+    helpSummary = "View current topic branches"
-  helpUsage = """
+    helpUsage = """
 %prog [<project>...]
 
 Summarizes the currently available topic branches.
@@ -95,111 +96,114 @@ the branch appears in, or does not appear in.  If no project list
 is shown, then the branch appears in all projects.
 
 """
-  PARALLEL_JOBS = DEFAULT_LOCAL_JOBS
+    PARALLEL_JOBS = DEFAULT_LOCAL_JOBS
 
-  def Execute(self, opt, args):
+    def Execute(self, opt, args):
-    projects = self.GetProjects(args, all_manifests=not opt.this_manifest_only)
+        projects = self.GetProjects(
-    out = BranchColoring(self.manifest.manifestProject.config)
+            args, all_manifests=not opt.this_manifest_only
-    all_branches = {}
+        )
-    project_cnt = len(projects)
+        out = BranchColoring(self.manifest.manifestProject.config)
+        all_branches = {}
+        project_cnt = len(projects)
 
-    def _ProcessResults(_pool, _output, results):
+        def _ProcessResults(_pool, _output, results):
-      for name, b in itertools.chain.from_iterable(results):
+            for name, b in itertools.chain.from_iterable(results):
-        if name not in all_branches:
+                if name not in all_branches:
-          all_branches[name] = BranchInfo(name)
+                    all_branches[name] = BranchInfo(name)
-        all_branches[name].add(b)
+                all_branches[name].add(b)
 
-    self.ExecuteInParallel(
+        self.ExecuteInParallel(
-        opt.jobs,
+            opt.jobs,
-        expand_project_to_branches,
+            expand_project_to_branches,
-        projects,
+            projects,
-        callback=_ProcessResults)
+            callback=_ProcessResults,
+        )
 
-    names = sorted(all_branches)
+        names = sorted(all_branches)
 
-    if not names:
+        if not names:
-      print('   (no branches)', file=sys.stderr)
+            print("   (no branches)", file=sys.stderr)
-      return
+            return
 
-    width = 25
+        width = 25
-    for name in names:
+        for name in names:
-      if width < len(name):
+            if width < len(name):
-        width = len(name)
+                width = len(name)
 
-    for name in names:
+        for name in names:
-      i = all_branches[name]
+            i = all_branches[name]
-      in_cnt = len(i.projects)
+            in_cnt = len(i.projects)
 
-      if i.IsCurrent:
+            if i.IsCurrent:
-        current = '*'
+                current = "*"
-        hdr = out.current
+                hdr = out.current
-      else:
-        current = ' '
-        hdr = out.local
-
-      if i.IsPublishedEqual:
-        published = 'P'
-      elif i.IsPublished:
-        published = 'p'
-      else:
-        published = ' '
-
-      hdr('%c%c %-*s' % (current, published, width, name))
-      out.write(' |')
-
-      _RelPath = lambda p: p.RelPath(local=opt.this_manifest_only)
-      if in_cnt < project_cnt:
-        fmt = out.write
-        paths = []
-        non_cur_paths = []
-        if i.IsSplitCurrent or (in_cnt <= project_cnt - in_cnt):
-          in_type = 'in'
-          for b in i.projects:
-            relpath = b.project.relpath
-            if not i.IsSplitCurrent or b.current:
-              paths.append(_RelPath(b.project))
             else:
-              non_cur_paths.append(_RelPath(b.project))
+                current = " "
-        else:
+                hdr = out.local
-          fmt = out.notinproject
-          in_type = 'not in'
-          have = set()
-          for b in i.projects:
-            have.add(_RelPath(b.project))
-          for p in projects:
-            if _RelPath(p) not in have:
-              paths.append(_RelPath(p))
 
-        s = ' %s %s' % (in_type, ', '.join(paths))
+            if i.IsPublishedEqual:
-        if not i.IsSplitCurrent and (width + 7 + len(s) < 80):
+                published = "P"
-          fmt = out.current if i.IsCurrent else fmt
+            elif i.IsPublished:
-          fmt(s)
+                published = "p"
-        else:
+            else:
-          fmt(' %s:' % in_type)
+                published = " "
-          fmt = out.current if i.IsCurrent else out.write
+
-          for p in paths:
+            hdr("%c%c %-*s" % (current, published, width, name))
+            out.write(" |")
+
+            _RelPath = lambda p: p.RelPath(local=opt.this_manifest_only)
+            if in_cnt < project_cnt:
+                fmt = out.write
+                paths = []
+                non_cur_paths = []
+                if i.IsSplitCurrent or (in_cnt <= project_cnt - in_cnt):
+                    in_type = "in"
+                    for b in i.projects:
+                        relpath = _RelPath(b.project)
+                        if not i.IsSplitCurrent or b.current:
+                            paths.append(relpath)
+                        else:
+                            non_cur_paths.append(relpath)
+                else:
+                    fmt = out.notinproject
+                    in_type = "not in"
+                    have = set()
+                    for b in i.projects:
+                        have.add(_RelPath(b.project))
+                    for p in projects:
+                        if _RelPath(p) not in have:
+                            paths.append(_RelPath(p))
+
+                s = " %s %s" % (in_type, ", ".join(paths))
+                if not i.IsSplitCurrent and (width + 7 + len(s) < 80):
+                    fmt = out.current if i.IsCurrent else fmt
+                    fmt(s)
+                else:
+                    fmt(" %s:" % in_type)
+                    fmt = out.current if i.IsCurrent else out.write
+                    for p in paths:
+                        out.nl()
+                        fmt(width * " " + "          %s" % p)
+                    fmt = out.write
+                    for p in non_cur_paths:
+                        out.nl()
+                        fmt(width * " " + "          %s" % p)
+            else:
+                out.write(" in all projects")
             out.nl()
-            fmt(width * ' ' + '          %s' % p)
-          fmt = out.write
-          for p in non_cur_paths:
-            out.nl()
-            fmt(width * ' ' + '          %s' % p)
-      else:
-        out.write(' in all projects')
-      out.nl()
 
 
 def expand_project_to_branches(project):
-  """Expands a project into a list of branch names & associated information.
+    """Expands a project into a list of branch names & associated information.
 
-  Args:
+    Args:
-    project: project.Project
+        project: project.Project
 
-  Returns:
+    Returns:
-    List[Tuple[str, git_config.Branch]]
+        List[Tuple[str, git_config.Branch]]
-  """
+    """
-  branches = []
+    branches = []
-  for name, b in project.GetBranches().items():
+    for name, b in project.GetBranches().items():
-    b.project = project
+        b.project = project
-    branches.append((name, b))
+        branches.append((name, b))
-  return branches
+    return branches

subcmds/checkout.py

@@ -13,19 +13,42 @@
 # limitations under the License.
 
 import functools
-import sys
+from typing import NamedTuple
 
-from command import Command, DEFAULT_LOCAL_JOBS
+from command import Command
+from command import DEFAULT_LOCAL_JOBS
+from error import GitError
+from error import RepoExitError
 from progress import Progress
+from project import Project
+from repo_logging import RepoLogger
+
+
+logger = RepoLogger(__file__)
+
+
+class CheckoutBranchResult(NamedTuple):
+    # Whether the Project is on the branch (i.e. branch exists and no errors)
+    result: bool
+    project: Project
+    error: Exception
+
+
+class CheckoutCommandError(RepoExitError):
+    """Exception thrown when checkout command fails."""
+
+
+class MissingBranchError(RepoExitError):
+    """Exception thrown when no project has specified branch."""
 
 
 class Checkout(Command):
-  COMMON = True
+    COMMON = True
-  helpSummary = "Checkout a branch for development"
+    helpSummary = "Checkout a branch for development"
-  helpUsage = """
+    helpUsage = """
 %prog <branchname> [<project>...]
 """
-  helpDescription = """
+    helpDescription = """
 The '%prog' command checks out an existing branch that was previously
 created by 'repo start'.
 
@@ -33,43 +56,55 @@ The command is equivalent to:
 
   repo forall [<project>...] -c git checkout <branchname>
 """
-  PARALLEL_JOBS = DEFAULT_LOCAL_JOBS
+    PARALLEL_JOBS = DEFAULT_LOCAL_JOBS
 
-  def ValidateOptions(self, opt, args):
+    def ValidateOptions(self, opt, args):
-    if not args:
+        if not args:
-      self.Usage()
+            self.Usage()
 
-  def _ExecuteOne(self, nb, project):
+    def _ExecuteOne(self, nb, project):
-    """Checkout one project."""
+        """Checkout one project."""
-    return (project.CheckoutBranch(nb), project)
+        error = None
+        result = None
+        try:
+            result = project.CheckoutBranch(nb)
+        except GitError as e:
+            error = e
+        return CheckoutBranchResult(result, project, error)
 
-  def Execute(self, opt, args):
+    def Execute(self, opt, args):
-    nb = args[0]
+        nb = args[0]
-    err = []
+        err = []
-    success = []
+        err_projects = []
-    all_projects = self.GetProjects(args[1:], all_manifests=not opt.this_manifest_only)
+        success = []
+        all_projects = self.GetProjects(
+            args[1:], all_manifests=not opt.this_manifest_only
+        )
 
-    def _ProcessResults(_pool, pm, results):
+        def _ProcessResults(_pool, pm, results):
-      for status, project in results:
+            for result in results:
-        if status is not None:
+                if result.error is not None:
-          if status:
+                    err.append(result.error)
-            success.append(project)
+                    err_projects.append(result.project)
-          else:
+                elif result.result:
-            err.append(project)
+                    success.append(result.project)
-        pm.update()
+                pm.update(msg="")
 
-    self.ExecuteInParallel(
+        self.ExecuteInParallel(
-        opt.jobs,
+            opt.jobs,
-        functools.partial(self._ExecuteOne, nb),
+            functools.partial(self._ExecuteOne, nb),
-        all_projects,
+            all_projects,
-        callback=_ProcessResults,
+            callback=_ProcessResults,
-        output=Progress('Checkout %s' % (nb,), len(all_projects), quiet=opt.quiet))
+            output=Progress(
+                "Checkout %s" % (nb,), len(all_projects), quiet=opt.quiet
+            ),
+        )
 
-    if err:
+        if err_projects:
-      for p in err:
+            for p in err_projects:
-        print("error: %s/: cannot checkout %s" % (p.relpath, nb),
+                logger.error("error: %s/: cannot checkout %s", p.relpath, nb)
-              file=sys.stderr)
+            raise CheckoutCommandError(aggregate_errors=err)
-      sys.exit(1)
+        elif not success:
-    elif not success:
+            msg = f"error: no project has branch {nb}"
-      print('error: no project has branch %s' % nb, file=sys.stderr)
+            logger.error(msg)
-      sys.exit(1)
+            raise MissingBranchError(msg)

subcmds/cherry_pick.py

@@ -14,99 +14,132 @@
 
 import re
 import sys
-from command import Command
-from git_command import GitCommand
 
-CHANGE_ID_RE = re.compile(r'^\s*Change-Id: I([0-9a-f]{40})\s*$')
+from command import Command
+from error import GitError
+from git_command import GitCommand
+from repo_logging import RepoLogger
+
+
+CHANGE_ID_RE = re.compile(r"^\s*Change-Id: I([0-9a-f]{40})\s*$")
+logger = RepoLogger(__file__)
 
 
 class CherryPick(Command):
-  COMMON = True
+    COMMON = True
-  helpSummary = "Cherry-pick a change."
+    helpSummary = "Cherry-pick a change."
-  helpUsage = """
+    helpUsage = """
 %prog <sha1>
 """
-  helpDescription = """
+    helpDescription = """
 '%prog' cherry-picks a change from one branch to another.
 The change id will be updated, and a reference to the old
 change id will be added.
 """
 
-  def ValidateOptions(self, opt, args):
+    def ValidateOptions(self, opt, args):
-    if len(args) != 1:
+        if len(args) != 1:
-      self.Usage()
+            self.Usage()
 
-  def Execute(self, opt, args):
+    def Execute(self, opt, args):
-    reference = args[0]
+        reference = args[0]
 
-    p = GitCommand(None,
+        p = GitCommand(
-                   ['rev-parse', '--verify', reference],
+            None,
-                   capture_stdout=True,
+            ["rev-parse", "--verify", reference],
-                   capture_stderr=True)
+            capture_stdout=True,
-    if p.Wait() != 0:
+            capture_stderr=True,
-      print(p.stderr, file=sys.stderr)
+            verify_command=True,
-      sys.exit(1)
+        )
-    sha1 = p.stdout.strip()
+        try:
+            p.Wait()
+        except GitError:
+            logger.error(p.stderr)
+            raise
 
-    p = GitCommand(None, ['cat-file', 'commit', sha1], capture_stdout=True)
+        sha1 = p.stdout.strip()
-    if p.Wait() != 0:
-      print("error: Failed to retrieve old commit message", file=sys.stderr)
-      sys.exit(1)
-    old_msg = self._StripHeader(p.stdout)
 
-    p = GitCommand(None,
+        p = GitCommand(
-                   ['cherry-pick', sha1],
+            None,
-                   capture_stdout=True,
+            ["cat-file", "commit", sha1],
-                   capture_stderr=True)
+            capture_stdout=True,
-    status = p.Wait()
+            verify_command=True,
+        )
 
-    if p.stdout:
+        try:
-      print(p.stdout.strip(), file=sys.stdout)
+            p.Wait()
-    if p.stderr:
+        except GitError:
-      print(p.stderr.strip(), file=sys.stderr)
+            logger.error("error: Failed to retrieve old commit message")
+            raise
 
-    if status == 0:
+        old_msg = self._StripHeader(p.stdout)
-      # The cherry-pick was applied correctly. We just need to edit the
-      # commit message.
-      new_msg = self._Reformat(old_msg, sha1)
 
-      p = GitCommand(None, ['commit', '--amend', '-F', '-'],
+        p = GitCommand(
-                     input=new_msg,
+            None,
-                     capture_stdout=True,
+            ["cherry-pick", sha1],
-                     capture_stderr=True)
+            capture_stdout=True,
-      if p.Wait() != 0:
+            capture_stderr=True,
-        print("error: Failed to update commit message", file=sys.stderr)
+            verify_command=True,
-        sys.exit(1)
+        )
 
-    else:
+        try:
-      print('NOTE: When committing (please see above) and editing the commit '
+            p.Wait()
-            'message, please remove the old Change-Id-line and add:')
+        except GitError as e:
-      print(self._GetReference(sha1), file=sys.stderr)
+            logger.error(e)
-      print(file=sys.stderr)
+            logger.warn(
+                "NOTE: When committing (please see above) and editing the "
+                "commit message, please remove the old Change-Id-line and "
+                "add:\n%s",
+                self._GetReference(sha1),
+            )
+            raise
 
-  def _IsChangeId(self, line):
+        if p.stdout:
-    return CHANGE_ID_RE.match(line)
+            print(p.stdout.strip(), file=sys.stdout)
+        if p.stderr:
+            print(p.stderr.strip(), file=sys.stderr)
 
-  def _GetReference(self, sha1):
+        # The cherry-pick was applied correctly. We just need to edit
-    return "(cherry picked from commit %s)" % sha1
+        # the commit message.
+        new_msg = self._Reformat(old_msg, sha1)
 
-  def _StripHeader(self, commit_msg):
+        p = GitCommand(
-    lines = commit_msg.splitlines()
+            None,
-    return "\n".join(lines[lines.index("") + 1:])
+            ["commit", "--amend", "-F", "-"],
+            input=new_msg,
+            capture_stdout=True,
+            capture_stderr=True,
+            verify_command=True,
+        )
+        try:
+            p.Wait()
+        except GitError:
+            logger.error("error: Failed to update commit message")
+            raise
 
-  def _Reformat(self, old_msg, sha1):
+    def _IsChangeId(self, line):
-    new_msg = []
+        return CHANGE_ID_RE.match(line)
 
-    for line in old_msg.splitlines():
+    def _GetReference(self, sha1):
-      if not self._IsChangeId(line):
+        return "(cherry picked from commit %s)" % sha1
-        new_msg.append(line)
 
-    # Add a blank line between the message and the change id/reference
+    def _StripHeader(self, commit_msg):
-    try:
+        lines = commit_msg.splitlines()
-      if new_msg[-1].strip() != "":
+        return "\n".join(lines[lines.index("") + 1 :])
-        new_msg.append("")
-    except IndexError:
-      pass
 
-    new_msg.append(self._GetReference(sha1))
+    def _Reformat(self, old_msg, sha1):
-    return "\n".join(new_msg)
+        new_msg = []
+
+        for line in old_msg.splitlines():
+            if not self._IsChangeId(line):
+                new_msg.append(line)
+
+        # Add a blank line between the message and the change id/reference.
+        try:
+            if new_msg[-1].strip() != "":
+                new_msg.append("")
+        except IndexError:
+            pass
+
+        new_msg.append(self._GetReference(sha1))
+        return "\n".join(new_msg)

subcmds/diff.py

@@ -15,58 +15,68 @@
 import functools
 import io
 
-from command import DEFAULT_LOCAL_JOBS, PagedCommand
+from command import DEFAULT_LOCAL_JOBS
+from command import PagedCommand
 
 
 class Diff(PagedCommand):
-  COMMON = True
+    COMMON = True
-  helpSummary = "Show changes between commit and working tree"
+    helpSummary = "Show changes between commit and working tree"
-  helpUsage = """
+    helpUsage = """
 %prog [<project>...]
 
 The -u option causes '%prog' to generate diff output with file paths
 relative to the repository root, so the output can be applied
 to the Unix 'patch' command.
 """
-  PARALLEL_JOBS = DEFAULT_LOCAL_JOBS
+    PARALLEL_JOBS = DEFAULT_LOCAL_JOBS
 
-  def _Options(self, p):
+    def _Options(self, p):
-    p.add_option('-u', '--absolute',
+        p.add_option(
-                 dest='absolute', action='store_true',
+            "-u",
-                 help='paths are relative to the repository root')
+            "--absolute",
+            dest="absolute",
+            action="store_true",
+            help="paths are relative to the repository root",
+        )
 
-  def _ExecuteOne(self, absolute, local, project):
+    def _ExecuteOne(self, absolute, local, project):
-    """Obtains the diff for a specific project.
+        """Obtains the diff for a specific project.
 
-    Args:
+        Args:
-      absolute: Paths are relative to the root.
+            absolute: Paths are relative to the root.
-      local: a boolean, if True, the path is relative to the local
+            local: a boolean, if True, the path is relative to the local
-             (sub)manifest.  If false, the path is relative to the
+                (sub)manifest.  If false, the path is relative to the outermost
-             outermost manifest.
+                manifest.
-      project: Project to get status of.
+            project: Project to get status of.
 
-    Returns:
+        Returns:
-      The status of the project.
+            The status of the project.
-    """
+        """
-    buf = io.StringIO()
+        buf = io.StringIO()
-    ret = project.PrintWorkTreeDiff(absolute, output_redir=buf, local=local)
+        ret = project.PrintWorkTreeDiff(absolute, output_redir=buf, local=local)
-    return (ret, buf.getvalue())
+        return (ret, buf.getvalue())
 
-  def Execute(self, opt, args):
+    def Execute(self, opt, args):
-    all_projects = self.GetProjects(args, all_manifests=not opt.this_manifest_only)
+        all_projects = self.GetProjects(
+            args, all_manifests=not opt.this_manifest_only
+        )
 
-    def _ProcessResults(_pool, _output, results):
+        def _ProcessResults(_pool, _output, results):
-      ret = 0
+            ret = 0
-      for (state, output) in results:
+            for state, output in results:
-        if output:
+                if output:
-          print(output, end='')
+                    print(output, end="")
-        if not state:
+                if not state:
-          ret = 1
+                    ret = 1
-      return ret
+            return ret
 
-    return self.ExecuteInParallel(
+        return self.ExecuteInParallel(
-        opt.jobs,
+            opt.jobs,
-        functools.partial(self._ExecuteOne, opt.absolute, opt.this_manifest_only),
+            functools.partial(
-        all_projects,
+                self._ExecuteOne, opt.absolute, opt.this_manifest_only
-        callback=_ProcessResults,
+            ),
-        ordered=True)
+            all_projects,
+            callback=_ProcessResults,
+            ordered=True,
+        )

subcmds/diffmanifests.py

@@ -18,24 +18,24 @@ from manifest_xml import RepoClient
 
 
 class _Coloring(Coloring):
-  def __init__(self, config):
+    def __init__(self, config):
-    Coloring.__init__(self, config, "status")
+        Coloring.__init__(self, config, "status")
 
 
 class Diffmanifests(PagedCommand):
-  """ A command to see logs in projects represented by manifests
+    """A command to see logs in projects represented by manifests
 
-  This is used to see deeper differences between manifests. Where a simple
+    This is used to see deeper differences between manifests. Where a simple
-  diff would only show a diff of sha1s for example, this command will display
+    diff would only show a diff of sha1s for example, this command will display
-  the logs of the project between both sha1s, allowing user to see diff at a
+    the logs of the project between both sha1s, allowing user to see diff at a
-  deeper level.
+    deeper level.
-  """
+    """
 
-  COMMON = True
+    COMMON = True
-  helpSummary = "Manifest diff utility"
+    helpSummary = "Manifest diff utility"
-  helpUsage = """%prog manifest1.xml [manifest2.xml] [options]"""
+    helpUsage = """%prog manifest1.xml [manifest2.xml] [options]"""
 
-  helpDescription = """
+    helpDescription = """
 The %prog command shows differences between project revisions of manifest1 and
 manifest2. if manifest2 is not specified, current manifest.xml will be used
 instead. Both absolute and relative paths may be used for manifests. Relative
@@ -65,155 +65,209 @@ synced and their revisions won't be found.
 
 """
 
-  def _Options(self, p):
+    def _Options(self, p):
-    p.add_option('--raw',
+        p.add_option(
-                 dest='raw', action='store_true',
+            "--raw", dest="raw", action="store_true", help="display raw diff"
-                 help='display raw diff')
+        )
-    p.add_option('--no-color',
+        p.add_option(
-                 dest='color', action='store_false', default=True,
+            "--no-color",
-                 help='does not display the diff in color')
+            dest="color",
-    p.add_option('--pretty-format',
+            action="store_false",
-                 dest='pretty_format', action='store',
+            default=True,
-                 metavar='<FORMAT>',
+            help="does not display the diff in color",
-                 help='print the log using a custom git pretty format string')
+        )
+        p.add_option(
+            "--pretty-format",
+            dest="pretty_format",
+            action="store",
+            metavar="<FORMAT>",
+            help="print the log using a custom git pretty format string",
+        )
 
-  def _printRawDiff(self, diff, pretty_format=None):
+    def _printRawDiff(self, diff, pretty_format=None, local=False):
-    for project in diff['added']:
+        _RelPath = lambda p: p.RelPath(local=local)
-      self.printText("A %s %s" % (project.relpath, project.revisionExpr))
+        for project in diff["added"]:
-      self.out.nl()
+            self.printText(
-
+                "A %s %s" % (_RelPath(project), project.revisionExpr)
-    for project in diff['removed']:
+            )
-      self.printText("R %s %s" % (project.relpath, project.revisionExpr))
-      self.out.nl()
-
-    for project, otherProject in diff['changed']:
-      self.printText("C %s %s %s" % (project.relpath, project.revisionExpr,
-                                     otherProject.revisionExpr))
-      self.out.nl()
-      self._printLogs(project, otherProject, raw=True, color=False, pretty_format=pretty_format)
-
-    for project, otherProject in diff['unreachable']:
-      self.printText("U %s %s %s" % (project.relpath, project.revisionExpr,
-                                     otherProject.revisionExpr))
-      self.out.nl()
-
-  def _printDiff(self, diff, color=True, pretty_format=None):
-    if diff['added']:
-      self.out.nl()
-      self.printText('added projects : \n')
-      self.out.nl()
-      for project in diff['added']:
-        self.printProject('\t%s' % (project.relpath))
-        self.printText(' at revision ')
-        self.printRevision(project.revisionExpr)
-        self.out.nl()
-
-    if diff['removed']:
-      self.out.nl()
-      self.printText('removed projects : \n')
-      self.out.nl()
-      for project in diff['removed']:
-        self.printProject('\t%s' % (project.relpath))
-        self.printText(' at revision ')
-        self.printRevision(project.revisionExpr)
-        self.out.nl()
-
-    if diff['missing']:
-      self.out.nl()
-      self.printText('missing projects : \n')
-      self.out.nl()
-      for project in diff['missing']:
-        self.printProject('\t%s' % (project.relpath))
-        self.printText(' at revision ')
-        self.printRevision(project.revisionExpr)
-        self.out.nl()
-
-    if diff['changed']:
-      self.out.nl()
-      self.printText('changed projects : \n')
-      self.out.nl()
-      for project, otherProject in diff['changed']:
-        self.printProject('\t%s' % (project.relpath))
-        self.printText(' changed from ')
-        self.printRevision(project.revisionExpr)
-        self.printText(' to ')
-        self.printRevision(otherProject.revisionExpr)
-        self.out.nl()
-        self._printLogs(project, otherProject, raw=False, color=color,
-                        pretty_format=pretty_format)
-        self.out.nl()
-
-    if diff['unreachable']:
-      self.out.nl()
-      self.printText('projects with unreachable revisions : \n')
-      self.out.nl()
-      for project, otherProject in diff['unreachable']:
-        self.printProject('\t%s ' % (project.relpath))
-        self.printRevision(project.revisionExpr)
-        self.printText(' or ')
-        self.printRevision(otherProject.revisionExpr)
-        self.printText(' not found')
-        self.out.nl()
-
-  def _printLogs(self, project, otherProject, raw=False, color=True,
-                 pretty_format=None):
-
-    logs = project.getAddedAndRemovedLogs(otherProject,
-                                          oneline=(pretty_format is None),
-                                          color=color,
-                                          pretty_format=pretty_format)
-    if logs['removed']:
-      removedLogs = logs['removed'].split('\n')
-      for log in removedLogs:
-        if log.strip():
-          if raw:
-            self.printText(' R ' + log)
-            self.out.nl()
-          else:
-            self.printRemoved('\t\t[-] ')
-            self.printText(log)
             self.out.nl()
 
-    if logs['added']:
+        for project in diff["removed"]:
-      addedLogs = logs['added'].split('\n')
+            self.printText(
-      for log in addedLogs:
+                "R %s %s" % (_RelPath(project), project.revisionExpr)
-        if log.strip():
+            )
-          if raw:
-            self.printText(' A ' + log)
-            self.out.nl()
-          else:
-            self.printAdded('\t\t[+] ')
-            self.printText(log)
             self.out.nl()
 
-  def ValidateOptions(self, opt, args):
+        for project, otherProject in diff["changed"]:
-    if not args or len(args) > 2:
+            self.printText(
-      self.OptionParser.error('missing manifests to diff')
+                "C %s %s %s"
-    if opt.this_manifest_only is False:
+                % (
-      raise self.OptionParser.error(
+                    _RelPath(project),
-          '`diffmanifest` only supports the current tree')
+                    project.revisionExpr,
+                    otherProject.revisionExpr,
+                )
+            )
+            self.out.nl()
+            self._printLogs(
+                project,
+                otherProject,
+                raw=True,
+                color=False,
+                pretty_format=pretty_format,
+            )
 
-  def Execute(self, opt, args):
+        for project, otherProject in diff["unreachable"]:
-    self.out = _Coloring(self.client.globalConfig)
+            self.printText(
-    self.printText = self.out.nofmt_printer('text')
+                "U %s %s %s"
-    if opt.color:
+                % (
-      self.printProject = self.out.nofmt_printer('project', attr='bold')
+                    _RelPath(project),
-      self.printAdded = self.out.nofmt_printer('green', fg='green', attr='bold')
+                    project.revisionExpr,
-      self.printRemoved = self.out.nofmt_printer('red', fg='red', attr='bold')
+                    otherProject.revisionExpr,
-      self.printRevision = self.out.nofmt_printer('revision', fg='yellow')
+                )
-    else:
+            )
-      self.printProject = self.printAdded = self.printRemoved = self.printRevision = self.printText
+            self.out.nl()
 
-    manifest1 = RepoClient(self.repodir)
+    def _printDiff(self, diff, color=True, pretty_format=None, local=False):
-    manifest1.Override(args[0], load_local_manifests=False)
+        _RelPath = lambda p: p.RelPath(local=local)
-    if len(args) == 1:
+        if diff["added"]:
-      manifest2 = self.manifest
+            self.out.nl()
-    else:
+            self.printText("added projects : \n")
-      manifest2 = RepoClient(self.repodir)
+            self.out.nl()
-      manifest2.Override(args[1], load_local_manifests=False)
+            for project in diff["added"]:
+                self.printProject("\t%s" % (_RelPath(project)))
+                self.printText(" at revision ")
+                self.printRevision(project.revisionExpr)
+                self.out.nl()
 
-    diff = manifest1.projectsDiff(manifest2)
+        if diff["removed"]:
-    if opt.raw:
+            self.out.nl()
-      self._printRawDiff(diff, pretty_format=opt.pretty_format)
+            self.printText("removed projects : \n")
-    else:
+            self.out.nl()
-      self._printDiff(diff, color=opt.color, pretty_format=opt.pretty_format)
+            for project in diff["removed"]:
+                self.printProject("\t%s" % (_RelPath(project)))
+                self.printText(" at revision ")
+                self.printRevision(project.revisionExpr)
+                self.out.nl()
+
+        if diff["missing"]:
+            self.out.nl()
+            self.printText("missing projects : \n")
+            self.out.nl()
+            for project in diff["missing"]:
+                self.printProject("\t%s" % (_RelPath(project)))
+                self.printText(" at revision ")
+                self.printRevision(project.revisionExpr)
+                self.out.nl()
+
+        if diff["changed"]:
+            self.out.nl()
+            self.printText("changed projects : \n")
+            self.out.nl()
+            for project, otherProject in diff["changed"]:
+                self.printProject("\t%s" % (_RelPath(project)))
+                self.printText(" changed from ")
+                self.printRevision(project.revisionExpr)
+                self.printText(" to ")
+                self.printRevision(otherProject.revisionExpr)
+                self.out.nl()
+                self._printLogs(
+                    project,
+                    otherProject,
+                    raw=False,
+                    color=color,
+                    pretty_format=pretty_format,
+                )
+                self.out.nl()
+
+        if diff["unreachable"]:
+            self.out.nl()
+            self.printText("projects with unreachable revisions : \n")
+            self.out.nl()
+            for project, otherProject in diff["unreachable"]:
+                self.printProject("\t%s " % (_RelPath(project)))
+                self.printRevision(project.revisionExpr)
+                self.printText(" or ")
+                self.printRevision(otherProject.revisionExpr)
+                self.printText(" not found")
+                self.out.nl()
+
+    def _printLogs(
+        self, project, otherProject, raw=False, color=True, pretty_format=None
+    ):
+        logs = project.getAddedAndRemovedLogs(
+            otherProject,
+            oneline=(pretty_format is None),
+            color=color,
+            pretty_format=pretty_format,
+        )
+        if logs["removed"]:
+            removedLogs = logs["removed"].split("\n")
+            for log in removedLogs:
+                if log.strip():
+                    if raw:
+                        self.printText(" R " + log)
+                        self.out.nl()
+                    else:
+                        self.printRemoved("\t\t[-] ")
+                        self.printText(log)
+                        self.out.nl()
+
+        if logs["added"]:
+            addedLogs = logs["added"].split("\n")
+            for log in addedLogs:
+                if log.strip():
+                    if raw:
+                        self.printText(" A " + log)
+                        self.out.nl()
+                    else:
+                        self.printAdded("\t\t[+] ")
+                        self.printText(log)
+                        self.out.nl()
+
+    def ValidateOptions(self, opt, args):
+        if not args or len(args) > 2:
+            self.OptionParser.error("missing manifests to diff")
+        if opt.this_manifest_only is False:
+            raise self.OptionParser.error(
+                "`diffmanifest` only supports the current tree"
+            )
+
+    def Execute(self, opt, args):
+        self.out = _Coloring(self.client.globalConfig)
+        self.printText = self.out.nofmt_printer("text")
+        if opt.color:
+            self.printProject = self.out.nofmt_printer("project", attr="bold")
+            self.printAdded = self.out.nofmt_printer(
+                "green", fg="green", attr="bold"
+            )
+            self.printRemoved = self.out.nofmt_printer(
+                "red", fg="red", attr="bold"
+            )
+            self.printRevision = self.out.nofmt_printer("revision", fg="yellow")
+        else:
+            self.printProject = (
+                self.printAdded
+            ) = self.printRemoved = self.printRevision = self.printText
+
+        manifest1 = RepoClient(self.repodir)
+        manifest1.Override(args[0], load_local_manifests=False)
+        if len(args) == 1:
+            manifest2 = self.manifest
+        else:
+            manifest2 = RepoClient(self.repodir)
+            manifest2.Override(args[1], load_local_manifests=False)
+
+        diff = manifest1.projectsDiff(manifest2)
+        if opt.raw:
+            self._printRawDiff(
+                diff,
+                pretty_format=opt.pretty_format,
+                local=opt.this_manifest_only,
+            )
+        else:
+            self._printDiff(
+                diff,
+                color=opt.color,
+                pretty_format=opt.pretty_format,
+                local=opt.this_manifest_only,
+            )

subcmds/download.py

@@ -16,145 +16,198 @@ import re
 import sys
 
 from command import Command
-from error import GitError, NoSuchProjectError
+from error import GitError
+from error import NoSuchProjectError
+from error import RepoExitError
+from repo_logging import RepoLogger
 
-CHANGE_RE = re.compile(r'^([1-9][0-9]*)(?:[/\.-]([1-9][0-9]*))?$')
+
+CHANGE_RE = re.compile(r"^([1-9][0-9]*)(?:[/\.-]([1-9][0-9]*))?$")
+logger = RepoLogger(__file__)
+
+
+class DownloadCommandError(RepoExitError):
+    """Error raised when download command fails."""
 
 
 class Download(Command):
-  COMMON = True
+    COMMON = True
-  helpSummary = "Download and checkout a change"
+    helpSummary = "Download and checkout a change"
-  helpUsage = """
+    helpUsage = """
 %prog {[project] change[/patchset]}...
 """
-  helpDescription = """
+    helpDescription = """
 The '%prog' command downloads a change from the review system and
 makes it available in your project's local working directory.
 If no project is specified try to use current directory as a project.
 """
 
-  def _Options(self, p):
+    def _Options(self, p):
-    p.add_option('-b', '--branch',
+        p.add_option("-b", "--branch", help="create a new branch first")
-                 help='create a new branch first')
+        p.add_option(
-    p.add_option('-c', '--cherry-pick',
+            "-c",
-                 dest='cherrypick', action='store_true',
+            "--cherry-pick",
-                 help="cherry-pick instead of checkout")
+            dest="cherrypick",
-    p.add_option('-x', '--record-origin', action='store_true',
+            action="store_true",
-                 help='pass -x when cherry-picking')
+            help="cherry-pick instead of checkout",
-    p.add_option('-r', '--revert',
+        )
-                 dest='revert', action='store_true',
+        p.add_option(
-                 help="revert instead of checkout")
+            "-x",
-    p.add_option('-f', '--ff-only',
+            "--record-origin",
-                 dest='ffonly', action='store_true',
+            action="store_true",
-                 help="force fast-forward merge")
+            help="pass -x when cherry-picking",
+        )
+        p.add_option(
+            "-r",
+            "--revert",
+            dest="revert",
+            action="store_true",
+            help="revert instead of checkout",
+        )
+        p.add_option(
+            "-f",
+            "--ff-only",
+            dest="ffonly",
+            action="store_true",
+            help="force fast-forward merge",
+        )
 
-  def _ParseChangeIds(self, opt, args):
+    def _ParseChangeIds(self, opt, args):
-    if not args:
+        if not args:
-      self.Usage()
+            self.Usage()
 
-    to_get = []
+        to_get = []
-    project = None
+        project = None
 
-    for a in args:
+        for a in args:
-      m = CHANGE_RE.match(a)
+            m = CHANGE_RE.match(a)
-      if m:
+            if m:
-        if not project:
+                if not project:
-          project = self.GetProjects(".")[0]
+                    project = self.GetProjects(".")[0]
-          print('Defaulting to cwd project', project.name)
+                    print("Defaulting to cwd project", project.name)
-        chg_id = int(m.group(1))
+                chg_id = int(m.group(1))
-        if m.group(2):
+                if m.group(2):
-          ps_id = int(m.group(2))
+                    ps_id = int(m.group(2))
-        else:
+                else:
-          ps_id = 1
+                    ps_id = 1
-          refs = 'refs/changes/%2.2d/%d/' % (chg_id % 100, chg_id)
+                    refs = "refs/changes/%2.2d/%d/" % (chg_id % 100, chg_id)
-          output = project._LsRemote(refs + '*')
+                    output = project._LsRemote(refs + "*")
-          if output:
+                    if output:
-            regex = refs + r'(\d+)'
+                        regex = refs + r"(\d+)"
-            rcomp = re.compile(regex, re.I)
+                        rcomp = re.compile(regex, re.I)
-            for line in output.splitlines():
+                        for line in output.splitlines():
-              match = rcomp.search(line)
+                            match = rcomp.search(line)
-              if match:
+                            if match:
-                ps_id = max(int(match.group(1)), ps_id)
+                                ps_id = max(int(match.group(1)), ps_id)
-        to_get.append((project, chg_id, ps_id))
+                to_get.append((project, chg_id, ps_id))
-      else:
+            else:
-        projects = self.GetProjects([a], all_manifests=not opt.this_manifest_only)
+                projects = self.GetProjects(
-        if len(projects) > 1:
+                    [a], all_manifests=not opt.this_manifest_only
-          # If the cwd is one of the projects, assume they want that.
+                )
-          try:
+                if len(projects) > 1:
-            project = self.GetProjects('.')[0]
+                    # If the cwd is one of the projects, assume they want that.
-          except NoSuchProjectError:
+                    try:
-            project = None
+                        project = self.GetProjects(".")[0]
-          if project not in projects:
+                    except NoSuchProjectError:
-            print('error: %s matches too many projects; please re-run inside '
+                        project = None
-                  'the project checkout.' % (a,), file=sys.stderr)
+                    if project not in projects:
-            for project in projects:
+                        logger.error(
-              print('  %s/ @ %s' % (project.RelPath(local=opt.this_manifest_only),
+                            "error: %s matches too many projects; please "
-                                    project.revisionExpr), file=sys.stderr)
+                            "re-run inside the project checkout.",
-            sys.exit(1)
+                            a,
-        else:
+                        )
-          project = projects[0]
+                        for project in projects:
-          print('Defaulting to cwd project', project.name)
+                            logger.error(
-    return to_get
+                                "  %s/ @ %s",
+                                project.RelPath(local=opt.this_manifest_only),
+                                project.revisionExpr,
+                            )
+                        raise NoSuchProjectError()
+                else:
+                    project = projects[0]
+                    print("Defaulting to cwd project", project.name)
+        return to_get
 
-  def ValidateOptions(self, opt, args):
+    def ValidateOptions(self, opt, args):
-    if opt.record_origin:
+        if opt.record_origin:
-      if not opt.cherrypick:
+            if not opt.cherrypick:
-        self.OptionParser.error('-x only makes sense with --cherry-pick')
+                self.OptionParser.error(
+                    "-x only makes sense with --cherry-pick"
+                )
 
-      if opt.ffonly:
+            if opt.ffonly:
-        self.OptionParser.error('-x and --ff are mutually exclusive options')
+                self.OptionParser.error(
+                    "-x and --ff are mutually exclusive options"
+                )
 
-  def Execute(self, opt, args):
+    def Execute(self, opt, args):
-    for project, change_id, ps_id in self._ParseChangeIds(opt, args):
+        try:
-      dl = project.DownloadPatchSet(change_id, ps_id)
+            self._ExecuteHelper(opt, args)
-      if not dl:
+        except Exception as e:
-        print('[%s] change %d/%d not found'
+            if isinstance(e, RepoExitError):
-              % (project.name, change_id, ps_id),
+                raise e
-              file=sys.stderr)
+            raise DownloadCommandError(aggregate_errors=[e])
-        sys.exit(1)
 
-      if not opt.revert and not dl.commits:
+    def _ExecuteHelper(self, opt, args):
-        print('[%s] change %d/%d has already been merged'
+        for project, change_id, ps_id in self._ParseChangeIds(opt, args):
-              % (project.name, change_id, ps_id),
+            dl = project.DownloadPatchSet(change_id, ps_id)
-              file=sys.stderr)
-        continue
 
-      if len(dl.commits) > 1:
+            if not opt.revert and not dl.commits:
-        print('[%s] %d/%d depends on %d unmerged changes:'
+                logger.error(
-              % (project.name, change_id, ps_id, len(dl.commits)),
+                    "[%s] change %d/%d has already been merged",
-              file=sys.stderr)
+                    project.name,
-        for c in dl.commits:
+                    change_id,
-          print('  %s' % (c), file=sys.stderr)
+                    ps_id,
+                )
+                continue
 
-      if opt.cherrypick:
+            if len(dl.commits) > 1:
-        mode = 'cherry-pick'
+                logger.error(
-      elif opt.revert:
+                    "[%s] %d/%d depends on %d unmerged changes:",
-        mode = 'revert'
+                    project.name,
-      elif opt.ffonly:
+                    change_id,
-        mode = 'fast-forward merge'
+                    ps_id,
-      else:
+                    len(dl.commits),
-        mode = 'checkout'
+                )
+                for c in dl.commits:
+                    print("  %s" % (c), file=sys.stderr)
 
-      # We'll combine the branch+checkout operation, but all the rest need a
+            if opt.cherrypick:
-      # dedicated branch start.
+                mode = "cherry-pick"
-      if opt.branch and mode != 'checkout':
+            elif opt.revert:
-        project.StartBranch(opt.branch)
+                mode = "revert"
+            elif opt.ffonly:
+                mode = "fast-forward merge"
+            else:
+                mode = "checkout"
 
-      try:
+            # We'll combine the branch+checkout operation, but all the rest need
-        if opt.cherrypick:
+            # a dedicated branch start.
-          project._CherryPick(dl.commit, ffonly=opt.ffonly,
+            if opt.branch and mode != "checkout":
-                              record_origin=opt.record_origin)
+                project.StartBranch(opt.branch)
-        elif opt.revert:
-          project._Revert(dl.commit)
-        elif opt.ffonly:
-          project._FastForward(dl.commit, ffonly=True)
-        else:
-          if opt.branch:
-            project.StartBranch(opt.branch, revision=dl.commit)
-          else:
-            project._Checkout(dl.commit)
 
-      except GitError:
+            try:
-        print('[%s] Could not complete the %s of %s'
+                if opt.cherrypick:
-              % (project.name, mode, dl.commit), file=sys.stderr)
+                    project._CherryPick(
-        sys.exit(1)
+                        dl.commit,
+                        ffonly=opt.ffonly,
+                        record_origin=opt.record_origin,
+                    )
+                elif opt.revert:
+                    project._Revert(dl.commit)
+                elif opt.ffonly:
+                    project._FastForward(dl.commit, ffonly=True)
+                else:
+                    if opt.branch:
+                        project.StartBranch(opt.branch, revision=dl.commit)
+                    else:
+                        project._Checkout(dl.commit)
+
+            except GitError:
+                logger.error(
+                    "[%s] Could not complete the %s of %s",
+                    project.name,
+                    mode,
+                    dl.commit,
+                )
+                raise

subcmds/forall.py

@@ -16,38 +16,44 @@ import errno
 import functools
 import io
 import multiprocessing
-import re
 import os
+import re
 import signal
-import sys
 import subprocess
+import sys
 
 from color import Coloring
-from command import DEFAULT_LOCAL_JOBS, Command, MirrorSafeCommand, WORKER_BATCH_SIZE
+from command import Command
+from command import DEFAULT_LOCAL_JOBS
+from command import MirrorSafeCommand
+from command import WORKER_BATCH_SIZE
 from error import ManifestInvalidRevisionError
+from repo_logging import RepoLogger
 
+
+logger = RepoLogger(__file__)
 _CAN_COLOR = [
-    'branch',
+    "branch",
-    'diff',
+    "diff",
-    'grep',
+    "grep",
-    'log',
+    "log",
 ]
 
 
 class ForallColoring(Coloring):
-  def __init__(self, config):
+    def __init__(self, config):
-    Coloring.__init__(self, config, 'forall')
+        Coloring.__init__(self, config, "forall")
-    self.project = self.printer('project', attr='bold')
+        self.project = self.printer("project", attr="bold")
 
 
 class Forall(Command, MirrorSafeCommand):
-  COMMON = False
+    COMMON = False
-  helpSummary = "Run a shell command in each project"
+    helpSummary = "Run a shell command in each project"
-  helpUsage = """
+    helpUsage = """
 %prog [<project>...] -c <command> [<arg>...]
 %prog -r str1 [str2] ... -c <command> [<arg>...]
 """
-  helpDescription = """
+    helpDescription = """
 Executes the same shell command in each project.
 
 The -r option allows running the command only on projects matching
@@ -125,236 +131,285 @@ terminal and are not redirected.
 If -e is used, when a command exits unsuccessfully, '%prog' will abort
 without iterating through the remaining projects.
 """
-  PARALLEL_JOBS = DEFAULT_LOCAL_JOBS
+    PARALLEL_JOBS = DEFAULT_LOCAL_JOBS
 
-  @staticmethod
+    @staticmethod
-  def _cmd_option(option, _opt_str, _value, parser):
+    def _cmd_option(option, _opt_str, _value, parser):
-    setattr(parser.values, option.dest, list(parser.rargs))
+        setattr(parser.values, option.dest, list(parser.rargs))
-    while parser.rargs:
+        while parser.rargs:
-      del parser.rargs[0]
+            del parser.rargs[0]
 
-  def _Options(self, p):
+    def _Options(self, p):
-    p.add_option('-r', '--regex',
+        p.add_option(
-                 dest='regex', action='store_true',
+            "-r",
-                 help='execute the command only on projects matching regex or wildcard expression')
+            "--regex",
-    p.add_option('-i', '--inverse-regex',
+            dest="regex",
-                 dest='inverse_regex', action='store_true',
+            action="store_true",
-                 help='execute the command only on projects not matching regex or '
+            help="execute the command only on projects matching regex or "
-                      'wildcard expression')
+            "wildcard expression",
-    p.add_option('-g', '--groups',
+        )
-                 dest='groups',
+        p.add_option(
-                 help='execute the command only on projects matching the specified groups')
+            "-i",
-    p.add_option('-c', '--command',
+            "--inverse-regex",
-                 help='command (and arguments) to execute',
+            dest="inverse_regex",
-                 dest='command',
+            action="store_true",
-                 action='callback',
+            help="execute the command only on projects not matching regex or "
-                 callback=self._cmd_option)
+            "wildcard expression",
-    p.add_option('-e', '--abort-on-errors',
+        )
-                 dest='abort_on_errors', action='store_true',
+        p.add_option(
-                 help='abort if a command exits unsuccessfully')
+            "-g",
-    p.add_option('--ignore-missing', action='store_true',
+            "--groups",
-                 help='silently skip & do not exit non-zero due missing '
+            dest="groups",
-                      'checkouts')
+            help="execute the command only on projects matching the specified "
+            "groups",
+        )
+        p.add_option(
+            "-c",
+            "--command",
+            help="command (and arguments) to execute",
+            dest="command",
+            action="callback",
+            callback=self._cmd_option,
+        )
+        p.add_option(
+            "-e",
+            "--abort-on-errors",
+            dest="abort_on_errors",
+            action="store_true",
+            help="abort if a command exits unsuccessfully",
+        )
+        p.add_option(
+            "--ignore-missing",
+            action="store_true",
+            help="silently skip & do not exit non-zero due missing "
+            "checkouts",
+        )
 
-    g = p.get_option_group('--quiet')
+        g = p.get_option_group("--quiet")
-    g.add_option('-p',
+        g.add_option(
-                 dest='project_header', action='store_true',
+            "-p",
-                 help='show project headers before output')
+            dest="project_header",
-    p.add_option('--interactive',
+            action="store_true",
-                 action='store_true',
+            help="show project headers before output",
-                 help='force interactive usage')
+        )
+        p.add_option(
+            "--interactive", action="store_true", help="force interactive usage"
+        )
 
-  def WantPager(self, opt):
+    def WantPager(self, opt):
-    return opt.project_header and opt.jobs == 1
+        return opt.project_header and opt.jobs == 1
 
-  def ValidateOptions(self, opt, args):
+    def ValidateOptions(self, opt, args):
-    if not opt.command:
+        if not opt.command:
-      self.Usage()
+            self.Usage()
 
-  def Execute(self, opt, args):
+    def Execute(self, opt, args):
-    cmd = [opt.command[0]]
+        cmd = [opt.command[0]]
-    all_trees = not opt.this_manifest_only
+        all_trees = not opt.this_manifest_only
 
-    shell = True
+        shell = True
-    if re.compile(r'^[a-z0-9A-Z_/\.-]+$').match(cmd[0]):
+        if re.compile(r"^[a-z0-9A-Z_/\.-]+$").match(cmd[0]):
-      shell = False
+            shell = False
 
-    if shell:
+        if shell:
-      cmd.append(cmd[0])
+            cmd.append(cmd[0])
-    cmd.extend(opt.command[1:])
+        cmd.extend(opt.command[1:])
 
-    # Historically, forall operated interactively, and in serial.  If the user
+        # Historically, forall operated interactively, and in serial.  If the
-    # has selected 1 job, then default to interacive mode.
+        # user has selected 1 job, then default to interacive mode.
-    if opt.jobs == 1:
+        if opt.jobs == 1:
-      opt.interactive = True
+            opt.interactive = True
 
-    if opt.project_header \
+        if opt.project_header and not shell and cmd[0] == "git":
-            and not shell \
+            # If this is a direct git command that can enable colorized
-            and cmd[0] == 'git':
+            # output and the user prefers coloring, add --color into the
-      # If this is a direct git command that can enable colorized
+            # command line because we are going to wrap the command into
-      # output and the user prefers coloring, add --color into the
+            # a pipe and git won't know coloring should activate.
-      # command line because we are going to wrap the command into
+            #
-      # a pipe and git won't know coloring should activate.
+            for cn in cmd[1:]:
-      #
+                if not cn.startswith("-"):
-      for cn in cmd[1:]:
+                    break
-        if not cn.startswith('-'):
+            else:
-          break
+                cn = None
-      else:
+            if cn and cn in _CAN_COLOR:
-        cn = None
-      if cn and cn in _CAN_COLOR:
-        class ColorCmd(Coloring):
-          def __init__(self, config, cmd):
-            Coloring.__init__(self, config, cmd)
-        if ColorCmd(self.manifest.manifestProject.config, cn).is_on:
-          cmd.insert(cmd.index(cn) + 1, '--color')
 
-    mirror = self.manifest.IsMirror
+                class ColorCmd(Coloring):
-    rc = 0
+                    def __init__(self, config, cmd):
+                        Coloring.__init__(self, config, cmd)
 
-    smart_sync_manifest_name = "smart_sync_override.xml"
+                if ColorCmd(self.manifest.manifestProject.config, cn).is_on:
-    smart_sync_manifest_path = os.path.join(
+                    cmd.insert(cmd.index(cn) + 1, "--color")
-        self.manifest.manifestProject.worktree, smart_sync_manifest_name)
 
-    if os.path.isfile(smart_sync_manifest_path):
+        mirror = self.manifest.IsMirror
-      self.manifest.Override(smart_sync_manifest_path)
+        rc = 0
 
-    if opt.regex:
+        smart_sync_manifest_name = "smart_sync_override.xml"
-      projects = self.FindProjects(args, all_manifests=all_trees)
+        smart_sync_manifest_path = os.path.join(
-    elif opt.inverse_regex:
+            self.manifest.manifestProject.worktree, smart_sync_manifest_name
-      projects = self.FindProjects(args, inverse=True, all_manifests=all_trees)
+        )
-    else:
-      projects = self.GetProjects(args, groups=opt.groups, all_manifests=all_trees)
 
-    os.environ['REPO_COUNT'] = str(len(projects))
+        if os.path.isfile(smart_sync_manifest_path):
+            self.manifest.Override(smart_sync_manifest_path)
 
-    try:
+        if opt.regex:
-      config = self.manifest.manifestProject.config
+            projects = self.FindProjects(args, all_manifests=all_trees)
-      with multiprocessing.Pool(opt.jobs, InitWorker) as pool:
+        elif opt.inverse_regex:
-        results_it = pool.imap(
+            projects = self.FindProjects(
-            functools.partial(DoWorkWrapper, mirror, opt, cmd, shell, config),
+                args, inverse=True, all_manifests=all_trees
-            enumerate(projects),
+            )
-            chunksize=WORKER_BATCH_SIZE)
+        else:
-        first = True
+            projects = self.GetProjects(
-        for (r, output) in results_it:
+                args, groups=opt.groups, all_manifests=all_trees
-          if output:
+            )
-            if first:
+
-              first = False
+        os.environ["REPO_COUNT"] = str(len(projects))
-            elif opt.project_header:
+
-              print()
+        try:
-            # To simplify the DoWorkWrapper, take care of automatic newlines.
+            config = self.manifest.manifestProject.config
-            end = '\n'
+            with multiprocessing.Pool(opt.jobs, InitWorker) as pool:
-            if output[-1] == '\n':
+                results_it = pool.imap(
-              end = ''
+                    functools.partial(
-            print(output, end=end)
+                        DoWorkWrapper, mirror, opt, cmd, shell, config
-          rc = rc or r
+                    ),
-          if r != 0 and opt.abort_on_errors:
+                    enumerate(projects),
-            raise Exception('Aborting due to previous error')
+                    chunksize=WORKER_BATCH_SIZE,
-    except (KeyboardInterrupt, WorkerKeyboardInterrupt):
+                )
-      # Catch KeyboardInterrupt raised inside and outside of workers
+                first = True
-      rc = rc or errno.EINTR
+                for r, output in results_it:
-    except Exception as e:
+                    if output:
-      # Catch any other exceptions raised
+                        if first:
-      print('forall: unhandled error, terminating the pool: %s: %s' %
+                            first = False
-            (type(e).__name__, e),
+                        elif opt.project_header:
-            file=sys.stderr)
+                            print()
-      rc = rc or getattr(e, 'errno', 1)
+                        # To simplify the DoWorkWrapper, take care of automatic
-    if rc != 0:
+                        # newlines.
-      sys.exit(rc)
+                        end = "\n"
+                        if output[-1] == "\n":
+                            end = ""
+                        print(output, end=end)
+                    rc = rc or r
+                    if r != 0 and opt.abort_on_errors:
+                        raise Exception("Aborting due to previous error")
+        except (KeyboardInterrupt, WorkerKeyboardInterrupt):
+            # Catch KeyboardInterrupt raised inside and outside of workers
+            rc = rc or errno.EINTR
+        except Exception as e:
+            # Catch any other exceptions raised
+            logger.error(
+                "forall: unhandled error, terminating the pool: %s: %s",
+                type(e).__name__,
+                e,
+            )
+            rc = rc or getattr(e, "errno", 1)
+        if rc != 0:
+            sys.exit(rc)
 
 
 class WorkerKeyboardInterrupt(Exception):
-  """ Keyboard interrupt exception for worker processes. """
+    """Keyboard interrupt exception for worker processes."""
 
 
 def InitWorker():
-  signal.signal(signal.SIGINT, signal.SIG_IGN)
+    signal.signal(signal.SIGINT, signal.SIG_IGN)
 
 
 def DoWorkWrapper(mirror, opt, cmd, shell, config, args):
-  """ A wrapper around the DoWork() method.
+    """A wrapper around the DoWork() method.
 
-  Catch the KeyboardInterrupt exceptions here and re-raise them as a different,
+    Catch the KeyboardInterrupt exceptions here and re-raise them as a
-  ``Exception``-based exception to stop it flooding the console with stacktraces
+    different, ``Exception``-based exception to stop it flooding the console
-  and making the parent hang indefinitely.
+    with stacktraces and making the parent hang indefinitely.
 
-  """
+    """
-  cnt, project = args
+    cnt, project = args
-  try:
+    try:
-    return DoWork(project, mirror, opt, cmd, shell, cnt, config)
+        return DoWork(project, mirror, opt, cmd, shell, cnt, config)
-  except KeyboardInterrupt:
+    except KeyboardInterrupt:
-    print('%s: Worker interrupted' % project.name)
+        print("%s: Worker interrupted" % project.name)
-    raise WorkerKeyboardInterrupt()
+        raise WorkerKeyboardInterrupt()
 
 
 def DoWork(project, mirror, opt, cmd, shell, cnt, config):
-  env = os.environ.copy()
+    env = os.environ.copy()
 
-  def setenv(name, val):
+    def setenv(name, val):
-    if val is None:
+        if val is None:
-      val = ''
+            val = ""
-    env[name] = val
+        env[name] = val
 
-  setenv('REPO_PROJECT', project.name)
+    setenv("REPO_PROJECT", project.name)
-  setenv('REPO_OUTERPATH', project.manifest.path_prefix)
+    setenv("REPO_OUTERPATH", project.manifest.path_prefix)
-  setenv('REPO_INNERPATH', project.relpath)
+    setenv("REPO_INNERPATH", project.relpath)
-  setenv('REPO_PATH', project.RelPath(local=opt.this_manifest_only))
+    setenv("REPO_PATH", project.RelPath(local=opt.this_manifest_only))
-  setenv('REPO_REMOTE', project.remote.name)
+    setenv("REPO_REMOTE", project.remote.name)
-  try:
+    try:
-    # If we aren't in a fully synced state and we don't have the ref the manifest
+        # If we aren't in a fully synced state and we don't have the ref the
-    # wants, then this will fail.  Ignore it for the purposes of this code.
+        # manifest wants, then this will fail.  Ignore it for the purposes of
-    lrev = '' if mirror else project.GetRevisionId()
+        # this code.
-  except ManifestInvalidRevisionError:
+        lrev = "" if mirror else project.GetRevisionId()
-    lrev = ''
+    except ManifestInvalidRevisionError:
-  setenv('REPO_LREV', lrev)
+        lrev = ""
-  setenv('REPO_RREV', project.revisionExpr)
+    setenv("REPO_LREV", lrev)
-  setenv('REPO_UPSTREAM', project.upstream)
+    setenv("REPO_RREV", project.revisionExpr)
-  setenv('REPO_DEST_BRANCH', project.dest_branch)
+    setenv("REPO_UPSTREAM", project.upstream)
-  setenv('REPO_I', str(cnt + 1))
+    setenv("REPO_DEST_BRANCH", project.dest_branch)
-  for annotation in project.annotations:
+    setenv("REPO_I", str(cnt + 1))
-    setenv("REPO__%s" % (annotation.name), annotation.value)
+    for annotation in project.annotations:
+        setenv("REPO__%s" % (annotation.name), annotation.value)
 
-  if mirror:
+    if mirror:
-    setenv('GIT_DIR', project.gitdir)
+        setenv("GIT_DIR", project.gitdir)
-    cwd = project.gitdir
+        cwd = project.gitdir
-  else:
+    else:
-    cwd = project.worktree
+        cwd = project.worktree
 
-  if not os.path.exists(cwd):
+    if not os.path.exists(cwd):
-    # Allow the user to silently ignore missing checkouts so they can run on
+        # Allow the user to silently ignore missing checkouts so they can run on
-    # partial checkouts (good for infra recovery tools).
+        # partial checkouts (good for infra recovery tools).
-    if opt.ignore_missing:
+        if opt.ignore_missing:
-      return (0, '')
+            return (0, "")
 
-    output = ''
+        output = ""
-    if ((opt.project_header and opt.verbose)
+        if (opt.project_header and opt.verbose) or not opt.project_header:
-            or not opt.project_header):
+            output = "skipping %s/" % project.RelPath(
-      output = 'skipping %s/' % project.RelPath(local=opt.this_manifest_only)
+                local=opt.this_manifest_only
-    return (1, output)
+            )
+        return (1, output)
 
-  if opt.verbose:
+    if opt.verbose:
-    stderr = subprocess.STDOUT
+        stderr = subprocess.STDOUT
-  else:
+    else:
-    stderr = subprocess.DEVNULL
+        stderr = subprocess.DEVNULL
 
-  stdin = None if opt.interactive else subprocess.DEVNULL
+    stdin = None if opt.interactive else subprocess.DEVNULL
 
-  result = subprocess.run(
+    result = subprocess.run(
-      cmd, cwd=cwd, shell=shell, env=env, check=False,
+        cmd,
-      encoding='utf-8', errors='replace',
+        cwd=cwd,
-      stdin=stdin, stdout=subprocess.PIPE, stderr=stderr)
+        shell=shell,
+        env=env,
+        check=False,
+        encoding="utf-8",
+        errors="replace",
+        stdin=stdin,
+        stdout=subprocess.PIPE,
+        stderr=stderr,
+    )
 
-  output = result.stdout
+    output = result.stdout
-  if opt.project_header:
+    if opt.project_header:
-    if output:
+        if output:
-      buf = io.StringIO()
+            buf = io.StringIO()
-      out = ForallColoring(config)
+            out = ForallColoring(config)
-      out.redirect(buf)
+            out.redirect(buf)
-      if mirror:
+            if mirror:
-        project_header_path = project.name
+                project_header_path = project.name
-      else:
+            else:
-        project_header_path = project.RelPath(local=opt.this_manifest_only)
+                project_header_path = project.RelPath(
-      out.project('project %s/' % project_header_path)
+                    local=opt.this_manifest_only
-      out.nl()
+                )
-      buf.write(output)
+            out.project("project %s/" % project_header_path)
-      output = buf.getvalue()
+            out.nl()
-  return (result.returncode, output)
+            buf.write(output)
+            output = buf.getvalue()
+    return (result.returncode, output)

subcmds/gitc_delete.py

@@ -1,46 +0,0 @@
-# Copyright (C) 2015 The Android Open Source Project
-#
-# Licensed under the Apache License, Version 2.0 (the "License");
-# you may not use this file except in compliance with the License.
-# You may obtain a copy of the License at
-#
-#      http://www.apache.org/licenses/LICENSE-2.0
-#
-# Unless required by applicable law or agreed to in writing, software
-# distributed under the License is distributed on an "AS IS" BASIS,
-# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
-# See the License for the specific language governing permissions and
-# limitations under the License.
-
-import sys
-
-from command import Command, GitcClientCommand
-import platform_utils
-
-
-class GitcDelete(Command, GitcClientCommand):
-  COMMON = True
-  visible_everywhere = False
-  helpSummary = "Delete a GITC Client."
-  helpUsage = """
-%prog
-"""
-  helpDescription = """
-This subcommand deletes the current GITC client, deleting the GITC manifest
-and all locally downloaded sources.
-"""
-
-  def _Options(self, p):
-    p.add_option('-f', '--force',
-                 dest='force', action='store_true',
-                 help='force the deletion (no prompt)')
-
-  def Execute(self, opt, args):
-    if not opt.force:
-      prompt = ('This will delete GITC client: %s\nAre you sure? (yes/no) ' %
-                self.gitc_manifest.gitc_client_name)
-      response = input(prompt).lower()
-      if not response == 'yes':
-        print('Response was not "yes"\n Exiting...')
-        sys.exit(1)
-    platform_utils.rmtree(self.gitc_manifest.gitc_client_dir)

subcmds/gitc_init.py

@@ -1,75 +0,0 @@
-# Copyright (C) 2015 The Android Open Source Project
-#
-# Licensed under the Apache License, Version 2.0 (the "License");
-# you may not use this file except in compliance with the License.
-# You may obtain a copy of the License at
-#
-#      http://www.apache.org/licenses/LICENSE-2.0
-#
-# Unless required by applicable law or agreed to in writing, software
-# distributed under the License is distributed on an "AS IS" BASIS,
-# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
-# See the License for the specific language governing permissions and
-# limitations under the License.
-
-import os
-import sys
-
-import gitc_utils
-from command import GitcAvailableCommand
-from manifest_xml import GitcManifest
-from subcmds import init
-import wrapper
-
-
-class GitcInit(init.Init, GitcAvailableCommand):
-  COMMON = True
-  MULTI_MANIFEST_SUPPORT = False
-  helpSummary = "Initialize a GITC Client."
-  helpUsage = """
-%prog [options] [client name]
-"""
-  helpDescription = """
-The '%prog' command is ran to initialize a new GITC client for use
-with the GITC file system.
-
-This command will setup the client directory, initialize repo, just
-like repo init does, and then downloads the manifest collection
-and installs it in the .repo/directory of the GITC client.
-
-Once this is done, a GITC manifest is generated by pulling the HEAD
-SHA for each project and generates the properly formatted XML file
-and installs it as .manifest in the GITC client directory.
-
-The -c argument is required to specify the GITC client name.
-
-The optional -f argument can be used to specify the manifest file to
-use for this GITC client.
-"""
-
-  def _Options(self, p):
-    super()._Options(p, gitc_init=True)
-
-  def Execute(self, opt, args):
-    gitc_client = gitc_utils.parse_clientdir(os.getcwd())
-    if not gitc_client or (opt.gitc_client and gitc_client != opt.gitc_client):
-      print('fatal: Please update your repo command. See go/gitc for instructions.',
-            file=sys.stderr)
-      sys.exit(1)
-    self.client_dir = os.path.join(gitc_utils.get_gitc_manifest_dir(),
-                                   gitc_client)
-    super().Execute(opt, args)
-
-    manifest_file = self.manifest.manifestFile
-    if opt.manifest_file:
-      if not os.path.exists(opt.manifest_file):
-        print('fatal: Specified manifest file %s does not exist.' %
-              opt.manifest_file)
-        sys.exit(1)
-      manifest_file = opt.manifest_file
-
-    manifest = GitcManifest(self.repodir, gitc_client)
-    manifest.Override(manifest_file)
-    gitc_utils.generate_gitc_manifest(None, manifest)
-    print('Please run `cd %s` to view your GITC client.' %
-          os.path.join(wrapper.Wrapper().GITC_FS_ROOT_DIR, gitc_client))

subcmds/grep.py

@@ -14,27 +14,52 @@
 
 import functools
 import sys
+from typing import NamedTuple
 
 from color import Coloring
-from command import DEFAULT_LOCAL_JOBS, PagedCommand
+from command import DEFAULT_LOCAL_JOBS
+from command import PagedCommand
 from error import GitError
+from error import InvalidArgumentsError
+from error import SilentRepoExitError
 from git_command import GitCommand
+from project import Project
+from repo_logging import RepoLogger
+
+
+logger = RepoLogger(__file__)
 
 
 class GrepColoring(Coloring):
-  def __init__(self, config):
+    def __init__(self, config):
-    Coloring.__init__(self, config, 'grep')
+        Coloring.__init__(self, config, "grep")
-    self.project = self.printer('project', attr='bold')
+        self.project = self.printer("project", attr="bold")
-    self.fail = self.printer('fail', fg='red')
+        self.fail = self.printer("fail", fg="red")
+
+
+class ExecuteOneResult(NamedTuple):
+    """Result from an execute instance."""
+
+    project: Project
+    rc: int
+    stdout: str
+    stderr: str
+    error: GitError
+
+
+class GrepCommandError(SilentRepoExitError):
+    """Grep command failure. Since Grep command
+    output already outputs errors ensure that
+    aggregate errors exit silently."""
 
 
 class Grep(PagedCommand):
-  COMMON = True
+    COMMON = True
-  helpSummary = "Print lines matching a pattern"
+    helpSummary = "Print lines matching a pattern"
-  helpUsage = """
+    helpUsage = """
 %prog {pattern | -e pattern} [<project>...]
 """
-  helpDescription = """
+    helpDescription = """
 Search for the specified patterns in all project files.
 
 # Boolean Options
@@ -62,215 +87,318 @@ contain a line that matches both expressions:
   repo grep --all-match -e NODE -e Unexpected
 
 """
-  PARALLEL_JOBS = DEFAULT_LOCAL_JOBS
+    PARALLEL_JOBS = DEFAULT_LOCAL_JOBS
 
-  @staticmethod
+    @staticmethod
-  def _carry_option(_option, opt_str, value, parser):
+    def _carry_option(_option, opt_str, value, parser):
-    pt = getattr(parser.values, 'cmd_argv', None)
+        pt = getattr(parser.values, "cmd_argv", None)
-    if pt is None:
+        if pt is None:
-      pt = []
+            pt = []
-      setattr(parser.values, 'cmd_argv', pt)
+            setattr(parser.values, "cmd_argv", pt)
 
-    if opt_str == '-(':
+        if opt_str == "-(":
-      pt.append('(')
+            pt.append("(")
-    elif opt_str == '-)':
+        elif opt_str == "-)":
-      pt.append(')')
+            pt.append(")")
-    else:
+        else:
-      pt.append(opt_str)
+            pt.append(opt_str)
 
-    if value is not None:
+        if value is not None:
-      pt.append(value)
+            pt.append(value)
 
-  def _CommonOptions(self, p):
+    def _CommonOptions(self, p):
-    """Override common options slightly."""
+        """Override common options slightly."""
-    super()._CommonOptions(p, opt_v=False)
+        super()._CommonOptions(p, opt_v=False)
 
-  def _Options(self, p):
+    def _Options(self, p):
-    g = p.add_option_group('Sources')
+        g = p.add_option_group("Sources")
-    g.add_option('--cached',
+        g.add_option(
-                 action='callback', callback=self._carry_option,
+            "--cached",
-                 help='Search the index, instead of the work tree')
+            action="callback",
-    g.add_option('-r', '--revision',
+            callback=self._carry_option,
-                 dest='revision', action='append', metavar='TREEish',
+            help="Search the index, instead of the work tree",
-                 help='Search TREEish, instead of the work tree')
+        )
+        g.add_option(
+            "-r",
+            "--revision",
+            dest="revision",
+            action="append",
+            metavar="TREEish",
+            help="Search TREEish, instead of the work tree",
+        )
 
-    g = p.add_option_group('Pattern')
+        g = p.add_option_group("Pattern")
-    g.add_option('-e',
+        g.add_option(
-                 action='callback', callback=self._carry_option,
+            "-e",
-                 metavar='PATTERN', type='str',
+            action="callback",
-                 help='Pattern to search for')
+            callback=self._carry_option,
-    g.add_option('-i', '--ignore-case',
+            metavar="PATTERN",
-                 action='callback', callback=self._carry_option,
+            type="str",
-                 help='Ignore case differences')
+            help="Pattern to search for",
-    g.add_option('-a', '--text',
+        )
-                 action='callback', callback=self._carry_option,
+        g.add_option(
-                 help="Process binary files as if they were text")
+            "-i",
-    g.add_option('-I',
+            "--ignore-case",
-                 action='callback', callback=self._carry_option,
+            action="callback",
-                 help="Don't match the pattern in binary files")
+            callback=self._carry_option,
-    g.add_option('-w', '--word-regexp',
+            help="Ignore case differences",
-                 action='callback', callback=self._carry_option,
+        )
-                 help='Match the pattern only at word boundaries')
+        g.add_option(
-    g.add_option('-v', '--invert-match',
+            "-a",
-                 action='callback', callback=self._carry_option,
+            "--text",
-                 help='Select non-matching lines')
+            action="callback",
-    g.add_option('-G', '--basic-regexp',
+            callback=self._carry_option,
-                 action='callback', callback=self._carry_option,
+            help="Process binary files as if they were text",
-                 help='Use POSIX basic regexp for patterns (default)')
+        )
-    g.add_option('-E', '--extended-regexp',
+        g.add_option(
-                 action='callback', callback=self._carry_option,
+            "-I",
-                 help='Use POSIX extended regexp for patterns')
+            action="callback",
-    g.add_option('-F', '--fixed-strings',
+            callback=self._carry_option,
-                 action='callback', callback=self._carry_option,
+            help="Don't match the pattern in binary files",
-                 help='Use fixed strings (not regexp) for pattern')
+        )
+        g.add_option(
+            "-w",
+            "--word-regexp",
+            action="callback",
+            callback=self._carry_option,
+            help="Match the pattern only at word boundaries",
+        )
+        g.add_option(
+            "-v",
+            "--invert-match",
+            action="callback",
+            callback=self._carry_option,
+            help="Select non-matching lines",
+        )
+        g.add_option(
+            "-G",
+            "--basic-regexp",
+            action="callback",
+            callback=self._carry_option,
+            help="Use POSIX basic regexp for patterns (default)",
+        )
+        g.add_option(
+            "-E",
+            "--extended-regexp",
+            action="callback",
+            callback=self._carry_option,
+            help="Use POSIX extended regexp for patterns",
+        )
+        g.add_option(
+            "-F",
+            "--fixed-strings",
+            action="callback",
+            callback=self._carry_option,
+            help="Use fixed strings (not regexp) for pattern",
+        )
 
-    g = p.add_option_group('Pattern Grouping')
+        g = p.add_option_group("Pattern Grouping")
-    g.add_option('--all-match',
+        g.add_option(
-                 action='callback', callback=self._carry_option,
+            "--all-match",
-                 help='Limit match to lines that have all patterns')
+            action="callback",
-    g.add_option('--and', '--or', '--not',
+            callback=self._carry_option,
-                 action='callback', callback=self._carry_option,
+            help="Limit match to lines that have all patterns",
-                 help='Boolean operators to combine patterns')
+        )
-    g.add_option('-(', '-)',
+        g.add_option(
-                 action='callback', callback=self._carry_option,
+            "--and",
-                 help='Boolean operator grouping')
+            "--or",
+            "--not",
+            action="callback",
+            callback=self._carry_option,
+            help="Boolean operators to combine patterns",
+        )
+        g.add_option(
+            "-(",
+            "-)",
+            action="callback",
+            callback=self._carry_option,
+            help="Boolean operator grouping",
+        )
 
-    g = p.add_option_group('Output')
+        g = p.add_option_group("Output")
-    g.add_option('-n',
+        g.add_option(
-                 action='callback', callback=self._carry_option,
+            "-n",
-                 help='Prefix the line number to matching lines')
+            action="callback",
-    g.add_option('-C',
+            callback=self._carry_option,
-                 action='callback', callback=self._carry_option,
+            help="Prefix the line number to matching lines",
-                 metavar='CONTEXT', type='str',
+        )
-                 help='Show CONTEXT lines around match')
+        g.add_option(
-    g.add_option('-B',
+            "-C",
-                 action='callback', callback=self._carry_option,
+            action="callback",
-                 metavar='CONTEXT', type='str',
+            callback=self._carry_option,
-                 help='Show CONTEXT lines before match')
+            metavar="CONTEXT",
-    g.add_option('-A',
+            type="str",
-                 action='callback', callback=self._carry_option,
+            help="Show CONTEXT lines around match",
-                 metavar='CONTEXT', type='str',
+        )
-                 help='Show CONTEXT lines after match')
+        g.add_option(
-    g.add_option('-l', '--name-only', '--files-with-matches',
+            "-B",
-                 action='callback', callback=self._carry_option,
+            action="callback",
-                 help='Show only file names containing matching lines')
+            callback=self._carry_option,
-    g.add_option('-L', '--files-without-match',
+            metavar="CONTEXT",
-                 action='callback', callback=self._carry_option,
+            type="str",
-                 help='Show only file names not containing matching lines')
+            help="Show CONTEXT lines before match",
+        )
+        g.add_option(
+            "-A",
+            action="callback",
+            callback=self._carry_option,
+            metavar="CONTEXT",
+            type="str",
+            help="Show CONTEXT lines after match",
+        )
+        g.add_option(
+            "-l",
+            "--name-only",
+            "--files-with-matches",
+            action="callback",
+            callback=self._carry_option,
+            help="Show only file names containing matching lines",
+        )
+        g.add_option(
+            "-L",
+            "--files-without-match",
+            action="callback",
+            callback=self._carry_option,
+            help="Show only file names not containing matching lines",
+        )
 
-  def _ExecuteOne(self, cmd_argv, project):
+    def _ExecuteOne(self, cmd_argv, project):
-    """Process one project."""
+        """Process one project."""
-    try:
+        try:
-      p = GitCommand(project,
+            p = GitCommand(
-                     cmd_argv,
+                project,
-                     bare=False,
+                cmd_argv,
-                     capture_stdout=True,
+                bare=False,
-                     capture_stderr=True)
+                capture_stdout=True,
-    except GitError as e:
+                capture_stderr=True,
-      return (project, -1, None, str(e))
+                verify_command=True,
+            )
+        except GitError as e:
+            return ExecuteOneResult(project, -1, None, str(e), e)
 
-    return (project, p.Wait(), p.stdout, p.stderr)
+        try:
+            error = None
+            rc = p.Wait()
+        except GitError as e:
+            rc = 1
+            error = e
+        return ExecuteOneResult(project, rc, p.stdout, p.stderr, error)
 
-  @staticmethod
+    @staticmethod
-  def _ProcessResults(full_name, have_rev, opt, _pool, out, results):
+    def _ProcessResults(full_name, have_rev, opt, _pool, out, results):
-    git_failed = False
+        git_failed = False
-    bad_rev = False
+        bad_rev = False
-    have_match = False
+        have_match = False
-    _RelPath = lambda p: p.RelPath(local=opt.this_manifest_only)
+        _RelPath = lambda p: p.RelPath(local=opt.this_manifest_only)
+        errors = []
 
-    for project, rc, stdout, stderr in results:
+        for result in results:
-      if rc < 0:
+            if result.rc < 0:
-        git_failed = True
+                git_failed = True
-        out.project('--- project %s ---' % _RelPath(project))
+                out.project("--- project %s ---" % _RelPath(result.project))
-        out.nl()
+                out.nl()
-        out.fail('%s', stderr)
+                out.fail("%s", result.stderr)
-        out.nl()
+                out.nl()
-        continue
+                errors.append(result.error)
+                continue
 
-      if rc:
+            if result.rc:
-        # no results
+                # no results
-        if stderr:
+                if result.stderr:
-          if have_rev and 'fatal: ambiguous argument' in stderr:
+                    if (
-            bad_rev = True
+                        have_rev
-          else:
+                        and "fatal: ambiguous argument" in result.stderr
-            out.project('--- project %s ---' % _RelPath(project))
+                    ):
-            out.nl()
+                        bad_rev = True
-            out.fail('%s', stderr.strip())
+                    else:
-            out.nl()
+                        out.project(
-        continue
+                            "--- project %s ---" % _RelPath(result.project)
-      have_match = True
+                        )
+                        out.nl()
+                        out.fail("%s", result.stderr.strip())
+                        out.nl()
+                    if result.error is not None:
+                        errors.append(result.error)
+                continue
+            have_match = True
 
-      # We cut the last element, to avoid a blank line.
+            # We cut the last element, to avoid a blank line.
-      r = stdout.split('\n')
+            r = result.stdout.split("\n")
-      r = r[0:-1]
+            r = r[0:-1]
 
-      if have_rev and full_name:
+            if have_rev and full_name:
-        for line in r:
+                for line in r:
-          rev, line = line.split(':', 1)
+                    rev, line = line.split(":", 1)
-          out.write("%s", rev)
+                    out.write("%s", rev)
-          out.write(':')
+                    out.write(":")
-          out.project(_RelPath(project))
+                    out.project(_RelPath(result.project))
-          out.write('/')
+                    out.write("/")
-          out.write("%s", line)
+                    out.write("%s", line)
-          out.nl()
+                    out.nl()
-      elif full_name:
+            elif full_name:
-        for line in r:
+                for line in r:
-          out.project(_RelPath(project))
+                    out.project(_RelPath(result.project))
-          out.write('/')
+                    out.write("/")
-          out.write("%s", line)
+                    out.write("%s", line)
-          out.nl()
+                    out.nl()
-      else:
+            else:
-        for line in r:
+                for line in r:
-          print(line)
+                    print(line)
 
-    return (git_failed, bad_rev, have_match)
+        return (git_failed, bad_rev, have_match, errors)
 
-  def Execute(self, opt, args):
+    def Execute(self, opt, args):
-    out = GrepColoring(self.manifest.manifestProject.config)
+        out = GrepColoring(self.manifest.manifestProject.config)
 
-    cmd_argv = ['grep']
+        cmd_argv = ["grep"]
-    if out.is_on:
+        if out.is_on:
-      cmd_argv.append('--color')
+            cmd_argv.append("--color")
-    cmd_argv.extend(getattr(opt, 'cmd_argv', []))
+        cmd_argv.extend(getattr(opt, "cmd_argv", []))
 
-    if '-e' not in cmd_argv:
+        if "-e" not in cmd_argv:
-      if not args:
+            if not args:
-        self.Usage()
+                self.Usage()
-      cmd_argv.append('-e')
+            cmd_argv.append("-e")
-      cmd_argv.append(args[0])
+            cmd_argv.append(args[0])
-      args = args[1:]
+            args = args[1:]
 
-    projects = self.GetProjects(args, all_manifests=not opt.this_manifest_only)
+        projects = self.GetProjects(
+            args, all_manifests=not opt.this_manifest_only
+        )
 
-    full_name = False
+        full_name = False
-    if len(projects) > 1:
+        if len(projects) > 1:
-      cmd_argv.append('--full-name')
+            cmd_argv.append("--full-name")
-      full_name = True
+            full_name = True
 
-    have_rev = False
+        have_rev = False
-    if opt.revision:
+        if opt.revision:
-      if '--cached' in cmd_argv:
+            if "--cached" in cmd_argv:
-        print('fatal: cannot combine --cached and --revision', file=sys.stderr)
+                msg = "fatal: cannot combine --cached and --revision"
-        sys.exit(1)
+                logger.error(msg)
-      have_rev = True
+                raise InvalidArgumentsError(msg)
-      cmd_argv.extend(opt.revision)
+            have_rev = True
-    cmd_argv.append('--')
+            cmd_argv.extend(opt.revision)
+        cmd_argv.append("--")
 
-    git_failed, bad_rev, have_match = self.ExecuteInParallel(
+        git_failed, bad_rev, have_match, errors = self.ExecuteInParallel(
-        opt.jobs,
+            opt.jobs,
-        functools.partial(self._ExecuteOne, cmd_argv),
+            functools.partial(self._ExecuteOne, cmd_argv),
-        projects,
+            projects,
-        callback=functools.partial(self._ProcessResults, full_name, have_rev, opt),
+            callback=functools.partial(
-        output=out,
+                self._ProcessResults, full_name, have_rev, opt
-        ordered=True)
+            ),
+            output=out,
+            ordered=True,
+        )
 
-    if git_failed:
+        if git_failed:
-      sys.exit(1)
+            raise GrepCommandError(
-    elif have_match:
+                "error: git failures", aggregate_errors=errors
-      sys.exit(0)
+            )
-    elif have_rev and bad_rev:
+        elif have_match:
-      for r in opt.revision:
+            sys.exit(0)
-        print("error: can't search revision %s" % r, file=sys.stderr)
+        elif have_rev and bad_rev:
-      sys.exit(1)
+            for r in opt.revision:
-    else:
+                logger.error("error: can't search revision %s", r)
-      sys.exit(1)
+        raise GrepCommandError(aggregate_errors=errors)

subcmds/help.py

@@ -16,165 +16,178 @@ import re
 import sys
 import textwrap
 
-from subcmds import all_commands
 from color import Coloring
-from command import PagedCommand, MirrorSafeCommand, GitcAvailableCommand, GitcClientCommand
+from command import MirrorSafeCommand
-import gitc_utils
+from command import PagedCommand
+from error import RepoExitError
+from subcmds import all_commands
 from wrapper import Wrapper
 
 
+class InvalidHelpCommand(RepoExitError):
+    """Invalid command passed into help."""
+
+
 class Help(PagedCommand, MirrorSafeCommand):
-  COMMON = False
+    COMMON = False
-  helpSummary = "Display detailed help on a command"
+    helpSummary = "Display detailed help on a command"
-  helpUsage = """
+    helpUsage = """
 %prog [--all|command]
 """
-  helpDescription = """
+    helpDescription = """
 Displays detailed usage information about a command.
 """
 
-  def _PrintCommands(self, commandNames):
+    def _PrintCommands(self, commandNames):
-    """Helper to display |commandNames| summaries."""
+        """Helper to display |commandNames| summaries."""
-    maxlen = 0
+        maxlen = 0
-    for name in commandNames:
+        for name in commandNames:
-      maxlen = max(maxlen, len(name))
+            maxlen = max(maxlen, len(name))
-    fmt = '  %%-%ds  %%s' % maxlen
+        fmt = "  %%-%ds  %%s" % maxlen
 
-    for name in commandNames:
+        for name in commandNames:
-      command = all_commands[name]()
+            command = all_commands[name]()
-      try:
+            try:
-        summary = command.helpSummary.strip()
+                summary = command.helpSummary.strip()
-      except AttributeError:
+            except AttributeError:
-        summary = ''
+                summary = ""
-      print(fmt % (name, summary))
+            print(fmt % (name, summary))
 
-  def _PrintAllCommands(self):
+    def _PrintAllCommands(self):
-    print('usage: repo COMMAND [ARGS]')
+        print("usage: repo COMMAND [ARGS]")
-    self.PrintAllCommandsBody()
+        self.PrintAllCommandsBody()
 
-  def PrintAllCommandsBody(self):
+    def PrintAllCommandsBody(self):
-    print('The complete list of recognized repo commands is:')
+        print("The complete list of recognized repo commands is:")
-    commandNames = list(sorted(all_commands))
+        commandNames = list(sorted(all_commands))
-    self._PrintCommands(commandNames)
+        self._PrintCommands(commandNames)
-    print("See 'repo help <command>' for more information on a "
+        print(
-          'specific command.')
+            "See 'repo help <command>' for more information on a "
-    print('Bug reports:', Wrapper().BUG_URL)
+            "specific command."
+        )
+        print("Bug reports:", Wrapper().BUG_URL)
 
-  def _PrintCommonCommands(self):
+    def _PrintCommonCommands(self):
-    print('usage: repo COMMAND [ARGS]')
+        print("usage: repo COMMAND [ARGS]")
-    self.PrintCommonCommandsBody()
+        self.PrintCommonCommandsBody()
 
-  def PrintCommonCommandsBody(self):
+    def PrintCommonCommandsBody(self):
-    print('The most commonly used repo commands are:')
+        print("The most commonly used repo commands are:")
 
-    def gitc_supported(cmd):
+        commandNames = list(
-      if not isinstance(cmd, GitcAvailableCommand) and not isinstance(cmd, GitcClientCommand):
+            sorted(
-        return True
+                name for name, command in all_commands.items() if command.COMMON
-      if self.client.isGitcClient:
+            )
-        return True
+        )
-      if isinstance(cmd, GitcClientCommand):
+        self._PrintCommands(commandNames)
-        return False
-      if gitc_utils.get_gitc_manifest_dir():
-        return True
-      return False
 
-    commandNames = list(sorted([name
+        print(
-                                for name, command in all_commands.items()
+            "See 'repo help <command>' for more information on a specific "
-                                if command.COMMON and gitc_supported(command)]))
+            "command.\nSee 'repo help --all' for a complete list of recognized "
-    self._PrintCommands(commandNames)
+            "commands."
+        )
+        print("Bug reports:", Wrapper().BUG_URL)
 
-    print(
+    def _PrintCommandHelp(self, cmd, header_prefix=""):
-        "See 'repo help <command>' for more information on a specific command.\n"
+        class _Out(Coloring):
-        "See 'repo help --all' for a complete list of recognized commands.")
+            def __init__(self, gc):
-    print('Bug reports:', Wrapper().BUG_URL)
+                Coloring.__init__(self, gc, "help")
+                self.heading = self.printer("heading", attr="bold")
+                self._first = True
 
-  def _PrintCommandHelp(self, cmd, header_prefix=''):
+            def _PrintSection(self, heading, bodyAttr):
-    class _Out(Coloring):
+                try:
-      def __init__(self, gc):
+                    body = getattr(cmd, bodyAttr)
-        Coloring.__init__(self, gc, 'help')
+                except AttributeError:
-        self.heading = self.printer('heading', attr='bold')
+                    return
-        self._first = True
+                if body == "" or body is None:
+                    return
 
-      def _PrintSection(self, heading, bodyAttr):
+                if not self._first:
-        try:
+                    self.nl()
-          body = getattr(cmd, bodyAttr)
+                self._first = False
-        except AttributeError:
-          return
-        if body == '' or body is None:
-          return
 
-        if not self._first:
+                self.heading("%s%s", header_prefix, heading)
-          self.nl()
+                self.nl()
-        self._first = False
+                self.nl()
 
-        self.heading('%s%s', header_prefix, heading)
+                me = "repo %s" % cmd.NAME
-        self.nl()
+                body = body.strip()
-        self.nl()
+                body = body.replace("%prog", me)
 
-        me = 'repo %s' % cmd.NAME
+                # Extract the title, but skip any trailing {#anchors}.
-        body = body.strip()
+                asciidoc_hdr = re.compile(r"^\n?#+ ([^{]+)(\{#.+\})?$")
-        body = body.replace('%prog', me)
+                for para in body.split("\n\n"):
+                    if para.startswith(" "):
+                        self.write("%s", para)
+                        self.nl()
+                        self.nl()
+                        continue
 
-        # Extract the title, but skip any trailing {#anchors}.
+                    m = asciidoc_hdr.match(para)
-        asciidoc_hdr = re.compile(r'^\n?#+ ([^{]+)(\{#.+\})?$')
+                    if m:
-        for para in body.split("\n\n"):
+                        self.heading("%s%s", header_prefix, m.group(1))
-          if para.startswith(' '):
+                        self.nl()
-            self.write('%s', para)
+                        self.nl()
-            self.nl()
+                        continue
-            self.nl()
-            continue
 
-          m = asciidoc_hdr.match(para)
+                    lines = textwrap.wrap(
-          if m:
+                        para.replace("  ", " "),
-            self.heading('%s%s', header_prefix, m.group(1))
+                        width=80,
-            self.nl()
+                        break_long_words=False,
-            self.nl()
+                        break_on_hyphens=False,
-            continue
+                    )
+                    for line in lines:
+                        self.write("%s", line)
+                        self.nl()
+                    self.nl()
 
-          lines = textwrap.wrap(para.replace('  ', ' '), width=80,
+        out = _Out(self.client.globalConfig)
-                                break_long_words=False, break_on_hyphens=False)
+        out._PrintSection("Summary", "helpSummary")
-          for line in lines:
+        cmd.OptionParser.print_help()
-            self.write('%s', line)
+        out._PrintSection("Description", "helpDescription")
-            self.nl()
-          self.nl()
 
-    out = _Out(self.client.globalConfig)
+    def _PrintAllCommandHelp(self):
-    out._PrintSection('Summary', 'helpSummary')
+        for name in sorted(all_commands):
-    cmd.OptionParser.print_help()
+            cmd = all_commands[name](manifest=self.manifest)
-    out._PrintSection('Description', 'helpDescription')
+            self._PrintCommandHelp(cmd, header_prefix="[%s] " % (name,))
 
-  def _PrintAllCommandHelp(self):
+    def _Options(self, p):
-    for name in sorted(all_commands):
+        p.add_option(
-      cmd = all_commands[name](manifest=self.manifest)
+            "-a",
-      self._PrintCommandHelp(cmd, header_prefix='[%s] ' % (name,))
+            "--all",
+            dest="show_all",
+            action="store_true",
+            help="show the complete list of commands",
+        )
+        p.add_option(
+            "--help-all",
+            dest="show_all_help",
+            action="store_true",
+            help="show the --help of all commands",
+        )
 
-  def _Options(self, p):
+    def Execute(self, opt, args):
-    p.add_option('-a', '--all',
+        if len(args) == 0:
-                 dest='show_all', action='store_true',
+            if opt.show_all_help:
-                 help='show the complete list of commands')
+                self._PrintAllCommandHelp()
-    p.add_option('--help-all',
+            elif opt.show_all:
-                 dest='show_all_help', action='store_true',
+                self._PrintAllCommands()
-                 help='show the --help of all commands')
+            else:
+                self._PrintCommonCommands()
 
-  def Execute(self, opt, args):
+        elif len(args) == 1:
-    if len(args) == 0:
+            name = args[0]
-      if opt.show_all_help:
-        self._PrintAllCommandHelp()
-      elif opt.show_all:
-        self._PrintAllCommands()
-      else:
-        self._PrintCommonCommands()
 
-    elif len(args) == 1:
+            try:
-      name = args[0]
+                cmd = all_commands[name](manifest=self.manifest)
+            except KeyError:
+                print(
+                    "repo: '%s' is not a repo command." % name, file=sys.stderr
+                )
+                raise InvalidHelpCommand(name)
 
-      try:
+            self._PrintCommandHelp(cmd)
-        cmd = all_commands[name](manifest=self.manifest)
-      except KeyError:
-        print("repo: '%s' is not a repo command." % name, file=sys.stderr)
-        sys.exit(1)
 
-      self._PrintCommandHelp(cmd)
+        else:
-
+            self._PrintCommandHelp(self)
-    else:
-      self._PrintCommandHelp(self)

subcmds/info.py

@@ -14,209 +14,241 @@
 
 import optparse
 
-from command import PagedCommand
 from color import Coloring
-from git_refs import R_M, R_HEADS
+from command import PagedCommand
+from git_refs import R_HEADS
+from git_refs import R_M
 
 
 class _Coloring(Coloring):
-  def __init__(self, config):
+    def __init__(self, config):
-    Coloring.__init__(self, config, "status")
+        Coloring.__init__(self, config, "status")
 
 
 class Info(PagedCommand):
-  COMMON = True
+    COMMON = True
-  helpSummary = "Get info on the manifest branch, current branch or unmerged branches"
+    helpSummary = (
-  helpUsage = "%prog [-dl] [-o [-c]] [<project>...]"
+        "Get info on the manifest branch, current branch or unmerged branches"
+    )
+    helpUsage = "%prog [-dl] [-o [-c]] [<project>...]"
 
-  def _Options(self, p):
+    def _Options(self, p):
-    p.add_option('-d', '--diff',
+        p.add_option(
-                 dest='all', action='store_true',
+            "-d",
-                 help="show full info and commit diff including remote branches")
+            "--diff",
-    p.add_option('-o', '--overview',
+            dest="all",
-                 dest='overview', action='store_true',
+            action="store_true",
-                 help='show overview of all local commits')
+            help="show full info and commit diff including remote branches",
-    p.add_option('-c', '--current-branch',
+        )
-                 dest="current_branch", action="store_true",
+        p.add_option(
-                 help="consider only checked out branches")
+            "-o",
-    p.add_option('--no-current-branch',
+            "--overview",
-                 dest='current_branch', action='store_false',
+            dest="overview",
-                 help='consider all local branches')
+            action="store_true",
-    # Turn this into a warning & remove this someday.
+            help="show overview of all local commits",
-    p.add_option('-b',
+        )
-                 dest='current_branch', action='store_true',
+        p.add_option(
-                 help=optparse.SUPPRESS_HELP)
+            "-c",
-    p.add_option('-l', '--local-only',
+            "--current-branch",
-                 dest="local", action="store_true",
+            dest="current_branch",
-                 help="disable all remote operations")
+            action="store_true",
+            help="consider only checked out branches",
+        )
+        p.add_option(
+            "--no-current-branch",
+            dest="current_branch",
+            action="store_false",
+            help="consider all local branches",
+        )
+        # Turn this into a warning & remove this someday.
+        p.add_option(
+            "-b",
+            dest="current_branch",
+            action="store_true",
+            help=optparse.SUPPRESS_HELP,
+        )
+        p.add_option(
+            "-l",
+            "--local-only",
+            dest="local",
+            action="store_true",
+            help="disable all remote operations",
+        )
 
-  def Execute(self, opt, args):
+    def Execute(self, opt, args):
-    self.out = _Coloring(self.client.globalConfig)
+        self.out = _Coloring(self.client.globalConfig)
-    self.heading = self.out.printer('heading', attr='bold')
+        self.heading = self.out.printer("heading", attr="bold")
-    self.headtext = self.out.nofmt_printer('headtext', fg='yellow')
+        self.headtext = self.out.nofmt_printer("headtext", fg="yellow")
-    self.redtext = self.out.printer('redtext', fg='red')
+        self.redtext = self.out.printer("redtext", fg="red")
-    self.sha = self.out.printer("sha", fg='yellow')
+        self.sha = self.out.printer("sha", fg="yellow")
-    self.text = self.out.nofmt_printer('text')
+        self.text = self.out.nofmt_printer("text")
-    self.dimtext = self.out.printer('dimtext', attr='dim')
+        self.dimtext = self.out.printer("dimtext", attr="dim")
 
-    self.opt = opt
+        self.opt = opt
 
-    if not opt.this_manifest_only:
+        if not opt.this_manifest_only:
-      self.manifest = self.manifest.outer_client
+            self.manifest = self.manifest.outer_client
-    manifestConfig = self.manifest.manifestProject.config
+        manifestConfig = self.manifest.manifestProject.config
-    mergeBranch = manifestConfig.GetBranch("default").merge
+        mergeBranch = manifestConfig.GetBranch("default").merge
-    manifestGroups = self.manifest.GetGroupsStr()
+        manifestGroups = self.manifest.GetGroupsStr()
 
-    self.heading("Manifest branch: ")
+        self.heading("Manifest branch: ")
-    if self.manifest.default.revisionExpr:
+        if self.manifest.default.revisionExpr:
-        self.headtext(self.manifest.default.revisionExpr)
+            self.headtext(self.manifest.default.revisionExpr)
-    self.out.nl()
+        self.out.nl()
-    self.heading("Manifest merge branch: ")
+        self.heading("Manifest merge branch: ")
-    self.headtext(mergeBranch)
+        self.headtext(mergeBranch)
-    self.out.nl()
+        self.out.nl()
-    self.heading("Manifest groups: ")
+        self.heading("Manifest groups: ")
-    self.headtext(manifestGroups)
+        self.headtext(manifestGroups)
-    self.out.nl()
-
-    self.printSeparator()
-
-    if not opt.overview:
-      self._printDiffInfo(opt, args)
-    else:
-      self._printCommitOverview(opt, args)
-
-  def printSeparator(self):
-    self.text("----------------------------")
-    self.out.nl()
-
-  def _printDiffInfo(self, opt, args):
-    # We let exceptions bubble up to main as they'll be well structured.
-    projs = self.GetProjects(args, all_manifests=not opt.this_manifest_only)
-
-    for p in projs:
-      self.heading("Project: ")
-      self.headtext(p.name)
-      self.out.nl()
-
-      self.heading("Mount path: ")
-      self.headtext(p.worktree)
-      self.out.nl()
-
-      self.heading("Current revision: ")
-      self.headtext(p.GetRevisionId())
-      self.out.nl()
-
-      currentBranch = p.CurrentBranch
-      if currentBranch:
-        self.heading('Current branch: ')
-        self.headtext(currentBranch)
         self.out.nl()
 
-      self.heading("Manifest revision: ")
+        self.printSeparator()
-      self.headtext(p.revisionExpr)
-      self.out.nl()
 
-      localBranches = list(p.GetBranches().keys())
+        if not opt.overview:
-      self.heading("Local Branches: ")
+            self._printDiffInfo(opt, args)
-      self.redtext(str(len(localBranches)))
+        else:
-      if localBranches:
+            self._printCommitOverview(opt, args)
-        self.text(" [")
-        self.text(", ".join(localBranches))
-        self.text("]")
-      self.out.nl()
 
-      if self.opt.all:
+    def printSeparator(self):
-        self.findRemoteLocalDiff(p)
+        self.text("----------------------------")
-
-      self.printSeparator()
-
-  def findRemoteLocalDiff(self, project):
-    # Fetch all the latest commits.
-    if not self.opt.local:
-      project.Sync_NetworkHalf(quiet=True, current_branch_only=True)
-
-    branch = self.manifest.manifestProject.config.GetBranch('default').merge
-    if branch.startswith(R_HEADS):
-      branch = branch[len(R_HEADS):]
-    logTarget = R_M + branch
-
-    bareTmp = project.bare_git._bare
-    project.bare_git._bare = False
-    localCommits = project.bare_git.rev_list(
-        '--abbrev=8',
-        '--abbrev-commit',
-        '--pretty=oneline',
-        logTarget + "..",
-        '--')
-
-    originCommits = project.bare_git.rev_list(
-        '--abbrev=8',
-        '--abbrev-commit',
-        '--pretty=oneline',
-        ".." + logTarget,
-        '--')
-    project.bare_git._bare = bareTmp
-
-    self.heading("Local Commits: ")
-    self.redtext(str(len(localCommits)))
-    self.dimtext(" (on current branch)")
-    self.out.nl()
-
-    for c in localCommits:
-      split = c.split()
-      self.sha(split[0] + " ")
-      self.text(" ".join(split[1:]))
-      self.out.nl()
-
-    self.printSeparator()
-
-    self.heading("Remote Commits: ")
-    self.redtext(str(len(originCommits)))
-    self.out.nl()
-
-    for c in originCommits:
-      split = c.split()
-      self.sha(split[0] + " ")
-      self.text(" ".join(split[1:]))
-      self.out.nl()
-
-  def _printCommitOverview(self, opt, args):
-    all_branches = []
-    for project in self.GetProjects(args, all_manifests=not opt.this_manifest_only):
-      br = [project.GetUploadableBranch(x)
-            for x in project.GetBranches()]
-      br = [x for x in br if x]
-      if self.opt.current_branch:
-        br = [x for x in br if x.name == project.CurrentBranch]
-      all_branches.extend(br)
-
-    if not all_branches:
-      return
-
-    self.out.nl()
-    self.heading('Projects Overview')
-    project = None
-
-    for branch in all_branches:
-      if project != branch.project:
-        project = branch.project
-        self.out.nl()
-        self.headtext(project.RelPath(local=opt.this_manifest_only))
         self.out.nl()
 
-      commits = branch.commits
+    def _printDiffInfo(self, opt, args):
-      date = branch.date
+        # We let exceptions bubble up to main as they'll be well structured.
-      self.text('%s %-33s (%2d commit%s, %s)' % (
+        projs = self.GetProjects(args, all_manifests=not opt.this_manifest_only)
-          branch.name == project.CurrentBranch and '*' or ' ',
-          branch.name,
-          len(commits),
-          len(commits) != 1 and 's' or '',
-          date))
-      self.out.nl()
 
-      for commit in commits:
+        for p in projs:
-        split = commit.split()
+            self.heading("Project: ")
-        self.text('{0:38}{1} '.format('', '-'))
+            self.headtext(p.name)
-        self.sha(split[0] + " ")
+            self.out.nl()
-        self.text(" ".join(split[1:]))
+
+            self.heading("Mount path: ")
+            self.headtext(p.worktree)
+            self.out.nl()
+
+            self.heading("Current revision: ")
+            self.headtext(p.GetRevisionId())
+            self.out.nl()
+
+            currentBranch = p.CurrentBranch
+            if currentBranch:
+                self.heading("Current branch: ")
+                self.headtext(currentBranch)
+                self.out.nl()
+
+            self.heading("Manifest revision: ")
+            self.headtext(p.revisionExpr)
+            self.out.nl()
+
+            localBranches = list(p.GetBranches().keys())
+            self.heading("Local Branches: ")
+            self.redtext(str(len(localBranches)))
+            if localBranches:
+                self.text(" [")
+                self.text(", ".join(localBranches))
+                self.text("]")
+            self.out.nl()
+
+            if self.opt.all:
+                self.findRemoteLocalDiff(p)
+
+            self.printSeparator()
+
+    def findRemoteLocalDiff(self, project):
+        # Fetch all the latest commits.
+        if not self.opt.local:
+            project.Sync_NetworkHalf(quiet=True, current_branch_only=True)
+
+        branch = self.manifest.manifestProject.config.GetBranch("default").merge
+        if branch.startswith(R_HEADS):
+            branch = branch[len(R_HEADS) :]
+        logTarget = R_M + branch
+
+        bareTmp = project.bare_git._bare
+        project.bare_git._bare = False
+        localCommits = project.bare_git.rev_list(
+            "--abbrev=8",
+            "--abbrev-commit",
+            "--pretty=oneline",
+            logTarget + "..",
+            "--",
+        )
+
+        originCommits = project.bare_git.rev_list(
+            "--abbrev=8",
+            "--abbrev-commit",
+            "--pretty=oneline",
+            ".." + logTarget,
+            "--",
+        )
+        project.bare_git._bare = bareTmp
+
+        self.heading("Local Commits: ")
+        self.redtext(str(len(localCommits)))
+        self.dimtext(" (on current branch)")
         self.out.nl()
+
+        for c in localCommits:
+            split = c.split()
+            self.sha(split[0] + " ")
+            self.text(" ".join(split[1:]))
+            self.out.nl()
+
+        self.printSeparator()
+
+        self.heading("Remote Commits: ")
+        self.redtext(str(len(originCommits)))
+        self.out.nl()
+
+        for c in originCommits:
+            split = c.split()
+            self.sha(split[0] + " ")
+            self.text(" ".join(split[1:]))
+            self.out.nl()
+
+    def _printCommitOverview(self, opt, args):
+        all_branches = []
+        for project in self.GetProjects(
+            args, all_manifests=not opt.this_manifest_only
+        ):
+            br = [project.GetUploadableBranch(x) for x in project.GetBranches()]
+            br = [x for x in br if x]
+            if self.opt.current_branch:
+                br = [x for x in br if x.name == project.CurrentBranch]
+            all_branches.extend(br)
+
+        if not all_branches:
+            return
+
+        self.out.nl()
+        self.heading("Projects Overview")
+        project = None
+
+        for branch in all_branches:
+            if project != branch.project:
+                project = branch.project
+                self.out.nl()
+                self.headtext(project.RelPath(local=opt.this_manifest_only))
+                self.out.nl()
+
+            commits = branch.commits
+            date = branch.date
+            self.text(
+                "%s %-33s (%2d commit%s, %s)"
+                % (
+                    branch.name == project.CurrentBranch and "*" or " ",
+                    branch.name,
+                    len(commits),
+                    len(commits) != 1 and "s" or "",
+                    date,
+                )
+            )
+            self.out.nl()
+
+            for commit in commits:
+                split = commit.split()
+                self.text("{0:38}{1} ".format("", "-"))
+                self.sha(split[0] + " ")
+                self.text(" ".join(split[1:]))
+                self.out.nl()

subcmds/init.py

@@ -13,28 +13,33 @@
 # limitations under the License.
 
 import os
-import platform
-import re
 import sys
-import urllib.parse
 
 from color import Coloring
-from command import InteractiveCommand, MirrorSafeCommand
+from command import InteractiveCommand
-from error import ManifestParseError
+from command import MirrorSafeCommand
-from project import SyncBuffer
+from error import RepoUnhandledExceptionError
-from git_config import GitConfig
+from error import UpdateManifestError
-from git_command import git_require, MIN_GIT_VERSION_SOFT, MIN_GIT_VERSION_HARD
+from git_command import git_require
+from git_command import MIN_GIT_VERSION_HARD
+from git_command import MIN_GIT_VERSION_SOFT
+from repo_logging import RepoLogger
 from wrapper import Wrapper
 
 
+logger = RepoLogger(__file__)
+
+_REPO_ALLOW_SHALLOW = os.environ.get("REPO_ALLOW_SHALLOW")
+
+
 class Init(InteractiveCommand, MirrorSafeCommand):
-  COMMON = True
+    COMMON = True
-  MULTI_MANIFEST_SUPPORT = True
+    MULTI_MANIFEST_SUPPORT = True
-  helpSummary = "Initialize a repo client checkout in the current directory"
+    helpSummary = "Initialize a repo client checkout in the current directory"
-  helpUsage = """
+    helpUsage = """
 %prog [options] [manifest url]
 """
-  helpDescription = """
+    helpDescription = """
 The '%prog' command is run once to install and initialize repo.
 The latest repo source code and manifest collection is downloaded
 from the server and is installed in the .repo/ directory in the
@@ -83,250 +88,310 @@ manifest, a subsequent `repo sync` (or `repo sync -d`) is necessary
 to update the working directory files.
 """
 
-  def _CommonOptions(self, p):
+    def _CommonOptions(self, p):
-    """Disable due to re-use of Wrapper()."""
+        """Disable due to re-use of Wrapper()."""
 
-  def _Options(self, p, gitc_init=False):
+    def _Options(self, p):
-    Wrapper().InitParser(p, gitc_init=gitc_init)
+        Wrapper().InitParser(p)
-    m = p.add_option_group('Multi-manifest')
+        m = p.add_option_group("Multi-manifest")
-    m.add_option('--outer-manifest', action='store_true', default=True,
+        m.add_option(
-                 help='operate starting at the outermost manifest')
+            "--outer-manifest",
-    m.add_option('--no-outer-manifest', dest='outer_manifest',
+            action="store_true",
-                 action='store_false', help='do not operate on outer manifests')
+            default=True,
-    m.add_option('--this-manifest-only', action='store_true', default=None,
+            help="operate starting at the outermost manifest",
-                 help='only operate on this (sub)manifest')
+        )
-    m.add_option('--no-this-manifest-only', '--all-manifests',
+        m.add_option(
-                 dest='this_manifest_only', action='store_false',
+            "--no-outer-manifest",
-                 help='operate on this manifest and its submanifests')
+            dest="outer_manifest",
+            action="store_false",
+            help="do not operate on outer manifests",
+        )
+        m.add_option(
+            "--this-manifest-only",
+            action="store_true",
+            default=None,
+            help="only operate on this (sub)manifest",
+        )
+        m.add_option(
+            "--no-this-manifest-only",
+            "--all-manifests",
+            dest="this_manifest_only",
+            action="store_false",
+            help="operate on this manifest and its submanifests",
+        )
 
-  def _RegisteredEnvironmentOptions(self):
+    def _RegisteredEnvironmentOptions(self):
-    return {'REPO_MANIFEST_URL': 'manifest_url',
+        return {
-            'REPO_MIRROR_LOCATION': 'reference'}
+            "REPO_MANIFEST_URL": "manifest_url",
+            "REPO_MIRROR_LOCATION": "reference",
+        }
 
-  def _SyncManifest(self, opt):
+    def _SyncManifest(self, opt):
-    """Call manifestProject.Sync with arguments from opt.
+        """Call manifestProject.Sync with arguments from opt.
 
-    Args:
+        Args:
-      opt: options from optparse.
+            opt: options from optparse.
-    """
+        """
-    # Normally this value is set when instantiating the project, but the
+        # Normally this value is set when instantiating the project, but the
-    # manifest project is special and is created when instantiating the
+        # manifest project is special and is created when instantiating the
-    # manifest which happens before we parse options.
+        # manifest which happens before we parse options.
-    self.manifest.manifestProject.clone_depth = opt.manifest_depth
+        self.manifest.manifestProject.clone_depth = opt.manifest_depth
-    if not self.manifest.manifestProject.Sync(
+        clone_filter_for_depth = (
-        manifest_url=opt.manifest_url,
+            "blob:none" if (_REPO_ALLOW_SHALLOW == "0") else None
-        manifest_branch=opt.manifest_branch,
+        )
-        standalone_manifest=opt.standalone_manifest,
+        if not self.manifest.manifestProject.Sync(
-        groups=opt.groups,
+            manifest_url=opt.manifest_url,
-        platform=opt.platform,
+            manifest_branch=opt.manifest_branch,
-        mirror=opt.mirror,
+            standalone_manifest=opt.standalone_manifest,
-        dissociate=opt.dissociate,
+            groups=opt.groups,
-        reference=opt.reference,
+            platform=opt.platform,
-        worktree=opt.worktree,
+            mirror=opt.mirror,
-        submodules=opt.submodules,
+            dissociate=opt.dissociate,
-        archive=opt.archive,
+            reference=opt.reference,
-        partial_clone=opt.partial_clone,
+            worktree=opt.worktree,
-        clone_filter=opt.clone_filter,
+            submodules=opt.submodules,
-        partial_clone_exclude=opt.partial_clone_exclude,
+            archive=opt.archive,
-        clone_bundle=opt.clone_bundle,
+            partial_clone=opt.partial_clone,
-        git_lfs=opt.git_lfs,
+            clone_filter=opt.clone_filter,
-        use_superproject=opt.use_superproject,
+            partial_clone_exclude=opt.partial_clone_exclude,
-        verbose=opt.verbose,
+            clone_filter_for_depth=clone_filter_for_depth,
-        current_branch_only=opt.current_branch_only,
+            clone_bundle=opt.clone_bundle,
-        tags=opt.tags,
+            git_lfs=opt.git_lfs,
-        depth=opt.depth,
+            use_superproject=opt.use_superproject,
-        git_event_log=self.git_event_log,
+            verbose=opt.verbose,
-        manifest_name=opt.manifest_name):
+            current_branch_only=opt.current_branch_only,
-      sys.exit(1)
+            tags=opt.tags,
+            depth=opt.depth,
+            git_event_log=self.git_event_log,
+            manifest_name=opt.manifest_name,
+        ):
+            manifest_name = opt.manifest_name
+            raise UpdateManifestError(
+                f"Unable to sync manifest {manifest_name}"
+            )
 
-  def _Prompt(self, prompt, value):
+    def _Prompt(self, prompt, value):
-    print('%-10s [%s]: ' % (prompt, value), end='')
+        print("%-10s [%s]: " % (prompt, value), end="", flush=True)
-    # TODO: When we require Python 3, use flush=True w/print above.
+        a = sys.stdin.readline().strip()
-    sys.stdout.flush()
+        if a == "":
-    a = sys.stdin.readline().strip()
+            return value
-    if a == '':
+        return a
-      return value
-    return a
 
-  def _ShouldConfigureUser(self, opt, existing_checkout):
+    def _ShouldConfigureUser(self, opt, existing_checkout):
-    gc = self.client.globalConfig
+        gc = self.client.globalConfig
-    mp = self.manifest.manifestProject
+        mp = self.manifest.manifestProject
 
-    # If we don't have local settings, get from global.
+        # If we don't have local settings, get from global.
-    if not mp.config.Has('user.name') or not mp.config.Has('user.email'):
+        if not mp.config.Has("user.name") or not mp.config.Has("user.email"):
-      if not gc.Has('user.name') or not gc.Has('user.email'):
+            if not gc.Has("user.name") or not gc.Has("user.email"):
-        return True
+                return True
 
-      mp.config.SetString('user.name', gc.GetString('user.name'))
+            mp.config.SetString("user.name", gc.GetString("user.name"))
-      mp.config.SetString('user.email', gc.GetString('user.email'))
+            mp.config.SetString("user.email", gc.GetString("user.email"))
 
-    if not opt.quiet and not existing_checkout or opt.verbose:
+        if not opt.quiet and not existing_checkout or opt.verbose:
-      print()
+            print()
-      print('Your identity is: %s <%s>' % (mp.config.GetString('user.name'),
+            print(
-                                           mp.config.GetString('user.email')))
+                "Your identity is: %s <%s>"
-      print("If you want to change this, please re-run 'repo init' with --config-name")
+                % (
-    return False
+                    mp.config.GetString("user.name"),
+                    mp.config.GetString("user.email"),
+                )
+            )
+            print(
+                "If you want to change this, please re-run 'repo init' with "
+                "--config-name"
+            )
+        return False
 
-  def _ConfigureUser(self, opt):
+    def _ConfigureUser(self, opt):
-    mp = self.manifest.manifestProject
+        mp = self.manifest.manifestProject
+
+        while True:
+            if not opt.quiet:
+                print()
+            name = self._Prompt("Your Name", mp.UserName)
+            email = self._Prompt("Your Email", mp.UserEmail)
+
+            if not opt.quiet:
+                print()
+            print("Your identity is: %s <%s>" % (name, email))
+            print("is this correct [y/N]? ", end="", flush=True)
+            a = sys.stdin.readline().strip().lower()
+            if a in ("yes", "y", "t", "true"):
+                break
+
+        if name != mp.UserName:
+            mp.config.SetString("user.name", name)
+        if email != mp.UserEmail:
+            mp.config.SetString("user.email", email)
+
+    def _HasColorSet(self, gc):
+        for n in ["ui", "diff", "status"]:
+            if gc.Has("color.%s" % n):
+                return True
+        return False
+
+    def _ConfigureColor(self):
+        gc = self.client.globalConfig
+        if self._HasColorSet(gc):
+            return
+
+        class _Test(Coloring):
+            def __init__(self):
+                Coloring.__init__(self, gc, "test color display")
+                self._on = True
+
+        out = _Test()
 
-    while True:
-      if not opt.quiet:
         print()
-      name = self._Prompt('Your Name', mp.UserName)
+        print("Testing colorized output (for 'repo diff', 'repo status'):")
-      email = self._Prompt('Your Email', mp.UserEmail)
+
+        for c in ["black", "red", "green", "yellow", "blue", "magenta", "cyan"]:
+            out.write(" ")
+            out.printer(fg=c)(" %-6s ", c)
+        out.write(" ")
+        out.printer(fg="white", bg="black")(" %s " % "white")
+        out.nl()
+
+        for c in ["bold", "dim", "ul", "reverse"]:
+            out.write(" ")
+            out.printer(fg="black", attr=c)(" %-6s ", c)
+        out.nl()
+
+        print(
+            "Enable color display in this user account (y/N)? ",
+            end="",
+            flush=True,
+        )
+        a = sys.stdin.readline().strip().lower()
+        if a in ("y", "yes", "t", "true", "on"):
+            gc.SetString("color.ui", "auto")
+
+    def _DisplayResult(self):
+        if self.manifest.IsMirror:
+            init_type = "mirror "
+        else:
+            init_type = ""
 
-      if not opt.quiet:
         print()
-      print('Your identity is: %s <%s>' % (name, email))
+        print(
-      print('is this correct [y/N]? ', end='')
+            "repo %shas been initialized in %s"
-      # TODO: When we require Python 3, use flush=True w/print above.
+            % (init_type, self.manifest.topdir)
-      sys.stdout.flush()
+        )
-      a = sys.stdin.readline().strip().lower()
-      if a in ('yes', 'y', 't', 'true'):
-        break
 
-    if name != mp.UserName:
+        current_dir = os.getcwd()
-      mp.config.SetString('user.name', name)
+        if current_dir != self.manifest.topdir:
-    if email != mp.UserEmail:
+            print(
-      mp.config.SetString('user.email', email)
+                "If this is not the directory in which you want to initialize "
+                "repo, please run:"
+            )
+            print("   rm -r %s" % os.path.join(self.manifest.topdir, ".repo"))
+            print("and try again.")
 
-  def _HasColorSet(self, gc):
+    def ValidateOptions(self, opt, args):
-    for n in ['ui', 'diff', 'status']:
+        if opt.reference:
-      if gc.Has('color.%s' % n):
+            opt.reference = os.path.expanduser(opt.reference)
-        return True
-    return False
 
-  def _ConfigureColor(self):
+        # Check this here, else manifest will be tagged "not new" and init won't
-    gc = self.client.globalConfig
+        # be possible anymore without removing the .repo/manifests directory.
-    if self._HasColorSet(gc):
+        if opt.mirror:
-      return
+            if opt.archive:
+                self.OptionParser.error(
+                    "--mirror and --archive cannot be used " "together."
+                )
+            if opt.use_superproject is not None:
+                self.OptionParser.error(
+                    "--mirror and --use-superproject cannot be "
+                    "used together."
+                )
+        if opt.archive and opt.use_superproject is not None:
+            self.OptionParser.error(
+                "--archive and --use-superproject cannot be used " "together."
+            )
 
-    class _Test(Coloring):
+        if opt.standalone_manifest and (
-      def __init__(self):
+            opt.manifest_branch or opt.manifest_name != "default.xml"
-        Coloring.__init__(self, gc, 'test color display')
+        ):
-        self._on = True
+            self.OptionParser.error(
-    out = _Test()
+                "--manifest-branch and --manifest-name cannot"
+                " be used with --standalone-manifest."
+            )
 
-    print()
+        if args:
-    print("Testing colorized output (for 'repo diff', 'repo status'):")
+            if opt.manifest_url:
+                self.OptionParser.error(
+                    "--manifest-url option and URL argument both specified: "
+                    "only use one to select the manifest URL."
+                )
 
-    for c in ['black', 'red', 'green', 'yellow', 'blue', 'magenta', 'cyan']:
+            opt.manifest_url = args.pop(0)
-      out.write(' ')
-      out.printer(fg=c)(' %-6s ', c)
-    out.write(' ')
-    out.printer(fg='white', bg='black')(' %s ' % 'white')
-    out.nl()
 
-    for c in ['bold', 'dim', 'ul', 'reverse']:
+            if args:
-      out.write(' ')
+                self.OptionParser.error("too many arguments to init")
-      out.printer(fg='black', attr=c)(' %-6s ', c)
-    out.nl()
 
-    print('Enable color display in this user account (y/N)? ', end='')
+    def Execute(self, opt, args):
-    # TODO: When we require Python 3, use flush=True w/print above.
+        git_require(MIN_GIT_VERSION_HARD, fail=True)
-    sys.stdout.flush()
+        if not git_require(MIN_GIT_VERSION_SOFT):
-    a = sys.stdin.readline().strip().lower()
+            logger.warning(
-    if a in ('y', 'yes', 't', 'true', 'on'):
+                "repo: warning: git-%s+ will soon be required; "
-      gc.SetString('color.ui', 'auto')
+                "please upgrade your version of git to maintain "
+                "support.",
+                ".".join(str(x) for x in MIN_GIT_VERSION_SOFT),
+            )
 
-  def _DisplayResult(self, opt):
+        rp = self.manifest.repoProject
-    if self.manifest.IsMirror:
-      init_type = 'mirror '
-    else:
-      init_type = ''
 
-    if not opt.quiet:
+        # Handle new --repo-url requests.
-      print()
+        if opt.repo_url:
-      print('repo %shas been initialized in %s' %
+            remote = rp.GetRemote("origin")
-            (init_type, self.manifest.topdir))
+            remote.url = opt.repo_url
+            remote.Save()
 
-    current_dir = os.getcwd()
+        # Handle new --repo-rev requests.
-    if current_dir != self.manifest.topdir:
+        if opt.repo_rev:
-      print('If this is not the directory in which you want to initialize '
+            wrapper = Wrapper()
-            'repo, please run:')
+            try:
-      print('   rm -r %s' % os.path.join(self.manifest.topdir, '.repo'))
+                remote_ref, rev = wrapper.check_repo_rev(
-      print('and try again.')
+                    rp.gitdir,
+                    opt.repo_rev,
+                    repo_verify=opt.repo_verify,
+                    quiet=opt.quiet,
+                )
+            except wrapper.CloneFailure as e:
+                err_msg = "fatal: double check your --repo-rev setting."
+                logger.error(err_msg)
+                self.git_event_log.ErrorEvent(err_msg)
+                raise RepoUnhandledExceptionError(e)
 
-  def ValidateOptions(self, opt, args):
+            branch = rp.GetBranch("default")
-    if opt.reference:
+            branch.merge = remote_ref
-      opt.reference = os.path.expanduser(opt.reference)
+            rp.work_git.reset("--hard", rev)
+            branch.Save()
 
-    # Check this here, else manifest will be tagged "not new" and init won't be
+        if opt.worktree:
-    # possible anymore without removing the .repo/manifests directory.
+            # Older versions of git supported worktree, but had dangerous gc
-    if opt.mirror:
+            # bugs.
-      if opt.archive:
+            git_require((2, 15, 0), fail=True, msg="git gc worktree corruption")
-        self.OptionParser.error('--mirror and --archive cannot be used '
-                                'together.')
-      if opt.use_superproject is not None:
-        self.OptionParser.error('--mirror and --use-superproject cannot be '
-                                'used together.')
-    if opt.archive and opt.use_superproject is not None:
-      self.OptionParser.error('--archive and --use-superproject cannot be used '
-                              'together.')
 
-    if opt.standalone_manifest and (opt.manifest_branch or
+        # Provide a short notice that we're reinitializing an existing checkout.
-                                    opt.manifest_name != 'default.xml'):
+        # Sometimes developers might not realize that they're in one, or that
-      self.OptionParser.error('--manifest-branch and --manifest-name cannot'
+        # repo doesn't do nested checkouts.
-                              ' be used with --standalone-manifest.')
+        existing_checkout = self.manifest.manifestProject.Exists
+        if not opt.quiet and existing_checkout:
+            print(
+                "repo: reusing existing repo client checkout in",
+                self.manifest.topdir,
+            )
 
-    if args:
+        self._SyncManifest(opt)
-      if opt.manifest_url:
-        self.OptionParser.error(
-            '--manifest-url option and URL argument both specified: only use '
-            'one to select the manifest URL.')
 
-      opt.manifest_url = args.pop(0)
+        if os.isatty(0) and os.isatty(1) and not self.manifest.IsMirror:
+            if opt.config_name or self._ShouldConfigureUser(
+                opt, existing_checkout
+            ):
+                self._ConfigureUser(opt)
+            self._ConfigureColor()
 
-      if args:
+        if not opt.quiet:
-        self.OptionParser.error('too many arguments to init')
+            self._DisplayResult()
-
-  def Execute(self, opt, args):
-    git_require(MIN_GIT_VERSION_HARD, fail=True)
-    if not git_require(MIN_GIT_VERSION_SOFT):
-      print('repo: warning: git-%s+ will soon be required; please upgrade your '
-            'version of git to maintain support.'
-            % ('.'.join(str(x) for x in MIN_GIT_VERSION_SOFT),),
-            file=sys.stderr)
-
-    rp = self.manifest.repoProject
-
-    # Handle new --repo-url requests.
-    if opt.repo_url:
-      remote = rp.GetRemote('origin')
-      remote.url = opt.repo_url
-      remote.Save()
-
-    # Handle new --repo-rev requests.
-    if opt.repo_rev:
-      wrapper = Wrapper()
-      try:
-        remote_ref, rev = wrapper.check_repo_rev(
-            rp.gitdir, opt.repo_rev, repo_verify=opt.repo_verify, quiet=opt.quiet)
-      except wrapper.CloneFailure:
-        print('fatal: double check your --repo-rev setting.', file=sys.stderr)
-        sys.exit(1)
-      branch = rp.GetBranch('default')
-      branch.merge = remote_ref
-      rp.work_git.reset('--hard', rev)
-      branch.Save()
-
-    if opt.worktree:
-      # Older versions of git supported worktree, but had dangerous gc bugs.
-      git_require((2, 15, 0), fail=True, msg='git gc worktree corruption')
-
-    # Provide a short notice that we're reinitializing an existing checkout.
-    # Sometimes developers might not realize that they're in one, or that
-    # repo doesn't do nested checkouts.
-    existing_checkout = self.manifest.manifestProject.Exists
-    if not opt.quiet and existing_checkout:
-      print('repo: reusing existing repo client checkout in', self.manifest.topdir)
-
-    self._SyncManifest(opt)
-
-    if os.isatty(0) and os.isatty(1) and not self.manifest.IsMirror:
-      if opt.config_name or self._ShouldConfigureUser(opt, existing_checkout):
-        self._ConfigureUser(opt)
-      self._ConfigureColor()
-
-    self._DisplayResult(opt)

subcmds/list.py

@@ -14,17 +14,18 @@
 
 import os
 
-from command import Command, MirrorSafeCommand
+from command import Command
+from command import MirrorSafeCommand
 
 
 class List(Command, MirrorSafeCommand):
-  COMMON = True
+    COMMON = True
-  helpSummary = "List projects and their associated directories"
+    helpSummary = "List projects and their associated directories"
-  helpUsage = """
+    helpUsage = """
 %prog [-f] [<project>...]
 %prog [-f] -r str1 [str2]...
 """
-  helpDescription = """
+    helpDescription = """
 List all projects; pass '.' to list the project for the cwd.
 
 By default, only projects that currently exist in the checkout are shown.  If
@@ -35,69 +36,103 @@ groups, then also pass --groups all.
 This is similar to running: repo forall -c 'echo "$REPO_PATH : $REPO_PROJECT"'.
 """
 
-  def _Options(self, p):
+    def _Options(self, p):
-    p.add_option('-r', '--regex',
+        p.add_option(
-                 dest='regex', action='store_true',
+            "-r",
-                 help='filter the project list based on regex or wildcard matching of strings')
+            "--regex",
-    p.add_option('-g', '--groups',
+            dest="regex",
-                 dest='groups',
+            action="store_true",
-                 help='filter the project list based on the groups the project is in')
+            help="filter the project list based on regex or wildcard matching "
-    p.add_option('-a', '--all',
+            "of strings",
-                 action='store_true',
+        )
-                 help='show projects regardless of checkout state')
+        p.add_option(
-    p.add_option('-n', '--name-only',
+            "-g",
-                 dest='name_only', action='store_true',
+            "--groups",
-                 help='display only the name of the repository')
+            dest="groups",
-    p.add_option('-p', '--path-only',
+            help="filter the project list based on the groups the project is "
-                 dest='path_only', action='store_true',
+            "in",
-                 help='display only the path of the repository')
+        )
-    p.add_option('-f', '--fullpath',
+        p.add_option(
-                 dest='fullpath', action='store_true',
+            "-a",
-                 help='display the full work tree path instead of the relative path')
+            "--all",
-    p.add_option('--relative-to', metavar='PATH',
+            action="store_true",
-                 help='display paths relative to this one (default: top of repo client checkout)')
+            help="show projects regardless of checkout state",
+        )
+        p.add_option(
+            "-n",
+            "--name-only",
+            dest="name_only",
+            action="store_true",
+            help="display only the name of the repository",
+        )
+        p.add_option(
+            "-p",
+            "--path-only",
+            dest="path_only",
+            action="store_true",
+            help="display only the path of the repository",
+        )
+        p.add_option(
+            "-f",
+            "--fullpath",
+            dest="fullpath",
+            action="store_true",
+            help="display the full work tree path instead of the relative path",
+        )
+        p.add_option(
+            "--relative-to",
+            metavar="PATH",
+            help="display paths relative to this one (default: top of repo "
+            "client checkout)",
+        )
 
-  def ValidateOptions(self, opt, args):
+    def ValidateOptions(self, opt, args):
-    if opt.fullpath and opt.name_only:
+        if opt.fullpath and opt.name_only:
-      self.OptionParser.error('cannot combine -f and -n')
+            self.OptionParser.error("cannot combine -f and -n")
 
-    # Resolve any symlinks so the output is stable.
+        # Resolve any symlinks so the output is stable.
-    if opt.relative_to:
+        if opt.relative_to:
-      opt.relative_to = os.path.realpath(opt.relative_to)
+            opt.relative_to = os.path.realpath(opt.relative_to)
 
-  def Execute(self, opt, args):
+    def Execute(self, opt, args):
-    """List all projects and the associated directories.
+        """List all projects and the associated directories.
 
-    This may be possible to do with 'repo forall', but repo newbies have
+        This may be possible to do with 'repo forall', but repo newbies have
-    trouble figuring that out.  The idea here is that it should be more
+        trouble figuring that out.  The idea here is that it should be more
-    discoverable.
+        discoverable.
 
-    Args:
+        Args:
-      opt: The options.
+            opt: The options.
-      args: Positional args.  Can be a list of projects to list, or empty.
+            args: Positional args.  Can be a list of projects to list, or empty.
-    """
+        """
-    if not opt.regex:
+        if not opt.regex:
-      projects = self.GetProjects(args, groups=opt.groups, missing_ok=opt.all,
+            projects = self.GetProjects(
-                                  all_manifests=not opt.this_manifest_only)
+                args,
-    else:
+                groups=opt.groups,
-      projects = self.FindProjects(args, all_manifests=not opt.this_manifest_only)
+                missing_ok=opt.all,
+                all_manifests=not opt.this_manifest_only,
+            )
+        else:
+            projects = self.FindProjects(
+                args, all_manifests=not opt.this_manifest_only
+            )
 
-    def _getpath(x):
+        def _getpath(x):
-      if opt.fullpath:
+            if opt.fullpath:
-        return x.worktree
+                return x.worktree
-      if opt.relative_to:
+            if opt.relative_to:
-        return os.path.relpath(x.worktree, opt.relative_to)
+                return os.path.relpath(x.worktree, opt.relative_to)
-      return x.RelPath(local=opt.this_manifest_only)
+            return x.RelPath(local=opt.this_manifest_only)
 
-    lines = []
+        lines = []
-    for project in projects:
+        for project in projects:
-      if opt.name_only and not opt.path_only:
+            if opt.name_only and not opt.path_only:
-        lines.append("%s" % (project.name))
+                lines.append("%s" % (project.name))
-      elif opt.path_only and not opt.name_only:
+            elif opt.path_only and not opt.name_only:
-        lines.append("%s" % (_getpath(project)))
+                lines.append("%s" % (_getpath(project)))
-      else:
+            else:
-        lines.append("%s : %s" % (_getpath(project), project.name))
+                lines.append("%s : %s" % (_getpath(project), project.name))
 
-    if lines:
+        if lines:
-      lines.sort()
+            lines.sort()
-      print('\n'.join(lines))
+            print("\n".join(lines))

subcmds/manifest.py

@@ -15,18 +15,21 @@
 import json
 import os
 import sys
-import optparse
 
 from command import PagedCommand
+from repo_logging import RepoLogger
+
+
+logger = RepoLogger(__file__)
 
 
 class Manifest(PagedCommand):
-  COMMON = False
+    COMMON = False
-  helpSummary = "Manifest inspection utility"
+    helpSummary = "Manifest inspection utility"
-  helpUsage = """
+    helpUsage = """
 %prog [-o {-|NAME.xml}] [-m MANIFEST.xml] [-r]
 """
-  _helpDescription = """
+    _helpDescription = """
 
 With the -o option, exports the current manifest for inspection.
 The manifest and (if present) local_manifests/ are combined
@@ -41,92 +44,136 @@ when the manifest was generated.  The 'dest-branch' attribute is set
 to indicate the remote ref to push changes to via 'repo upload'.
 """
 
-  @property
+    @property
-  def helpDescription(self):
+    def helpDescription(self):
-    helptext = self._helpDescription + '\n'
+        helptext = self._helpDescription + "\n"
-    r = os.path.dirname(__file__)
+        r = os.path.dirname(__file__)
-    r = os.path.dirname(r)
+        r = os.path.dirname(r)
-    with open(os.path.join(r, 'docs', 'manifest-format.md')) as fd:
+        with open(os.path.join(r, "docs", "manifest-format.md")) as fd:
-      for line in fd:
+            for line in fd:
-        helptext += line
+                helptext += line
-    return helptext
+        return helptext
 
-  def _Options(self, p):
+    def _Options(self, p):
-    p.add_option('-r', '--revision-as-HEAD',
+        p.add_option(
-                 dest='peg_rev', action='store_true',
+            "-r",
-                 help='save revisions as current HEAD')
+            "--revision-as-HEAD",
-    p.add_option('-m', '--manifest-name',
+            dest="peg_rev",
-                 help='temporary manifest to use for this sync', metavar='NAME.xml')
+            action="store_true",
-    p.add_option('--suppress-upstream-revision', dest='peg_rev_upstream',
+            help="save revisions as current HEAD",
-                 default=True, action='store_false',
+        )
-                 help='if in -r mode, do not write the upstream field '
+        p.add_option(
-                 '(only of use if the branch names for a sha1 manifest are '
+            "-m",
-                 'sensitive)')
+            "--manifest-name",
-    p.add_option('--suppress-dest-branch', dest='peg_rev_dest_branch',
+            help="temporary manifest to use for this sync",
-                 default=True, action='store_false',
+            metavar="NAME.xml",
-                 help='if in -r mode, do not write the dest-branch field '
+        )
-                 '(only of use if the branch names for a sha1 manifest are '
+        p.add_option(
-                 'sensitive)')
+            "--suppress-upstream-revision",
-    p.add_option('--json', default=False, action='store_true',
+            dest="peg_rev_upstream",
-                 help='output manifest in JSON format (experimental)')
+            default=True,
-    p.add_option('--pretty', default=False, action='store_true',
+            action="store_false",
-                 help='format output for humans to read')
+            help="if in -r mode, do not write the upstream field "
-    p.add_option('--no-local-manifests', default=False, action='store_true',
+            "(only of use if the branch names for a sha1 manifest are "
-                 dest='ignore_local_manifests', help='ignore local manifests')
+            "sensitive)",
-    p.add_option('-o', '--output-file',
+        )
-                 dest='output_file',
+        p.add_option(
-                 default='-',
+            "--suppress-dest-branch",
-                 help='file to save the manifest to. (Filename prefix for multi-tree.)',
+            dest="peg_rev_dest_branch",
-                 metavar='-|NAME.xml')
+            default=True,
+            action="store_false",
+            help="if in -r mode, do not write the dest-branch field "
+            "(only of use if the branch names for a sha1 manifest are "
+            "sensitive)",
+        )
+        p.add_option(
+            "--json",
+            default=False,
+            action="store_true",
+            help="output manifest in JSON format (experimental)",
+        )
+        p.add_option(
+            "--pretty",
+            default=False,
+            action="store_true",
+            help="format output for humans to read",
+        )
+        p.add_option(
+            "--no-local-manifests",
+            default=False,
+            action="store_true",
+            dest="ignore_local_manifests",
+            help="ignore local manifests",
+        )
+        p.add_option(
+            "-o",
+            "--output-file",
+            dest="output_file",
+            default="-",
+            help="file to save the manifest to. (Filename prefix for "
+            "multi-tree.)",
+            metavar="-|NAME.xml",
+        )
 
-  def _Output(self, opt):
+    def _Output(self, opt):
-    # If alternate manifest is specified, override the manifest file that we're using.
+        # If alternate manifest is specified, override the manifest file that
-    if opt.manifest_name:
+        # we're using.
-      self.manifest.Override(opt.manifest_name, False)
+        if opt.manifest_name:
+            self.manifest.Override(opt.manifest_name, False)
 
-    for manifest in self.ManifestList(opt):
+        for manifest in self.ManifestList(opt):
-      output_file = opt.output_file
+            output_file = opt.output_file
-      if output_file == '-':
+            if output_file == "-":
-        fd = sys.stdout
+                fd = sys.stdout
-      else:
+            else:
-        if manifest.path_prefix:
+                if manifest.path_prefix:
-          output_file = f'{opt.output_file}:{manifest.path_prefix.replace("/", "%2f")}'
+                    output_file = (
-        fd = open(output_file, 'w')
+                        f"{opt.output_file}:"
+                        f'{manifest.path_prefix.replace("/", "%2f")}'
+                    )
+                fd = open(output_file, "w")
 
-      manifest.SetUseLocalManifests(not opt.ignore_local_manifests)
+            manifest.SetUseLocalManifests(not opt.ignore_local_manifests)
 
-      if opt.json:
+            if opt.json:
-        print('warning: --json is experimental!', file=sys.stderr)
+                logger.warn("warning: --json is experimental!")
-        doc = manifest.ToDict(peg_rev=opt.peg_rev,
+                doc = manifest.ToDict(
-                                   peg_rev_upstream=opt.peg_rev_upstream,
+                    peg_rev=opt.peg_rev,
-                                   peg_rev_dest_branch=opt.peg_rev_dest_branch)
+                    peg_rev_upstream=opt.peg_rev_upstream,
+                    peg_rev_dest_branch=opt.peg_rev_dest_branch,
+                )
 
-        json_settings = {
+                json_settings = {
-            # JSON style guide says Uunicode characters are fully allowed.
+                    # JSON style guide says Unicode characters are fully
-            'ensure_ascii': False,
+                    # allowed.
-            # We use 2 space indent to match JSON style guide.
+                    "ensure_ascii": False,
-            'indent': 2 if opt.pretty else None,
+                    # We use 2 space indent to match JSON style guide.
-            'separators': (',', ': ') if opt.pretty else (',', ':'),
+                    "indent": 2 if opt.pretty else None,
-            'sort_keys': True,
+                    "separators": (",", ": ") if opt.pretty else (",", ":"),
-        }
+                    "sort_keys": True,
-        fd.write(json.dumps(doc, **json_settings))
+                }
-      else:
+                fd.write(json.dumps(doc, **json_settings))
-        manifest.Save(fd,
+            else:
-                      peg_rev=opt.peg_rev,
+                manifest.Save(
-                      peg_rev_upstream=opt.peg_rev_upstream,
+                    fd,
-                      peg_rev_dest_branch=opt.peg_rev_dest_branch)
+                    peg_rev=opt.peg_rev,
-      if output_file != '-':
+                    peg_rev_upstream=opt.peg_rev_upstream,
-        fd.close()
+                    peg_rev_dest_branch=opt.peg_rev_dest_branch,
-        if manifest.path_prefix:
+                )
-          print(f'Saved {manifest.path_prefix} submanifest to {output_file}',
+            if output_file != "-":
-                file=sys.stderr)
+                fd.close()
-        else:
+                if manifest.path_prefix:
-          print(f'Saved manifest to {output_file}', file=sys.stderr)
+                    logger.warn(
+                        "Saved %s submanifest to %s",
+                        manifest.path_prefix,
+                        output_file,
+                    )
+                else:
+                    logger.warn("Saved manifest to %s", output_file)
 
+    def ValidateOptions(self, opt, args):
+        if args:
+            self.Usage()
 
-  def ValidateOptions(self, opt, args):
+    def Execute(self, opt, args):
-    if args:
+        self._Output(opt)
-      self.Usage()
-
-  def Execute(self, opt, args):
-    self._Output(opt)

subcmds/overview.py

@@ -19,12 +19,12 @@ from command import PagedCommand
 
 
 class Overview(PagedCommand):
-  COMMON = True
+    COMMON = True
-  helpSummary = "Display overview of unmerged project branches"
+    helpSummary = "Display overview of unmerged project branches"
-  helpUsage = """
+    helpUsage = """
 %prog [--current-branch] [<project>...]
 """
-  helpDescription = """
+    helpDescription = """
 The '%prog' command is used to display an overview of the projects branches,
 and list any local commits that have not yet been merged into the project.
 
@@ -33,59 +33,77 @@ branches currently checked out in each project.  By default, all branches
 are displayed.
 """
 
-  def _Options(self, p):
+    def _Options(self, p):
-    p.add_option('-c', '--current-branch',
+        p.add_option(
-                 dest="current_branch", action="store_true",
+            "-c",
-                 help="consider only checked out branches")
+            "--current-branch",
-    p.add_option('--no-current-branch',
+            dest="current_branch",
-                 dest='current_branch', action='store_false',
+            action="store_true",
-                 help='consider all local branches')
+            help="consider only checked out branches",
-    # Turn this into a warning & remove this someday.
+        )
-    p.add_option('-b',
+        p.add_option(
-                 dest='current_branch', action='store_true',
+            "--no-current-branch",
-                 help=optparse.SUPPRESS_HELP)
+            dest="current_branch",
+            action="store_false",
+            help="consider all local branches",
+        )
+        # Turn this into a warning & remove this someday.
+        p.add_option(
+            "-b",
+            dest="current_branch",
+            action="store_true",
+            help=optparse.SUPPRESS_HELP,
+        )
 
-  def Execute(self, opt, args):
+    def Execute(self, opt, args):
-    all_branches = []
+        all_branches = []
-    for project in self.GetProjects(args, all_manifests=not opt.this_manifest_only):
+        for project in self.GetProjects(
-      br = [project.GetUploadableBranch(x)
+            args, all_manifests=not opt.this_manifest_only
-            for x in project.GetBranches()]
+        ):
-      br = [x for x in br if x]
+            br = [project.GetUploadableBranch(x) for x in project.GetBranches()]
-      if opt.current_branch:
+            br = [x for x in br if x]
-        br = [x for x in br if x.name == project.CurrentBranch]
+            if opt.current_branch:
-      all_branches.extend(br)
+                br = [x for x in br if x.name == project.CurrentBranch]
+            all_branches.extend(br)
 
-    if not all_branches:
+        if not all_branches:
-      return
+            return
 
-    class Report(Coloring):
+        class Report(Coloring):
-      def __init__(self, config):
+            def __init__(self, config):
-        Coloring.__init__(self, config, 'status')
+                Coloring.__init__(self, config, "status")
-        self.project = self.printer('header', attr='bold')
+                self.project = self.printer("header", attr="bold")
-        self.text = self.printer('text')
+                self.text = self.printer("text")
 
-    out = Report(all_branches[0].project.config)
+        out = Report(all_branches[0].project.config)
-    out.text("Deprecated. See repo info -o.")
+        out.text("Deprecated. See repo info -o.")
-    out.nl()
-    out.project('Projects Overview')
-    out.nl()
-
-    project = None
-
-    for branch in all_branches:
-      if project != branch.project:
-        project = branch.project
         out.nl()
-        out.project('project %s/' % project.RelPath(local=opt.this_manifest_only))
+        out.project("Projects Overview")
         out.nl()
 
-      commits = branch.commits
+        project = None
-      date = branch.date
+
-      print('%s %-33s (%2d commit%s, %s)' % (
+        for branch in all_branches:
-            branch.name == project.CurrentBranch and '*' or ' ',
+            if project != branch.project:
-            branch.name,
+                project = branch.project
-            len(commits),
+                out.nl()
-            len(commits) != 1 and 's' or ' ',
+                out.project(
-            date))
+                    "project %s/"
-      for commit in commits:
+                    % project.RelPath(local=opt.this_manifest_only)
-        print('%-35s   - %s' % ('', commit))
+                )
+                out.nl()
+
+            commits = branch.commits
+            date = branch.date
+            print(
+                "%s %-33s (%2d commit%s, %s)"
+                % (
+                    branch.name == project.CurrentBranch and "*" or " ",
+                    branch.name,
+                    len(commits),
+                    len(commits) != 1 and "s" or " ",
+                    date,
+                )
+            )
+            for commit in commits:
+                print("%-35s   - %s" % ("", commit))

subcmds/prune.py

@@ -15,67 +15,81 @@
 import itertools
 
 from color import Coloring
-from command import DEFAULT_LOCAL_JOBS, PagedCommand
+from command import DEFAULT_LOCAL_JOBS
+from command import PagedCommand
 
 
 class Prune(PagedCommand):
-  COMMON = True
+    COMMON = True
-  helpSummary = "Prune (delete) already merged topics"
+    helpSummary = "Prune (delete) already merged topics"
-  helpUsage = """
+    helpUsage = """
 %prog [<project>...]
 """
-  PARALLEL_JOBS = DEFAULT_LOCAL_JOBS
+    PARALLEL_JOBS = DEFAULT_LOCAL_JOBS
 
-  def _ExecuteOne(self, project):
+    def _ExecuteOne(self, project):
-    """Process one project."""
+        """Process one project."""
-    return project.PruneHeads()
+        return project.PruneHeads()
 
-  def Execute(self, opt, args):
+    def Execute(self, opt, args):
-    projects = self.GetProjects(args, all_manifests=not opt.this_manifest_only)
+        projects = self.GetProjects(
+            args, all_manifests=not opt.this_manifest_only
+        )
 
-    # NB: Should be able to refactor this module to display summary as results
+        # NB: Should be able to refactor this module to display summary as
-    # come back from children.
+        # results come back from children.
-    def _ProcessResults(_pool, _output, results):
+        def _ProcessResults(_pool, _output, results):
-      return list(itertools.chain.from_iterable(results))
+            return list(itertools.chain.from_iterable(results))
 
-    all_branches = self.ExecuteInParallel(
+        all_branches = self.ExecuteInParallel(
-        opt.jobs,
+            opt.jobs,
-        self._ExecuteOne,
+            self._ExecuteOne,
-        projects,
+            projects,
-        callback=_ProcessResults,
+            callback=_ProcessResults,
-        ordered=True)
+            ordered=True,
+        )
 
-    if not all_branches:
+        if not all_branches:
-      return
+            return
 
-    class Report(Coloring):
+        class Report(Coloring):
-      def __init__(self, config):
+            def __init__(self, config):
-        Coloring.__init__(self, config, 'status')
+                Coloring.__init__(self, config, "status")
-        self.project = self.printer('header', attr='bold')
+                self.project = self.printer("header", attr="bold")
 
-    out = Report(all_branches[0].project.config)
+        out = Report(all_branches[0].project.config)
-    out.project('Pending Branches')
+        out.project("Pending Branches")
-    out.nl()
-
-    project = None
-
-    for branch in all_branches:
-      if project != branch.project:
-        project = branch.project
-        out.nl()
-        out.project('project %s/' % project.RelPath(local=opt.this_manifest_only))
         out.nl()
 
-      print('%s %-33s ' % (
+        project = None
-            branch.name == project.CurrentBranch and '*' or ' ',
-            branch.name), end='')
 
-      if not branch.base_exists:
+        for branch in all_branches:
-        print('(ignoring: tracking branch is gone: %s)' % (branch.base,))
+            if project != branch.project:
-      else:
+                project = branch.project
-        commits = branch.commits
+                out.nl()
-        date = branch.date
+                out.project(
-        print('(%2d commit%s, %s)' % (
+                    "project %s/"
-            len(commits),
+                    % project.RelPath(local=opt.this_manifest_only)
-            len(commits) != 1 and 's' or ' ',
+                )
-            date))
+                out.nl()
+
+            print(
+                "%s %-33s "
+                % (
+                    branch.name == project.CurrentBranch and "*" or " ",
+                    branch.name,
+                ),
+                end="",
+            )
+
+            if not branch.base_exists:
+                print(
+                    "(ignoring: tracking branch is gone: %s)" % (branch.base,)
+                )
+            else:
+                commits = branch.commits
+                date = branch.date
+                print(
+                    "(%2d commit%s, %s)"
+                    % (len(commits), len(commits) != 1 and "s" or " ", date)
+                )

subcmds/rebase.py

@@ -17,149 +17,198 @@ import sys
 from color import Coloring
 from command import Command
 from git_command import GitCommand
+from repo_logging import RepoLogger
+
+
+logger = RepoLogger(__file__)
 
 
 class RebaseColoring(Coloring):
-  def __init__(self, config):
+    def __init__(self, config):
-    Coloring.__init__(self, config, 'rebase')
+        Coloring.__init__(self, config, "rebase")
-    self.project = self.printer('project', attr='bold')
+        self.project = self.printer("project", attr="bold")
-    self.fail = self.printer('fail', fg='red')
+        self.fail = self.printer("fail", fg="red")
 
 
 class Rebase(Command):
-  COMMON = True
+    COMMON = True
-  helpSummary = "Rebase local branches on upstream branch"
+    helpSummary = "Rebase local branches on upstream branch"
-  helpUsage = """
+    helpUsage = """
 %prog {[<project>...] | -i <project>...}
 """
-  helpDescription = """
+    helpDescription = """
 '%prog' uses git rebase to move local changes in the current topic branch to
 the HEAD of the upstream history, useful when you have made commits in a topic
 branch but need to incorporate new upstream changes "underneath" them.
 """
 
-  def _Options(self, p):
+    def _Options(self, p):
-    g = p.get_option_group('--quiet')
+        g = p.get_option_group("--quiet")
-    g.add_option('-i', '--interactive',
+        g.add_option(
-                 dest="interactive", action="store_true",
+            "-i",
-                 help="interactive rebase (single project only)")
+            "--interactive",
+            dest="interactive",
+            action="store_true",
+            help="interactive rebase (single project only)",
+        )
 
-    p.add_option('--fail-fast',
+        p.add_option(
-                 dest='fail_fast', action='store_true',
+            "--fail-fast",
-                 help='stop rebasing after first error is hit')
+            dest="fail_fast",
-    p.add_option('-f', '--force-rebase',
+            action="store_true",
-                 dest='force_rebase', action='store_true',
+            help="stop rebasing after first error is hit",
-                 help='pass --force-rebase to git rebase')
+        )
-    p.add_option('--no-ff',
+        p.add_option(
-                 dest='ff', default=True, action='store_false',
+            "-f",
-                 help='pass --no-ff to git rebase')
+            "--force-rebase",
-    p.add_option('--autosquash',
+            dest="force_rebase",
-                 dest='autosquash', action='store_true',
+            action="store_true",
-                 help='pass --autosquash to git rebase')
+            help="pass --force-rebase to git rebase",
-    p.add_option('--whitespace',
+        )
-                 dest='whitespace', action='store', metavar='WS',
+        p.add_option(
-                 help='pass --whitespace to git rebase')
+            "--no-ff",
-    p.add_option('--auto-stash',
+            dest="ff",
-                 dest='auto_stash', action='store_true',
+            default=True,
-                 help='stash local modifications before starting')
+            action="store_false",
-    p.add_option('-m', '--onto-manifest',
+            help="pass --no-ff to git rebase",
-                 dest='onto_manifest', action='store_true',
+        )
-                 help='rebase onto the manifest version instead of upstream '
+        p.add_option(
-                      'HEAD (this helps to make sure the local tree stays '
+            "--autosquash",
-                      'consistent if you previously synced to a manifest)')
+            dest="autosquash",
+            action="store_true",
+            help="pass --autosquash to git rebase",
+        )
+        p.add_option(
+            "--whitespace",
+            dest="whitespace",
+            action="store",
+            metavar="WS",
+            help="pass --whitespace to git rebase",
+        )
+        p.add_option(
+            "--auto-stash",
+            dest="auto_stash",
+            action="store_true",
+            help="stash local modifications before starting",
+        )
+        p.add_option(
+            "-m",
+            "--onto-manifest",
+            dest="onto_manifest",
+            action="store_true",
+            help="rebase onto the manifest version instead of upstream "
+            "HEAD (this helps to make sure the local tree stays "
+            "consistent if you previously synced to a manifest)",
+        )
 
-  def Execute(self, opt, args):
+    def Execute(self, opt, args):
-    all_projects = self.GetProjects(args, all_manifests=not opt.this_manifest_only)
+        all_projects = self.GetProjects(
-    one_project = len(all_projects) == 1
+            args, all_manifests=not opt.this_manifest_only
+        )
+        one_project = len(all_projects) == 1
 
-    if opt.interactive and not one_project:
+        if opt.interactive and not one_project:
-      print('error: interactive rebase not supported with multiple projects',
+            logger.error(
-            file=sys.stderr)
+                "error: interactive rebase not supported with multiple projects"
-      if len(args) == 1:
+            )
-        print('note: project %s is mapped to more than one path' % (args[0],),
-              file=sys.stderr)
-      return 1
 
-    # Setup the common git rebase args that we use for all projects.
+            if len(args) == 1:
-    common_args = ['rebase']
+                logger.warn(
-    if opt.whitespace:
+                    "note: project %s is mapped to more than one path", args[0]
-      common_args.append('--whitespace=%s' % opt.whitespace)
+                )
-    if opt.quiet:
-      common_args.append('--quiet')
-    if opt.force_rebase:
-      common_args.append('--force-rebase')
-    if not opt.ff:
-      common_args.append('--no-ff')
-    if opt.autosquash:
-      common_args.append('--autosquash')
-    if opt.interactive:
-      common_args.append('-i')
 
-    config = self.manifest.manifestProject.config
+            return 1
-    out = RebaseColoring(config)
-    out.redirect(sys.stdout)
-    _RelPath = lambda p: p.RelPath(local=opt.this_manifest_only)
 
-    ret = 0
+        # Setup the common git rebase args that we use for all projects.
-    for project in all_projects:
+        common_args = ["rebase"]
-      if ret and opt.fail_fast:
+        if opt.whitespace:
-        break
+            common_args.append("--whitespace=%s" % opt.whitespace)
+        if opt.quiet:
+            common_args.append("--quiet")
+        if opt.force_rebase:
+            common_args.append("--force-rebase")
+        if not opt.ff:
+            common_args.append("--no-ff")
+        if opt.autosquash:
+            common_args.append("--autosquash")
+        if opt.interactive:
+            common_args.append("-i")
 
-      cb = project.CurrentBranch
+        config = self.manifest.manifestProject.config
-      if not cb:
+        out = RebaseColoring(config)
-        if one_project:
+        out.redirect(sys.stdout)
-          print("error: project %s has a detached HEAD" % _RelPath(project),
+        _RelPath = lambda p: p.RelPath(local=opt.this_manifest_only)
-                file=sys.stderr)
-          return 1
-        # ignore branches with detatched HEADs
-        continue
 
-      upbranch = project.GetBranch(cb)
+        ret = 0
-      if not upbranch.LocalMerge:
+        for project in all_projects:
-        if one_project:
+            if ret and opt.fail_fast:
-          print("error: project %s does not track any remote branches"
+                break
-                % _RelPath(project), file=sys.stderr)
-          return 1
-        # ignore branches without remotes
-        continue
 
-      args = common_args[:]
+            cb = project.CurrentBranch
-      if opt.onto_manifest:
+            if not cb:
-        args.append('--onto')
+                if one_project:
-        args.append(project.revisionExpr)
+                    logger.error(
+                        "error: project %s has a detached HEAD",
+                        _RelPath(project),
+                    )
+                    return 1
+                # Ignore branches with detached HEADs.
+                continue
 
-      args.append(upbranch.LocalMerge)
+            upbranch = project.GetBranch(cb)
+            if not upbranch.LocalMerge:
+                if one_project:
+                    logger.error(
+                        "error: project %s does not track any remote branches",
+                        _RelPath(project),
+                    )
+                    return 1
+                # Ignore branches without remotes.
+                continue
 
-      out.project('project %s: rebasing %s -> %s',
+            args = common_args[:]
-                  _RelPath(project), cb, upbranch.LocalMerge)
+            if opt.onto_manifest:
-      out.nl()
+                args.append("--onto")
-      out.flush()
+                args.append(project.revisionExpr)
 
-      needs_stash = False
+            args.append(upbranch.LocalMerge)
-      if opt.auto_stash:
-        stash_args = ["update-index", "--refresh", "-q"]
 
-        if GitCommand(project, stash_args).Wait() != 0:
+            out.project(
-          needs_stash = True
+                "project %s: rebasing %s -> %s",
-          # Dirty index, requires stash...
+                _RelPath(project),
-          stash_args = ["stash"]
+                cb,
+                upbranch.LocalMerge,
+            )
+            out.nl()
+            out.flush()
 
-          if GitCommand(project, stash_args).Wait() != 0:
+            needs_stash = False
-            ret += 1
+            if opt.auto_stash:
-            continue
+                stash_args = ["update-index", "--refresh", "-q"]
 
-      if GitCommand(project, args).Wait() != 0:
+                if GitCommand(project, stash_args).Wait() != 0:
-        ret += 1
+                    needs_stash = True
-        continue
+                    # Dirty index, requires stash...
+                    stash_args = ["stash"]
 
-      if needs_stash:
+                    if GitCommand(project, stash_args).Wait() != 0:
-        stash_args.append('pop')
+                        ret += 1
-        stash_args.append('--quiet')
+                        continue
-        if GitCommand(project, stash_args).Wait() != 0:
-          ret += 1
 
-    if ret:
+            if GitCommand(project, args).Wait() != 0:
-      out.fail('%i projects had errors', ret)
+                ret += 1
-      out.nl()
+                continue
 
-    return ret
+            if needs_stash:
+                stash_args.append("pop")
+                stash_args.append("--quiet")
+                if GitCommand(project, stash_args).Wait() != 0:
+                    ret += 1
+
+        if ret:
+            msg_fmt = "%d projects had errors"
+            self.git_event_log.ErrorEvent(msg_fmt % (ret), msg_fmt)
+            out.fail(msg_fmt, ret)
+            out.nl()
+
+        return ret

subcmds/selfupdate.py

@@ -12,21 +12,30 @@
 # See the License for the specific language governing permissions and
 # limitations under the License.
 
-from optparse import SUPPRESS_HELP
+import optparse
-import sys
 
-from command import Command, MirrorSafeCommand
+from command import Command
-from subcmds.sync import _PostRepoUpgrade
+from command import MirrorSafeCommand
+from error import RepoExitError
+from repo_logging import RepoLogger
 from subcmds.sync import _PostRepoFetch
+from subcmds.sync import _PostRepoUpgrade
+
+
+logger = RepoLogger(__file__)
+
+
+class SelfupdateError(RepoExitError):
+    """Exit error for failed selfupdate command."""
 
 
 class Selfupdate(Command, MirrorSafeCommand):
-  COMMON = False
+    COMMON = False
-  helpSummary = "Update repo to the latest version"
+    helpSummary = "Update repo to the latest version"
-  helpUsage = """
+    helpUsage = """
 %prog
 """
-  helpDescription = """
+    helpDescription = """
 The '%prog' command upgrades repo to the latest version, if a
 newer version is available.
 
@@ -34,28 +43,34 @@ Normally this is done automatically by 'repo sync' and does not
 need to be performed by an end-user.
 """
 
-  def _Options(self, p):
+    def _Options(self, p):
-    g = p.add_option_group('repo Version options')
+        g = p.add_option_group("repo Version options")
-    g.add_option('--no-repo-verify',
+        g.add_option(
-                 dest='repo_verify', default=True, action='store_false',
+            "--no-repo-verify",
-                 help='do not verify repo source code')
+            dest="repo_verify",
-    g.add_option('--repo-upgraded',
+            default=True,
-                 dest='repo_upgraded', action='store_true',
+            action="store_false",
-                 help=SUPPRESS_HELP)
+            help="do not verify repo source code",
+        )
+        g.add_option(
+            "--repo-upgraded",
+            dest="repo_upgraded",
+            action="store_true",
+            help=optparse.SUPPRESS_HELP,
+        )
 
-  def Execute(self, opt, args):
+    def Execute(self, opt, args):
-    rp = self.manifest.repoProject
+        rp = self.manifest.repoProject
-    rp.PreSync()
+        rp.PreSync()
 
-    if opt.repo_upgraded:
+        if opt.repo_upgraded:
-      _PostRepoUpgrade(self.manifest)
+            _PostRepoUpgrade(self.manifest)
 
-    else:
+        else:
-      if not rp.Sync_NetworkHalf().success:
+            result = rp.Sync_NetworkHalf()
-        print("error: can't update repo", file=sys.stderr)
+            if result.error:
-        sys.exit(1)
+                logger.error("error: can't update repo")
+                raise SelfupdateError(aggregate_errors=[result.error])
 
-      rp.bare_git.gc('--auto')
+            rp.bare_git.gc("--auto")
-      _PostRepoFetch(rp,
+            _PostRepoFetch(rp, repo_verify=opt.repo_verify, verbose=True)
-                     repo_verify=opt.repo_verify,
-                     verbose=True)

subcmds/smartsync.py

@@ -16,18 +16,18 @@ from subcmds.sync import Sync
 
 
 class Smartsync(Sync):
-  COMMON = True
+    COMMON = True
-  helpSummary = "Update working tree to the latest known good revision"
+    helpSummary = "Update working tree to the latest known good revision"
-  helpUsage = """
+    helpUsage = """
 %prog [<project>...]
 """
-  helpDescription = """
+    helpDescription = """
 The '%prog' command is a shortcut for sync -s.
 """
 
-  def _Options(self, p):
+    def _Options(self, p):
-    Sync._Options(self, p, show_smart=False)
+        Sync._Options(self, p, show_smart=False)
 
-  def Execute(self, opt, args):
+    def Execute(self, opt, args):
-    opt.smart_sync = True
+        opt.smart_sync = True
-    Sync.Execute(self, opt, args)
+        Sync.Execute(self, opt, args)

subcmds/stage.py

@@ -17,101 +17,118 @@ import sys
 from color import Coloring
 from command import InteractiveCommand
 from git_command import GitCommand
+from repo_logging import RepoLogger
+
+
+logger = RepoLogger(__file__)
 
 
 class _ProjectList(Coloring):
-  def __init__(self, gc):
+    def __init__(self, gc):
-    Coloring.__init__(self, gc, 'interactive')
+        Coloring.__init__(self, gc, "interactive")
-    self.prompt = self.printer('prompt', fg='blue', attr='bold')
+        self.prompt = self.printer("prompt", fg="blue", attr="bold")
-    self.header = self.printer('header', attr='bold')
+        self.header = self.printer("header", attr="bold")
-    self.help = self.printer('help', fg='red', attr='bold')
+        self.help = self.printer("help", fg="red", attr="bold")
 
 
 class Stage(InteractiveCommand):
-  COMMON = True
+    COMMON = True
-  helpSummary = "Stage file(s) for commit"
+    helpSummary = "Stage file(s) for commit"
-  helpUsage = """
+    helpUsage = """
 %prog -i [<project>...]
 """
-  helpDescription = """
+    helpDescription = """
 The '%prog' command stages files to prepare the next commit.
 """
 
-  def _Options(self, p):
+    def _Options(self, p):
-    g = p.get_option_group('--quiet')
+        g = p.get_option_group("--quiet")
-    g.add_option('-i', '--interactive',
+        g.add_option(
-                 dest='interactive', action='store_true',
+            "-i",
-                 help='use interactive staging')
+            "--interactive",
+            dest="interactive",
+            action="store_true",
+            help="use interactive staging",
+        )
 
-  def Execute(self, opt, args):
+    def Execute(self, opt, args):
-    if opt.interactive:
+        if opt.interactive:
-      self._Interactive(opt, args)
+            self._Interactive(opt, args)
-    else:
+        else:
-      self.Usage()
+            self.Usage()
 
-  def _Interactive(self, opt, args):
+    def _Interactive(self, opt, args):
-    all_projects = [
+        all_projects = [
-        p for p in self.GetProjects(args, all_manifests=not opt.this_manifest_only)
+            p
-        if p.IsDirty()]
+            for p in self.GetProjects(
-    if not all_projects:
+                args, all_manifests=not opt.this_manifest_only
-      print('no projects have uncommitted modifications', file=sys.stderr)
+            )
-      return
+            if p.IsDirty()
+        ]
+        if not all_projects:
+            logger.error("no projects have uncommitted modifications")
+            return
 
-    out = _ProjectList(self.manifest.manifestProject.config)
+        out = _ProjectList(self.manifest.manifestProject.config)
-    while True:
+        while True:
-      out.header('        %s', 'project')
+            out.header("        %s", "project")
-      out.nl()
+            out.nl()
 
-      for i in range(len(all_projects)):
+            for i in range(len(all_projects)):
-        project = all_projects[i]
+                project = all_projects[i]
-        out.write('%3d:    %s', i + 1,
+                out.write(
-                  project.RelPath(local=opt.this_manifest_only) + '/')
+                    "%3d:    %s",
-        out.nl()
+                    i + 1,
-      out.nl()
+                    project.RelPath(local=opt.this_manifest_only) + "/",
+                )
+                out.nl()
+            out.nl()
 
-      out.write('%3d: (', 0)
+            out.write("%3d: (", 0)
-      out.prompt('q')
+            out.prompt("q")
-      out.write('uit)')
+            out.write("uit)")
-      out.nl()
+            out.nl()
 
-      out.prompt('project> ')
+            out.prompt("project> ")
-      out.flush()
+            out.flush()
-      try:
+            try:
-        a = sys.stdin.readline()
+                a = sys.stdin.readline()
-      except KeyboardInterrupt:
+            except KeyboardInterrupt:
-        out.nl()
+                out.nl()
-        break
+                break
-      if a == '':
+            if a == "":
-        out.nl()
+                out.nl()
-        break
+                break
 
-      a = a.strip()
+            a = a.strip()
-      if a.lower() in ('q', 'quit', 'exit'):
+            if a.lower() in ("q", "quit", "exit"):
-        break
+                break
-      if not a:
+            if not a:
-        continue
+                continue
 
-      try:
+            try:
-        a_index = int(a)
+                a_index = int(a)
-      except ValueError:
+            except ValueError:
-        a_index = None
+                a_index = None
 
-      if a_index is not None:
+            if a_index is not None:
-        if a_index == 0:
+                if a_index == 0:
-          break
+                    break
-        if 0 < a_index and a_index <= len(all_projects):
+                if 0 < a_index and a_index <= len(all_projects):
-          _AddI(all_projects[a_index - 1])
+                    _AddI(all_projects[a_index - 1])
-          continue
+                    continue
 
-      projects = [
+            projects = [
-          p for p in all_projects
+                p
-          if a in [p.name, p.RelPath(local=opt.this_manifest_only)]]
+                for p in all_projects
-      if len(projects) == 1:
+                if a in [p.name, p.RelPath(local=opt.this_manifest_only)]
-        _AddI(projects[0])
+            ]
-        continue
+            if len(projects) == 1:
-    print('Bye.')
+                _AddI(projects[0])
+                continue
+        print("Bye.")
 
 
 def _AddI(project):
-  p = GitCommand(project, ['add', '--interactive'], bare=False)
+    p = GitCommand(project, ["add", "--interactive"], bare=False)
-  p.Wait()
+    p.Wait()

subcmds/start.py

@@ -13,131 +13,136 @@
 # limitations under the License.
 
 import functools
-import os
+from typing import NamedTuple
-import sys
 
-from command import Command, DEFAULT_LOCAL_JOBS
+from command import Command
-from git_config import IsImmutable
+from command import DEFAULT_LOCAL_JOBS
+from error import RepoExitError
 from git_command import git
-import gitc_utils
+from git_config import IsImmutable
 from progress import Progress
-from project import SyncBuffer
+from project import Project
+from repo_logging import RepoLogger
+
+
+logger = RepoLogger(__file__)
+
+
+class ExecuteOneResult(NamedTuple):
+    project: Project
+    error: Exception
+
+
+class StartError(RepoExitError):
+    """Exit error for failed start command."""
 
 
 class Start(Command):
-  COMMON = True
+    COMMON = True
-  helpSummary = "Start a new branch for development"
+    helpSummary = "Start a new branch for development"
-  helpUsage = """
+    helpUsage = """
 %prog <newbranchname> [--all | <project>...]
 """
-  helpDescription = """
+    helpDescription = """
 '%prog' begins a new branch of development, starting from the
 revision specified in the manifest.
 """
-  PARALLEL_JOBS = DEFAULT_LOCAL_JOBS
+    PARALLEL_JOBS = DEFAULT_LOCAL_JOBS
 
-  def _Options(self, p):
+    def _Options(self, p):
-    p.add_option('--all',
+        p.add_option(
-                 dest='all', action='store_true',
+            "--all",
-                 help='begin branch in all projects')
+            dest="all",
-    p.add_option('-r', '--rev', '--revision', dest='revision',
+            action="store_true",
-                 help='point branch at this revision instead of upstream')
+            help="begin branch in all projects",
-    p.add_option('--head', '--HEAD',
+        )
-                 dest='revision', action='store_const', const='HEAD',
+        p.add_option(
-                 help='abbreviation for --rev HEAD')
+            "-r",
+            "--rev",
+            "--revision",
+            dest="revision",
+            help="point branch at this revision instead of upstream",
+        )
+        p.add_option(
+            "--head",
+            "--HEAD",
+            dest="revision",
+            action="store_const",
+            const="HEAD",
+            help="abbreviation for --rev HEAD",
+        )
 
-  def ValidateOptions(self, opt, args):
+    def ValidateOptions(self, opt, args):
-    if not args:
+        if not args:
-      self.Usage()
+            self.Usage()
 
-    nb = args[0]
+        nb = args[0]
-    if not git.check_ref_format('heads/%s' % nb):
+        if not git.check_ref_format("heads/%s" % nb):
-      self.OptionParser.error("'%s' is not a valid name" % nb)
+            self.OptionParser.error("'%s' is not a valid name" % nb)
 
-  def _ExecuteOne(self, revision, nb, project):
+    def _ExecuteOne(self, revision, nb, project):
-    """Start one project."""
+        """Start one project."""
-    # If the current revision is immutable, such as a SHA1, a tag or
+        # If the current revision is immutable, such as a SHA1, a tag or
-    # a change, then we can't push back to it. Substitute with
+        # a change, then we can't push back to it. Substitute with
-    # dest_branch, if defined; or with manifest default revision instead.
+        # dest_branch, if defined; or with manifest default revision instead.
-    branch_merge = ''
+        branch_merge = ""
-    if IsImmutable(project.revisionExpr):
+        error = None
-      if project.dest_branch:
+        if IsImmutable(project.revisionExpr):
-        branch_merge = project.dest_branch
+            if project.dest_branch:
-      else:
+                branch_merge = project.dest_branch
-        branch_merge = self.manifest.default.revisionExpr
+            else:
+                branch_merge = self.manifest.default.revisionExpr
 
-    try:
+        try:
-      ret = project.StartBranch(
+            project.StartBranch(
-          nb, branch_merge=branch_merge, revision=revision)
+                nb, branch_merge=branch_merge, revision=revision
-    except Exception as e:
+            )
-      print('error: unable to checkout %s: %s' % (project.name, e), file=sys.stderr)
+        except Exception as e:
-      ret = False
+            logger.error("error: unable to checkout %s: %s", project.name, e)
-    return (ret, project)
+            error = e
+        return ExecuteOneResult(project, error)
 
-  def Execute(self, opt, args):
+    def Execute(self, opt, args):
-    nb = args[0]
+        nb = args[0]
-    err = []
+        err_projects = []
-    projects = []
+        err = []
-    if not opt.all:
+        projects = []
-      projects = args[1:]
+        if not opt.all:
-      if len(projects) < 1:
+            projects = args[1:]
-        projects = ['.']  # start it in the local project by default
+            if len(projects) < 1:
+                projects = ["."]  # start it in the local project by default
 
-    all_projects = self.GetProjects(projects,
+        all_projects = self.GetProjects(
-                                    missing_ok=bool(self.gitc_manifest),
+            projects,
-                                    all_manifests=not opt.this_manifest_only)
+            all_manifests=not opt.this_manifest_only,
+        )
 
-    # This must happen after we find all_projects, since GetProjects may need
+        def _ProcessResults(_pool, pm, results):
-    # the local directory, which will disappear once we save the GITC manifest.
+            for result in results:
-    if self.gitc_manifest:
+                if result.error:
-      gitc_projects = self.GetProjects(projects, manifest=self.gitc_manifest,
+                    err_projects.append(result.project)
-                                       missing_ok=True)
+                    err.append(result.error)
-      for project in gitc_projects:
+                pm.update(msg="")
-        if project.old_revision:
-          project.already_synced = True
-        else:
-          project.already_synced = False
-          project.old_revision = project.revisionExpr
-        project.revisionExpr = None
-      # Save the GITC manifest.
-      gitc_utils.save_manifest(self.gitc_manifest)
 
-      # Make sure we have a valid CWD
+        self.ExecuteInParallel(
-      if not os.path.exists(os.getcwd()):
+            opt.jobs,
-        os.chdir(self.manifest.topdir)
+            functools.partial(self._ExecuteOne, opt.revision, nb),
+            all_projects,
+            callback=_ProcessResults,
+            output=Progress(
+                "Starting %s" % (nb,), len(all_projects), quiet=opt.quiet
+            ),
+        )
 
-      pm = Progress('Syncing %s' % nb, len(all_projects), quiet=opt.quiet)
+        if err_projects:
-      for project in all_projects:
+            for p in err_projects:
-        gitc_project = self.gitc_manifest.paths[project.relpath]
+                logger.error(
-        # Sync projects that have not been opened.
+                    "error: %s/: cannot start %s",
-        if not gitc_project.already_synced:
+                    p.RelPath(local=opt.this_manifest_only),
-          proj_localdir = os.path.join(self.gitc_manifest.gitc_client_dir,
+                    nb,
-                                       project.relpath)
+                )
-          project.worktree = proj_localdir
+            msg_fmt = "cannot start %d project(s)"
-          if not os.path.exists(proj_localdir):
+            self.git_event_log.ErrorEvent(
-            os.makedirs(proj_localdir)
+                msg_fmt % (len(err_projects)), msg_fmt
-          project.Sync_NetworkHalf()
+            )
-          sync_buf = SyncBuffer(self.manifest.manifestProject.config)
+            raise StartError(aggregate_errors=err)
-          project.Sync_LocalHalf(sync_buf)
-          project.revisionId = gitc_project.old_revision
-        pm.update()
-      pm.end()
-
-    def _ProcessResults(_pool, pm, results):
-      for (result, project) in results:
-        if not result:
-          err.append(project)
-        pm.update()
-
-    self.ExecuteInParallel(
-        opt.jobs,
-        functools.partial(self._ExecuteOne, opt.revision, nb),
-        all_projects,
-        callback=_ProcessResults,
-        output=Progress('Starting %s' % (nb,), len(all_projects), quiet=opt.quiet))
-
-    if err:
-      for p in err:
-        print("error: %s/: cannot start %s" % (p.RelPath(local=opt.this_manifest_only), nb),
-              file=sys.stderr)
-      sys.exit(1)

subcmds/status.py

@@ -17,19 +17,19 @@ import glob
 import io
 import os
 
-from command import DEFAULT_LOCAL_JOBS, PagedCommand
-
 from color import Coloring
+from command import DEFAULT_LOCAL_JOBS
+from command import PagedCommand
 import platform_utils
 
 
 class Status(PagedCommand):
-  COMMON = True
+    COMMON = True
-  helpSummary = "Show the working tree status"
+    helpSummary = "Show the working tree status"
-  helpUsage = """
+    helpUsage = """
 %prog [<project>...]
 """
-  helpDescription = """
+    helpDescription = """
 '%prog' compares the working tree to the staging area (aka index),
 and the most recent commit on this branch (HEAD), in each project
 specified.  A summary is displayed, one line per file where there
@@ -76,109 +76,128 @@ the following meanings:
  d:  deleted       (    in index, not in work tree                )
 
 """
-  PARALLEL_JOBS = DEFAULT_LOCAL_JOBS
+    PARALLEL_JOBS = DEFAULT_LOCAL_JOBS
 
-  def _Options(self, p):
+    def _Options(self, p):
-    p.add_option('-o', '--orphans',
+        p.add_option(
-                 dest='orphans', action='store_true',
+            "-o",
-                 help="include objects in working directory outside of repo projects")
+            "--orphans",
+            dest="orphans",
+            action="store_true",
+            help="include objects in working directory outside of repo "
+            "projects",
+        )
 
-  def _StatusHelper(self, quiet, local, project):
+    def _StatusHelper(self, quiet, local, project):
-    """Obtains the status for a specific project.
+        """Obtains the status for a specific project.
 
-    Obtains the status for a project, redirecting the output to
+        Obtains the status for a project, redirecting the output to
-    the specified object.
+        the specified object.
 
-    Args:
+        Args:
-      quiet: Where to output the status.
+            quiet: Where to output the status.
-      local: a boolean, if True, the path is relative to the local
+            local: a boolean, if True, the path is relative to the local
-             (sub)manifest.  If false, the path is relative to the
+                (sub)manifest.  If false, the path is relative to the outermost
-             outermost manifest.
+                manifest.
-      project: Project to get status of.
+            project: Project to get status of.
 
-    Returns:
+        Returns:
-      The status of the project.
+            The status of the project.
-    """
+        """
-    buf = io.StringIO()
+        buf = io.StringIO()
-    ret = project.PrintWorkTreeStatus(quiet=quiet, output_redir=buf,
+        ret = project.PrintWorkTreeStatus(
-                                      local=local)
+            quiet=quiet, output_redir=buf, local=local
-    return (ret, buf.getvalue())
+        )
+        return (ret, buf.getvalue())
 
-  def _FindOrphans(self, dirs, proj_dirs, proj_dirs_parents, outstring):
+    def _FindOrphans(self, dirs, proj_dirs, proj_dirs_parents, outstring):
-    """find 'dirs' that are present in 'proj_dirs_parents' but not in 'proj_dirs'"""
+        """find 'dirs' that are present in 'proj_dirs_parents' but not in 'proj_dirs'"""  # noqa: E501
-    status_header = ' --\t'
+        status_header = " --\t"
-    for item in dirs:
+        for item in dirs:
-      if not platform_utils.isdir(item):
+            if not platform_utils.isdir(item):
-        outstring.append(''.join([status_header, item]))
+                outstring.append("".join([status_header, item]))
-        continue
+                continue
-      if item in proj_dirs:
+            if item in proj_dirs:
-        continue
+                continue
-      if item in proj_dirs_parents:
+            if item in proj_dirs_parents:
-        self._FindOrphans(glob.glob('%s/.*' % item) +
+                self._FindOrphans(
-                          glob.glob('%s/*' % item),
+                    glob.glob("%s/.*" % item) + glob.glob("%s/*" % item),
-                          proj_dirs, proj_dirs_parents, outstring)
+                    proj_dirs,
-        continue
+                    proj_dirs_parents,
-      outstring.append(''.join([status_header, item, '/']))
+                    outstring,
+                )
+                continue
+            outstring.append("".join([status_header, item, "/"]))
 
-  def Execute(self, opt, args):
+    def Execute(self, opt, args):
-    all_projects = self.GetProjects(args, all_manifests=not opt.this_manifest_only)
+        all_projects = self.GetProjects(
+            args, all_manifests=not opt.this_manifest_only
+        )
 
-    def _ProcessResults(_pool, _output, results):
+        def _ProcessResults(_pool, _output, results):
-      ret = 0
+            ret = 0
-      for (state, output) in results:
+            for state, output in results:
-        if output:
+                if output:
-          print(output, end='')
+                    print(output, end="")
-        if state == 'CLEAN':
+                if state == "CLEAN":
-          ret += 1
+                    ret += 1
-      return ret
+            return ret
 
-    counter = self.ExecuteInParallel(
+        counter = self.ExecuteInParallel(
-        opt.jobs,
+            opt.jobs,
-        functools.partial(self._StatusHelper, opt.quiet, opt.this_manifest_only),
+            functools.partial(
-        all_projects,
+                self._StatusHelper, opt.quiet, opt.this_manifest_only
-        callback=_ProcessResults,
+            ),
-        ordered=True)
+            all_projects,
+            callback=_ProcessResults,
+            ordered=True,
+        )
 
-    if not opt.quiet and len(all_projects) == counter:
+        if not opt.quiet and len(all_projects) == counter:
-      print('nothing to commit (working directory clean)')
+            print("nothing to commit (working directory clean)")
 
-    if opt.orphans:
+        if opt.orphans:
-      proj_dirs = set()
+            proj_dirs = set()
-      proj_dirs_parents = set()
+            proj_dirs_parents = set()
-      for project in self.GetProjects(None, missing_ok=True, all_manifests=not opt.this_manifest_only):
+            for project in self.GetProjects(
-        relpath = project.RelPath(local=opt.this_manifest_only)
+                None, missing_ok=True, all_manifests=not opt.this_manifest_only
-        proj_dirs.add(relpath)
+            ):
-        (head, _tail) = os.path.split(relpath)
+                relpath = project.RelPath(local=opt.this_manifest_only)
-        while head != "":
+                proj_dirs.add(relpath)
-          proj_dirs_parents.add(head)
+                (head, _tail) = os.path.split(relpath)
-          (head, _tail) = os.path.split(head)
+                while head != "":
-      proj_dirs.add('.repo')
+                    proj_dirs_parents.add(head)
+                    (head, _tail) = os.path.split(head)
+            proj_dirs.add(".repo")
 
-      class StatusColoring(Coloring):
+            class StatusColoring(Coloring):
-        def __init__(self, config):
+                def __init__(self, config):
-          Coloring.__init__(self, config, 'status')
+                    Coloring.__init__(self, config, "status")
-          self.project = self.printer('header', attr='bold')
+                    self.project = self.printer("header", attr="bold")
-          self.untracked = self.printer('untracked', fg='red')
+                    self.untracked = self.printer("untracked", fg="red")
 
-      orig_path = os.getcwd()
+            orig_path = os.getcwd()
-      try:
+            try:
-        os.chdir(self.manifest.topdir)
+                os.chdir(self.manifest.topdir)
 
-        outstring = []
+                outstring = []
-        self._FindOrphans(glob.glob('.*') +
+                self._FindOrphans(
-                          glob.glob('*'),
+                    glob.glob(".*") + glob.glob("*"),
-                          proj_dirs, proj_dirs_parents, outstring)
+                    proj_dirs,
+                    proj_dirs_parents,
+                    outstring,
+                )
 
-        if outstring:
+                if outstring:
-          output = StatusColoring(self.client.globalConfig)
+                    output = StatusColoring(self.client.globalConfig)
-          output.project('Objects not within a project (orphans)')
+                    output.project("Objects not within a project (orphans)")
-          output.nl()
+                    output.nl()
-          for entry in outstring:
+                    for entry in outstring:
-            output.untracked(entry)
+                        output.untracked(entry)
-            output.nl()
+                        output.nl()
-        else:
+                else:
-          print('No orphan files or directories')
+                    print("No orphan files or directories")
 
-      finally:
+            finally:
-        # Restore CWD.
+                # Restore CWD.
-        os.chdir(orig_path)
+                os.chdir(orig_path)

subcmds/version.py

@@ -15,52 +15,62 @@
 import platform
 import sys
 
-from command import Command, MirrorSafeCommand
+from command import Command
-from git_command import git, RepoSourceVersion, user_agent
+from command import MirrorSafeCommand
+from git_command import git
+from git_command import RepoSourceVersion
+from git_command import user_agent
 from git_refs import HEAD
 from wrapper import Wrapper
 
 
 class Version(Command, MirrorSafeCommand):
-  wrapper_version = None
+    wrapper_version = None
-  wrapper_path = None
+    wrapper_path = None
 
-  COMMON = False
+    COMMON = False
-  helpSummary = "Display the version of repo"
+    helpSummary = "Display the version of repo"
-  helpUsage = """
+    helpUsage = """
 %prog
 """
 
-  def Execute(self, opt, args):
+    def Execute(self, opt, args):
-    rp = self.manifest.repoProject
+        rp = self.manifest.repoProject
-    rem = rp.GetRemote()
+        rem = rp.GetRemote()
-    branch = rp.GetBranch('default')
+        branch = rp.GetBranch("default")
 
-    # These might not be the same.  Report them both.
+        # These might not be the same.  Report them both.
-    src_ver = RepoSourceVersion()
+        src_ver = RepoSourceVersion()
-    rp_ver = rp.bare_git.describe(HEAD)
+        rp_ver = rp.bare_git.describe(HEAD)
-    print('repo version %s' % rp_ver)
+        print("repo version %s" % rp_ver)
-    print('       (from %s)' % rem.url)
+        print("       (from %s)" % rem.url)
-    print('       (tracking %s)' % branch.merge)
+        print("       (tracking %s)" % branch.merge)
-    print('       (%s)' % rp.bare_git.log('-1', '--format=%cD', HEAD))
+        print("       (%s)" % rp.bare_git.log("-1", "--format=%cD", HEAD))
 
-    if self.wrapper_path is not None:
+        if self.wrapper_path is not None:
-      print('repo launcher version %s' % self.wrapper_version)
+            print("repo launcher version %s" % self.wrapper_version)
-      print('       (from %s)' % self.wrapper_path)
+            print("       (from %s)" % self.wrapper_path)
 
-      if src_ver != rp_ver:
+            if src_ver != rp_ver:
-        print('       (currently at %s)' % src_ver)
+                print("       (currently at %s)" % src_ver)
 
-    print('repo User-Agent %s' % user_agent.repo)
+        print("repo User-Agent %s" % user_agent.repo)
-    print('git %s' % git.version_tuple().full)
+        print("git %s" % git.version_tuple().full)
-    print('git User-Agent %s' % user_agent.git)
+        print("git User-Agent %s" % user_agent.git)
-    print('Python %s' % sys.version)
+        print("Python %s" % sys.version)
-    uname = platform.uname()
+        uname = platform.uname()
-    if sys.version_info.major < 3:
+        if sys.version_info.major < 3:
-      # Python 3 returns a named tuple, but Python 2 is simpler.
+            # Python 3 returns a named tuple, but Python 2 is simpler.
-      print(uname)
+            print(uname)
-    else:
+        else:
-      print('OS %s %s (%s)' % (uname.system, uname.release, uname.version))
+            print(
-      print('CPU %s (%s)' %
+                "OS %s %s (%s)" % (uname.system, uname.release, uname.version)
-            (uname.machine, uname.processor if uname.processor else 'unknown'))
+            )
-    print('Bug reports:', Wrapper().BUG_URL)
+            print(
+                "CPU %s (%s)"
+                % (
+                    uname.machine,
+                    uname.processor if uname.processor else "unknown",
+                )
+            )
+        print("Bug reports:", Wrapper().BUG_URL)

tests/conftest.py

@@ -0,0 +1,25 @@
+# Copyright 2022 The Android Open Source Project
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#      http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+"""Common fixtures for pytests."""
+
+import pytest
+
+import repo_trace
+
+
+@pytest.fixture(autouse=True)
+def disable_repo_trace(tmp_path):
+    """Set an environment marker to relax certain strict checks for test code."""  # noqa: E501
+    repo_trace._TRACE_FILE = str(tmp_path / "TRACE_FILE_from_test")

tests/test_editor.py

@@ -20,37 +20,37 @@ from editor import Editor
 
 
 class EditorTestCase(unittest.TestCase):
-  """Take care of resetting Editor state across tests."""
+    """Take care of resetting Editor state across tests."""
 
-  def setUp(self):
+    def setUp(self):
-    self.setEditor(None)
+        self.setEditor(None)
 
-  def tearDown(self):
+    def tearDown(self):
-    self.setEditor(None)
+        self.setEditor(None)
 
-  @staticmethod
+    @staticmethod
-  def setEditor(editor):
+    def setEditor(editor):
-    Editor._editor = editor
+        Editor._editor = editor
 
 
 class GetEditor(EditorTestCase):
-  """Check GetEditor behavior."""
+    """Check GetEditor behavior."""
 
-  def test_basic(self):
+    def test_basic(self):
-    """Basic checking of _GetEditor."""
+        """Basic checking of _GetEditor."""
-    self.setEditor(':')
+        self.setEditor(":")
-    self.assertEqual(':', Editor._GetEditor())
+        self.assertEqual(":", Editor._GetEditor())
 
 
 class EditString(EditorTestCase):
-  """Check EditString behavior."""
+    """Check EditString behavior."""
 
-  def test_no_editor(self):
+    def test_no_editor(self):
-    """Check behavior when no editor is available."""
+        """Check behavior when no editor is available."""
-    self.setEditor(':')
+        self.setEditor(":")
-    self.assertEqual('foo', Editor.EditString('foo'))
+        self.assertEqual("foo", Editor.EditString("foo"))
 
-  def test_cat_editor(self):
+    def test_cat_editor(self):
-    """Check behavior when editor is `cat`."""
+        """Check behavior when editor is `cat`."""
-    self.setEditor('cat')
+        self.setEditor("cat")
-    self.assertEqual('foo', Editor.EditString('foo'))
+        self.assertEqual("foo", Editor.EditString("foo"))

tests/test_error.py

@@ -18,36 +18,53 @@ import inspect
 import pickle
 import unittest
 
+import command
 import error
+import fetch
+import git_command
+import project
+from subcmds import all_modules
+
+
+imports = all_modules + [
+    error,
+    project,
+    git_command,
+    fetch,
+    command,
+]
 
 
 class PickleTests(unittest.TestCase):
-  """Make sure all our custom exceptions can be pickled."""
+    """Make sure all our custom exceptions can be pickled."""
 
-  def getExceptions(self):
+    def getExceptions(self):
-    """Return all our custom exceptions."""
+        """Return all our custom exceptions."""
-    for name in dir(error):
+        for entry in imports:
-      cls = getattr(error, name)
+            for name in dir(entry):
-      if isinstance(cls, type) and issubclass(cls, Exception):
+                cls = getattr(entry, name)
-        yield cls
+                if isinstance(cls, type) and issubclass(cls, Exception):
+                    yield cls
 
-  def testExceptionLookup(self):
+    def testExceptionLookup(self):
-    """Make sure our introspection logic works."""
+        """Make sure our introspection logic works."""
-    classes = list(self.getExceptions())
+        classes = list(self.getExceptions())
-    self.assertIn(error.HookError, classes)
+        self.assertIn(error.HookError, classes)
-    # Don't assert the exact number to avoid being a change-detector test.
+        # Don't assert the exact number to avoid being a change-detector test.
-    self.assertGreater(len(classes), 10)
+        self.assertGreater(len(classes), 10)
 
-  def testPickle(self):
+    def testPickle(self):
-    """Try to pickle all the exceptions."""
+        """Try to pickle all the exceptions."""
-    for cls in self.getExceptions():
+        for cls in self.getExceptions():
-      args = inspect.getfullargspec(cls.__init__).args[1:]
+            args = inspect.getfullargspec(cls.__init__).args[1:]
-      obj = cls(*args)
+            obj = cls(*args)
-      p = pickle.dumps(obj)
+            p = pickle.dumps(obj)
-      try:
+            try:
-        newobj = pickle.loads(p)
+                newobj = pickle.loads(p)
-      except Exception as e:  # pylint: disable=broad-except
+            except Exception as e:  # pylint: disable=broad-except
-        self.fail('Class %s is unable to be pickled: %s\n'
+                self.fail(
-                  'Incomplete super().__init__(...) call?' % (cls, e))
+                    "Class %s is unable to be pickled: %s\n"
-      self.assertIsInstance(newobj, cls)
+                    "Incomplete super().__init__(...) call?" % (cls, e)
-      self.assertEqual(str(obj), str(newobj))
+                )
+            self.assertIsInstance(newobj, cls)
+            self.assertEqual(str(obj), str(newobj))

tests/test_git_command.py

@@ -14,109 +14,203 @@
 
 """Unittests for the git_command.py module."""
 
+import os
 import re
+import subprocess
 import unittest
 
+
 try:
-  from unittest import mock
+    from unittest import mock
 except ImportError:
-  import mock
+    import mock
 
 import git_command
 import wrapper
 
 
+class GitCommandTest(unittest.TestCase):
+    """Tests the GitCommand class (via git_command.git)."""
+
+    def setUp(self):
+        def realpath_mock(val):
+            return val
+
+        mock.patch.object(
+            os.path, "realpath", side_effect=realpath_mock
+        ).start()
+
+    def tearDown(self):
+        mock.patch.stopall()
+
+    def test_alternative_setting_when_matching(self):
+        r = git_command._build_env(
+            objdir=os.path.join("zap", "objects"), gitdir="zap"
+        )
+
+        self.assertIsNone(r.get("GIT_ALTERNATE_OBJECT_DIRECTORIES"))
+        self.assertEqual(
+            r.get("GIT_OBJECT_DIRECTORY"), os.path.join("zap", "objects")
+        )
+
+    def test_alternative_setting_when_different(self):
+        r = git_command._build_env(
+            objdir=os.path.join("wow", "objects"), gitdir="zap"
+        )
+
+        self.assertEqual(
+            r.get("GIT_ALTERNATE_OBJECT_DIRECTORIES"),
+            os.path.join("zap", "objects"),
+        )
+        self.assertEqual(
+            r.get("GIT_OBJECT_DIRECTORY"), os.path.join("wow", "objects")
+        )
+
+
+class GitCommandWaitTest(unittest.TestCase):
+    """Tests the GitCommand class .Wait()"""
+
+    def setUp(self):
+        class MockPopen(object):
+            rc = 0
+
+            def communicate(
+                self, input: str = None, timeout: float = None
+            ) -> [str, str]:
+                """Mock communicate fn."""
+                return ["", ""]
+
+            def wait(self, timeout=None):
+                return self.rc
+
+        self.popen = popen = MockPopen()
+
+        def popen_mock(*args, **kwargs):
+            return popen
+
+        def realpath_mock(val):
+            return val
+
+        mock.patch.object(subprocess, "Popen", side_effect=popen_mock).start()
+
+        mock.patch.object(
+            os.path, "realpath", side_effect=realpath_mock
+        ).start()
+
+    def tearDown(self):
+        mock.patch.stopall()
+
+    def test_raises_when_verify_non_zero_result(self):
+        self.popen.rc = 1
+        r = git_command.GitCommand(None, ["status"], verify_command=True)
+        with self.assertRaises(git_command.GitCommandError):
+            r.Wait()
+
+    def test_returns_when_no_verify_non_zero_result(self):
+        self.popen.rc = 1
+        r = git_command.GitCommand(None, ["status"], verify_command=False)
+        self.assertEqual(1, r.Wait())
+
+    def test_default_returns_non_zero_result(self):
+        self.popen.rc = 1
+        r = git_command.GitCommand(None, ["status"])
+        self.assertEqual(1, r.Wait())
+
+
 class GitCallUnitTest(unittest.TestCase):
-  """Tests the _GitCall class (via git_command.git)."""
+    """Tests the _GitCall class (via git_command.git)."""
 
-  def test_version_tuple(self):
+    def test_version_tuple(self):
-    """Check git.version_tuple() handling."""
+        """Check git.version_tuple() handling."""
-    ver = git_command.git.version_tuple()
+        ver = git_command.git.version_tuple()
-    self.assertIsNotNone(ver)
+        self.assertIsNotNone(ver)
 
-    # We don't dive too deep into the values here to avoid having to update
+        # We don't dive too deep into the values here to avoid having to update
-    # whenever git versions change.  We do check relative to this min version
+        # whenever git versions change.  We do check relative to this min
-    # as this is what `repo` itself requires via MIN_GIT_VERSION.
+        # version as this is what `repo` itself requires via MIN_GIT_VERSION.
-    MIN_GIT_VERSION = (2, 10, 2)
+        MIN_GIT_VERSION = (2, 10, 2)
-    self.assertTrue(isinstance(ver.major, int))
+        self.assertTrue(isinstance(ver.major, int))
-    self.assertTrue(isinstance(ver.minor, int))
+        self.assertTrue(isinstance(ver.minor, int))
-    self.assertTrue(isinstance(ver.micro, int))
+        self.assertTrue(isinstance(ver.micro, int))
 
-    self.assertGreater(ver.major, MIN_GIT_VERSION[0] - 1)
+        self.assertGreater(ver.major, MIN_GIT_VERSION[0] - 1)
-    self.assertGreaterEqual(ver.micro, 0)
+        self.assertGreaterEqual(ver.micro, 0)
-    self.assertGreaterEqual(ver.major, 0)
+        self.assertGreaterEqual(ver.major, 0)
 
-    self.assertGreaterEqual(ver, MIN_GIT_VERSION)
+        self.assertGreaterEqual(ver, MIN_GIT_VERSION)
-    self.assertLess(ver, (9999, 9999, 9999))
+        self.assertLess(ver, (9999, 9999, 9999))
 
-    self.assertNotEqual('', ver.full)
+        self.assertNotEqual("", ver.full)
 
 
 class UserAgentUnitTest(unittest.TestCase):
-  """Tests the UserAgent function."""
+    """Tests the UserAgent function."""
 
-  def test_smoke_os(self):
+    def test_smoke_os(self):
-    """Make sure UA OS setting returns something useful."""
+        """Make sure UA OS setting returns something useful."""
-    os_name = git_command.user_agent.os
+        os_name = git_command.user_agent.os
-    # We can't dive too deep because of OS/tool differences, but we can check
+        # We can't dive too deep because of OS/tool differences, but we can
-    # the general form.
+        # check the general form.
-    m = re.match(r'^[^ ]+$', os_name)
+        m = re.match(r"^[^ ]+$", os_name)
-    self.assertIsNotNone(m)
+        self.assertIsNotNone(m)
 
-  def test_smoke_repo(self):
+    def test_smoke_repo(self):
-    """Make sure repo UA returns something useful."""
+        """Make sure repo UA returns something useful."""
-    ua = git_command.user_agent.repo
+        ua = git_command.user_agent.repo
-    # We can't dive too deep because of OS/tool differences, but we can check
+        # We can't dive too deep because of OS/tool differences, but we can
-    # the general form.
+        # check the general form.
-    m = re.match(r'^git-repo/[^ ]+ ([^ ]+) git/[^ ]+ Python/[0-9.]+', ua)
+        m = re.match(r"^git-repo/[^ ]+ ([^ ]+) git/[^ ]+ Python/[0-9.]+", ua)
-    self.assertIsNotNone(m)
+        self.assertIsNotNone(m)
 
-  def test_smoke_git(self):
+    def test_smoke_git(self):
-    """Make sure git UA returns something useful."""
+        """Make sure git UA returns something useful."""
-    ua = git_command.user_agent.git
+        ua = git_command.user_agent.git
-    # We can't dive too deep because of OS/tool differences, but we can check
+        # We can't dive too deep because of OS/tool differences, but we can
-    # the general form.
+        # check the general form.
-    m = re.match(r'^git/[^ ]+ ([^ ]+) git-repo/[^ ]+', ua)
+        m = re.match(r"^git/[^ ]+ ([^ ]+) git-repo/[^ ]+", ua)
-    self.assertIsNotNone(m)
+        self.assertIsNotNone(m)
 
 
 class GitRequireTests(unittest.TestCase):
-  """Test the git_require helper."""
+    """Test the git_require helper."""
 
-  def setUp(self):
+    def setUp(self):
-    ver = wrapper.GitVersion(1, 2, 3, 4)
+        self.wrapper = wrapper.Wrapper()
-    mock.patch.object(git_command.git, 'version_tuple', return_value=ver).start()
+        ver = self.wrapper.GitVersion(1, 2, 3, 4)
+        mock.patch.object(
+            git_command.git, "version_tuple", return_value=ver
+        ).start()
 
-  def tearDown(self):
+    def tearDown(self):
-    mock.patch.stopall()
+        mock.patch.stopall()
 
-  def test_older_nonfatal(self):
+    def test_older_nonfatal(self):
-    """Test non-fatal require calls with old versions."""
+        """Test non-fatal require calls with old versions."""
-    self.assertFalse(git_command.git_require((2,)))
+        self.assertFalse(git_command.git_require((2,)))
-    self.assertFalse(git_command.git_require((1, 3)))
+        self.assertFalse(git_command.git_require((1, 3)))
-    self.assertFalse(git_command.git_require((1, 2, 4)))
+        self.assertFalse(git_command.git_require((1, 2, 4)))
-    self.assertFalse(git_command.git_require((1, 2, 3, 5)))
+        self.assertFalse(git_command.git_require((1, 2, 3, 5)))
 
-  def test_newer_nonfatal(self):
+    def test_newer_nonfatal(self):
-    """Test non-fatal require calls with newer versions."""
+        """Test non-fatal require calls with newer versions."""
-    self.assertTrue(git_command.git_require((0,)))
+        self.assertTrue(git_command.git_require((0,)))
-    self.assertTrue(git_command.git_require((1, 0)))
+        self.assertTrue(git_command.git_require((1, 0)))
-    self.assertTrue(git_command.git_require((1, 2, 0)))
+        self.assertTrue(git_command.git_require((1, 2, 0)))
-    self.assertTrue(git_command.git_require((1, 2, 3, 0)))
+        self.assertTrue(git_command.git_require((1, 2, 3, 0)))
 
-  def test_equal_nonfatal(self):
+    def test_equal_nonfatal(self):
-    """Test require calls with equal values."""
+        """Test require calls with equal values."""
-    self.assertTrue(git_command.git_require((1, 2, 3, 4), fail=False))
+        self.assertTrue(git_command.git_require((1, 2, 3, 4), fail=False))
-    self.assertTrue(git_command.git_require((1, 2, 3, 4), fail=True))
+        self.assertTrue(git_command.git_require((1, 2, 3, 4), fail=True))
 
-  def test_older_fatal(self):
+    def test_older_fatal(self):
-    """Test fatal require calls with old versions."""
+        """Test fatal require calls with old versions."""
-    with self.assertRaises(SystemExit) as e:
+        with self.assertRaises(git_command.GitRequireError) as e:
-      git_command.git_require((2,), fail=True)
+            git_command.git_require((2,), fail=True)
-      self.assertNotEqual(0, e.code)
+            self.assertNotEqual(0, e.code)
 
-  def test_older_fatal_msg(self):
+    def test_older_fatal_msg(self):
-    """Test fatal require calls with old versions and message."""
+        """Test fatal require calls with old versions and message."""
-    with self.assertRaises(SystemExit) as e:
+        with self.assertRaises(git_command.GitRequireError) as e:
-      git_command.git_require((2,), fail=True, msg='so sad')
+            git_command.git_require((2,), fail=True, msg="so sad")
-      self.assertNotEqual(0, e.code)
+            self.assertNotEqual(0, e.code)

tests/test_git_config.py

@@ -22,171 +22,169 @@ import git_config
 
 
 def fixture(*paths):
-  """Return a path relative to test/fixtures.
+    """Return a path relative to test/fixtures."""
-  """
+    return os.path.join(os.path.dirname(__file__), "fixtures", *paths)
-  return os.path.join(os.path.dirname(__file__), 'fixtures', *paths)
 
 
 class GitConfigReadOnlyTests(unittest.TestCase):
-  """Read-only tests of the GitConfig class."""
+    """Read-only tests of the GitConfig class."""
 
-  def setUp(self):
+    def setUp(self):
-    """Create a GitConfig object using the test.gitconfig fixture.
+        """Create a GitConfig object using the test.gitconfig fixture."""
-    """
+        config_fixture = fixture("test.gitconfig")
-    config_fixture = fixture('test.gitconfig')
+        self.config = git_config.GitConfig(config_fixture)
-    self.config = git_config.GitConfig(config_fixture)
 
-  def test_GetString_with_empty_config_values(self):
+    def test_GetString_with_empty_config_values(self):
-    """
+        """
-    Test config entries with no value.
+        Test config entries with no value.
 
-    [section]
+        [section]
-        empty
+            empty
 
-    """
+        """
-    val = self.config.GetString('section.empty')
+        val = self.config.GetString("section.empty")
-    self.assertEqual(val, None)
+        self.assertEqual(val, None)
 
-  def test_GetString_with_true_value(self):
+    def test_GetString_with_true_value(self):
-    """
+        """
-    Test config entries with a string value.
+        Test config entries with a string value.
 
-    [section]
+        [section]
-        nonempty = true
+            nonempty = true
 
-    """
+        """
-    val = self.config.GetString('section.nonempty')
+        val = self.config.GetString("section.nonempty")
-    self.assertEqual(val, 'true')
+        self.assertEqual(val, "true")
 
-  def test_GetString_from_missing_file(self):
+    def test_GetString_from_missing_file(self):
-    """
+        """
-    Test missing config file
+        Test missing config file
-    """
+        """
-    config_fixture = fixture('not.present.gitconfig')
+        config_fixture = fixture("not.present.gitconfig")
-    config = git_config.GitConfig(config_fixture)
+        config = git_config.GitConfig(config_fixture)
-    val = config.GetString('empty')
+        val = config.GetString("empty")
-    self.assertEqual(val, None)
+        self.assertEqual(val, None)
 
-  def test_GetBoolean_undefined(self):
+    def test_GetBoolean_undefined(self):
-    """Test GetBoolean on key that doesn't exist."""
+        """Test GetBoolean on key that doesn't exist."""
-    self.assertIsNone(self.config.GetBoolean('section.missing'))
+        self.assertIsNone(self.config.GetBoolean("section.missing"))
 
-  def test_GetBoolean_invalid(self):
+    def test_GetBoolean_invalid(self):
-    """Test GetBoolean on invalid boolean value."""
+        """Test GetBoolean on invalid boolean value."""
-    self.assertIsNone(self.config.GetBoolean('section.boolinvalid'))
+        self.assertIsNone(self.config.GetBoolean("section.boolinvalid"))
 
-  def test_GetBoolean_true(self):
+    def test_GetBoolean_true(self):
-    """Test GetBoolean on valid true boolean."""
+        """Test GetBoolean on valid true boolean."""
-    self.assertTrue(self.config.GetBoolean('section.booltrue'))
+        self.assertTrue(self.config.GetBoolean("section.booltrue"))
 
-  def test_GetBoolean_false(self):
+    def test_GetBoolean_false(self):
-    """Test GetBoolean on valid false boolean."""
+        """Test GetBoolean on valid false boolean."""
-    self.assertFalse(self.config.GetBoolean('section.boolfalse'))
+        self.assertFalse(self.config.GetBoolean("section.boolfalse"))
 
-  def test_GetInt_undefined(self):
+    def test_GetInt_undefined(self):
-    """Test GetInt on key that doesn't exist."""
+        """Test GetInt on key that doesn't exist."""
-    self.assertIsNone(self.config.GetInt('section.missing'))
+        self.assertIsNone(self.config.GetInt("section.missing"))
 
-  def test_GetInt_invalid(self):
+    def test_GetInt_invalid(self):
-    """Test GetInt on invalid integer value."""
+        """Test GetInt on invalid integer value."""
-    self.assertIsNone(self.config.GetBoolean('section.intinvalid'))
+        self.assertIsNone(self.config.GetBoolean("section.intinvalid"))
 
-  def test_GetInt_valid(self):
+    def test_GetInt_valid(self):
-    """Test GetInt on valid integers."""
+        """Test GetInt on valid integers."""
-    TESTS = (
+        TESTS = (
-        ('inthex', 16),
+            ("inthex", 16),
-        ('inthexk', 16384),
+            ("inthexk", 16384),
-        ('int', 10),
+            ("int", 10),
-        ('intk', 10240),
+            ("intk", 10240),
-        ('intm', 10485760),
+            ("intm", 10485760),
-        ('intg', 10737418240),
+            ("intg", 10737418240),
-    )
+        )
-    for key, value in TESTS:
+        for key, value in TESTS:
-      self.assertEqual(value, self.config.GetInt('section.%s' % (key,)))
+            self.assertEqual(value, self.config.GetInt("section.%s" % (key,)))
 
 
 class GitConfigReadWriteTests(unittest.TestCase):
-  """Read/write tests of the GitConfig class."""
+    """Read/write tests of the GitConfig class."""
 
-  def setUp(self):
+    def setUp(self):
-    self.tmpfile = tempfile.NamedTemporaryFile()
+        self.tmpfile = tempfile.NamedTemporaryFile()
-    self.config = self.get_config()
+        self.config = self.get_config()
 
-  def get_config(self):
+    def get_config(self):
-    """Get a new GitConfig instance."""
+        """Get a new GitConfig instance."""
-    return git_config.GitConfig(self.tmpfile.name)
+        return git_config.GitConfig(self.tmpfile.name)
 
-  def test_SetString(self):
+    def test_SetString(self):
-    """Test SetString behavior."""
+        """Test SetString behavior."""
-    # Set a value.
+        # Set a value.
-    self.assertIsNone(self.config.GetString('foo.bar'))
+        self.assertIsNone(self.config.GetString("foo.bar"))
-    self.config.SetString('foo.bar', 'val')
+        self.config.SetString("foo.bar", "val")
-    self.assertEqual('val', self.config.GetString('foo.bar'))
+        self.assertEqual("val", self.config.GetString("foo.bar"))
 
-    # Make sure the value was actually written out.
+        # Make sure the value was actually written out.
-    config = self.get_config()
+        config = self.get_config()
-    self.assertEqual('val', config.GetString('foo.bar'))
+        self.assertEqual("val", config.GetString("foo.bar"))
 
-    # Update the value.
+        # Update the value.
-    self.config.SetString('foo.bar', 'valll')
+        self.config.SetString("foo.bar", "valll")
-    self.assertEqual('valll', self.config.GetString('foo.bar'))
+        self.assertEqual("valll", self.config.GetString("foo.bar"))
-    config = self.get_config()
+        config = self.get_config()
-    self.assertEqual('valll', config.GetString('foo.bar'))
+        self.assertEqual("valll", config.GetString("foo.bar"))
 
-    # Delete the value.
+        # Delete the value.
-    self.config.SetString('foo.bar', None)
+        self.config.SetString("foo.bar", None)
-    self.assertIsNone(self.config.GetString('foo.bar'))
+        self.assertIsNone(self.config.GetString("foo.bar"))
-    config = self.get_config()
+        config = self.get_config()
-    self.assertIsNone(config.GetString('foo.bar'))
+        self.assertIsNone(config.GetString("foo.bar"))
 
-  def test_SetBoolean(self):
+    def test_SetBoolean(self):
-    """Test SetBoolean behavior."""
+        """Test SetBoolean behavior."""
-    # Set a true value.
+        # Set a true value.
-    self.assertIsNone(self.config.GetBoolean('foo.bar'))
+        self.assertIsNone(self.config.GetBoolean("foo.bar"))
-    for val in (True, 1):
+        for val in (True, 1):
-      self.config.SetBoolean('foo.bar', val)
+            self.config.SetBoolean("foo.bar", val)
-      self.assertTrue(self.config.GetBoolean('foo.bar'))
+            self.assertTrue(self.config.GetBoolean("foo.bar"))
 
-    # Make sure the value was actually written out.
+        # Make sure the value was actually written out.
-    config = self.get_config()
+        config = self.get_config()
-    self.assertTrue(config.GetBoolean('foo.bar'))
+        self.assertTrue(config.GetBoolean("foo.bar"))
-    self.assertEqual('true', config.GetString('foo.bar'))
+        self.assertEqual("true", config.GetString("foo.bar"))
 
-    # Set a false value.
+        # Set a false value.
-    for val in (False, 0):
+        for val in (False, 0):
-      self.config.SetBoolean('foo.bar', val)
+            self.config.SetBoolean("foo.bar", val)
-      self.assertFalse(self.config.GetBoolean('foo.bar'))
+            self.assertFalse(self.config.GetBoolean("foo.bar"))
 
-    # Make sure the value was actually written out.
+        # Make sure the value was actually written out.
-    config = self.get_config()
+        config = self.get_config()
-    self.assertFalse(config.GetBoolean('foo.bar'))
+        self.assertFalse(config.GetBoolean("foo.bar"))
-    self.assertEqual('false', config.GetString('foo.bar'))
+        self.assertEqual("false", config.GetString("foo.bar"))
 
-    # Delete the value.
+        # Delete the value.
-    self.config.SetBoolean('foo.bar', None)
+        self.config.SetBoolean("foo.bar", None)
-    self.assertIsNone(self.config.GetBoolean('foo.bar'))
+        self.assertIsNone(self.config.GetBoolean("foo.bar"))
-    config = self.get_config()
+        config = self.get_config()
-    self.assertIsNone(config.GetBoolean('foo.bar'))
+        self.assertIsNone(config.GetBoolean("foo.bar"))
 
-  def test_GetSyncAnalysisStateData(self):
+    def test_GetSyncAnalysisStateData(self):
-    """Test config entries with a sync state analysis data."""
+        """Test config entries with a sync state analysis data."""
-    superproject_logging_data = {}
+        superproject_logging_data = {}
-    superproject_logging_data['test'] = False
+        superproject_logging_data["test"] = False
-    options = type('options', (object,), {})()
+        options = type("options", (object,), {})()
-    options.verbose = 'true'
+        options.verbose = "true"
-    options.mp_update = 'false'
+        options.mp_update = "false"
-    TESTS = (
+        TESTS = (
-        ('superproject.test', 'false'),
+            ("superproject.test", "false"),
-        ('options.verbose', 'true'),
+            ("options.verbose", "true"),
-        ('options.mpupdate', 'false'),
+            ("options.mpupdate", "false"),
-        ('main.version', '1'),
+            ("main.version", "1"),
-    )
+        )
-    self.config.UpdateSyncAnalysisState(options, superproject_logging_data)
+        self.config.UpdateSyncAnalysisState(options, superproject_logging_data)
-    sync_data = self.config.GetSyncAnalysisStateData()
+        sync_data = self.config.GetSyncAnalysisStateData()
-    for key, value in TESTS:
+        for key, value in TESTS:
-      self.assertEqual(sync_data[f'{git_config.SYNC_STATE_PREFIX}{key}'], value)
+            self.assertEqual(
-    self.assertTrue(sync_data[f'{git_config.SYNC_STATE_PREFIX}main.synctime'])
+                sync_data[f"{git_config.SYNC_STATE_PREFIX}{key}"], value
-
+            )
-
+        self.assertTrue(
-if __name__ == '__main__':
+            sync_data[f"{git_config.SYNC_STATE_PREFIX}main.synctime"]
-  unittest.main()
+        )

tests/test_git_superproject.py

@@ -21,303 +21,379 @@ import tempfile
 import unittest
 from unittest import mock
 
+from test_manifest_xml import sort_attributes
+
 import git_superproject
 import git_trace2_event_log
 import manifest_xml
-from test_manifest_xml import sort_attributes
 
 
 class SuperprojectTestCase(unittest.TestCase):
-  """TestCase for the Superproject module."""
+    """TestCase for the Superproject module."""
 
-  PARENT_SID_KEY = 'GIT_TRACE2_PARENT_SID'
+    PARENT_SID_KEY = "GIT_TRACE2_PARENT_SID"
-  PARENT_SID_VALUE = 'parent_sid'
+    PARENT_SID_VALUE = "parent_sid"
-  SELF_SID_REGEX = r'repo-\d+T\d+Z-.*'
+    SELF_SID_REGEX = r"repo-\d+T\d+Z-.*"
-  FULL_SID_REGEX = r'^%s/%s' % (PARENT_SID_VALUE, SELF_SID_REGEX)
+    FULL_SID_REGEX = r"^%s/%s" % (PARENT_SID_VALUE, SELF_SID_REGEX)
 
-  def setUp(self):
+    def setUp(self):
-    """Set up superproject every time."""
+        """Set up superproject every time."""
-    self.tempdirobj = tempfile.TemporaryDirectory(prefix='repo_tests')
+        self.tempdirobj = tempfile.TemporaryDirectory(prefix="repo_tests")
-    self.tempdir = self.tempdirobj.name
+        self.tempdir = self.tempdirobj.name
-    self.repodir = os.path.join(self.tempdir, '.repo')
+        self.repodir = os.path.join(self.tempdir, ".repo")
-    self.manifest_file = os.path.join(
+        self.manifest_file = os.path.join(
-        self.repodir, manifest_xml.MANIFEST_FILE_NAME)
+            self.repodir, manifest_xml.MANIFEST_FILE_NAME
-    os.mkdir(self.repodir)
+        )
-    self.platform = platform.system().lower()
+        os.mkdir(self.repodir)
+        self.platform = platform.system().lower()
 
-    # By default we initialize with the expected case where
+        # By default we initialize with the expected case where
-    # repo launches us (so GIT_TRACE2_PARENT_SID is set).
+        # repo launches us (so GIT_TRACE2_PARENT_SID is set).
-    env = {
+        env = {
-        self.PARENT_SID_KEY: self.PARENT_SID_VALUE,
+            self.PARENT_SID_KEY: self.PARENT_SID_VALUE,
-    }
+        }
-    self.git_event_log = git_trace2_event_log.EventLog(env=env)
+        self.git_event_log = git_trace2_event_log.EventLog(env=env)
 
-    # The manifest parsing really wants a git repo currently.
+        # The manifest parsing really wants a git repo currently.
-    gitdir = os.path.join(self.repodir, 'manifests.git')
+        gitdir = os.path.join(self.repodir, "manifests.git")
-    os.mkdir(gitdir)
+        os.mkdir(gitdir)
-    with open(os.path.join(gitdir, 'config'), 'w') as fp:
+        with open(os.path.join(gitdir, "config"), "w") as fp:
-      fp.write("""[remote "origin"]
+            fp.write(
+                """[remote "origin"]
         url = https://localhost:0/manifest
-""")
+"""
+            )
 
-    manifest = self.getXmlManifest("""
+        manifest = self.getXmlManifest(
+            """
 <manifest>
   <remote name="default-remote" fetch="http://localhost" />
   <default remote="default-remote" revision="refs/heads/main" />
   <superproject name="superproject"/>
-  <project path="art" name="platform/art" groups="notdefault,platform-""" + self.platform + """
+  <project path="art" name="platform/art" groups="notdefault,platform-"""
+            + self.platform
+            + """
   " /></manifest>
-""")
+"""
-    self._superproject = git_superproject.Superproject(
+        )
-        manifest, name='superproject',
+        self._superproject = git_superproject.Superproject(
-        remote=manifest.remotes.get('default-remote').ToRemoteSpec('superproject'),
+            manifest,
-        revision='refs/heads/main')
+            name="superproject",
+            remote=manifest.remotes.get("default-remote").ToRemoteSpec(
+                "superproject"
+            ),
+            revision="refs/heads/main",
+        )
 
-  def tearDown(self):
+    def tearDown(self):
-    """Tear down superproject every time."""
+        """Tear down superproject every time."""
-    self.tempdirobj.cleanup()
+        self.tempdirobj.cleanup()
 
-  def getXmlManifest(self, data):
+    def getXmlManifest(self, data):
-    """Helper to initialize a manifest for testing."""
+        """Helper to initialize a manifest for testing."""
-    with open(self.manifest_file, 'w') as fp:
+        with open(self.manifest_file, "w") as fp:
-      fp.write(data)
+            fp.write(data)
-    return manifest_xml.XmlManifest(self.repodir, self.manifest_file)
+        return manifest_xml.XmlManifest(self.repodir, self.manifest_file)
 
-  def verifyCommonKeys(self, log_entry, expected_event_name, full_sid=True):
+    def verifyCommonKeys(self, log_entry, expected_event_name, full_sid=True):
-    """Helper function to verify common event log keys."""
+        """Helper function to verify common event log keys."""
-    self.assertIn('event', log_entry)
+        self.assertIn("event", log_entry)
-    self.assertIn('sid', log_entry)
+        self.assertIn("sid", log_entry)
-    self.assertIn('thread', log_entry)
+        self.assertIn("thread", log_entry)
-    self.assertIn('time', log_entry)
+        self.assertIn("time", log_entry)
 
-    # Do basic data format validation.
+        # Do basic data format validation.
-    self.assertEqual(expected_event_name, log_entry['event'])
+        self.assertEqual(expected_event_name, log_entry["event"])
-    if full_sid:
+        if full_sid:
-      self.assertRegex(log_entry['sid'], self.FULL_SID_REGEX)
+            self.assertRegex(log_entry["sid"], self.FULL_SID_REGEX)
-    else:
+        else:
-      self.assertRegex(log_entry['sid'], self.SELF_SID_REGEX)
+            self.assertRegex(log_entry["sid"], self.SELF_SID_REGEX)
-    self.assertRegex(log_entry['time'], r'^\d+-\d+-\d+T\d+:\d+:\d+\.\d+Z$')
+        self.assertRegex(
+            log_entry["time"], r"^\d+-\d+-\d+T\d+:\d+:\d+\.\d+\+00:00$"
+        )
 
-  def readLog(self, log_path):
+    def readLog(self, log_path):
-    """Helper function to read log data into a list."""
+        """Helper function to read log data into a list."""
-    log_data = []
+        log_data = []
-    with open(log_path, mode='rb') as f:
+        with open(log_path, mode="rb") as f:
-      for line in f:
+            for line in f:
-        log_data.append(json.loads(line))
+                log_data.append(json.loads(line))
-    return log_data
+        return log_data
 
-  def verifyErrorEvent(self):
+    def verifyErrorEvent(self):
-    """Helper to verify that error event is written."""
+        """Helper to verify that error event is written."""
 
-    with tempfile.TemporaryDirectory(prefix='event_log_tests') as tempdir:
+        with tempfile.TemporaryDirectory(prefix="event_log_tests") as tempdir:
-      log_path = self.git_event_log.Write(path=tempdir)
+            log_path = self.git_event_log.Write(path=tempdir)
-      self.log_data = self.readLog(log_path)
+            self.log_data = self.readLog(log_path)
 
-    self.assertEqual(len(self.log_data), 2)
+        self.assertEqual(len(self.log_data), 2)
-    error_event = self.log_data[1]
+        error_event = self.log_data[1]
-    self.verifyCommonKeys(self.log_data[0], expected_event_name='version')
+        self.verifyCommonKeys(self.log_data[0], expected_event_name="version")
-    self.verifyCommonKeys(error_event, expected_event_name='error')
+        self.verifyCommonKeys(error_event, expected_event_name="error")
-    # Check for 'error' event specific fields.
+        # Check for 'error' event specific fields.
-    self.assertIn('msg', error_event)
+        self.assertIn("msg", error_event)
-    self.assertIn('fmt', error_event)
+        self.assertIn("fmt", error_event)
 
-  def test_superproject_get_superproject_no_superproject(self):
+    def test_superproject_get_superproject_no_superproject(self):
-    """Test with no url."""
+        """Test with no url."""
-    manifest = self.getXmlManifest("""
+        manifest = self.getXmlManifest(
+            """
 <manifest>
 </manifest>
-""")
+"""
-    self.assertIsNone(manifest.superproject)
+        )
+        self.assertIsNone(manifest.superproject)
 
-  def test_superproject_get_superproject_invalid_url(self):
+    def test_superproject_get_superproject_invalid_url(self):
-    """Test with an invalid url."""
+        """Test with an invalid url."""
-    manifest = self.getXmlManifest("""
+        manifest = self.getXmlManifest(
+            """
 <manifest>
   <remote name="test-remote" fetch="localhost" />
   <default remote="test-remote" revision="refs/heads/main" />
   <superproject name="superproject"/>
 </manifest>
-""")
+"""
-    superproject = git_superproject.Superproject(
+        )
-        manifest, name='superproject',
+        superproject = git_superproject.Superproject(
-        remote=manifest.remotes.get('test-remote').ToRemoteSpec('superproject'),
+            manifest,
-        revision='refs/heads/main')
+            name="superproject",
-    sync_result = superproject.Sync(self.git_event_log)
+            remote=manifest.remotes.get("test-remote").ToRemoteSpec(
-    self.assertFalse(sync_result.success)
+                "superproject"
-    self.assertTrue(sync_result.fatal)
+            ),
-
+            revision="refs/heads/main",
-  def test_superproject_get_superproject_invalid_branch(self):
+        )
-    """Test with an invalid branch."""
+        sync_result = superproject.Sync(self.git_event_log)
-    manifest = self.getXmlManifest("""
-<manifest>
-  <remote name="test-remote" fetch="localhost" />
-  <default remote="test-remote" revision="refs/heads/main" />
-  <superproject name="superproject"/>
-</manifest>
-""")
-    self._superproject = git_superproject.Superproject(
-        manifest, name='superproject',
-        remote=manifest.remotes.get('test-remote').ToRemoteSpec('superproject'),
-        revision='refs/heads/main')
-    with mock.patch.object(self._superproject, '_branch', 'junk'):
-      sync_result = self._superproject.Sync(self.git_event_log)
-      self.assertFalse(sync_result.success)
-      self.assertTrue(sync_result.fatal)
-
-  def test_superproject_get_superproject_mock_init(self):
-    """Test with _Init failing."""
-    with mock.patch.object(self._superproject, '_Init', return_value=False):
-      sync_result = self._superproject.Sync(self.git_event_log)
-      self.assertFalse(sync_result.success)
-      self.assertTrue(sync_result.fatal)
-
-  def test_superproject_get_superproject_mock_fetch(self):
-    """Test with _Fetch failing."""
-    with mock.patch.object(self._superproject, '_Init', return_value=True):
-      os.mkdir(self._superproject._superproject_path)
-      with mock.patch.object(self._superproject, '_Fetch', return_value=False):
-        sync_result = self._superproject.Sync(self.git_event_log)
         self.assertFalse(sync_result.success)
         self.assertTrue(sync_result.fatal)
 
-  def test_superproject_get_all_project_commit_ids_mock_ls_tree(self):
+    def test_superproject_get_superproject_invalid_branch(self):
-    """Test with LsTree being a mock."""
+        """Test with an invalid branch."""
-    data = ('120000 blob 158258bdf146f159218e2b90f8b699c4d85b5804\tAndroid.bp\x00'
+        manifest = self.getXmlManifest(
-            '160000 commit 2c2724cb36cd5a9cec6c852c681efc3b7c6b86ea\tart\x00'
+            """
-            '160000 commit e9d25da64d8d365dbba7c8ee00fe8c4473fe9a06\tbootable/recovery\x00'
+<manifest>
-            '120000 blob acc2cbdf438f9d2141f0ae424cec1d8fc4b5d97f\tbootstrap.bash\x00'
+  <remote name="test-remote" fetch="localhost" />
-            '160000 commit ade9b7a0d874e25fff4bf2552488825c6f111928\tbuild/bazel\x00')
+  <default remote="test-remote" revision="refs/heads/main" />
-    with mock.patch.object(self._superproject, '_Init', return_value=True):
+  <superproject name="superproject"/>
-      with mock.patch.object(self._superproject, '_Fetch', return_value=True):
+</manifest>
-        with mock.patch.object(self._superproject, '_LsTree', return_value=data):
+"""
-          commit_ids_result = self._superproject._GetAllProjectsCommitIds()
+        )
-          self.assertEqual(commit_ids_result.commit_ids, {
+        self._superproject = git_superproject.Superproject(
-              'art': '2c2724cb36cd5a9cec6c852c681efc3b7c6b86ea',
+            manifest,
-              'bootable/recovery': 'e9d25da64d8d365dbba7c8ee00fe8c4473fe9a06',
+            name="superproject",
-              'build/bazel': 'ade9b7a0d874e25fff4bf2552488825c6f111928'
+            remote=manifest.remotes.get("test-remote").ToRemoteSpec(
-          })
+                "superproject"
-          self.assertFalse(commit_ids_result.fatal)
+            ),
+            revision="refs/heads/main",
+        )
+        with mock.patch.object(self._superproject, "_branch", "junk"):
+            sync_result = self._superproject.Sync(self.git_event_log)
+            self.assertFalse(sync_result.success)
+            self.assertTrue(sync_result.fatal)
+            self.verifyErrorEvent()
 
-  def test_superproject_write_manifest_file(self):
+    def test_superproject_get_superproject_mock_init(self):
-    """Test with writing manifest to a file after setting revisionId."""
+        """Test with _Init failing."""
-    self.assertEqual(len(self._superproject._manifest.projects), 1)
+        with mock.patch.object(self._superproject, "_Init", return_value=False):
-    project = self._superproject._manifest.projects[0]
+            sync_result = self._superproject.Sync(self.git_event_log)
-    project.SetRevisionId('ABCDEF')
+            self.assertFalse(sync_result.success)
-    # Create temporary directory so that it can write the file.
+            self.assertTrue(sync_result.fatal)
-    os.mkdir(self._superproject._superproject_path)
-    manifest_path = self._superproject._WriteManifestFile()
-    self.assertIsNotNone(manifest_path)
-    with open(manifest_path, 'r') as fp:
-      manifest_xml_data = fp.read()
-    self.assertEqual(
-        sort_attributes(manifest_xml_data),
-        '<?xml version="1.0" ?><manifest>'
-        '<remote fetch="http://localhost" name="default-remote"/>'
-        '<default remote="default-remote" revision="refs/heads/main"/>'
-        '<project groups="notdefault,platform-' + self.platform + '" '
-        'name="platform/art" path="art" revision="ABCDEF" upstream="refs/heads/main"/>'
-        '<superproject name="superproject"/>'
-        '</manifest>')
 
-  def test_superproject_update_project_revision_id(self):
+    def test_superproject_get_superproject_mock_fetch(self):
-    """Test with LsTree being a mock."""
+        """Test with _Fetch failing."""
-    self.assertEqual(len(self._superproject._manifest.projects), 1)
+        with mock.patch.object(self._superproject, "_Init", return_value=True):
-    projects = self._superproject._manifest.projects
+            os.mkdir(self._superproject._superproject_path)
-    data = ('160000 commit 2c2724cb36cd5a9cec6c852c681efc3b7c6b86ea\tart\x00'
+            with mock.patch.object(
-            '160000 commit e9d25da64d8d365dbba7c8ee00fe8c4473fe9a06\tbootable/recovery\x00')
+                self._superproject, "_Fetch", return_value=False
-    with mock.patch.object(self._superproject, '_Init', return_value=True):
+            ):
-      with mock.patch.object(self._superproject, '_Fetch', return_value=True):
+                sync_result = self._superproject.Sync(self.git_event_log)
-        with mock.patch.object(self._superproject,
+                self.assertFalse(sync_result.success)
-                               '_LsTree',
+                self.assertTrue(sync_result.fatal)
-                               return_value=data):
+
-          # Create temporary directory so that it can write the file.
+    def test_superproject_get_all_project_commit_ids_mock_ls_tree(self):
-          os.mkdir(self._superproject._superproject_path)
+        """Test with LsTree being a mock."""
-          update_result = self._superproject.UpdateProjectsRevisionId(projects, self.git_event_log)
+        data = (
-          self.assertIsNotNone(update_result.manifest_path)
+            "120000 blob 158258bdf146f159218e2b90f8b699c4d85b5804\tAndroid.bp\x00"
-          self.assertFalse(update_result.fatal)
+            "160000 commit 2c2724cb36cd5a9cec6c852c681efc3b7c6b86ea\tart\x00"
-          with open(update_result.manifest_path, 'r') as fp:
+            "160000 commit e9d25da64d8d365dbba7c8ee00fe8c4473fe9a06\tbootable/recovery\x00"
+            "120000 blob acc2cbdf438f9d2141f0ae424cec1d8fc4b5d97f\tbootstrap.bash\x00"
+            "160000 commit ade9b7a0d874e25fff4bf2552488825c6f111928\tbuild/bazel\x00"
+        )
+        with mock.patch.object(self._superproject, "_Init", return_value=True):
+            with mock.patch.object(
+                self._superproject, "_Fetch", return_value=True
+            ):
+                with mock.patch.object(
+                    self._superproject, "_LsTree", return_value=data
+                ):
+                    commit_ids_result = (
+                        self._superproject._GetAllProjectsCommitIds()
+                    )
+                    self.assertEqual(
+                        commit_ids_result.commit_ids,
+                        {
+                            "art": "2c2724cb36cd5a9cec6c852c681efc3b7c6b86ea",
+                            "bootable/recovery": "e9d25da64d8d365dbba7c8ee00fe8c4473fe9a06",
+                            "build/bazel": "ade9b7a0d874e25fff4bf2552488825c6f111928",
+                        },
+                    )
+                    self.assertFalse(commit_ids_result.fatal)
+
+    def test_superproject_write_manifest_file(self):
+        """Test with writing manifest to a file after setting revisionId."""
+        self.assertEqual(len(self._superproject._manifest.projects), 1)
+        project = self._superproject._manifest.projects[0]
+        project.SetRevisionId("ABCDEF")
+        # Create temporary directory so that it can write the file.
+        os.mkdir(self._superproject._superproject_path)
+        manifest_path = self._superproject._WriteManifestFile()
+        self.assertIsNotNone(manifest_path)
+        with open(manifest_path, "r") as fp:
             manifest_xml_data = fp.read()
-          self.assertEqual(
+        self.assertEqual(
-              sort_attributes(manifest_xml_data),
+            sort_attributes(manifest_xml_data),
-              '<?xml version="1.0" ?><manifest>'
+            '<?xml version="1.0" ?><manifest>'
-              '<remote fetch="http://localhost" name="default-remote"/>'
+            '<remote fetch="http://localhost" name="default-remote"/>'
-              '<default remote="default-remote" revision="refs/heads/main"/>'
+            '<default remote="default-remote" revision="refs/heads/main"/>'
-              '<project groups="notdefault,platform-' + self.platform + '" '
+            '<project groups="notdefault,platform-' + self.platform + '" '
-              'name="platform/art" path="art" '
+            'name="platform/art" path="art" revision="ABCDEF" upstream="refs/heads/main"/>'
-              'revision="2c2724cb36cd5a9cec6c852c681efc3b7c6b86ea" upstream="refs/heads/main"/>'
+            '<superproject name="superproject"/>'
-              '<superproject name="superproject"/>'
+            "</manifest>",
-              '</manifest>')
+        )
 
-  def test_superproject_update_project_revision_id_no_superproject_tag(self):
+    def test_superproject_update_project_revision_id(self):
-    """Test update of commit ids of a manifest without superproject tag."""
+        """Test with LsTree being a mock."""
-    manifest = self.getXmlManifest("""
+        self.assertEqual(len(self._superproject._manifest.projects), 1)
+        projects = self._superproject._manifest.projects
+        data = (
+            "160000 commit 2c2724cb36cd5a9cec6c852c681efc3b7c6b86ea\tart\x00"
+            "160000 commit e9d25da64d8d365dbba7c8ee00fe8c4473fe9a06\tbootable/recovery\x00"
+        )
+        with mock.patch.object(self._superproject, "_Init", return_value=True):
+            with mock.patch.object(
+                self._superproject, "_Fetch", return_value=True
+            ):
+                with mock.patch.object(
+                    self._superproject, "_LsTree", return_value=data
+                ):
+                    # Create temporary directory so that it can write the file.
+                    os.mkdir(self._superproject._superproject_path)
+                    update_result = self._superproject.UpdateProjectsRevisionId(
+                        projects, self.git_event_log
+                    )
+                    self.assertIsNotNone(update_result.manifest_path)
+                    self.assertFalse(update_result.fatal)
+                    with open(update_result.manifest_path, "r") as fp:
+                        manifest_xml_data = fp.read()
+                    self.assertEqual(
+                        sort_attributes(manifest_xml_data),
+                        '<?xml version="1.0" ?><manifest>'
+                        '<remote fetch="http://localhost" name="default-remote"/>'
+                        '<default remote="default-remote" revision="refs/heads/main"/>'
+                        '<project groups="notdefault,platform-'
+                        + self.platform
+                        + '" '
+                        'name="platform/art" path="art" '
+                        'revision="2c2724cb36cd5a9cec6c852c681efc3b7c6b86ea" upstream="refs/heads/main"/>'
+                        '<superproject name="superproject"/>'
+                        "</manifest>",
+                    )
+
+    def test_superproject_update_project_revision_id_no_superproject_tag(self):
+        """Test update of commit ids of a manifest without superproject tag."""
+        manifest = self.getXmlManifest(
+            """
 <manifest>
   <remote name="default-remote" fetch="http://localhost" />
   <default remote="default-remote" revision="refs/heads/main" />
   <project name="test-name"/>
 </manifest>
-""")
+"""
-    self.maxDiff = None
+        )
-    self.assertIsNone(manifest.superproject)
+        self.maxDiff = None
-    self.assertEqual(
+        self.assertIsNone(manifest.superproject)
-        sort_attributes(manifest.ToXml().toxml()),
+        self.assertEqual(
-        '<?xml version="1.0" ?><manifest>'
+            sort_attributes(manifest.ToXml().toxml()),
-        '<remote fetch="http://localhost" name="default-remote"/>'
+            '<?xml version="1.0" ?><manifest>'
-        '<default remote="default-remote" revision="refs/heads/main"/>'
+            '<remote fetch="http://localhost" name="default-remote"/>'
-        '<project name="test-name"/>'
+            '<default remote="default-remote" revision="refs/heads/main"/>'
-        '</manifest>')
+            '<project name="test-name"/>'
+            "</manifest>",
+        )
 
-  def test_superproject_update_project_revision_id_from_local_manifest_group(self):
+    def test_superproject_update_project_revision_id_from_local_manifest_group(
-    """Test update of commit ids of a manifest that have local manifest no superproject group."""
+        self,
-    local_group = manifest_xml.LOCAL_MANIFEST_GROUP_PREFIX + ':local'
+    ):
-    manifest = self.getXmlManifest("""
+        """Test update of commit ids of a manifest that have local manifest no superproject group."""
+        local_group = manifest_xml.LOCAL_MANIFEST_GROUP_PREFIX + ":local"
+        manifest = self.getXmlManifest(
+            """
 <manifest>
   <remote name="default-remote" fetch="http://localhost" />
   <remote name="goog" fetch="http://localhost2" />
   <default remote="default-remote" revision="refs/heads/main" />
   <superproject name="superproject"/>
   <project path="vendor/x" name="platform/vendor/x" remote="goog"
-           groups=\"""" + local_group + """
+           groups=\""""
+            + local_group
+            + """
          " revision="master-with-vendor" clone-depth="1" />
-  <project path="art" name="platform/art" groups="notdefault,platform-""" + self.platform + """
+  <project path="art" name="platform/art" groups="notdefault,platform-"""
+            + self.platform
+            + """
   " /></manifest>
-""")
+"""
-    self.maxDiff = None
+        )
-    self._superproject = git_superproject.Superproject(
+        self.maxDiff = None
-        manifest, name='superproject',
+        self._superproject = git_superproject.Superproject(
-        remote=manifest.remotes.get('default-remote').ToRemoteSpec('superproject'),
+            manifest,
-        revision='refs/heads/main')
+            name="superproject",
-    self.assertEqual(len(self._superproject._manifest.projects), 2)
+            remote=manifest.remotes.get("default-remote").ToRemoteSpec(
-    projects = self._superproject._manifest.projects
+                "superproject"
-    data = ('160000 commit 2c2724cb36cd5a9cec6c852c681efc3b7c6b86ea\tart\x00')
+            ),
-    with mock.patch.object(self._superproject, '_Init', return_value=True):
+            revision="refs/heads/main",
-      with mock.patch.object(self._superproject, '_Fetch', return_value=True):
+        )
-        with mock.patch.object(self._superproject,
+        self.assertEqual(len(self._superproject._manifest.projects), 2)
-                               '_LsTree',
+        projects = self._superproject._manifest.projects
-                               return_value=data):
+        data = "160000 commit 2c2724cb36cd5a9cec6c852c681efc3b7c6b86ea\tart\x00"
-          # Create temporary directory so that it can write the file.
+        with mock.patch.object(self._superproject, "_Init", return_value=True):
-          os.mkdir(self._superproject._superproject_path)
+            with mock.patch.object(
-          update_result = self._superproject.UpdateProjectsRevisionId(projects, self.git_event_log)
+                self._superproject, "_Fetch", return_value=True
-          self.assertIsNotNone(update_result.manifest_path)
+            ):
-          self.assertFalse(update_result.fatal)
+                with mock.patch.object(
-          with open(update_result.manifest_path, 'r') as fp:
+                    self._superproject, "_LsTree", return_value=data
-            manifest_xml_data = fp.read()
+                ):
-          # Verify platform/vendor/x's project revision hasn't changed.
+                    # Create temporary directory so that it can write the file.
-          self.assertEqual(
+                    os.mkdir(self._superproject._superproject_path)
-              sort_attributes(manifest_xml_data),
+                    update_result = self._superproject.UpdateProjectsRevisionId(
-              '<?xml version="1.0" ?><manifest>'
+                        projects, self.git_event_log
-              '<remote fetch="http://localhost" name="default-remote"/>'
+                    )
-              '<remote fetch="http://localhost2" name="goog"/>'
+                    self.assertIsNotNone(update_result.manifest_path)
-              '<default remote="default-remote" revision="refs/heads/main"/>'
+                    self.assertFalse(update_result.fatal)
-              '<project groups="notdefault,platform-' + self.platform + '" '
+                    with open(update_result.manifest_path, "r") as fp:
-              'name="platform/art" path="art" '
+                        manifest_xml_data = fp.read()
-              'revision="2c2724cb36cd5a9cec6c852c681efc3b7c6b86ea" upstream="refs/heads/main"/>'
+                    # Verify platform/vendor/x's project revision hasn't
-              '<superproject name="superproject"/>'
+                    # changed.
-              '</manifest>')
+                    self.assertEqual(
+                        sort_attributes(manifest_xml_data),
+                        '<?xml version="1.0" ?><manifest>'
+                        '<remote fetch="http://localhost" name="default-remote"/>'
+                        '<remote fetch="http://localhost2" name="goog"/>'
+                        '<default remote="default-remote" revision="refs/heads/main"/>'
+                        '<project groups="notdefault,platform-'
+                        + self.platform
+                        + '" '
+                        'name="platform/art" path="art" '
+                        'revision="2c2724cb36cd5a9cec6c852c681efc3b7c6b86ea" upstream="refs/heads/main"/>'
+                        '<superproject name="superproject"/>'
+                        "</manifest>",
+                    )
 
-  def test_superproject_update_project_revision_id_with_pinned_manifest(self):
+    def test_superproject_update_project_revision_id_with_pinned_manifest(self):
-    """Test update of commit ids of a pinned manifest."""
+        """Test update of commit ids of a pinned manifest."""
-    manifest = self.getXmlManifest("""
+        manifest = self.getXmlManifest(
+            """
 <manifest>
   <remote name="default-remote" fetch="http://localhost" />
   <default remote="default-remote" revision="refs/heads/main" />
@@ -325,46 +401,136 @@ class SuperprojectTestCase(unittest.TestCase):
   <project path="vendor/x" name="platform/vendor/x" revision="" />
   <project path="vendor/y" name="platform/vendor/y"
            revision="52d3c9f7c107839ece2319d077de0cd922aa9d8f" />
-  <project path="art" name="platform/art" groups="notdefault,platform-""" + self.platform + """
+  <project path="art" name="platform/art" groups="notdefault,platform-"""
+            + self.platform
+            + """
   " /></manifest>
-""")
+"""
-    self.maxDiff = None
+        )
-    self._superproject = git_superproject.Superproject(
+        self.maxDiff = None
-        manifest, name='superproject',
+        self._superproject = git_superproject.Superproject(
-        remote=manifest.remotes.get('default-remote').ToRemoteSpec('superproject'),
+            manifest,
-        revision='refs/heads/main')
+            name="superproject",
-    self.assertEqual(len(self._superproject._manifest.projects), 3)
+            remote=manifest.remotes.get("default-remote").ToRemoteSpec(
-    projects = self._superproject._manifest.projects
+                "superproject"
-    data = ('160000 commit 2c2724cb36cd5a9cec6c852c681efc3b7c6b86ea\tart\x00'
+            ),
-            '160000 commit e9d25da64d8d365dbba7c8ee00fe8c4473fe9a06\tvendor/x\x00')
+            revision="refs/heads/main",
-    with mock.patch.object(self._superproject, '_Init', return_value=True):
+        )
-      with mock.patch.object(self._superproject, '_Fetch', return_value=True):
+        self.assertEqual(len(self._superproject._manifest.projects), 3)
-        with mock.patch.object(self._superproject,
+        projects = self._superproject._manifest.projects
-                               '_LsTree',
+        data = (
-                               return_value=data):
+            "160000 commit 2c2724cb36cd5a9cec6c852c681efc3b7c6b86ea\tart\x00"
-          # Create temporary directory so that it can write the file.
+            "160000 commit e9d25da64d8d365dbba7c8ee00fe8c4473fe9a06\tvendor/x\x00"
-          os.mkdir(self._superproject._superproject_path)
+        )
-          update_result = self._superproject.UpdateProjectsRevisionId(projects, self.git_event_log)
+        with mock.patch.object(self._superproject, "_Init", return_value=True):
-          self.assertIsNotNone(update_result.manifest_path)
+            with mock.patch.object(
-          self.assertFalse(update_result.fatal)
+                self._superproject, "_Fetch", return_value=True
-          with open(update_result.manifest_path, 'r') as fp:
+            ):
-            manifest_xml_data = fp.read()
+                with mock.patch.object(
-          # Verify platform/vendor/x's project revision hasn't changed.
+                    self._superproject, "_LsTree", return_value=data
-          self.assertEqual(
+                ):
-              sort_attributes(manifest_xml_data),
+                    # Create temporary directory so that it can write the file.
-              '<?xml version="1.0" ?><manifest>'
+                    os.mkdir(self._superproject._superproject_path)
-              '<remote fetch="http://localhost" name="default-remote"/>'
+                    update_result = self._superproject.UpdateProjectsRevisionId(
-              '<default remote="default-remote" revision="refs/heads/main"/>'
+                        projects, self.git_event_log
-              '<project groups="notdefault,platform-' + self.platform + '" '
+                    )
-              'name="platform/art" path="art" '
+                    self.assertIsNotNone(update_result.manifest_path)
-              'revision="2c2724cb36cd5a9cec6c852c681efc3b7c6b86ea" upstream="refs/heads/main"/>'
+                    self.assertFalse(update_result.fatal)
-              '<project name="platform/vendor/x" path="vendor/x" '
+                    with open(update_result.manifest_path, "r") as fp:
-              'revision="e9d25da64d8d365dbba7c8ee00fe8c4473fe9a06" upstream="refs/heads/main"/>'
+                        manifest_xml_data = fp.read()
-              '<project name="platform/vendor/y" path="vendor/y" '
+                    # Verify platform/vendor/x's project revision hasn't
-              'revision="52d3c9f7c107839ece2319d077de0cd922aa9d8f"/>'
+                    # changed.
-              '<superproject name="superproject"/>'
+                    self.assertEqual(
-              '</manifest>')
+                        sort_attributes(manifest_xml_data),
+                        '<?xml version="1.0" ?><manifest>'
+                        '<remote fetch="http://localhost" name="default-remote"/>'
+                        '<default remote="default-remote" revision="refs/heads/main"/>'
+                        '<project groups="notdefault,platform-'
+                        + self.platform
+                        + '" '
+                        'name="platform/art" path="art" '
+                        'revision="2c2724cb36cd5a9cec6c852c681efc3b7c6b86ea" upstream="refs/heads/main"/>'
+                        '<project name="platform/vendor/x" path="vendor/x" '
+                        'revision="e9d25da64d8d365dbba7c8ee00fe8c4473fe9a06" upstream="refs/heads/main"/>'
+                        '<project name="platform/vendor/y" path="vendor/y" '
+                        'revision="52d3c9f7c107839ece2319d077de0cd922aa9d8f"/>'
+                        '<superproject name="superproject"/>'
+                        "</manifest>",
+                    )
 
+    def test_Fetch(self):
+        manifest = self.getXmlManifest(
+            """
+<manifest>
+  <remote name="default-remote" fetch="http://localhost" />
+  <default remote="default-remote" revision="refs/heads/main" />
+  <superproject name="superproject"/>
+  " /></manifest>
+"""
+        )
+        self.maxDiff = None
+        self._superproject = git_superproject.Superproject(
+            manifest,
+            name="superproject",
+            remote=manifest.remotes.get("default-remote").ToRemoteSpec(
+                "superproject"
+            ),
+            revision="refs/heads/main",
+        )
+        os.mkdir(self._superproject._superproject_path)
+        os.mkdir(self._superproject._work_git)
+        with mock.patch.object(self._superproject, "_Init", return_value=True):
+            with mock.patch(
+                "git_superproject.GitCommand", autospec=True
+            ) as mock_git_command:
+                with mock.patch(
+                    "git_superproject.GitRefs.get", autospec=True
+                ) as mock_git_refs:
+                    instance = mock_git_command.return_value
+                    instance.Wait.return_value = 0
+                    mock_git_refs.side_effect = ["", "1234"]
 
-if __name__ == '__main__':
+                    self.assertTrue(self._superproject._Fetch())
-  unittest.main()
+                    self.assertEqual(
+                        # TODO: Once we require Python 3.8+,
+                        #  use 'mock_git_command.call_args.args'.
+                        mock_git_command.call_args[0],
+                        (
+                            None,
+                            [
+                                "fetch",
+                                "http://localhost/superproject",
+                                "--depth",
+                                "1",
+                                "--force",
+                                "--no-tags",
+                                "--filter",
+                                "blob:none",
+                                "refs/heads/main:refs/heads/main",
+                            ],
+                        ),
+                    )
+
+                    # If branch for revision exists, set as --negotiation-tip.
+                    self.assertTrue(self._superproject._Fetch())
+                    self.assertEqual(
+                        # TODO: Once we require Python 3.8+,
+                        #  use 'mock_git_command.call_args.args'.
+                        mock_git_command.call_args[0],
+                        (
+                            None,
+                            [
+                                "fetch",
+                                "http://localhost/superproject",
+                                "--depth",
+                                "1",
+                                "--force",
+                                "--no-tags",
+                                "--filter",
+                                "blob:none",
+                                "--negotiation-tip",
+                                "1234",
+                                "refs/heads/main:refs/heads/main",
+                            ],
+                        ),
+                    )

tests/test_git_trace2_event_log.py

@@ -27,365 +27,384 @@ import platform_utils
 
 
 def serverLoggingThread(socket_path, server_ready, received_traces):
-  """Helper function to receive logs over a Unix domain socket.
+    """Helper function to receive logs over a Unix domain socket.
 
-  Appends received messages on the provided socket and appends to received_traces.
+    Appends received messages on the provided socket and appends to
+    received_traces.
 
-  Args:
+    Args:
-    socket_path: path to a Unix domain socket on which to listen for traces
+        socket_path: path to a Unix domain socket on which to listen for traces
-    server_ready: a threading.Condition used to signal to the caller that this thread is ready to
+        server_ready: a threading.Condition used to signal to the caller that
-        accept connections
+            this thread is ready to accept connections
-    received_traces: a list to which received traces will be appended (after decoding to a utf-8
+        received_traces: a list to which received traces will be appended (after
-        string).
+            decoding to a utf-8 string).
-  """
+    """
-  platform_utils.remove(socket_path, missing_ok=True)
+    platform_utils.remove(socket_path, missing_ok=True)
-  data = b''
+    data = b""
-  with socket.socket(socket.AF_UNIX, socket.SOCK_STREAM) as sock:
+    with socket.socket(socket.AF_UNIX, socket.SOCK_STREAM) as sock:
-    sock.bind(socket_path)
+        sock.bind(socket_path)
-    sock.listen(0)
+        sock.listen(0)
-    with server_ready:
+        with server_ready:
-      server_ready.notify()
+            server_ready.notify()
-    with sock.accept()[0] as conn:
+        with sock.accept()[0] as conn:
-      while True:
+            while True:
-        recved = conn.recv(4096)
+                recved = conn.recv(4096)
-        if not recved:
+                if not recved:
-          break
+                    break
-        data += recved
+                data += recved
-  received_traces.extend(data.decode('utf-8').splitlines())
+    received_traces.extend(data.decode("utf-8").splitlines())
 
 
 class EventLogTestCase(unittest.TestCase):
-  """TestCase for the EventLog module."""
+    """TestCase for the EventLog module."""
 
-  PARENT_SID_KEY = 'GIT_TRACE2_PARENT_SID'
+    PARENT_SID_KEY = "GIT_TRACE2_PARENT_SID"
-  PARENT_SID_VALUE = 'parent_sid'
+    PARENT_SID_VALUE = "parent_sid"
-  SELF_SID_REGEX = r'repo-\d+T\d+Z-.*'
+    SELF_SID_REGEX = r"repo-\d+T\d+Z-.*"
-  FULL_SID_REGEX = r'^%s/%s' % (PARENT_SID_VALUE, SELF_SID_REGEX)
+    FULL_SID_REGEX = r"^%s/%s" % (PARENT_SID_VALUE, SELF_SID_REGEX)
 
-  def setUp(self):
+    def setUp(self):
-    """Load the event_log module every time."""
+        """Load the event_log module every time."""
-    self._event_log_module = None
+        self._event_log_module = None
-    # By default we initialize with the expected case where
+        # By default we initialize with the expected case where
-    # repo launches us (so GIT_TRACE2_PARENT_SID is set).
+        # repo launches us (so GIT_TRACE2_PARENT_SID is set).
-    env = {
+        env = {
-        self.PARENT_SID_KEY: self.PARENT_SID_VALUE,
+            self.PARENT_SID_KEY: self.PARENT_SID_VALUE,
-    }
+        }
-    self._event_log_module = git_trace2_event_log.EventLog(env=env)
+        self._event_log_module = git_trace2_event_log.EventLog(env=env)
-    self._log_data = None
+        self._log_data = None
 
-  def verifyCommonKeys(self, log_entry, expected_event_name=None, full_sid=True):
+    def verifyCommonKeys(
-    """Helper function to verify common event log keys."""
+        self, log_entry, expected_event_name=None, full_sid=True
-    self.assertIn('event', log_entry)
+    ):
-    self.assertIn('sid', log_entry)
+        """Helper function to verify common event log keys."""
-    self.assertIn('thread', log_entry)
+        self.assertIn("event", log_entry)
-    self.assertIn('time', log_entry)
+        self.assertIn("sid", log_entry)
+        self.assertIn("thread", log_entry)
+        self.assertIn("time", log_entry)
 
-    # Do basic data format validation.
+        # Do basic data format validation.
-    if expected_event_name:
+        if expected_event_name:
-      self.assertEqual(expected_event_name, log_entry['event'])
+            self.assertEqual(expected_event_name, log_entry["event"])
-    if full_sid:
+        if full_sid:
-      self.assertRegex(log_entry['sid'], self.FULL_SID_REGEX)
+            self.assertRegex(log_entry["sid"], self.FULL_SID_REGEX)
-    else:
+        else:
-      self.assertRegex(log_entry['sid'], self.SELF_SID_REGEX)
+            self.assertRegex(log_entry["sid"], self.SELF_SID_REGEX)
-    self.assertRegex(log_entry['time'], r'^\d+-\d+-\d+T\d+:\d+:\d+\.\d+Z$')
+        self.assertRegex(
+            log_entry["time"], r"^\d+-\d+-\d+T\d+:\d+:\d+\.\d+\+00:00$"
+        )
 
-  def readLog(self, log_path):
+    def readLog(self, log_path):
-    """Helper function to read log data into a list."""
+        """Helper function to read log data into a list."""
-    log_data = []
+        log_data = []
-    with open(log_path, mode='rb') as f:
+        with open(log_path, mode="rb") as f:
-      for line in f:
+            for line in f:
-        log_data.append(json.loads(line))
+                log_data.append(json.loads(line))
-    return log_data
+        return log_data
 
-  def remove_prefix(self, s, prefix):
+    def remove_prefix(self, s, prefix):
-    """Return a copy string after removing |prefix| from |s|, if present or the original string."""
+        """Return a copy string after removing |prefix| from |s|, if present or
-    if s.startswith(prefix):
+        the original string."""
-        return s[len(prefix):]
+        if s.startswith(prefix):
-    else:
+            return s[len(prefix) :]
-        return s
+        else:
+            return s
 
-  def test_initial_state_with_parent_sid(self):
+    def test_initial_state_with_parent_sid(self):
-    """Test initial state when 'GIT_TRACE2_PARENT_SID' is set by parent."""
+        """Test initial state when 'GIT_TRACE2_PARENT_SID' is set by parent."""
-    self.assertRegex(self._event_log_module.full_sid, self.FULL_SID_REGEX)
+        self.assertRegex(self._event_log_module.full_sid, self.FULL_SID_REGEX)
 
-  def test_initial_state_no_parent_sid(self):
+    def test_initial_state_no_parent_sid(self):
-    """Test initial state when 'GIT_TRACE2_PARENT_SID' is not set."""
+        """Test initial state when 'GIT_TRACE2_PARENT_SID' is not set."""
-    # Setup an empty environment dict (no parent sid).
+        # Setup an empty environment dict (no parent sid).
-    self._event_log_module = git_trace2_event_log.EventLog(env={})
+        self._event_log_module = git_trace2_event_log.EventLog(env={})
-    self.assertRegex(self._event_log_module.full_sid, self.SELF_SID_REGEX)
+        self.assertRegex(self._event_log_module.full_sid, self.SELF_SID_REGEX)
 
-  def test_version_event(self):
+    def test_version_event(self):
-    """Test 'version' event data is valid.
+        """Test 'version' event data is valid.
 
-    Verify that the 'version' event is written even when no other
+        Verify that the 'version' event is written even when no other
-    events are addded.
+        events are addded.
 
-    Expected event log:
+        Expected event log:
-    <version event>
+        <version event>
-    """
+        """
-    with tempfile.TemporaryDirectory(prefix='event_log_tests') as tempdir:
+        with tempfile.TemporaryDirectory(prefix="event_log_tests") as tempdir:
-      log_path = self._event_log_module.Write(path=tempdir)
+            log_path = self._event_log_module.Write(path=tempdir)
-      self._log_data = self.readLog(log_path)
+            self._log_data = self.readLog(log_path)
 
-    # A log with no added events should only have the version entry.
+        # A log with no added events should only have the version entry.
-    self.assertEqual(len(self._log_data), 1)
+        self.assertEqual(len(self._log_data), 1)
-    version_event = self._log_data[0]
+        version_event = self._log_data[0]
-    self.verifyCommonKeys(version_event, expected_event_name='version')
+        self.verifyCommonKeys(version_event, expected_event_name="version")
-    # Check for 'version' event specific fields.
+        # Check for 'version' event specific fields.
-    self.assertIn('evt', version_event)
+        self.assertIn("evt", version_event)
-    self.assertIn('exe', version_event)
+        self.assertIn("exe", version_event)
-    # Verify "evt" version field is a string.
+        # Verify "evt" version field is a string.
-    self.assertIsInstance(version_event['evt'], str)
+        self.assertIsInstance(version_event["evt"], str)
 
-  def test_start_event(self):
+    def test_start_event(self):
-    """Test and validate 'start' event data is valid.
+        """Test and validate 'start' event data is valid.
-
-    Expected event log:
-    <version event>
-    <start event>
-    """
-    self._event_log_module.StartEvent()
-    with tempfile.TemporaryDirectory(prefix='event_log_tests') as tempdir:
-      log_path = self._event_log_module.Write(path=tempdir)
-      self._log_data = self.readLog(log_path)
-
-    self.assertEqual(len(self._log_data), 2)
-    start_event = self._log_data[1]
-    self.verifyCommonKeys(self._log_data[0], expected_event_name='version')
-    self.verifyCommonKeys(start_event, expected_event_name='start')
-    # Check for 'start' event specific fields.
-    self.assertIn('argv', start_event)
-    self.assertTrue(isinstance(start_event['argv'], list))
-
-  def test_exit_event_result_none(self):
-    """Test 'exit' event data is valid when result is None.
-
-    We expect None result to be converted to 0 in the exit event data.
-
-    Expected event log:
-    <version event>
-    <exit event>
-    """
-    self._event_log_module.ExitEvent(None)
-    with tempfile.TemporaryDirectory(prefix='event_log_tests') as tempdir:
-      log_path = self._event_log_module.Write(path=tempdir)
-      self._log_data = self.readLog(log_path)
-
-    self.assertEqual(len(self._log_data), 2)
-    exit_event = self._log_data[1]
-    self.verifyCommonKeys(self._log_data[0], expected_event_name='version')
-    self.verifyCommonKeys(exit_event, expected_event_name='exit')
-    # Check for 'exit' event specific fields.
-    self.assertIn('code', exit_event)
-    # 'None' result should convert to 0 (successful) return code.
-    self.assertEqual(exit_event['code'], 0)
-
-  def test_exit_event_result_integer(self):
-    """Test 'exit' event data is valid when result is an integer.
-
-    Expected event log:
-    <version event>
-    <exit event>
-    """
-    self._event_log_module.ExitEvent(2)
-    with tempfile.TemporaryDirectory(prefix='event_log_tests') as tempdir:
-      log_path = self._event_log_module.Write(path=tempdir)
-      self._log_data = self.readLog(log_path)
-
-    self.assertEqual(len(self._log_data), 2)
-    exit_event = self._log_data[1]
-    self.verifyCommonKeys(self._log_data[0], expected_event_name='version')
-    self.verifyCommonKeys(exit_event, expected_event_name='exit')
-    # Check for 'exit' event specific fields.
-    self.assertIn('code', exit_event)
-    self.assertEqual(exit_event['code'], 2)
-
-  def test_command_event(self):
-    """Test and validate 'command' event data is valid.
-
-    Expected event log:
-    <version event>
-    <command event>
-    """
-    name = 'repo'
-    subcommands = ['init' 'this']
-    self._event_log_module.CommandEvent(name='repo', subcommands=subcommands)
-    with tempfile.TemporaryDirectory(prefix='event_log_tests') as tempdir:
-      log_path = self._event_log_module.Write(path=tempdir)
-      self._log_data = self.readLog(log_path)
-
-    self.assertEqual(len(self._log_data), 2)
-    command_event = self._log_data[1]
-    self.verifyCommonKeys(self._log_data[0], expected_event_name='version')
-    self.verifyCommonKeys(command_event, expected_event_name='command')
-    # Check for 'command' event specific fields.
-    self.assertIn('name', command_event)
-    self.assertIn('subcommands', command_event)
-    self.assertEqual(command_event['name'], name)
-    self.assertEqual(command_event['subcommands'], subcommands)
-
-  def test_def_params_event_repo_config(self):
-    """Test 'def_params' event data outputs only repo config keys.
-
-    Expected event log:
-    <version event>
-    <def_param event>
-    <def_param event>
-    """
-    config = {
-        'git.foo': 'bar',
-        'repo.partialclone': 'true',
-        'repo.partialclonefilter': 'blob:none',
-    }
-    self._event_log_module.DefParamRepoEvents(config)
-
-    with tempfile.TemporaryDirectory(prefix='event_log_tests') as tempdir:
-      log_path = self._event_log_module.Write(path=tempdir)
-      self._log_data = self.readLog(log_path)
-
-    self.assertEqual(len(self._log_data), 3)
-    def_param_events = self._log_data[1:]
-    self.verifyCommonKeys(self._log_data[0], expected_event_name='version')
-
-    for event in def_param_events:
-      self.verifyCommonKeys(event, expected_event_name='def_param')
-      # Check for 'def_param' event specific fields.
-      self.assertIn('param', event)
-      self.assertIn('value', event)
-      self.assertTrue(event['param'].startswith('repo.'))
-
-  def test_def_params_event_no_repo_config(self):
-    """Test 'def_params' event data won't output non-repo config keys.
-
-    Expected event log:
-    <version event>
-    """
-    config = {
-        'git.foo': 'bar',
-        'git.core.foo2': 'baz',
-    }
-    self._event_log_module.DefParamRepoEvents(config)
-
-    with tempfile.TemporaryDirectory(prefix='event_log_tests') as tempdir:
-      log_path = self._event_log_module.Write(path=tempdir)
-      self._log_data = self.readLog(log_path)
-
-    self.assertEqual(len(self._log_data), 1)
-    self.verifyCommonKeys(self._log_data[0], expected_event_name='version')
-
-  def test_data_event_config(self):
-    """Test 'data' event data outputs all config keys.
-
-    Expected event log:
-    <version event>
-    <data event>
-    <data event>
-    """
-    config = {
-        'git.foo': 'bar',
-        'repo.partialclone': 'false',
-        'repo.syncstate.superproject.hassuperprojecttag': 'true',
-        'repo.syncstate.superproject.sys.argv': ['--', 'sync', 'protobuf'],
-    }
-    prefix_value = 'prefix'
-    self._event_log_module.LogDataConfigEvents(config, prefix_value)
-
-    with tempfile.TemporaryDirectory(prefix='event_log_tests') as tempdir:
-      log_path = self._event_log_module.Write(path=tempdir)
-      self._log_data = self.readLog(log_path)
-
-    self.assertEqual(len(self._log_data), 5)
-    data_events = self._log_data[1:]
-    self.verifyCommonKeys(self._log_data[0], expected_event_name='version')
-
-    for event in data_events:
-      self.verifyCommonKeys(event)
-      # Check for 'data' event specific fields.
-      self.assertIn('key', event)
-      self.assertIn('value', event)
-      key = event['key']
-      key = self.remove_prefix(key, f'{prefix_value}/')
-      value = event['value']
-      self.assertEqual(self._event_log_module.GetDataEventName(value), event['event'])
-      self.assertTrue(key in config and value == config[key])
-
-  def test_error_event(self):
-    """Test and validate 'error' event data is valid.
-
-    Expected event log:
-    <version event>
-    <error event>
-    """
-    msg = 'invalid option: --cahced'
-    fmt = 'invalid option: %s'
-    self._event_log_module.ErrorEvent(msg, fmt)
-    with tempfile.TemporaryDirectory(prefix='event_log_tests') as tempdir:
-      log_path = self._event_log_module.Write(path=tempdir)
-      self._log_data = self.readLog(log_path)
-
-    self.assertEqual(len(self._log_data), 2)
-    error_event = self._log_data[1]
-    self.verifyCommonKeys(self._log_data[0], expected_event_name='version')
-    self.verifyCommonKeys(error_event, expected_event_name='error')
-    # Check for 'error' event specific fields.
-    self.assertIn('msg', error_event)
-    self.assertIn('fmt', error_event)
-    self.assertEqual(error_event['msg'], msg)
-    self.assertEqual(error_event['fmt'], fmt)
-
-  def test_write_with_filename(self):
-    """Test Write() with a path to a file exits with None."""
-    self.assertIsNone(self._event_log_module.Write(path='path/to/file'))
-
-  def test_write_with_git_config(self):
-    """Test Write() uses the git config path when 'git config' call succeeds."""
-    with tempfile.TemporaryDirectory(prefix='event_log_tests') as tempdir:
-      with mock.patch.object(self._event_log_module,
-                             '_GetEventTargetPath', return_value=tempdir):
-        self.assertEqual(os.path.dirname(self._event_log_module.Write()), tempdir)
-
-  def test_write_no_git_config(self):
-    """Test Write() with no git config variable present exits with None."""
-    with mock.patch.object(self._event_log_module,
-                           '_GetEventTargetPath', return_value=None):
-      self.assertIsNone(self._event_log_module.Write())
-
-  def test_write_non_string(self):
-    """Test Write() with non-string type for |path| throws TypeError."""
-    with self.assertRaises(TypeError):
-      self._event_log_module.Write(path=1234)
-
-  def test_write_socket(self):
-    """Test Write() with Unix domain socket for |path| and validate received traces."""
-    received_traces = []
-    with tempfile.TemporaryDirectory(prefix='test_server_sockets') as tempdir:
-      socket_path = os.path.join(tempdir, "server.sock")
-      server_ready = threading.Condition()
-      # Start "server" listening on Unix domain socket at socket_path.
-      try:
-        server_thread = threading.Thread(
-            target=serverLoggingThread,
-            args=(socket_path, server_ready, received_traces))
-        server_thread.start()
-
-        with server_ready:
-          server_ready.wait()
 
+        Expected event log:
+        <version event>
+        <start event>
+        """
         self._event_log_module.StartEvent()
-        path = self._event_log_module.Write(path=f'af_unix:{socket_path}')
+        with tempfile.TemporaryDirectory(prefix="event_log_tests") as tempdir:
-      finally:
+            log_path = self._event_log_module.Write(path=tempdir)
-        server_thread.join(timeout=5)
+            self._log_data = self.readLog(log_path)
 
-    self.assertEqual(path, f'af_unix:stream:{socket_path}')
+        self.assertEqual(len(self._log_data), 2)
-    self.assertEqual(len(received_traces), 2)
+        start_event = self._log_data[1]
-    version_event = json.loads(received_traces[0])
+        self.verifyCommonKeys(self._log_data[0], expected_event_name="version")
-    start_event = json.loads(received_traces[1])
+        self.verifyCommonKeys(start_event, expected_event_name="start")
-    self.verifyCommonKeys(version_event, expected_event_name='version')
+        # Check for 'start' event specific fields.
-    self.verifyCommonKeys(start_event, expected_event_name='start')
+        self.assertIn("argv", start_event)
-    # Check for 'start' event specific fields.
+        self.assertTrue(isinstance(start_event["argv"], list))
-    self.assertIn('argv', start_event)
-    self.assertIsInstance(start_event['argv'], list)
 
+    def test_exit_event_result_none(self):
+        """Test 'exit' event data is valid when result is None.
 
-if __name__ == '__main__':
+        We expect None result to be converted to 0 in the exit event data.
-  unittest.main()
+
+        Expected event log:
+        <version event>
+        <exit event>
+        """
+        self._event_log_module.ExitEvent(None)
+        with tempfile.TemporaryDirectory(prefix="event_log_tests") as tempdir:
+            log_path = self._event_log_module.Write(path=tempdir)
+            self._log_data = self.readLog(log_path)
+
+        self.assertEqual(len(self._log_data), 2)
+        exit_event = self._log_data[1]
+        self.verifyCommonKeys(self._log_data[0], expected_event_name="version")
+        self.verifyCommonKeys(exit_event, expected_event_name="exit")
+        # Check for 'exit' event specific fields.
+        self.assertIn("code", exit_event)
+        # 'None' result should convert to 0 (successful) return code.
+        self.assertEqual(exit_event["code"], 0)
+
+    def test_exit_event_result_integer(self):
+        """Test 'exit' event data is valid when result is an integer.
+
+        Expected event log:
+        <version event>
+        <exit event>
+        """
+        self._event_log_module.ExitEvent(2)
+        with tempfile.TemporaryDirectory(prefix="event_log_tests") as tempdir:
+            log_path = self._event_log_module.Write(path=tempdir)
+            self._log_data = self.readLog(log_path)
+
+        self.assertEqual(len(self._log_data), 2)
+        exit_event = self._log_data[1]
+        self.verifyCommonKeys(self._log_data[0], expected_event_name="version")
+        self.verifyCommonKeys(exit_event, expected_event_name="exit")
+        # Check for 'exit' event specific fields.
+        self.assertIn("code", exit_event)
+        self.assertEqual(exit_event["code"], 2)
+
+    def test_command_event(self):
+        """Test and validate 'command' event data is valid.
+
+        Expected event log:
+        <version event>
+        <command event>
+        """
+        name = "repo"
+        subcommands = ["init" "this"]
+        self._event_log_module.CommandEvent(
+            name="repo", subcommands=subcommands
+        )
+        with tempfile.TemporaryDirectory(prefix="event_log_tests") as tempdir:
+            log_path = self._event_log_module.Write(path=tempdir)
+            self._log_data = self.readLog(log_path)
+
+        self.assertEqual(len(self._log_data), 2)
+        command_event = self._log_data[1]
+        self.verifyCommonKeys(self._log_data[0], expected_event_name="version")
+        self.verifyCommonKeys(command_event, expected_event_name="command")
+        # Check for 'command' event specific fields.
+        self.assertIn("name", command_event)
+        self.assertIn("subcommands", command_event)
+        self.assertEqual(command_event["name"], name)
+        self.assertEqual(command_event["subcommands"], subcommands)
+
+    def test_def_params_event_repo_config(self):
+        """Test 'def_params' event data outputs only repo config keys.
+
+        Expected event log:
+        <version event>
+        <def_param event>
+        <def_param event>
+        """
+        config = {
+            "git.foo": "bar",
+            "repo.partialclone": "true",
+            "repo.partialclonefilter": "blob:none",
+        }
+        self._event_log_module.DefParamRepoEvents(config)
+
+        with tempfile.TemporaryDirectory(prefix="event_log_tests") as tempdir:
+            log_path = self._event_log_module.Write(path=tempdir)
+            self._log_data = self.readLog(log_path)
+
+        self.assertEqual(len(self._log_data), 3)
+        def_param_events = self._log_data[1:]
+        self.verifyCommonKeys(self._log_data[0], expected_event_name="version")
+
+        for event in def_param_events:
+            self.verifyCommonKeys(event, expected_event_name="def_param")
+            # Check for 'def_param' event specific fields.
+            self.assertIn("param", event)
+            self.assertIn("value", event)
+            self.assertTrue(event["param"].startswith("repo."))
+
+    def test_def_params_event_no_repo_config(self):
+        """Test 'def_params' event data won't output non-repo config keys.
+
+        Expected event log:
+        <version event>
+        """
+        config = {
+            "git.foo": "bar",
+            "git.core.foo2": "baz",
+        }
+        self._event_log_module.DefParamRepoEvents(config)
+
+        with tempfile.TemporaryDirectory(prefix="event_log_tests") as tempdir:
+            log_path = self._event_log_module.Write(path=tempdir)
+            self._log_data = self.readLog(log_path)
+
+        self.assertEqual(len(self._log_data), 1)
+        self.verifyCommonKeys(self._log_data[0], expected_event_name="version")
+
+    def test_data_event_config(self):
+        """Test 'data' event data outputs all config keys.
+
+        Expected event log:
+        <version event>
+        <data event>
+        <data event>
+        """
+        config = {
+            "git.foo": "bar",
+            "repo.partialclone": "false",
+            "repo.syncstate.superproject.hassuperprojecttag": "true",
+            "repo.syncstate.superproject.sys.argv": ["--", "sync", "protobuf"],
+        }
+        prefix_value = "prefix"
+        self._event_log_module.LogDataConfigEvents(config, prefix_value)
+
+        with tempfile.TemporaryDirectory(prefix="event_log_tests") as tempdir:
+            log_path = self._event_log_module.Write(path=tempdir)
+            self._log_data = self.readLog(log_path)
+
+        self.assertEqual(len(self._log_data), 5)
+        data_events = self._log_data[1:]
+        self.verifyCommonKeys(self._log_data[0], expected_event_name="version")
+
+        for event in data_events:
+            self.verifyCommonKeys(event)
+            # Check for 'data' event specific fields.
+            self.assertIn("key", event)
+            self.assertIn("value", event)
+            key = event["key"]
+            key = self.remove_prefix(key, f"{prefix_value}/")
+            value = event["value"]
+            self.assertEqual(
+                self._event_log_module.GetDataEventName(value), event["event"]
+            )
+            self.assertTrue(key in config and value == config[key])
+
+    def test_error_event(self):
+        """Test and validate 'error' event data is valid.
+
+        Expected event log:
+        <version event>
+        <error event>
+        """
+        msg = "invalid option: --cahced"
+        fmt = "invalid option: %s"
+        self._event_log_module.ErrorEvent(msg, fmt)
+        with tempfile.TemporaryDirectory(prefix="event_log_tests") as tempdir:
+            log_path = self._event_log_module.Write(path=tempdir)
+            self._log_data = self.readLog(log_path)
+
+        self.assertEqual(len(self._log_data), 2)
+        error_event = self._log_data[1]
+        self.verifyCommonKeys(self._log_data[0], expected_event_name="version")
+        self.verifyCommonKeys(error_event, expected_event_name="error")
+        # Check for 'error' event specific fields.
+        self.assertIn("msg", error_event)
+        self.assertIn("fmt", error_event)
+        self.assertEqual(error_event["msg"], f"RepoErrorEvent:{msg}")
+        self.assertEqual(error_event["fmt"], f"RepoErrorEvent:{fmt}")
+
+    def test_write_with_filename(self):
+        """Test Write() with a path to a file exits with None."""
+        self.assertIsNone(self._event_log_module.Write(path="path/to/file"))
+
+    def test_write_with_git_config(self):
+        """Test Write() uses the git config path when 'git config' call
+        succeeds."""
+        with tempfile.TemporaryDirectory(prefix="event_log_tests") as tempdir:
+            with mock.patch.object(
+                self._event_log_module,
+                "_GetEventTargetPath",
+                return_value=tempdir,
+            ):
+                self.assertEqual(
+                    os.path.dirname(self._event_log_module.Write()), tempdir
+                )
+
+    def test_write_no_git_config(self):
+        """Test Write() with no git config variable present exits with None."""
+        with mock.patch.object(
+            self._event_log_module, "_GetEventTargetPath", return_value=None
+        ):
+            self.assertIsNone(self._event_log_module.Write())
+
+    def test_write_non_string(self):
+        """Test Write() with non-string type for |path| throws TypeError."""
+        with self.assertRaises(TypeError):
+            self._event_log_module.Write(path=1234)
+
+    def test_write_socket(self):
+        """Test Write() with Unix domain socket for |path| and validate received
+        traces."""
+        received_traces = []
+        with tempfile.TemporaryDirectory(
+            prefix="test_server_sockets"
+        ) as tempdir:
+            socket_path = os.path.join(tempdir, "server.sock")
+            server_ready = threading.Condition()
+            # Start "server" listening on Unix domain socket at socket_path.
+            try:
+                server_thread = threading.Thread(
+                    target=serverLoggingThread,
+                    args=(socket_path, server_ready, received_traces),
+                )
+                server_thread.start()
+
+                with server_ready:
+                    server_ready.wait(timeout=120)
+
+                self._event_log_module.StartEvent()
+                path = self._event_log_module.Write(
+                    path=f"af_unix:{socket_path}"
+                )
+            finally:
+                server_thread.join(timeout=5)
+
+        self.assertEqual(path, f"af_unix:stream:{socket_path}")
+        self.assertEqual(len(received_traces), 2)
+        version_event = json.loads(received_traces[0])
+        start_event = json.loads(received_traces[1])
+        self.verifyCommonKeys(version_event, expected_event_name="version")
+        self.verifyCommonKeys(start_event, expected_event_name="start")
+        # Check for 'start' event specific fields.
+        self.assertIn("argv", start_event)
+        self.assertIsInstance(start_event["argv"], list)

tests/test_hooks.py

@@ -14,42 +14,42 @@
 
 """Unittests for the hooks.py module."""
 
-import hooks
 import unittest
 
+import hooks
+
+
 class RepoHookShebang(unittest.TestCase):
-  """Check shebang parsing in RepoHook."""
+    """Check shebang parsing in RepoHook."""
 
-  def test_no_shebang(self):
+    def test_no_shebang(self):
-    """Lines w/out shebangs should be rejected."""
+        """Lines w/out shebangs should be rejected."""
-    DATA = (
+        DATA = ("", "#\n# foo\n", "# Bad shebang in script\n#!/foo\n")
-        '',
+        for data in DATA:
-        '#\n# foo\n',
+            self.assertIsNone(hooks.RepoHook._ExtractInterpFromShebang(data))
-        '# Bad shebang in script\n#!/foo\n'
-    )
-    for data in DATA:
-      self.assertIsNone(hooks.RepoHook._ExtractInterpFromShebang(data))
 
-  def test_direct_interp(self):
+    def test_direct_interp(self):
-    """Lines whose shebang points directly to the interpreter."""
+        """Lines whose shebang points directly to the interpreter."""
-    DATA = (
+        DATA = (
-        ('#!/foo', '/foo'),
+            ("#!/foo", "/foo"),
-        ('#! /foo', '/foo'),
+            ("#! /foo", "/foo"),
-        ('#!/bin/foo ', '/bin/foo'),
+            ("#!/bin/foo ", "/bin/foo"),
-        ('#! /usr/foo ', '/usr/foo'),
+            ("#! /usr/foo ", "/usr/foo"),
-        ('#! /usr/foo -args', '/usr/foo'),
+            ("#! /usr/foo -args", "/usr/foo"),
-    )
+        )
-    for shebang, interp in DATA:
+        for shebang, interp in DATA:
-      self.assertEqual(hooks.RepoHook._ExtractInterpFromShebang(shebang),
+            self.assertEqual(
-                       interp)
+                hooks.RepoHook._ExtractInterpFromShebang(shebang), interp
+            )
 
-  def test_env_interp(self):
+    def test_env_interp(self):
-    """Lines whose shebang launches through `env`."""
+        """Lines whose shebang launches through `env`."""
-    DATA = (
+        DATA = (
-        ('#!/usr/bin/env foo', 'foo'),
+            ("#!/usr/bin/env foo", "foo"),
-        ('#!/bin/env foo', 'foo'),
+            ("#!/bin/env foo", "foo"),
-        ('#! /bin/env /bin/foo ', '/bin/foo'),
+            ("#! /bin/env /bin/foo ", "/bin/foo"),
-    )
+        )
-    for shebang, interp in DATA:
+        for shebang, interp in DATA:
-      self.assertEqual(hooks.RepoHook._ExtractInterpFromShebang(shebang),
+            self.assertEqual(
-                       interp)
+                hooks.RepoHook._ExtractInterpFromShebang(shebang), interp
+            )

tests/test_platform_utils.py

@@ -22,29 +22,31 @@ import platform_utils
 
 
 class RemoveTests(unittest.TestCase):
-  """Check remove() helper."""
+    """Check remove() helper."""
 
-  def testMissingOk(self):
+    def testMissingOk(self):
-    """Check missing_ok handling."""
+        """Check missing_ok handling."""
-    with tempfile.TemporaryDirectory() as tmpdir:
+        with tempfile.TemporaryDirectory() as tmpdir:
-      path = os.path.join(tmpdir, 'test')
+            path = os.path.join(tmpdir, "test")
 
-      # Should not fail.
+            # Should not fail.
-      platform_utils.remove(path, missing_ok=True)
+            platform_utils.remove(path, missing_ok=True)
 
-      # Should fail.
+            # Should fail.
-      self.assertRaises(OSError, platform_utils.remove, path)
+            self.assertRaises(OSError, platform_utils.remove, path)
-      self.assertRaises(OSError, platform_utils.remove, path, missing_ok=False)
+            self.assertRaises(
+                OSError, platform_utils.remove, path, missing_ok=False
+            )
 
-      # Should not fail if it exists.
+            # Should not fail if it exists.
-      open(path, 'w').close()
+            open(path, "w").close()
-      platform_utils.remove(path, missing_ok=True)
+            platform_utils.remove(path, missing_ok=True)
-      self.assertFalse(os.path.exists(path))
+            self.assertFalse(os.path.exists(path))
 
-      open(path, 'w').close()
+            open(path, "w").close()
-      platform_utils.remove(path)
+            platform_utils.remove(path)
-      self.assertFalse(os.path.exists(path))
+            self.assertFalse(os.path.exists(path))
 
-      open(path, 'w').close()
+            open(path, "w").close()
-      platform_utils.remove(path, missing_ok=False)
+            platform_utils.remove(path, missing_ok=False)
-      self.assertFalse(os.path.exists(path))
+            self.assertFalse(os.path.exists(path))

tests/test_project.py

@@ -24,382 +24,500 @@ import unittest
 import error
 import git_command
 import git_config
+import manifest_xml
 import platform_utils
 import project
 
 
 @contextlib.contextmanager
 def TempGitTree():
-  """Create a new empty git checkout for testing."""
+    """Create a new empty git checkout for testing."""
-  with tempfile.TemporaryDirectory(prefix='repo-tests') as tempdir:
+    with tempfile.TemporaryDirectory(prefix="repo-tests") as tempdir:
-    # Tests need to assume, that main is default branch at init,
+        # Tests need to assume, that main is default branch at init,
-    # which is not supported in config until 2.28.
+        # which is not supported in config until 2.28.
-    cmd = ['git', 'init']
+        cmd = ["git", "init"]
-    if git_command.git_require((2, 28, 0)):
+        if git_command.git_require((2, 28, 0)):
-      cmd += ['--initial-branch=main']
+            cmd += ["--initial-branch=main"]
-    else:
+        else:
-      # Use template dir for init.
+            # Use template dir for init.
-      templatedir = tempfile.mkdtemp(prefix='.test-template')
+            templatedir = tempfile.mkdtemp(prefix=".test-template")
-      with open(os.path.join(templatedir, 'HEAD'), 'w') as fp:
+            with open(os.path.join(templatedir, "HEAD"), "w") as fp:
-        fp.write('ref: refs/heads/main\n')
+                fp.write("ref: refs/heads/main\n")
-      cmd += ['--template', templatedir]
+            cmd += ["--template", templatedir]
-    subprocess.check_call(cmd, cwd=tempdir)
+        subprocess.check_call(cmd, cwd=tempdir)
-    yield tempdir
+        yield tempdir
 
 
 class FakeProject(object):
-  """A fake for Project for basic functionality."""
+    """A fake for Project for basic functionality."""
 
-  def __init__(self, worktree):
+    def __init__(self, worktree):
-    self.worktree = worktree
+        self.worktree = worktree
-    self.gitdir = os.path.join(worktree, '.git')
+        self.gitdir = os.path.join(worktree, ".git")
-    self.name = 'fakeproject'
+        self.name = "fakeproject"
-    self.work_git = project.Project._GitGetByExec(
+        self.work_git = project.Project._GitGetByExec(
-        self, bare=False, gitdir=self.gitdir)
+            self, bare=False, gitdir=self.gitdir
-    self.bare_git = project.Project._GitGetByExec(
+        )
-        self, bare=True, gitdir=self.gitdir)
+        self.bare_git = project.Project._GitGetByExec(
-    self.config = git_config.GitConfig.ForRepository(gitdir=self.gitdir)
+            self, bare=True, gitdir=self.gitdir
+        )
+        self.config = git_config.GitConfig.ForRepository(gitdir=self.gitdir)
 
 
 class ReviewableBranchTests(unittest.TestCase):
-  """Check ReviewableBranch behavior."""
+    """Check ReviewableBranch behavior."""
 
-  def test_smoke(self):
+    def test_smoke(self):
-    """A quick run through everything."""
+        """A quick run through everything."""
-    with TempGitTree() as tempdir:
+        with TempGitTree() as tempdir:
-      fakeproj = FakeProject(tempdir)
+            fakeproj = FakeProject(tempdir)
 
-      # Generate some commits.
+            # Generate some commits.
-      with open(os.path.join(tempdir, 'readme'), 'w') as fp:
+            with open(os.path.join(tempdir, "readme"), "w") as fp:
-        fp.write('txt')
+                fp.write("txt")
-      fakeproj.work_git.add('readme')
+            fakeproj.work_git.add("readme")
-      fakeproj.work_git.commit('-mAdd file')
+            fakeproj.work_git.commit("-mAdd file")
-      fakeproj.work_git.checkout('-b', 'work')
+            fakeproj.work_git.checkout("-b", "work")
-      fakeproj.work_git.rm('-f', 'readme')
+            fakeproj.work_git.rm("-f", "readme")
-      fakeproj.work_git.commit('-mDel file')
+            fakeproj.work_git.commit("-mDel file")
 
-      # Start off with the normal details.
+            # Start off with the normal details.
-      rb = project.ReviewableBranch(
+            rb = project.ReviewableBranch(
-          fakeproj, fakeproj.config.GetBranch('work'), 'main')
+                fakeproj, fakeproj.config.GetBranch("work"), "main"
-      self.assertEqual('work', rb.name)
+            )
-      self.assertEqual(1, len(rb.commits))
+            self.assertEqual("work", rb.name)
-      self.assertIn('Del file', rb.commits[0])
+            self.assertEqual(1, len(rb.commits))
-      d = rb.unabbrev_commits
+            self.assertIn("Del file", rb.commits[0])
-      self.assertEqual(1, len(d))
+            d = rb.unabbrev_commits
-      short, long = next(iter(d.items()))
+            self.assertEqual(1, len(d))
-      self.assertTrue(long.startswith(short))
+            short, long = next(iter(d.items()))
-      self.assertTrue(rb.base_exists)
+            self.assertTrue(long.startswith(short))
-      # Hard to assert anything useful about this.
+            self.assertTrue(rb.base_exists)
-      self.assertTrue(rb.date)
+            # Hard to assert anything useful about this.
+            self.assertTrue(rb.date)
 
-      # Now delete the tracking branch!
+            # Now delete the tracking branch!
-      fakeproj.work_git.branch('-D', 'main')
+            fakeproj.work_git.branch("-D", "main")
-      rb = project.ReviewableBranch(
+            rb = project.ReviewableBranch(
-          fakeproj, fakeproj.config.GetBranch('work'), 'main')
+                fakeproj, fakeproj.config.GetBranch("work"), "main"
-      self.assertEqual(0, len(rb.commits))
+            )
-      self.assertFalse(rb.base_exists)
+            self.assertEqual(0, len(rb.commits))
-      # Hard to assert anything useful about this.
+            self.assertFalse(rb.base_exists)
-      self.assertTrue(rb.date)
+            # Hard to assert anything useful about this.
+            self.assertTrue(rb.date)
 
 
 class CopyLinkTestCase(unittest.TestCase):
-  """TestCase for stub repo client checkouts.
+    """TestCase for stub repo client checkouts.
 
-  It'll have a layout like:
+    It'll have a layout like this:
-    tempdir/          # self.tempdir
+      tempdir/          # self.tempdir
-      checkout/       # self.topdir
+        checkout/       # self.topdir
-        git-project/  # self.worktree
+          git-project/  # self.worktree
 
-  Attributes:
+    Attributes:
-    tempdir: A dedicated temporary directory.
+      tempdir: A dedicated temporary directory.
-    worktree: The top of the repo client checkout.
+      worktree: The top of the repo client checkout.
-    topdir: The top of a project checkout.
+      topdir: The top of a project checkout.
-  """
+    """
 
-  def setUp(self):
+    def setUp(self):
-    self.tempdirobj = tempfile.TemporaryDirectory(prefix='repo_tests')
+        self.tempdirobj = tempfile.TemporaryDirectory(prefix="repo_tests")
-    self.tempdir = self.tempdirobj.name
+        self.tempdir = self.tempdirobj.name
-    self.topdir = os.path.join(self.tempdir, 'checkout')
+        self.topdir = os.path.join(self.tempdir, "checkout")
-    self.worktree = os.path.join(self.topdir, 'git-project')
+        self.worktree = os.path.join(self.topdir, "git-project")
-    os.makedirs(self.topdir)
+        os.makedirs(self.topdir)
-    os.makedirs(self.worktree)
+        os.makedirs(self.worktree)
 
-  def tearDown(self):
+    def tearDown(self):
-    self.tempdirobj.cleanup()
+        self.tempdirobj.cleanup()
 
-  @staticmethod
+    @staticmethod
-  def touch(path):
+    def touch(path):
-    with open(path, 'w'):
+        with open(path, "w"):
-      pass
+            pass
 
-  def assertExists(self, path, msg=None):
+    def assertExists(self, path, msg=None):
-    """Make sure |path| exists."""
+        """Make sure |path| exists."""
-    if os.path.exists(path):
+        if os.path.exists(path):
-      return
+            return
 
-    if msg is None:
+        if msg is None:
-      msg = ['path is missing: %s' % path]
+            msg = ["path is missing: %s" % path]
-      while path != '/':
+            while path != "/":
-        path = os.path.dirname(path)
+                path = os.path.dirname(path)
-        if not path:
+                if not path:
-          # If we're given something like "foo", abort once we get to "".
+                    # If we're given something like "foo", abort once we get to
-          break
+                    # "".
-        result = os.path.exists(path)
+                    break
-        msg.append('\tos.path.exists(%s): %s' % (path, result))
+                result = os.path.exists(path)
-        if result:
+                msg.append("\tos.path.exists(%s): %s" % (path, result))
-          msg.append('\tcontents: %r' % os.listdir(path))
+                if result:
-          break
+                    msg.append("\tcontents: %r" % os.listdir(path))
-      msg = '\n'.join(msg)
+                    break
+            msg = "\n".join(msg)
 
-    raise self.failureException(msg)
+        raise self.failureException(msg)
 
 
 class CopyFile(CopyLinkTestCase):
-  """Check _CopyFile handling."""
+    """Check _CopyFile handling."""
 
-  def CopyFile(self, src, dest):
+    def CopyFile(self, src, dest):
-    return project._CopyFile(self.worktree, src, self.topdir, dest)
+        return project._CopyFile(self.worktree, src, self.topdir, dest)
 
-  def test_basic(self):
+    def test_basic(self):
-    """Basic test of copying a file from a project to the toplevel."""
+        """Basic test of copying a file from a project to the toplevel."""
-    src = os.path.join(self.worktree, 'foo.txt')
+        src = os.path.join(self.worktree, "foo.txt")
-    self.touch(src)
+        self.touch(src)
-    cf = self.CopyFile('foo.txt', 'foo')
+        cf = self.CopyFile("foo.txt", "foo")
-    cf._Copy()
+        cf._Copy()
-    self.assertExists(os.path.join(self.topdir, 'foo'))
+        self.assertExists(os.path.join(self.topdir, "foo"))
 
-  def test_src_subdir(self):
+    def test_src_subdir(self):
-    """Copy a file from a subdir of a project."""
+        """Copy a file from a subdir of a project."""
-    src = os.path.join(self.worktree, 'bar', 'foo.txt')
+        src = os.path.join(self.worktree, "bar", "foo.txt")
-    os.makedirs(os.path.dirname(src))
+        os.makedirs(os.path.dirname(src))
-    self.touch(src)
+        self.touch(src)
-    cf = self.CopyFile('bar/foo.txt', 'new.txt')
+        cf = self.CopyFile("bar/foo.txt", "new.txt")
-    cf._Copy()
+        cf._Copy()
-    self.assertExists(os.path.join(self.topdir, 'new.txt'))
+        self.assertExists(os.path.join(self.topdir, "new.txt"))
 
-  def test_dest_subdir(self):
+    def test_dest_subdir(self):
-    """Copy a file to a subdir of a checkout."""
+        """Copy a file to a subdir of a checkout."""
-    src = os.path.join(self.worktree, 'foo.txt')
+        src = os.path.join(self.worktree, "foo.txt")
-    self.touch(src)
+        self.touch(src)
-    cf = self.CopyFile('foo.txt', 'sub/dir/new.txt')
+        cf = self.CopyFile("foo.txt", "sub/dir/new.txt")
-    self.assertFalse(os.path.exists(os.path.join(self.topdir, 'sub')))
+        self.assertFalse(os.path.exists(os.path.join(self.topdir, "sub")))
-    cf._Copy()
+        cf._Copy()
-    self.assertExists(os.path.join(self.topdir, 'sub', 'dir', 'new.txt'))
+        self.assertExists(os.path.join(self.topdir, "sub", "dir", "new.txt"))
 
-  def test_update(self):
+    def test_update(self):
-    """Make sure changed files get copied again."""
+        """Make sure changed files get copied again."""
-    src = os.path.join(self.worktree, 'foo.txt')
+        src = os.path.join(self.worktree, "foo.txt")
-    dest = os.path.join(self.topdir, 'bar')
+        dest = os.path.join(self.topdir, "bar")
-    with open(src, 'w') as f:
+        with open(src, "w") as f:
-      f.write('1st')
+            f.write("1st")
-    cf = self.CopyFile('foo.txt', 'bar')
+        cf = self.CopyFile("foo.txt", "bar")
-    cf._Copy()
+        cf._Copy()
-    self.assertExists(dest)
+        self.assertExists(dest)
-    with open(dest) as f:
+        with open(dest) as f:
-      self.assertEqual(f.read(), '1st')
+            self.assertEqual(f.read(), "1st")
 
-    with open(src, 'w') as f:
+        with open(src, "w") as f:
-      f.write('2nd!')
+            f.write("2nd!")
-    cf._Copy()
+        cf._Copy()
-    with open(dest) as f:
+        with open(dest) as f:
-      self.assertEqual(f.read(), '2nd!')
+            self.assertEqual(f.read(), "2nd!")
 
-  def test_src_block_symlink(self):
+    def test_src_block_symlink(self):
-    """Do not allow reading from a symlinked path."""
+        """Do not allow reading from a symlinked path."""
-    src = os.path.join(self.worktree, 'foo.txt')
+        src = os.path.join(self.worktree, "foo.txt")
-    sym = os.path.join(self.worktree, 'sym')
+        sym = os.path.join(self.worktree, "sym")
-    self.touch(src)
+        self.touch(src)
-    platform_utils.symlink('foo.txt', sym)
+        platform_utils.symlink("foo.txt", sym)
-    self.assertExists(sym)
+        self.assertExists(sym)
-    cf = self.CopyFile('sym', 'foo')
+        cf = self.CopyFile("sym", "foo")
-    self.assertRaises(error.ManifestInvalidPathError, cf._Copy)
+        self.assertRaises(error.ManifestInvalidPathError, cf._Copy)
 
-  def test_src_block_symlink_traversal(self):
+    def test_src_block_symlink_traversal(self):
-    """Do not allow reading through a symlink dir."""
+        """Do not allow reading through a symlink dir."""
-    realfile = os.path.join(self.tempdir, 'file.txt')
+        realfile = os.path.join(self.tempdir, "file.txt")
-    self.touch(realfile)
+        self.touch(realfile)
-    src = os.path.join(self.worktree, 'bar', 'file.txt')
+        src = os.path.join(self.worktree, "bar", "file.txt")
-    platform_utils.symlink(self.tempdir, os.path.join(self.worktree, 'bar'))
+        platform_utils.symlink(self.tempdir, os.path.join(self.worktree, "bar"))
-    self.assertExists(src)
+        self.assertExists(src)
-    cf = self.CopyFile('bar/file.txt', 'foo')
+        cf = self.CopyFile("bar/file.txt", "foo")
-    self.assertRaises(error.ManifestInvalidPathError, cf._Copy)
+        self.assertRaises(error.ManifestInvalidPathError, cf._Copy)
 
-  def test_src_block_copy_from_dir(self):
+    def test_src_block_copy_from_dir(self):
-    """Do not allow copying from a directory."""
+        """Do not allow copying from a directory."""
-    src = os.path.join(self.worktree, 'dir')
+        src = os.path.join(self.worktree, "dir")
-    os.makedirs(src)
+        os.makedirs(src)
-    cf = self.CopyFile('dir', 'foo')
+        cf = self.CopyFile("dir", "foo")
-    self.assertRaises(error.ManifestInvalidPathError, cf._Copy)
+        self.assertRaises(error.ManifestInvalidPathError, cf._Copy)
 
-  def test_dest_block_symlink(self):
+    def test_dest_block_symlink(self):
-    """Do not allow writing to a symlink."""
+        """Do not allow writing to a symlink."""
-    src = os.path.join(self.worktree, 'foo.txt')
+        src = os.path.join(self.worktree, "foo.txt")
-    self.touch(src)
+        self.touch(src)
-    platform_utils.symlink('dest', os.path.join(self.topdir, 'sym'))
+        platform_utils.symlink("dest", os.path.join(self.topdir, "sym"))
-    cf = self.CopyFile('foo.txt', 'sym')
+        cf = self.CopyFile("foo.txt", "sym")
-    self.assertRaises(error.ManifestInvalidPathError, cf._Copy)
+        self.assertRaises(error.ManifestInvalidPathError, cf._Copy)
 
-  def test_dest_block_symlink_traversal(self):
+    def test_dest_block_symlink_traversal(self):
-    """Do not allow writing through a symlink dir."""
+        """Do not allow writing through a symlink dir."""
-    src = os.path.join(self.worktree, 'foo.txt')
+        src = os.path.join(self.worktree, "foo.txt")
-    self.touch(src)
+        self.touch(src)
-    platform_utils.symlink(tempfile.gettempdir(),
+        platform_utils.symlink(
-                           os.path.join(self.topdir, 'sym'))
+            tempfile.gettempdir(), os.path.join(self.topdir, "sym")
-    cf = self.CopyFile('foo.txt', 'sym/foo.txt')
+        )
-    self.assertRaises(error.ManifestInvalidPathError, cf._Copy)
+        cf = self.CopyFile("foo.txt", "sym/foo.txt")
+        self.assertRaises(error.ManifestInvalidPathError, cf._Copy)
 
-  def test_src_block_copy_to_dir(self):
+    def test_src_block_copy_to_dir(self):
-    """Do not allow copying to a directory."""
+        """Do not allow copying to a directory."""
-    src = os.path.join(self.worktree, 'foo.txt')
+        src = os.path.join(self.worktree, "foo.txt")
-    self.touch(src)
+        self.touch(src)
-    os.makedirs(os.path.join(self.topdir, 'dir'))
+        os.makedirs(os.path.join(self.topdir, "dir"))
-    cf = self.CopyFile('foo.txt', 'dir')
+        cf = self.CopyFile("foo.txt", "dir")
-    self.assertRaises(error.ManifestInvalidPathError, cf._Copy)
+        self.assertRaises(error.ManifestInvalidPathError, cf._Copy)
 
 
 class LinkFile(CopyLinkTestCase):
-  """Check _LinkFile handling."""
+    """Check _LinkFile handling."""
 
-  def LinkFile(self, src, dest):
+    def LinkFile(self, src, dest):
-    return project._LinkFile(self.worktree, src, self.topdir, dest)
+        return project._LinkFile(self.worktree, src, self.topdir, dest)
 
-  def test_basic(self):
+    def test_basic(self):
-    """Basic test of linking a file from a project into the toplevel."""
+        """Basic test of linking a file from a project into the toplevel."""
-    src = os.path.join(self.worktree, 'foo.txt')
+        src = os.path.join(self.worktree, "foo.txt")
-    self.touch(src)
+        self.touch(src)
-    lf = self.LinkFile('foo.txt', 'foo')
+        lf = self.LinkFile("foo.txt", "foo")
-    lf._Link()
+        lf._Link()
-    dest = os.path.join(self.topdir, 'foo')
+        dest = os.path.join(self.topdir, "foo")
-    self.assertExists(dest)
+        self.assertExists(dest)
-    self.assertTrue(os.path.islink(dest))
+        self.assertTrue(os.path.islink(dest))
-    self.assertEqual(os.path.join('git-project', 'foo.txt'), os.readlink(dest))
+        self.assertEqual(
+            os.path.join("git-project", "foo.txt"), os.readlink(dest)
+        )
 
-  def test_src_subdir(self):
+    def test_src_subdir(self):
-    """Link to a file in a subdir of a project."""
+        """Link to a file in a subdir of a project."""
-    src = os.path.join(self.worktree, 'bar', 'foo.txt')
+        src = os.path.join(self.worktree, "bar", "foo.txt")
-    os.makedirs(os.path.dirname(src))
+        os.makedirs(os.path.dirname(src))
-    self.touch(src)
+        self.touch(src)
-    lf = self.LinkFile('bar/foo.txt', 'foo')
+        lf = self.LinkFile("bar/foo.txt", "foo")
-    lf._Link()
+        lf._Link()
-    self.assertExists(os.path.join(self.topdir, 'foo'))
+        self.assertExists(os.path.join(self.topdir, "foo"))
 
-  def test_src_self(self):
+    def test_src_self(self):
-    """Link to the project itself."""
+        """Link to the project itself."""
-    dest = os.path.join(self.topdir, 'foo', 'bar')
+        dest = os.path.join(self.topdir, "foo", "bar")
-    lf = self.LinkFile('.', 'foo/bar')
+        lf = self.LinkFile(".", "foo/bar")
-    lf._Link()
+        lf._Link()
-    self.assertExists(dest)
+        self.assertExists(dest)
-    self.assertEqual(os.path.join('..', 'git-project'), os.readlink(dest))
+        self.assertEqual(os.path.join("..", "git-project"), os.readlink(dest))
 
-  def test_dest_subdir(self):
+    def test_dest_subdir(self):
-    """Link a file to a subdir of a checkout."""
+        """Link a file to a subdir of a checkout."""
-    src = os.path.join(self.worktree, 'foo.txt')
+        src = os.path.join(self.worktree, "foo.txt")
-    self.touch(src)
+        self.touch(src)
-    lf = self.LinkFile('foo.txt', 'sub/dir/foo/bar')
+        lf = self.LinkFile("foo.txt", "sub/dir/foo/bar")
-    self.assertFalse(os.path.exists(os.path.join(self.topdir, 'sub')))
+        self.assertFalse(os.path.exists(os.path.join(self.topdir, "sub")))
-    lf._Link()
+        lf._Link()
-    self.assertExists(os.path.join(self.topdir, 'sub', 'dir', 'foo', 'bar'))
+        self.assertExists(os.path.join(self.topdir, "sub", "dir", "foo", "bar"))
 
-  def test_src_block_relative(self):
+    def test_src_block_relative(self):
-    """Do not allow relative symlinks."""
+        """Do not allow relative symlinks."""
-    BAD_SOURCES = (
+        BAD_SOURCES = (
-        './',
+            "./",
-        '..',
+            "..",
-        '../',
+            "../",
-        'foo/.',
+            "foo/.",
-        'foo/./bar',
+            "foo/./bar",
-        'foo/..',
+            "foo/..",
-        'foo/../foo',
+            "foo/../foo",
-    )
+        )
-    for src in BAD_SOURCES:
+        for src in BAD_SOURCES:
-      lf = self.LinkFile(src, 'foo')
+            lf = self.LinkFile(src, "foo")
-      self.assertRaises(error.ManifestInvalidPathError, lf._Link)
+            self.assertRaises(error.ManifestInvalidPathError, lf._Link)
 
-  def test_update(self):
+    def test_update(self):
-    """Make sure changed targets get updated."""
+        """Make sure changed targets get updated."""
-    dest = os.path.join(self.topdir, 'sym')
+        dest = os.path.join(self.topdir, "sym")
 
-    src = os.path.join(self.worktree, 'foo.txt')
+        src = os.path.join(self.worktree, "foo.txt")
-    self.touch(src)
+        self.touch(src)
-    lf = self.LinkFile('foo.txt', 'sym')
+        lf = self.LinkFile("foo.txt", "sym")
-    lf._Link()
+        lf._Link()
-    self.assertEqual(os.path.join('git-project', 'foo.txt'), os.readlink(dest))
+        self.assertEqual(
+            os.path.join("git-project", "foo.txt"), os.readlink(dest)
+        )
 
-    # Point the symlink somewhere else.
+        # Point the symlink somewhere else.
-    os.unlink(dest)
+        os.unlink(dest)
-    platform_utils.symlink(self.tempdir, dest)
+        platform_utils.symlink(self.tempdir, dest)
-    lf._Link()
+        lf._Link()
-    self.assertEqual(os.path.join('git-project', 'foo.txt'), os.readlink(dest))
+        self.assertEqual(
+            os.path.join("git-project", "foo.txt"), os.readlink(dest)
+        )
 
 
 class MigrateWorkTreeTests(unittest.TestCase):
-  """Check _MigrateOldWorkTreeGitDir handling."""
+    """Check _MigrateOldWorkTreeGitDir handling."""
 
-  _SYMLINKS = {
+    _SYMLINKS = {
-      'config', 'description', 'hooks', 'info', 'logs', 'objects',
+        "config",
-      'packed-refs', 'refs', 'rr-cache', 'shallow', 'svn',
+        "description",
-  }
+        "hooks",
-  _FILES = {
+        "info",
-      'COMMIT_EDITMSG', 'FETCH_HEAD', 'HEAD', 'index', 'ORIG_HEAD',
+        "logs",
-      'unknown-file-should-be-migrated',
+        "objects",
-  }
+        "packed-refs",
-  _CLEAN_FILES = {
+        "refs",
-      'a-vim-temp-file~', '#an-emacs-temp-file#',
+        "rr-cache",
-  }
+        "shallow",
+        "svn",
+    }
+    _FILES = {
+        "COMMIT_EDITMSG",
+        "FETCH_HEAD",
+        "HEAD",
+        "index",
+        "ORIG_HEAD",
+        "unknown-file-should-be-migrated",
+    }
+    _CLEAN_FILES = {
+        "a-vim-temp-file~",
+        "#an-emacs-temp-file#",
+    }
 
-  @classmethod
+    @classmethod
-  @contextlib.contextmanager
+    @contextlib.contextmanager
-  def _simple_layout(cls):
+    def _simple_layout(cls):
-    """Create a simple repo client checkout to test against."""
+        """Create a simple repo client checkout to test against."""
-    with tempfile.TemporaryDirectory() as tempdir:
+        with tempfile.TemporaryDirectory() as tempdir:
-      tempdir = Path(tempdir)
+            tempdir = Path(tempdir)
 
-      gitdir = tempdir / '.repo/projects/src/test.git'
+            gitdir = tempdir / ".repo/projects/src/test.git"
-      gitdir.mkdir(parents=True)
+            gitdir.mkdir(parents=True)
-      cmd = ['git', 'init', '--bare', str(gitdir)]
+            cmd = ["git", "init", "--bare", str(gitdir)]
-      subprocess.check_call(cmd)
+            subprocess.check_call(cmd)
 
-      dotgit = tempdir / 'src/test/.git'
+            dotgit = tempdir / "src/test/.git"
-      dotgit.mkdir(parents=True)
+            dotgit.mkdir(parents=True)
-      for name in cls._SYMLINKS:
+            for name in cls._SYMLINKS:
-        (dotgit / name).symlink_to(f'../../../.repo/projects/src/test.git/{name}')
+                (dotgit / name).symlink_to(
-      for name in cls._FILES | cls._CLEAN_FILES:
+                    f"../../../.repo/projects/src/test.git/{name}"
-        (dotgit / name).write_text(name)
+                )
+            for name in cls._FILES | cls._CLEAN_FILES:
+                (dotgit / name).write_text(name)
 
-      yield tempdir
+            yield tempdir
 
-  def test_standard(self):
+    def test_standard(self):
-    """Migrate a standard checkout that we expect."""
+        """Migrate a standard checkout that we expect."""
-    with self._simple_layout() as tempdir:
+        with self._simple_layout() as tempdir:
-      dotgit = tempdir / 'src/test/.git'
+            dotgit = tempdir / "src/test/.git"
-      project.Project._MigrateOldWorkTreeGitDir(str(dotgit))
+            project.Project._MigrateOldWorkTreeGitDir(str(dotgit))
 
-      # Make sure the dir was transformed into a symlink.
+            # Make sure the dir was transformed into a symlink.
-      self.assertTrue(dotgit.is_symlink())
+            self.assertTrue(dotgit.is_symlink())
-      self.assertEqual(os.readlink(dotgit), '../../.repo/projects/src/test.git')
+            self.assertEqual(
+                os.readlink(dotgit),
+                os.path.normpath("../../.repo/projects/src/test.git"),
+            )
 
-      # Make sure files were moved over.
+            # Make sure files were moved over.
-      gitdir = tempdir / '.repo/projects/src/test.git'
+            gitdir = tempdir / ".repo/projects/src/test.git"
-      for name in self._FILES:
+            for name in self._FILES:
-        self.assertEqual(name, (gitdir / name).read_text())
+                self.assertEqual(name, (gitdir / name).read_text())
-      # Make sure files were removed.
+            # Make sure files were removed.
-      for name in self._CLEAN_FILES:
+            for name in self._CLEAN_FILES:
-        self.assertFalse((gitdir / name).exists())
+                self.assertFalse((gitdir / name).exists())
 
-  def test_unknown(self):
+    def test_unknown(self):
-    """A checkout with unknown files should abort."""
+        """A checkout with unknown files should abort."""
-    with self._simple_layout() as tempdir:
+        with self._simple_layout() as tempdir:
-      dotgit = tempdir / 'src/test/.git'
+            dotgit = tempdir / "src/test/.git"
-      (tempdir / '.repo/projects/src/test.git/random-file').write_text('one')
+            (tempdir / ".repo/projects/src/test.git/random-file").write_text(
-      (dotgit / 'random-file').write_text('two')
+                "one"
-      with self.assertRaises(error.GitError):
+            )
-        project.Project._MigrateOldWorkTreeGitDir(str(dotgit))
+            (dotgit / "random-file").write_text("two")
+            with self.assertRaises(error.GitError):
+                project.Project._MigrateOldWorkTreeGitDir(str(dotgit))
 
-      # Make sure no content was actually changed.
+            # Make sure no content was actually changed.
-      self.assertTrue(dotgit.is_dir())
+            self.assertTrue(dotgit.is_dir())
-      for name in self._FILES:
+            for name in self._FILES:
-        self.assertTrue((dotgit / name).is_file())
+                self.assertTrue((dotgit / name).is_file())
-      for name in self._CLEAN_FILES:
+            for name in self._CLEAN_FILES:
-        self.assertTrue((dotgit / name).is_file())
+                self.assertTrue((dotgit / name).is_file())
-      for name in self._SYMLINKS:
+            for name in self._SYMLINKS:
-        self.assertTrue((dotgit / name).is_symlink())
+                self.assertTrue((dotgit / name).is_symlink())
+
+
+class ManifestPropertiesFetchedCorrectly(unittest.TestCase):
+    """Ensure properties are fetched properly."""
+
+    def setUpManifest(self, tempdir):
+        repodir = os.path.join(tempdir, ".repo")
+        manifest_dir = os.path.join(repodir, "manifests")
+        manifest_file = os.path.join(repodir, manifest_xml.MANIFEST_FILE_NAME)
+        os.mkdir(repodir)
+        os.mkdir(manifest_dir)
+        manifest = manifest_xml.XmlManifest(repodir, manifest_file)
+
+        return project.ManifestProject(
+            manifest, "test/manifest", os.path.join(tempdir, ".git"), tempdir
+        )
+
+    def test_manifest_config_properties(self):
+        """Test we are fetching the manifest config properties correctly."""
+
+        with TempGitTree() as tempdir:
+            fakeproj = self.setUpManifest(tempdir)
+
+            # Set property using the expected Set method, then ensure
+            # the porperty functions are using the correct Get methods.
+            fakeproj.config.SetString(
+                "manifest.standalone", "https://chicken/manifest.git"
+            )
+            self.assertEqual(
+                fakeproj.standalone_manifest_url, "https://chicken/manifest.git"
+            )
+
+            fakeproj.config.SetString(
+                "manifest.groups", "test-group, admin-group"
+            )
+            self.assertEqual(
+                fakeproj.manifest_groups, "test-group, admin-group"
+            )
+
+            fakeproj.config.SetString("repo.reference", "mirror/ref")
+            self.assertEqual(fakeproj.reference, "mirror/ref")
+
+            fakeproj.config.SetBoolean("repo.dissociate", False)
+            self.assertFalse(fakeproj.dissociate)
+
+            fakeproj.config.SetBoolean("repo.archive", False)
+            self.assertFalse(fakeproj.archive)
+
+            fakeproj.config.SetBoolean("repo.mirror", False)
+            self.assertFalse(fakeproj.mirror)
+
+            fakeproj.config.SetBoolean("repo.worktree", False)
+            self.assertFalse(fakeproj.use_worktree)
+
+            fakeproj.config.SetBoolean("repo.clonebundle", False)
+            self.assertFalse(fakeproj.clone_bundle)
+
+            fakeproj.config.SetBoolean("repo.submodules", False)
+            self.assertFalse(fakeproj.submodules)
+
+            fakeproj.config.SetBoolean("repo.git-lfs", False)
+            self.assertFalse(fakeproj.git_lfs)
+
+            fakeproj.config.SetBoolean("repo.superproject", False)
+            self.assertFalse(fakeproj.use_superproject)
+
+            fakeproj.config.SetBoolean("repo.partialclone", False)
+            self.assertFalse(fakeproj.partial_clone)
+
+            fakeproj.config.SetString("repo.depth", "48")
+            self.assertEqual(fakeproj.depth, "48")
+
+            fakeproj.config.SetString("repo.clonefilter", "blob:limit=10M")
+            self.assertEqual(fakeproj.clone_filter, "blob:limit=10M")
+
+            fakeproj.config.SetString(
+                "repo.partialcloneexclude", "third_party/big_repo"
+            )
+            self.assertEqual(
+                fakeproj.partial_clone_exclude, "third_party/big_repo"
+            )
+
+            fakeproj.config.SetString("manifest.platform", "auto")
+            self.assertEqual(fakeproj.manifest_platform, "auto")

tests/test_repo_logging.py

@@ -0,0 +1,64 @@
+# Copyright (C) 2023 The Android Open Source Project
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#      http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+"""Unit test for repo_logging module."""
+import unittest
+from unittest import mock
+
+from error import RepoExitError
+from repo_logging import RepoLogger
+
+
+class TestRepoLogger(unittest.TestCase):
+    @mock.patch.object(RepoLogger, "error")
+    def test_log_aggregated_errors_logs_aggregated_errors(self, mock_error):
+        """Test if log_aggregated_errors logs a list of aggregated errors."""
+        logger = RepoLogger(__name__)
+        logger.log_aggregated_errors(
+            RepoExitError(
+                aggregate_errors=[
+                    Exception("foo"),
+                    Exception("bar"),
+                    Exception("baz"),
+                    Exception("hello"),
+                    Exception("world"),
+                    Exception("test"),
+                ]
+            )
+        )
+
+        mock_error.assert_has_calls(
+            [
+                mock.call("=" * 80),
+                mock.call(
+                    "Repo command failed due to the following `%s` errors:",
+                    "RepoExitError",
+                ),
+                mock.call("foo\nbar\nbaz\nhello\nworld"),
+                mock.call("+%d additional errors...", 1),
+            ]
+        )
+
+    @mock.patch.object(RepoLogger, "error")
+    def test_log_aggregated_errors_logs_single_error(self, mock_error):
+        """Test if log_aggregated_errors logs empty aggregated_errors."""
+        logger = RepoLogger(__name__)
+        logger.log_aggregated_errors(RepoExitError())
+
+        mock_error.assert_has_calls(
+            [
+                mock.call("=" * 80),
+                mock.call("Repo command failed: %s", "RepoExitError"),
+            ]
+        )

tests/test_repo_trace.py

@@ -0,0 +1,60 @@
+# Copyright 2022 The Android Open Source Project
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#      http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+"""Unittests for the repo_trace.py module."""
+
+import os
+import unittest
+from unittest import mock
+
+import repo_trace
+
+
+class TraceTests(unittest.TestCase):
+    """Check Trace behavior."""
+
+    def testTrace_MaxSizeEnforced(self):
+        content = "git chicken"
+
+        with repo_trace.Trace(content, first_trace=True):
+            pass
+        first_trace_size = os.path.getsize(repo_trace._TRACE_FILE)
+
+        with repo_trace.Trace(content):
+            pass
+        self.assertGreater(
+            os.path.getsize(repo_trace._TRACE_FILE), first_trace_size
+        )
+
+        # Check we clear everything is the last chunk is larger than _MAX_SIZE.
+        with mock.patch("repo_trace._MAX_SIZE", 0):
+            with repo_trace.Trace(content, first_trace=True):
+                pass
+            self.assertEqual(
+                first_trace_size, os.path.getsize(repo_trace._TRACE_FILE)
+            )
+
+            # Check we only clear the chunks we need to.
+            repo_trace._MAX_SIZE = (first_trace_size + 1) / (1024 * 1024)
+            with repo_trace.Trace(content, first_trace=True):
+                pass
+            self.assertEqual(
+                first_trace_size * 2, os.path.getsize(repo_trace._TRACE_FILE)
+            )
+
+            with repo_trace.Trace(content, first_trace=True):
+                pass
+            self.assertEqual(
+                first_trace_size * 2, os.path.getsize(repo_trace._TRACE_FILE)
+            )

tests/test_ssh.py

@@ -23,52 +23,58 @@ import ssh
 
 
 class SshTests(unittest.TestCase):
-  """Tests the ssh functions."""
+    """Tests the ssh functions."""
 
-  def test_parse_ssh_version(self):
+    def test_parse_ssh_version(self):
-    """Check _parse_ssh_version() handling."""
+        """Check _parse_ssh_version() handling."""
-    ver = ssh._parse_ssh_version('Unknown\n')
+        ver = ssh._parse_ssh_version("Unknown\n")
-    self.assertEqual(ver, ())
+        self.assertEqual(ver, ())
-    ver = ssh._parse_ssh_version('OpenSSH_1.0\n')
+        ver = ssh._parse_ssh_version("OpenSSH_1.0\n")
-    self.assertEqual(ver, (1, 0))
+        self.assertEqual(ver, (1, 0))
-    ver = ssh._parse_ssh_version('OpenSSH_6.6.1p1 Ubuntu-2ubuntu2.13, OpenSSL 1.0.1f 6 Jan 2014\n')
+        ver = ssh._parse_ssh_version(
-    self.assertEqual(ver, (6, 6, 1))
+            "OpenSSH_6.6.1p1 Ubuntu-2ubuntu2.13, OpenSSL 1.0.1f 6 Jan 2014\n"
-    ver = ssh._parse_ssh_version('OpenSSH_7.6p1 Ubuntu-4ubuntu0.3, OpenSSL 1.0.2n  7 Dec 2017\n')
+        )
-    self.assertEqual(ver, (7, 6))
+        self.assertEqual(ver, (6, 6, 1))
+        ver = ssh._parse_ssh_version(
+            "OpenSSH_7.6p1 Ubuntu-4ubuntu0.3, OpenSSL 1.0.2n  7 Dec 2017\n"
+        )
+        self.assertEqual(ver, (7, 6))
+        ver = ssh._parse_ssh_version("OpenSSH_9.0p1, LibreSSL 3.3.6\n")
+        self.assertEqual(ver, (9, 0))
 
-  def test_version(self):
+    def test_version(self):
-    """Check version() handling."""
+        """Check version() handling."""
-    with mock.patch('ssh._run_ssh_version', return_value='OpenSSH_1.2\n'):
+        with mock.patch("ssh._run_ssh_version", return_value="OpenSSH_1.2\n"):
-      self.assertEqual(ssh.version(), (1, 2))
+            self.assertEqual(ssh.version(), (1, 2))
 
-  def test_context_manager_empty(self):
+    def test_context_manager_empty(self):
-    """Verify context manager with no clients works correctly."""
+        """Verify context manager with no clients works correctly."""
-    with multiprocessing.Manager() as manager:
+        with multiprocessing.Manager() as manager:
-      with ssh.ProxyManager(manager):
+            with ssh.ProxyManager(manager):
-        pass
+                pass
 
-  def test_context_manager_child_cleanup(self):
+    def test_context_manager_child_cleanup(self):
-    """Verify orphaned clients & masters get cleaned up."""
+        """Verify orphaned clients & masters get cleaned up."""
-    with multiprocessing.Manager() as manager:
+        with multiprocessing.Manager() as manager:
-      with ssh.ProxyManager(manager) as ssh_proxy:
+            with ssh.ProxyManager(manager) as ssh_proxy:
-        client = subprocess.Popen(['sleep', '964853320'])
+                client = subprocess.Popen(["sleep", "964853320"])
-        ssh_proxy.add_client(client)
+                ssh_proxy.add_client(client)
-        master = subprocess.Popen(['sleep', '964853321'])
+                master = subprocess.Popen(["sleep", "964853321"])
-        ssh_proxy.add_master(master)
+                ssh_proxy.add_master(master)
-    # If the process still exists, these will throw timeout errors.
+        # If the process still exists, these will throw timeout errors.
-    client.wait(0)
+        client.wait(0)
-    master.wait(0)
+        master.wait(0)
 
-  def test_ssh_sock(self):
+    def test_ssh_sock(self):
-    """Check sock() function."""
+        """Check sock() function."""
-    manager = multiprocessing.Manager()
+        manager = multiprocessing.Manager()
-    proxy = ssh.ProxyManager(manager)
+        proxy = ssh.ProxyManager(manager)
-    with mock.patch('tempfile.mkdtemp', return_value='/tmp/foo'):
+        with mock.patch("tempfile.mkdtemp", return_value="/tmp/foo"):
-      # old ssh version uses port
+            # Old ssh version uses port.
-      with mock.patch('ssh.version', return_value=(6, 6)):
+            with mock.patch("ssh.version", return_value=(6, 6)):
-        self.assertTrue(proxy.sock().endswith('%p'))
+                self.assertTrue(proxy.sock().endswith("%p"))
 
-      proxy._sock_path = None
+            proxy._sock_path = None
-      # new ssh version uses hash
+            # New ssh version uses hash.
-      with mock.patch('ssh.version', return_value=(6, 7)):
+            with mock.patch("ssh.version", return_value=(6, 7)):
-        self.assertTrue(proxy.sock().endswith('%C'))
+                self.assertTrue(proxy.sock().endswith("%C"))

tests/test_subcmds.py

@@ -21,53 +21,71 @@ import subcmds
 
 
 class AllCommands(unittest.TestCase):
-  """Check registered all_commands."""
+    """Check registered all_commands."""
 
-  def test_required_basic(self):
+    def test_required_basic(self):
-    """Basic checking of registered commands."""
+        """Basic checking of registered commands."""
-    # NB: We don't test all subcommands as we want to avoid "change detection"
+        # NB: We don't test all subcommands as we want to avoid "change
-    # tests, so we just look for the most common/important ones here that are
+        # detection" tests, so we just look for the most common/important ones
-    # unlikely to ever change.
+        # here that are unlikely to ever change.
-    for cmd in {'cherry-pick', 'help', 'init', 'start', 'sync', 'upload'}:
+        for cmd in {"cherry-pick", "help", "init", "start", "sync", "upload"}:
-      self.assertIn(cmd, subcmds.all_commands)
+            self.assertIn(cmd, subcmds.all_commands)
 
-  def test_naming(self):
+    def test_naming(self):
-    """Verify we don't add things that we shouldn't."""
+        """Verify we don't add things that we shouldn't."""
-    for cmd in subcmds.all_commands:
+        for cmd in subcmds.all_commands:
-      # Reject filename suffixes like "help.py".
+            # Reject filename suffixes like "help.py".
-      self.assertNotIn('.', cmd)
+            self.assertNotIn(".", cmd)
 
-      # Make sure all '_' were converted to '-'.
+            # Make sure all '_' were converted to '-'.
-      self.assertNotIn('_', cmd)
+            self.assertNotIn("_", cmd)
 
-      # Reject internal python paths like "__init__".
+            # Reject internal python paths like "__init__".
-      self.assertFalse(cmd.startswith('__'))
+            self.assertFalse(cmd.startswith("__"))
 
-  def test_help_desc_style(self):
+    def test_help_desc_style(self):
-    """Force some consistency in option descriptions.
+        """Force some consistency in option descriptions.
 
-    Python's optparse & argparse has a few default options like --help.  Their
+        Python's optparse & argparse has a few default options like --help.
-    option description text uses lowercase sentence fragments, so enforce our
+        Their option description text uses lowercase sentence fragments, so
-    options follow the same style so UI is consistent.
+        enforce our options follow the same style so UI is consistent.
 
-    We enforce:
+        We enforce:
-    * Text starts with lowercase.
+        * Text starts with lowercase.
-    * Text doesn't end with period.
+        * Text doesn't end with period.
-    """
+        """
-    for name, cls in subcmds.all_commands.items():
+        for name, cls in subcmds.all_commands.items():
-      cmd = cls()
+            cmd = cls()
-      parser = cmd.OptionParser
+            parser = cmd.OptionParser
-      for option in parser.option_list:
+            for option in parser.option_list:
-        if option.help == optparse.SUPPRESS_HELP:
+                if option.help == optparse.SUPPRESS_HELP:
-          continue
+                    continue
 
-        c = option.help[0]
+                c = option.help[0]
-        self.assertEqual(
+                self.assertEqual(
-            c.lower(), c,
+                    c.lower(),
-            msg=f'subcmds/{name}.py: {option.get_opt_string()}: help text '
+                    c,
-                f'should start with lowercase: "{option.help}"')
+                    msg=f"subcmds/{name}.py: {option.get_opt_string()}: "
+                    f'help text should start with lowercase: "{option.help}"',
+                )
 
-        self.assertNotEqual(
+                self.assertNotEqual(
-            option.help[-1], '.',
+                    option.help[-1],
-            msg=f'subcmds/{name}.py: {option.get_opt_string()}: help text '
+                    ".",
-                f'should not end in a period: "{option.help}"')
+                    msg=f"subcmds/{name}.py: {option.get_opt_string()}: "
+                    f'help text should not end in a period: "{option.help}"',
+                )
+
+    def test_cli_option_style(self):
+        """Force some consistency in option flags."""
+        for name, cls in subcmds.all_commands.items():
+            cmd = cls()
+            parser = cmd.OptionParser
+            for option in parser.option_list:
+                for opt in option._long_opts:
+                    self.assertNotIn(
+                        "_",
+                        opt,
+                        msg=f"subcmds/{name}.py: {opt}: only use dashes in "
+                        "options, not underscores",
+                    )

tests/test_subcmds_init.py

@@ -20,30 +20,27 @@ from subcmds import init
 
 
 class InitCommand(unittest.TestCase):
-  """Check registered all_commands."""
+    """Check registered all_commands."""
 
-  def setUp(self):
+    def setUp(self):
-    self.cmd = init.Init()
+        self.cmd = init.Init()
 
-  def test_cli_parser_good(self):
+    def test_cli_parser_good(self):
-    """Check valid command line options."""
+        """Check valid command line options."""
-    ARGV = (
+        ARGV = ([],)
-        [],
+        for argv in ARGV:
-    )
+            opts, args = self.cmd.OptionParser.parse_args(argv)
-    for argv in ARGV:
+            self.cmd.ValidateOptions(opts, args)
-      opts, args = self.cmd.OptionParser.parse_args(argv)
-      self.cmd.ValidateOptions(opts, args)
 
-  def test_cli_parser_bad(self):
+    def test_cli_parser_bad(self):
-    """Check invalid command line options."""
+        """Check invalid command line options."""
-    ARGV = (
+        ARGV = (
-        # Too many arguments.
+            # Too many arguments.
-        ['url', 'asdf'],
+            ["url", "asdf"],
-
+            # Conflicting options.
-        # Conflicting options.
+            ["--mirror", "--archive"],
-        ['--mirror', '--archive'],
+        )
-    )
+        for argv in ARGV:
-    for argv in ARGV:
+            opts, args = self.cmd.OptionParser.parse_args(argv)
-      opts, args = self.cmd.OptionParser.parse_args(argv)
+            with self.assertRaises(SystemExit):
-      with self.assertRaises(SystemExit):
+                self.cmd.ValidateOptions(opts, args)
-        self.cmd.ValidateOptions(opts, args)

tests/test_subcmds_sync.py

@@ -11,35 +11,392 @@
 # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
 # See the License for the specific language governing permissions and
 # limitations under the License.
-
 """Unittests for the subcmds/sync.py module."""
 
+import os
+import shutil
+import tempfile
+import time
+import unittest
 from unittest import mock
 
 import pytest
 
+import command
+from error import GitError
+from error import RepoExitError
+from project import SyncNetworkHalfResult
 from subcmds import sync
 
 
 @pytest.mark.parametrize(
-  'use_superproject, cli_args, result',
+    "use_superproject, cli_args, result",
-  [
+    [
-    (True, ['--current-branch'], True),
+        (True, ["--current-branch"], True),
-    (True, ['--no-current-branch'], True),
+        (True, ["--no-current-branch"], True),
-    (True, [], True),
+        (True, [], True),
-    (False, ['--current-branch'], True),
+        (False, ["--current-branch"], True),
-    (False, ['--no-current-branch'], False),
+        (False, ["--no-current-branch"], False),
-    (False, [], None),
+        (False, [], None),
-  ]
+    ],
 )
 def test_get_current_branch_only(use_superproject, cli_args, result):
-  """Test Sync._GetCurrentBranchOnly logic.
+    """Test Sync._GetCurrentBranchOnly logic.
 
-  Sync._GetCurrentBranchOnly should return True if a superproject is requested,
+    Sync._GetCurrentBranchOnly should return True if a superproject is
-  and otherwise the value of the current_branch_only option.
+    requested, and otherwise the value of the current_branch_only option.
-  """
+    """
-  cmd = sync.Sync()
+    cmd = sync.Sync()
-  opts, _ = cmd.OptionParser.parse_args(cli_args)
+    opts, _ = cmd.OptionParser.parse_args(cli_args)
 
-  with mock.patch('git_superproject.UseSuperproject', return_value=use_superproject):
+    with mock.patch(
-    assert cmd._GetCurrentBranchOnly(opts, cmd.manifest) == result
+        "git_superproject.UseSuperproject", return_value=use_superproject
+    ):
+        assert cmd._GetCurrentBranchOnly(opts, cmd.manifest) == result
+
+
+# Used to patch os.cpu_count() for reliable results.
+OS_CPU_COUNT = 24
+
+
+@pytest.mark.parametrize(
+    "argv, jobs_manifest, jobs, jobs_net, jobs_check",
+    [
+        # No user or manifest settings.
+        ([], None, OS_CPU_COUNT, 1, command.DEFAULT_LOCAL_JOBS),
+        # No user settings, so manifest settings control.
+        ([], 3, 3, 3, 3),
+        # User settings, but no manifest.
+        (["--jobs=4"], None, 4, 4, 4),
+        (["--jobs=4", "--jobs-network=5"], None, 4, 5, 4),
+        (["--jobs=4", "--jobs-checkout=6"], None, 4, 4, 6),
+        (["--jobs=4", "--jobs-network=5", "--jobs-checkout=6"], None, 4, 5, 6),
+        (
+            ["--jobs-network=5"],
+            None,
+            OS_CPU_COUNT,
+            5,
+            command.DEFAULT_LOCAL_JOBS,
+        ),
+        (["--jobs-checkout=6"], None, OS_CPU_COUNT, 1, 6),
+        (["--jobs-network=5", "--jobs-checkout=6"], None, OS_CPU_COUNT, 5, 6),
+        # User settings with manifest settings.
+        (["--jobs=4"], 3, 4, 4, 4),
+        (["--jobs=4", "--jobs-network=5"], 3, 4, 5, 4),
+        (["--jobs=4", "--jobs-checkout=6"], 3, 4, 4, 6),
+        (["--jobs=4", "--jobs-network=5", "--jobs-checkout=6"], 3, 4, 5, 6),
+        (["--jobs-network=5"], 3, 3, 5, 3),
+        (["--jobs-checkout=6"], 3, 3, 3, 6),
+        (["--jobs-network=5", "--jobs-checkout=6"], 3, 3, 5, 6),
+        # Settings that exceed rlimits get capped.
+        (["--jobs=1000000"], None, 83, 83, 83),
+        ([], 1000000, 83, 83, 83),
+    ],
+)
+def test_cli_jobs(argv, jobs_manifest, jobs, jobs_net, jobs_check):
+    """Tests --jobs option behavior."""
+    mp = mock.MagicMock()
+    mp.manifest.default.sync_j = jobs_manifest
+
+    cmd = sync.Sync()
+    opts, args = cmd.OptionParser.parse_args(argv)
+    cmd.ValidateOptions(opts, args)
+
+    with mock.patch.object(sync, "_rlimit_nofile", return_value=(256, 256)):
+        with mock.patch.object(os, "cpu_count", return_value=OS_CPU_COUNT):
+            cmd._ValidateOptionsWithManifest(opts, mp)
+            assert opts.jobs == jobs
+            assert opts.jobs_network == jobs_net
+            assert opts.jobs_checkout == jobs_check
+
+
+class LocalSyncState(unittest.TestCase):
+    """Tests for LocalSyncState."""
+
+    _TIME = 10
+
+    def setUp(self):
+        """Common setup."""
+        self.topdir = tempfile.mkdtemp("LocalSyncState")
+        self.repodir = os.path.join(self.topdir, ".repo")
+        os.makedirs(self.repodir)
+
+        self.manifest = mock.MagicMock(
+            topdir=self.topdir,
+            repodir=self.repodir,
+            repoProject=mock.MagicMock(relpath=".repo/repo"),
+        )
+        self.state = self._new_state()
+
+    def tearDown(self):
+        """Common teardown."""
+        shutil.rmtree(self.topdir)
+
+    def _new_state(self, time=_TIME):
+        with mock.patch("time.time", return_value=time):
+            return sync.LocalSyncState(self.manifest)
+
+    def test_set(self):
+        """Times are set."""
+        p = mock.MagicMock(relpath="projA")
+        self.state.SetFetchTime(p)
+        self.state.SetCheckoutTime(p)
+        self.assertEqual(self.state.GetFetchTime(p), self._TIME)
+        self.assertEqual(self.state.GetCheckoutTime(p), self._TIME)
+
+    def test_update(self):
+        """Times are updated."""
+        with open(self.state._path, "w") as f:
+            f.write(
+                """
+            {
+              "projB": {
+                "last_fetch": 5,
+                "last_checkout": 7
+              }
+            }
+            """
+            )
+
+        # Initialize state to read from the new file.
+        self.state = self._new_state()
+        projA = mock.MagicMock(relpath="projA")
+        projB = mock.MagicMock(relpath="projB")
+        self.assertEqual(self.state.GetFetchTime(projA), None)
+        self.assertEqual(self.state.GetFetchTime(projB), 5)
+        self.assertEqual(self.state.GetCheckoutTime(projB), 7)
+
+        self.state.SetFetchTime(projA)
+        self.state.SetFetchTime(projB)
+        self.assertEqual(self.state.GetFetchTime(projA), self._TIME)
+        self.assertEqual(self.state.GetFetchTime(projB), self._TIME)
+        self.assertEqual(self.state.GetCheckoutTime(projB), 7)
+
+    def test_save_to_file(self):
+        """Data is saved under repodir."""
+        p = mock.MagicMock(relpath="projA")
+        self.state.SetFetchTime(p)
+        self.state.Save()
+        self.assertEqual(
+            os.listdir(self.repodir), [".repo_localsyncstate.json"]
+        )
+
+    def test_partial_sync(self):
+        """Partial sync state is detected."""
+        with open(self.state._path, "w") as f:
+            f.write(
+                """
+            {
+              "projA": {
+                "last_fetch": 5,
+                "last_checkout": 5
+              },
+              "projB": {
+                "last_fetch": 5,
+                "last_checkout": 5
+              }
+            }
+            """
+            )
+
+        # Initialize state to read from the new file.
+        self.state = self._new_state()
+        projB = mock.MagicMock(relpath="projB")
+        self.assertEqual(self.state.IsPartiallySynced(), False)
+
+        self.state.SetFetchTime(projB)
+        self.state.SetCheckoutTime(projB)
+        self.assertEqual(self.state.IsPartiallySynced(), True)
+
+    def test_ignore_repo_project(self):
+        """Sync data for repo project is ignored when checking partial sync."""
+        p = mock.MagicMock(relpath="projA")
+        self.state.SetFetchTime(p)
+        self.state.SetCheckoutTime(p)
+        self.state.SetFetchTime(self.manifest.repoProject)
+        self.state.Save()
+        self.assertEqual(self.state.IsPartiallySynced(), False)
+
+        self.state = self._new_state(self._TIME + 1)
+        self.state.SetFetchTime(self.manifest.repoProject)
+        self.assertEqual(
+            self.state.GetFetchTime(self.manifest.repoProject), self._TIME + 1
+        )
+        self.assertEqual(self.state.GetFetchTime(p), self._TIME)
+        self.assertEqual(self.state.IsPartiallySynced(), False)
+
+    def test_nonexistent_project(self):
+        """Unsaved projects don't have data."""
+        p = mock.MagicMock(relpath="projC")
+        self.assertEqual(self.state.GetFetchTime(p), None)
+        self.assertEqual(self.state.GetCheckoutTime(p), None)
+
+    def test_prune_removed_projects(self):
+        """Removed projects are pruned."""
+        with open(self.state._path, "w") as f:
+            f.write(
+                """
+            {
+              "projA": {
+                "last_fetch": 5
+              },
+              "projB": {
+                "last_fetch": 7
+              }
+            }
+            """
+            )
+
+        def mock_exists(path):
+            if "projA" in path:
+                return False
+            return True
+
+        projA = mock.MagicMock(relpath="projA")
+        projB = mock.MagicMock(relpath="projB")
+        self.state = self._new_state()
+        self.assertEqual(self.state.GetFetchTime(projA), 5)
+        self.assertEqual(self.state.GetFetchTime(projB), 7)
+        with mock.patch("os.path.exists", side_effect=mock_exists):
+            self.state.PruneRemovedProjects()
+        self.assertIsNone(self.state.GetFetchTime(projA))
+
+        self.state = self._new_state()
+        self.assertIsNone(self.state.GetFetchTime(projA))
+        self.assertEqual(self.state.GetFetchTime(projB), 7)
+
+
+class GetPreciousObjectsState(unittest.TestCase):
+    """Tests for _GetPreciousObjectsState."""
+
+    def setUp(self):
+        """Common setup."""
+        self.cmd = sync.Sync()
+        self.project = p = mock.MagicMock(
+            use_git_worktrees=False, UseAlternates=False
+        )
+        p.manifest.GetProjectsWithName.return_value = [p]
+
+        self.opt = mock.Mock(spec_set=["this_manifest_only"])
+        self.opt.this_manifest_only = False
+
+    def test_worktrees(self):
+        """False for worktrees."""
+        self.project.use_git_worktrees = True
+        self.assertFalse(
+            self.cmd._GetPreciousObjectsState(self.project, self.opt)
+        )
+
+    def test_not_shared(self):
+        """Singleton project."""
+        self.assertFalse(
+            self.cmd._GetPreciousObjectsState(self.project, self.opt)
+        )
+
+    def test_shared(self):
+        """Shared project."""
+        self.project.manifest.GetProjectsWithName.return_value = [
+            self.project,
+            self.project,
+        ]
+        self.assertTrue(
+            self.cmd._GetPreciousObjectsState(self.project, self.opt)
+        )
+
+    def test_shared_with_alternates(self):
+        """Shared project, with alternates."""
+        self.project.manifest.GetProjectsWithName.return_value = [
+            self.project,
+            self.project,
+        ]
+        self.project.UseAlternates = True
+        self.assertFalse(
+            self.cmd._GetPreciousObjectsState(self.project, self.opt)
+        )
+
+    def test_not_found(self):
+        """Project not found in manifest."""
+        self.project.manifest.GetProjectsWithName.return_value = []
+        self.assertFalse(
+            self.cmd._GetPreciousObjectsState(self.project, self.opt)
+        )
+
+
+class SyncCommand(unittest.TestCase):
+    """Tests for cmd.Execute."""
+
+    def setUp(self):
+        """Common setup."""
+        self.repodir = tempfile.mkdtemp(".repo")
+        self.manifest = manifest = mock.MagicMock(
+            repodir=self.repodir,
+        )
+
+        git_event_log = mock.MagicMock(ErrorEvent=mock.Mock(return_value=None))
+        self.outer_client = outer_client = mock.MagicMock()
+        outer_client.manifest.IsArchive = True
+        manifest.manifestProject.worktree = "worktree_path/"
+        manifest.repoProject.LastFetch = time.time()
+        self.sync_network_half_error = None
+        self.sync_local_half_error = None
+        self.cmd = sync.Sync(
+            manifest=manifest,
+            outer_client=outer_client,
+            git_event_log=git_event_log,
+        )
+
+        def Sync_NetworkHalf(*args, **kwargs):
+            return SyncNetworkHalfResult(True, self.sync_network_half_error)
+
+        def Sync_LocalHalf(*args, **kwargs):
+            if self.sync_local_half_error:
+                raise self.sync_local_half_error
+
+        self.project = p = mock.MagicMock(
+            use_git_worktrees=False,
+            UseAlternates=False,
+            name="project",
+            Sync_NetworkHalf=Sync_NetworkHalf,
+            Sync_LocalHalf=Sync_LocalHalf,
+            RelPath=mock.Mock(return_value="rel_path"),
+        )
+        p.manifest.GetProjectsWithName.return_value = [p]
+
+        mock.patch.object(
+            sync,
+            "_PostRepoFetch",
+            return_value=None,
+        ).start()
+
+        mock.patch.object(
+            self.cmd, "GetProjects", return_value=[self.project]
+        ).start()
+
+        opt, _ = self.cmd.OptionParser.parse_args([])
+        opt.clone_bundle = False
+        opt.jobs = 4
+        opt.quiet = True
+        opt.use_superproject = False
+        opt.current_branch_only = True
+        opt.optimized_fetch = True
+        opt.retry_fetches = 1
+        opt.prune = False
+        opt.auto_gc = False
+        opt.repo_verify = False
+        self.opt = opt
+
+    def tearDown(self):
+        mock.patch.stopall()
+
+    def test_command_exit_error(self):
+        """Ensure unsuccessful commands raise expected errors."""
+        self.sync_network_half_error = GitError(
+            "sync_network_half_error error", project=self.project
+        )
+        self.sync_local_half_error = GitError(
+            "sync_local_half_error", project=self.project
+        )
+        with self.assertRaises(RepoExitError) as e:
+            self.cmd.Execute(self.opt, [])
+            self.assertIn(self.sync_local_half_error, e.aggregate_errors)
+            self.assertIn(self.sync_network_half_error, e.aggregate_errors)

tests/test_subcmds_upload.py

@@ -0,0 +1,70 @@
+# Copyright (C) 2023 The Android Open Source Project
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#      http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+"""Unittests for the subcmds/upload.py module."""
+
+import unittest
+from unittest import mock
+
+from error import GitError
+from error import UploadError
+from subcmds import upload
+
+
+class UnexpectedError(Exception):
+    """An exception not expected by upload command."""
+
+
+class UploadCommand(unittest.TestCase):
+    """Check registered all_commands."""
+
+    def setUp(self):
+        self.cmd = upload.Upload()
+        self.branch = mock.MagicMock()
+        self.people = mock.MagicMock()
+        self.opt, _ = self.cmd.OptionParser.parse_args([])
+        mock.patch.object(
+            self.cmd, "_AppendAutoList", return_value=None
+        ).start()
+        mock.patch.object(self.cmd, "git_event_log").start()
+
+    def tearDown(self):
+        mock.patch.stopall()
+
+    def test_UploadAndReport_UploadError(self):
+        """Check UploadExitError raised when UploadError encountered."""
+        side_effect = UploadError("upload error")
+        with mock.patch.object(
+            self.cmd, "_UploadBranch", side_effect=side_effect
+        ):
+            with self.assertRaises(upload.UploadExitError):
+                self.cmd._UploadAndReport(self.opt, [self.branch], self.people)
+
+    def test_UploadAndReport_GitError(self):
+        """Check UploadExitError raised when GitError encountered."""
+        side_effect = GitError("some git error")
+        with mock.patch.object(
+            self.cmd, "_UploadBranch", side_effect=side_effect
+        ):
+            with self.assertRaises(upload.UploadExitError):
+                self.cmd._UploadAndReport(self.opt, [self.branch], self.people)
+
+    def test_UploadAndReport_UnhandledError(self):
+        """Check UnexpectedError passed through."""
+        side_effect = UnexpectedError("some os error")
+        with mock.patch.object(
+            self.cmd, "_UploadBranch", side_effect=side_effect
+        ):
+            with self.assertRaises(type(side_effect)):
+                self.cmd._UploadAndReport(self.opt, [self.branch], self.people)

tests/test_update_manpages.py

@@ -0,0 +1,28 @@
+# Copyright 2022 The Android Open Source Project
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#      http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+"""Unittests for the update_manpages module."""
+
+import unittest
+
+from release import update_manpages
+
+
+class UpdateManpagesTest(unittest.TestCase):
+    """Tests the update-manpages code."""
+
+    def test_replace_regex(self):
+        """Check that replace_regex works."""
+        data = "\n\033[1mSummary\033[m\n"
+        self.assertEqual(update_manpages.replace_regex(data), "\nSummary\n")

tox.ini

@@ -15,7 +15,8 @@
 # https://tox.readthedocs.io/
 
 [tox]
-envlist = py36, py37, py38, py39
+envlist = lint, py36, py37, py38, py39, py310, py311
+requires = virtualenv<20.22.0
 
 [gh-actions]
 python =
@@ -23,11 +24,39 @@ python =
     3.7: py37
     3.8: py38
     3.9: py39
+    3.10: py310
+    3.11: py311
 
 [testenv]
-deps = pytest
+deps =
-commands = {envpython} run_tests
+    black
+    flake8
+    isort
+    pytest
+    pytest-timeout
+commands = {envpython} run_tests {posargs}
 setenv =
     GIT_AUTHOR_NAME = Repo test author
     GIT_COMMITTER_NAME = Repo test committer
     EMAIL = repo@gerrit.nodomain
+
+[testenv:lint]
+skip_install = true
+deps =
+    black
+    flake8
+commands =
+    black --check {posargs:.}
+    flake8
+
+[testenv:format]
+skip_install = true
+deps =
+    black
+    flake8
+commands =
+    black {posargs:.}
+    flake8
+
+[pytest]
+timeout = 300

wrapper.py

@@ -12,24 +12,21 @@
 # See the License for the specific language governing permissions and
 # limitations under the License.
 
-try:
+import functools
-  from importlib.machinery import SourceFileLoader
+import importlib.machinery
-  _loader = lambda *args: SourceFileLoader(*args).load_module()
+import importlib.util
-except ImportError:
-  import imp
-  _loader = lambda *args: imp.load_source(*args)
 import os
 
 
 def WrapperPath():
-  return os.path.join(os.path.dirname(__file__), 'repo')
+    return os.path.join(os.path.dirname(__file__), "repo")
-
-
-_wrapper_module = None
 
 
+@functools.lru_cache(maxsize=None)
 def Wrapper():
-  global _wrapper_module
+    modname = "wrapper"
-  if not _wrapper_module:
+    loader = importlib.machinery.SourceFileLoader(modname, WrapperPath())
-    _wrapper_module = _loader('wrapper', WrapperPath())
+    spec = importlib.util.spec_from_loader(modname, loader)
-  return _wrapper_module
+    module = importlib.util.module_from_spec(spec)
+    loader.exec_module(module)
+    return module