mirror of
https://gerrit.googlesource.com/git-repo
synced 2025-06-28 20:17:26 +00:00
Compare commits
12 Commits
Author | SHA1 | Date | |
---|---|---|---|
d92076d930 | |||
aeb2eee9d3 | |||
45d1c372a7 | |||
19607b2817 | |||
68744dbc01 | |||
ef412624e9 | |||
a06ab7d28b | |||
471a7ed5f7 | |||
619a2b5887 | |||
ab15e42fa4 | |||
75c02fe4cb | |||
afd1b4023f |
16
.flake8
16
.flake8
@ -1,15 +1,3 @@
|
|||||||
[flake8]
|
[flake8]
|
||||||
max-line-length=100
|
max-line-length=80
|
||||||
ignore=
|
ignore=E111,E114,E402
|
||||||
# E111: Indentation is not a multiple of four
|
|
||||||
E111,
|
|
||||||
# E114: Indentation is not a multiple of four (comment)
|
|
||||||
E114,
|
|
||||||
# E402: Module level import not at top of file
|
|
||||||
E402,
|
|
||||||
# E731: do not assign a lambda expression, use a def
|
|
||||||
E731,
|
|
||||||
# W503: Line break before binary operator
|
|
||||||
W503,
|
|
||||||
# W504: Line break after binary operator
|
|
||||||
W504
|
|
||||||
|
31
.github/workflows/test-ci.yml
vendored
31
.github/workflows/test-ci.yml
vendored
@ -1,31 +0,0 @@
|
|||||||
# GitHub actions workflow.
|
|
||||||
# https://help.github.com/en/actions/automating-your-workflow-with-github-actions/workflow-syntax-for-github-actions
|
|
||||||
|
|
||||||
name: Test CI
|
|
||||||
|
|
||||||
on:
|
|
||||||
push:
|
|
||||||
branches: [main, repo-1, stable, maint]
|
|
||||||
tags: [v*]
|
|
||||||
|
|
||||||
jobs:
|
|
||||||
test:
|
|
||||||
strategy:
|
|
||||||
fail-fast: false
|
|
||||||
matrix:
|
|
||||||
os: [ubuntu-latest, macos-latest, windows-latest]
|
|
||||||
python-version: [3.5, 3.6, 3.7, 3.8, 3.9]
|
|
||||||
runs-on: ${{ matrix.os }}
|
|
||||||
|
|
||||||
steps:
|
|
||||||
- uses: actions/checkout@v2
|
|
||||||
- name: Set up Python ${{ matrix.python-version }}
|
|
||||||
uses: actions/setup-python@v1
|
|
||||||
with:
|
|
||||||
python-version: ${{ matrix.python-version }}
|
|
||||||
- name: Install dependencies
|
|
||||||
run: |
|
|
||||||
python -m pip install --upgrade pip
|
|
||||||
pip install tox tox-gh-actions
|
|
||||||
- name: Test with tox
|
|
||||||
run: tox
|
|
2
.gitignore
vendored
2
.gitignore
vendored
@ -1,4 +1,3 @@
|
|||||||
*.asc
|
|
||||||
*.egg-info/
|
*.egg-info/
|
||||||
*.log
|
*.log
|
||||||
*.pyc
|
*.pyc
|
||||||
@ -7,7 +6,6 @@ __pycache__
|
|||||||
.repopickle_*
|
.repopickle_*
|
||||||
/repoc
|
/repoc
|
||||||
/.tox
|
/.tox
|
||||||
/.venv
|
|
||||||
|
|
||||||
# PyCharm related
|
# PyCharm related
|
||||||
/.idea/
|
/.idea/
|
||||||
|
1
.mailmap
1
.mailmap
@ -4,7 +4,6 @@ Hu Xiuyun <xiuyun.hu@hisilicon.com> Hu xiuyun <xiuyun.hu@hisilicon.com
|
|||||||
Hu Xiuyun <xiuyun.hu@hisilicon.com> Hu Xiuyun <clouds08@qq.com>
|
Hu Xiuyun <xiuyun.hu@hisilicon.com> Hu Xiuyun <clouds08@qq.com>
|
||||||
Jelly Chen <chenguodong@huawei.com> chenguodong <chenguodong@huawei.com>
|
Jelly Chen <chenguodong@huawei.com> chenguodong <chenguodong@huawei.com>
|
||||||
Jia Bi <bijia@xiaomi.com> bijia <bijia@xiaomi.com>
|
Jia Bi <bijia@xiaomi.com> bijia <bijia@xiaomi.com>
|
||||||
Jiri Tyr <jiri.tyr@gmail.com> Jiri tyr <jiri.tyr@gmail.com>
|
|
||||||
JoonCheol Park <jooncheol@gmail.com> Jooncheol Park <jooncheol@gmail.com>
|
JoonCheol Park <jooncheol@gmail.com> Jooncheol Park <jooncheol@gmail.com>
|
||||||
Sergii Pylypenko <x.pelya.x@gmail.com> pelya <x.pelya.x@gmail.com>
|
Sergii Pylypenko <x.pelya.x@gmail.com> pelya <x.pelya.x@gmail.com>
|
||||||
Shawn Pearce <sop@google.com> Shawn O. Pearce <sop@google.com>
|
Shawn Pearce <sop@google.com> Shawn O. Pearce <sop@google.com>
|
||||||
|
29
README.md
29
README.md
@ -6,29 +6,15 @@ development workflow. Repo is not meant to replace Git, only to make it
|
|||||||
easier to work with Git. The repo command is an executable Python script
|
easier to work with Git. The repo command is an executable Python script
|
||||||
that you can put anywhere in your path.
|
that you can put anywhere in your path.
|
||||||
|
|
||||||
* Homepage: <https://gerrit.googlesource.com/git-repo/>
|
* Homepage: https://gerrit.googlesource.com/git-repo/
|
||||||
* Mailing list: [repo-discuss on Google Groups][repo-discuss]
|
* Bug reports: https://bugs.chromium.org/p/gerrit/issues/list?q=component:repo
|
||||||
* Bug reports: <https://bugs.chromium.org/p/gerrit/issues/list?q=component:repo>
|
* Source: https://gerrit.googlesource.com/git-repo/
|
||||||
* Source: <https://gerrit.googlesource.com/git-repo/>
|
* Overview: https://source.android.com/source/developing.html
|
||||||
* Overview: <https://source.android.com/source/developing.html>
|
* Docs: https://source.android.com/source/using-repo.html
|
||||||
* Docs: <https://source.android.com/source/using-repo.html>
|
|
||||||
* [repo Manifest Format](./docs/manifest-format.md)
|
* [repo Manifest Format](./docs/manifest-format.md)
|
||||||
* [repo Hooks](./docs/repo-hooks.md)
|
* [repo Hooks](./docs/repo-hooks.md)
|
||||||
* [Submitting patches](./SUBMITTING_PATCHES.md)
|
* [Submitting patches](./SUBMITTING_PATCHES.md)
|
||||||
* Running Repo in [Microsoft Windows](./docs/windows.md)
|
* Running Repo in [Microsoft Windows](./docs/windows.md)
|
||||||
* GitHub mirror: <https://github.com/GerritCodeReview/git-repo>
|
|
||||||
* Postsubmit tests: <https://github.com/GerritCodeReview/git-repo/actions>
|
|
||||||
|
|
||||||
## Contact
|
|
||||||
|
|
||||||
Please use the [repo-discuss] mailing list or [issue tracker] for questions.
|
|
||||||
|
|
||||||
You can [file a new bug report][new-bug] under the "repo" component.
|
|
||||||
|
|
||||||
Please do not e-mail individual developers for support.
|
|
||||||
They do not have the bandwidth for it, and often times questions have already
|
|
||||||
been asked on [repo-discuss] or bugs posted to the [issue tracker].
|
|
||||||
So please search those sites first.
|
|
||||||
|
|
||||||
## Install
|
## Install
|
||||||
|
|
||||||
@ -48,8 +34,3 @@ $ PATH="${HOME}/.bin:${PATH}"
|
|||||||
$ curl https://storage.googleapis.com/git-repo-downloads/repo > ~/.bin/repo
|
$ curl https://storage.googleapis.com/git-repo-downloads/repo > ~/.bin/repo
|
||||||
$ chmod a+rx ~/.bin/repo
|
$ chmod a+rx ~/.bin/repo
|
||||||
```
|
```
|
||||||
|
|
||||||
|
|
||||||
[new-bug]: https://bugs.chromium.org/p/gerrit/issues/entry?template=Repo+tool+issue
|
|
||||||
[issue tracker]: https://bugs.chromium.org/p/gerrit/issues/list?q=component:repo
|
|
||||||
[repo-discuss]: https://groups.google.com/forum/#!forum/repo-discuss
|
|
||||||
|
@ -4,13 +4,13 @@
|
|||||||
|
|
||||||
- Make small logical changes.
|
- Make small logical changes.
|
||||||
- Provide a meaningful commit message.
|
- Provide a meaningful commit message.
|
||||||
- Check for coding errors and style nits with flake8.
|
- Check for coding errors and style nits with pyflakes and flake8
|
||||||
- Make sure all code is under the Apache License, 2.0.
|
- Make sure all code is under the Apache License, 2.0.
|
||||||
- Publish your changes for review.
|
- Publish your changes for review.
|
||||||
- Make corrections if requested.
|
- Make corrections if requested.
|
||||||
- Verify your changes on gerrit so they can be submitted.
|
- Verify your changes on gerrit so they can be submitted.
|
||||||
|
|
||||||
`git push https://gerrit-review.googlesource.com/git-repo HEAD:refs/for/main`
|
`git push https://gerrit-review.googlesource.com/git-repo HEAD:refs/for/master`
|
||||||
|
|
||||||
|
|
||||||
# Long Version
|
# Long Version
|
||||||
@ -38,30 +38,34 @@ If your description starts to get too long, that's a sign that you
|
|||||||
probably need to split up your commit to finer grained pieces.
|
probably need to split up your commit to finer grained pieces.
|
||||||
|
|
||||||
|
|
||||||
## Check for coding errors and style violations with flake8
|
## Check for coding errors and style nits with pyflakes and flake8
|
||||||
|
|
||||||
Run `flake8` on changed modules:
|
### Coding errors
|
||||||
|
|
||||||
|
Run `pyflakes` on changed modules:
|
||||||
|
|
||||||
|
pyflakes file.py
|
||||||
|
|
||||||
|
Ideally there should be no new errors or warnings introduced.
|
||||||
|
|
||||||
|
### Style violations
|
||||||
|
|
||||||
|
Run `flake8` on changes modules:
|
||||||
|
|
||||||
flake8 file.py
|
flake8 file.py
|
||||||
|
|
||||||
Note that repo generally follows [Google's Python Style Guide] rather than
|
Note that repo generally follows [Google's python style guide] rather than
|
||||||
[PEP 8], with a couple of notable exceptions:
|
[PEP 8], so it's possible that the output of `flake8` will be quite noisy.
|
||||||
|
It's not mandatory to avoid all warnings, but at least the maximum line
|
||||||
|
length should be followed.
|
||||||
|
|
||||||
* Indentation is at 2 columns rather than 4
|
If there are many occurrences of the same warning that cannot be
|
||||||
* The maximum line length is 100 columns rather than 80
|
avoided without going against the Google style guide, these may be
|
||||||
|
suppressed in the included `.flake8` file.
|
||||||
|
|
||||||
There should be no new errors or warnings introduced.
|
[Google's python style guide]: https://google.github.io/styleguide/pyguide.html
|
||||||
|
|
||||||
Warnings that cannot be avoided without going against the Google Style Guide
|
|
||||||
may be suppressed inline individally using a `# noqa` comment as described
|
|
||||||
in the [flake8 documentation].
|
|
||||||
|
|
||||||
If there are many occurrences of the same warning, these may be suppressed for
|
|
||||||
the entire project in the included `.flake8` file.
|
|
||||||
|
|
||||||
[Google's Python Style Guide]: https://google.github.io/styleguide/pyguide.html
|
|
||||||
[PEP 8]: https://www.python.org/dev/peps/pep-0008/
|
[PEP 8]: https://www.python.org/dev/peps/pep-0008/
|
||||||
[flake8 documentation]: https://flake8.pycqa.org/en/3.1.1/user/ignoring-errors.html#in-line-ignoring-errors
|
|
||||||
|
|
||||||
## Running tests
|
## Running tests
|
||||||
|
|
||||||
@ -150,7 +154,7 @@ Push your patches over HTTPS to the review server, possibly through
|
|||||||
a remembered remote to make this easier in the future:
|
a remembered remote to make this easier in the future:
|
||||||
|
|
||||||
git config remote.review.url https://gerrit-review.googlesource.com/git-repo
|
git config remote.review.url https://gerrit-review.googlesource.com/git-repo
|
||||||
git config remote.review.push HEAD:refs/for/main
|
git config remote.review.push HEAD:refs/for/master
|
||||||
|
|
||||||
git push review
|
git push review
|
||||||
|
|
||||||
|
3
color.py
3
color.py
@ -1,3 +1,5 @@
|
|||||||
|
# -*- coding:utf-8 -*-
|
||||||
|
#
|
||||||
# Copyright (C) 2008 The Android Open Source Project
|
# Copyright (C) 2008 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
@ -82,7 +84,6 @@ def _Color(fg=None, bg=None, attr=None):
|
|||||||
code = ''
|
code = ''
|
||||||
return code
|
return code
|
||||||
|
|
||||||
|
|
||||||
DEFAULT = None
|
DEFAULT = None
|
||||||
|
|
||||||
|
|
||||||
|
105
command.py
105
command.py
@ -1,3 +1,5 @@
|
|||||||
|
# -*- coding:utf-8 -*-
|
||||||
|
#
|
||||||
# Copyright (C) 2008 The Android Open Source Project
|
# Copyright (C) 2008 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
@ -12,7 +14,6 @@
|
|||||||
# See the License for the specific language governing permissions and
|
# See the License for the specific language governing permissions and
|
||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
|
|
||||||
import multiprocessing
|
|
||||||
import os
|
import os
|
||||||
import optparse
|
import optparse
|
||||||
import platform
|
import platform
|
||||||
@ -22,21 +23,6 @@ import sys
|
|||||||
from event_log import EventLog
|
from event_log import EventLog
|
||||||
from error import NoSuchProjectError
|
from error import NoSuchProjectError
|
||||||
from error import InvalidProjectGroupsError
|
from error import InvalidProjectGroupsError
|
||||||
import progress
|
|
||||||
|
|
||||||
|
|
||||||
# Number of projects to submit to a single worker process at a time.
|
|
||||||
# This number represents a tradeoff between the overhead of IPC and finer
|
|
||||||
# grained opportunity for parallelism. This particular value was chosen by
|
|
||||||
# iterating through powers of two until the overall performance no longer
|
|
||||||
# improved. The performance of this batch size is not a function of the
|
|
||||||
# number of cores on the system.
|
|
||||||
WORKER_BATCH_SIZE = 32
|
|
||||||
|
|
||||||
|
|
||||||
# How many jobs to run in parallel by default? This assumes the jobs are
|
|
||||||
# largely I/O bound and do not hit the network.
|
|
||||||
DEFAULT_LOCAL_JOBS = min(os.cpu_count(), 8)
|
|
||||||
|
|
||||||
|
|
||||||
class Command(object):
|
class Command(object):
|
||||||
@ -48,10 +34,6 @@ class Command(object):
|
|||||||
manifest = None
|
manifest = None
|
||||||
_optparse = None
|
_optparse = None
|
||||||
|
|
||||||
# Whether this command supports running in parallel. If greater than 0,
|
|
||||||
# it is the number of parallel jobs to default to.
|
|
||||||
PARALLEL_JOBS = None
|
|
||||||
|
|
||||||
def WantPager(self, _opt):
|
def WantPager(self, _opt):
|
||||||
return False
|
return False
|
||||||
|
|
||||||
@ -84,35 +66,13 @@ class Command(object):
|
|||||||
usage = self.helpUsage.strip().replace('%prog', me)
|
usage = self.helpUsage.strip().replace('%prog', me)
|
||||||
except AttributeError:
|
except AttributeError:
|
||||||
usage = 'repo %s' % self.NAME
|
usage = 'repo %s' % self.NAME
|
||||||
epilog = 'Run `repo help %s` to view the detailed manual.' % self.NAME
|
self._optparse = optparse.OptionParser(usage=usage)
|
||||||
self._optparse = optparse.OptionParser(usage=usage, epilog=epilog)
|
|
||||||
self._CommonOptions(self._optparse)
|
|
||||||
self._Options(self._optparse)
|
self._Options(self._optparse)
|
||||||
return self._optparse
|
return self._optparse
|
||||||
|
|
||||||
def _CommonOptions(self, p, opt_v=True):
|
|
||||||
"""Initialize the option parser with common options.
|
|
||||||
|
|
||||||
These will show up for *all* subcommands, so use sparingly.
|
|
||||||
NB: Keep in sync with repo:InitParser().
|
|
||||||
"""
|
|
||||||
g = p.add_option_group('Logging options')
|
|
||||||
opts = ['-v'] if opt_v else []
|
|
||||||
g.add_option(*opts, '--verbose',
|
|
||||||
dest='output_mode', action='store_true',
|
|
||||||
help='show all output')
|
|
||||||
g.add_option('-q', '--quiet',
|
|
||||||
dest='output_mode', action='store_false',
|
|
||||||
help='only show errors')
|
|
||||||
|
|
||||||
if self.PARALLEL_JOBS is not None:
|
|
||||||
p.add_option(
|
|
||||||
'-j', '--jobs',
|
|
||||||
type=int, default=self.PARALLEL_JOBS,
|
|
||||||
help='number of jobs to run in parallel (default: %s)' % self.PARALLEL_JOBS)
|
|
||||||
|
|
||||||
def _Options(self, p):
|
def _Options(self, p):
|
||||||
"""Initialize the option parser with subcommand-specific options."""
|
"""Initialize the option parser.
|
||||||
|
"""
|
||||||
|
|
||||||
def _RegisteredEnvironmentOptions(self):
|
def _RegisteredEnvironmentOptions(self):
|
||||||
"""Get options that can be set from environment variables.
|
"""Get options that can be set from environment variables.
|
||||||
@ -138,11 +98,6 @@ class Command(object):
|
|||||||
self.OptionParser.print_usage()
|
self.OptionParser.print_usage()
|
||||||
sys.exit(1)
|
sys.exit(1)
|
||||||
|
|
||||||
def CommonValidateOptions(self, opt, args):
|
|
||||||
"""Validate common options."""
|
|
||||||
opt.quiet = opt.output_mode is False
|
|
||||||
opt.verbose = opt.output_mode is True
|
|
||||||
|
|
||||||
def ValidateOptions(self, opt, args):
|
def ValidateOptions(self, opt, args):
|
||||||
"""Validate the user options & arguments before executing.
|
"""Validate the user options & arguments before executing.
|
||||||
|
|
||||||
@ -158,44 +113,6 @@ class Command(object):
|
|||||||
"""
|
"""
|
||||||
raise NotImplementedError
|
raise NotImplementedError
|
||||||
|
|
||||||
@staticmethod
|
|
||||||
def ExecuteInParallel(jobs, func, inputs, callback, output=None, ordered=False):
|
|
||||||
"""Helper for managing parallel execution boiler plate.
|
|
||||||
|
|
||||||
For subcommands that can easily split their work up.
|
|
||||||
|
|
||||||
Args:
|
|
||||||
jobs: How many parallel processes to use.
|
|
||||||
func: The function to apply to each of the |inputs|. Usually a
|
|
||||||
functools.partial for wrapping additional arguments. It will be run
|
|
||||||
in a separate process, so it must be pickalable, so nested functions
|
|
||||||
won't work. Methods on the subcommand Command class should work.
|
|
||||||
inputs: The list of items to process. Must be a list.
|
|
||||||
callback: The function to pass the results to for processing. It will be
|
|
||||||
executed in the main thread and process the results of |func| as they
|
|
||||||
become available. Thus it may be a local nested function. Its return
|
|
||||||
value is passed back directly. It takes three arguments:
|
|
||||||
- The processing pool (or None with one job).
|
|
||||||
- The |output| argument.
|
|
||||||
- An iterator for the results.
|
|
||||||
output: An output manager. May be progress.Progess or color.Coloring.
|
|
||||||
ordered: Whether the jobs should be processed in order.
|
|
||||||
|
|
||||||
Returns:
|
|
||||||
The |callback| function's results are returned.
|
|
||||||
"""
|
|
||||||
try:
|
|
||||||
# NB: Multiprocessing is heavy, so don't spin it up for one job.
|
|
||||||
if len(inputs) == 1 or jobs == 1:
|
|
||||||
return callback(None, output, (func(x) for x in inputs))
|
|
||||||
else:
|
|
||||||
with multiprocessing.Pool(jobs) as pool:
|
|
||||||
submit = pool.imap if ordered else pool.imap_unordered
|
|
||||||
return callback(pool, output, submit(func, inputs, chunksize=WORKER_BATCH_SIZE))
|
|
||||||
finally:
|
|
||||||
if isinstance(output, progress.Progress):
|
|
||||||
output.end()
|
|
||||||
|
|
||||||
def _ResetPathToProjectMap(self, projects):
|
def _ResetPathToProjectMap(self, projects):
|
||||||
self._by_path = dict((p.worktree, p) for p in projects)
|
self._by_path = dict((p.worktree, p) for p in projects)
|
||||||
|
|
||||||
@ -206,9 +123,9 @@ class Command(object):
|
|||||||
project = None
|
project = None
|
||||||
if os.path.exists(path):
|
if os.path.exists(path):
|
||||||
oldpath = None
|
oldpath = None
|
||||||
while (path and
|
while path and \
|
||||||
path != oldpath and
|
path != oldpath and \
|
||||||
path != manifest.topdir):
|
path != manifest.topdir:
|
||||||
try:
|
try:
|
||||||
project = self._by_path[path]
|
project = self._by_path[path]
|
||||||
break
|
break
|
||||||
@ -239,7 +156,9 @@ class Command(object):
|
|||||||
mp = manifest.manifestProject
|
mp = manifest.manifestProject
|
||||||
|
|
||||||
if not groups:
|
if not groups:
|
||||||
groups = manifest.GetGroupsStr()
|
groups = mp.config.GetString('manifest.groups')
|
||||||
|
if not groups:
|
||||||
|
groups = 'default,platform-' + platform.system().lower()
|
||||||
groups = [x for x in re.split(r'[,\s]+', groups) if x]
|
groups = [x for x in re.split(r'[,\s]+', groups) if x]
|
||||||
|
|
||||||
if not args:
|
if not args:
|
||||||
@ -317,7 +236,6 @@ class InteractiveCommand(Command):
|
|||||||
"""Command which requires user interaction on the tty and
|
"""Command which requires user interaction on the tty and
|
||||||
must not run within a pager, even if the user asks to.
|
must not run within a pager, even if the user asks to.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
def WantPager(self, _opt):
|
def WantPager(self, _opt):
|
||||||
return False
|
return False
|
||||||
|
|
||||||
@ -326,7 +244,6 @@ class PagedCommand(Command):
|
|||||||
"""Command which defaults to output in a pager, as its
|
"""Command which defaults to output in a pager, as its
|
||||||
display tends to be larger than one screen full.
|
display tends to be larger than one screen full.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
def WantPager(self, _opt):
|
def WantPager(self, _opt):
|
||||||
return True
|
return True
|
||||||
|
|
||||||
|
121
completion.bash
121
completion.bash
@ -1,121 +0,0 @@
|
|||||||
# Copyright 2021 The Android Open Source Project
|
|
||||||
#
|
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
|
||||||
# you may not use this file except in compliance with the License.
|
|
||||||
# You may obtain a copy of the License at
|
|
||||||
#
|
|
||||||
# http://www.apache.org/licenses/LICENSE-2.0
|
|
||||||
#
|
|
||||||
# Unless required by applicable law or agreed to in writing, software
|
|
||||||
# distributed under the License is distributed on an "AS IS" BASIS,
|
|
||||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
|
||||||
# See the License for the specific language governing permissions and
|
|
||||||
# limitations under the License.
|
|
||||||
|
|
||||||
# Programmable bash completion. https://github.com/scop/bash-completion
|
|
||||||
|
|
||||||
# Complete the list of repo subcommands.
|
|
||||||
__complete_repo_list_commands() {
|
|
||||||
local repo=${COMP_WORDS[0]}
|
|
||||||
(
|
|
||||||
# Handle completions if running outside of a checkout.
|
|
||||||
if ! "${repo}" help --all 2>/dev/null; then
|
|
||||||
repo help 2>/dev/null
|
|
||||||
fi
|
|
||||||
) | sed -n '/^ /{s/ \([^ ]\+\) .\+/\1/;p}'
|
|
||||||
}
|
|
||||||
|
|
||||||
# Complete list of all branches available in all projects in the repo client
|
|
||||||
# checkout.
|
|
||||||
__complete_repo_list_branches() {
|
|
||||||
local repo=${COMP_WORDS[0]}
|
|
||||||
"${repo}" branches 2>/dev/null | \
|
|
||||||
sed -n '/|/{s/[ *][Pp ] *\([^ ]\+\) .*/\1/;p}'
|
|
||||||
}
|
|
||||||
|
|
||||||
# Complete list of all projects available in the repo client checkout.
|
|
||||||
__complete_repo_list_projects() {
|
|
||||||
local repo=${COMP_WORDS[0]}
|
|
||||||
"${repo}" list -n 2>/dev/null
|
|
||||||
}
|
|
||||||
|
|
||||||
# Complete the repo <command> argument.
|
|
||||||
__complete_repo_command() {
|
|
||||||
if [[ ${COMP_CWORD} -ne 1 ]]; then
|
|
||||||
return 1
|
|
||||||
fi
|
|
||||||
|
|
||||||
local command=${COMP_WORDS[1]}
|
|
||||||
COMPREPLY=($(compgen -W "$(__complete_repo_list_commands)" -- "${command}"))
|
|
||||||
return 0
|
|
||||||
}
|
|
||||||
|
|
||||||
# Complete repo subcommands that take <branch> <projects>.
|
|
||||||
__complete_repo_command_branch_projects() {
|
|
||||||
local current=$1
|
|
||||||
if [[ ${COMP_CWORD} -eq 2 ]]; then
|
|
||||||
COMPREPLY=($(compgen -W "$(__complete_repo_list_branches)" -- "${current}"))
|
|
||||||
else
|
|
||||||
COMPREPLY=($(compgen -W "$(__complete_repo_list_projects)" -- "${current}"))
|
|
||||||
fi
|
|
||||||
}
|
|
||||||
|
|
||||||
# Complete repo subcommands that take only <projects>.
|
|
||||||
__complete_repo_command_projects() {
|
|
||||||
local current=$1
|
|
||||||
COMPREPLY=($(compgen -W "$(__complete_repo_list_projects)" -- "${current}"))
|
|
||||||
}
|
|
||||||
|
|
||||||
# Complete the repo subcommand arguments.
|
|
||||||
__complete_repo_arg() {
|
|
||||||
if [[ ${COMP_CWORD} -le 1 ]]; then
|
|
||||||
return 1
|
|
||||||
fi
|
|
||||||
|
|
||||||
local command=${COMP_WORDS[1]}
|
|
||||||
local current=${COMP_WORDS[COMP_CWORD]}
|
|
||||||
case ${command} in
|
|
||||||
abandon|checkout)
|
|
||||||
__complete_repo_command_branch_projects "${current}"
|
|
||||||
return 0
|
|
||||||
;;
|
|
||||||
|
|
||||||
branch|branches|diff|info|list|overview|prune|rebase|smartsync|stage|status|\
|
|
||||||
sync|upload)
|
|
||||||
__complete_repo_command_projects "${current}"
|
|
||||||
return 0
|
|
||||||
;;
|
|
||||||
|
|
||||||
help)
|
|
||||||
if [[ ${COMP_CWORD} -eq 2 ]]; then
|
|
||||||
COMPREPLY=(
|
|
||||||
$(compgen -W "$(__complete_repo_list_commands)" -- "${current}")
|
|
||||||
)
|
|
||||||
fi
|
|
||||||
return 0
|
|
||||||
;;
|
|
||||||
|
|
||||||
start)
|
|
||||||
if [[ ${COMP_CWORD} -gt 2 ]]; then
|
|
||||||
COMPREPLY=(
|
|
||||||
$(compgen -W "$(__complete_repo_list_projects)" -- "${current}")
|
|
||||||
)
|
|
||||||
fi
|
|
||||||
return 0
|
|
||||||
;;
|
|
||||||
|
|
||||||
*)
|
|
||||||
return 1
|
|
||||||
;;
|
|
||||||
esac
|
|
||||||
}
|
|
||||||
|
|
||||||
# Complete the repo arguments.
|
|
||||||
__complete_repo() {
|
|
||||||
COMPREPLY=()
|
|
||||||
__complete_repo_command && return 0
|
|
||||||
__complete_repo_arg && return 0
|
|
||||||
return 0
|
|
||||||
}
|
|
||||||
|
|
||||||
complete -F __complete_repo repo
|
|
@ -1,257 +0,0 @@
|
|||||||
# Repo internal filesystem layout
|
|
||||||
|
|
||||||
A reference to the `.repo/` tree in repo client checkouts.
|
|
||||||
Hopefully it's complete & up-to-date, but who knows!
|
|
||||||
|
|
||||||
*** note
|
|
||||||
**Warning**:
|
|
||||||
This is meant for developers of the repo project itself as a quick reference.
|
|
||||||
**Nothing** in here must be construed as ABI, or that repo itself will never
|
|
||||||
change its internals in backwards incompatible ways.
|
|
||||||
***
|
|
||||||
|
|
||||||
[TOC]
|
|
||||||
|
|
||||||
## .repo/ layout
|
|
||||||
|
|
||||||
All content under `.repo/` is managed by `repo` itself with few exceptions.
|
|
||||||
|
|
||||||
In general, you should not make manual changes in here.
|
|
||||||
If a setting was initialized using an option to `repo init`, you should use that
|
|
||||||
command to change the setting later on.
|
|
||||||
It is always safe to re-run `repo init` in existing repo client checkouts.
|
|
||||||
For example, if you want to change the manifest branch, you can simply run
|
|
||||||
`repo init --manifest-branch=<new name>` and repo will take care of the rest.
|
|
||||||
|
|
||||||
* `config`: Per-repo client checkout settings using [git-config] file format.
|
|
||||||
* `.repo_config.json`: JSON cache of the `config` file for repo to
|
|
||||||
read/process quickly.
|
|
||||||
|
|
||||||
### repo/ state
|
|
||||||
|
|
||||||
* `repo/`: A git checkout of the repo project. This is how `repo` re-execs
|
|
||||||
itself to get the latest released version.
|
|
||||||
|
|
||||||
It tracks the git repository at `REPO_URL` using the `REPO_REV` branch.
|
|
||||||
Those are specified at `repo init` time using the `--repo-url=<REPO_URL>`
|
|
||||||
and `--repo-rev=<REPO_REV>` options.
|
|
||||||
|
|
||||||
Any changes made to this directory will usually be automatically discarded
|
|
||||||
by repo itself when it checks for updates. If you want to update to the
|
|
||||||
latest version of repo, use `repo selfupdate` instead. If you want to
|
|
||||||
change the git URL/branch that this tracks, re-run `repo init` with the new
|
|
||||||
settings.
|
|
||||||
|
|
||||||
* `.repo_fetchtimes.json`: Used by `repo sync` to record stats when syncing
|
|
||||||
the various projects.
|
|
||||||
|
|
||||||
### Manifests
|
|
||||||
|
|
||||||
For more documentation on the manifest format, including the local_manifests
|
|
||||||
support, see the [manifest-format.md] file.
|
|
||||||
|
|
||||||
* `manifests/`: A git checkout of the manifest project. Its `.git/` state
|
|
||||||
points to the `manifest.git` bare checkout (see below). It tracks the git
|
|
||||||
branch specified at `repo init` time via `--manifest-branch`.
|
|
||||||
|
|
||||||
The local branch name is always `default` regardless of the remote tracking
|
|
||||||
branch. Do not get confused if the remote branch is not `default`, or if
|
|
||||||
there is a remote `default` that is completely different!
|
|
||||||
|
|
||||||
No manual changes should be made in here as it will just confuse repo and
|
|
||||||
it won't automatically recover causing no new changes to be picked up.
|
|
||||||
|
|
||||||
* `manifests.git/`: A bare checkout of the manifest project. It tracks the
|
|
||||||
git repository specified at `repo init` time via `--manifest-url`.
|
|
||||||
|
|
||||||
No manual changes should be made in here as it will just confuse repo.
|
|
||||||
If you want to switch the tracking settings, re-run `repo init` with the
|
|
||||||
new settings.
|
|
||||||
|
|
||||||
* `manifest.xml`: The manifest that repo uses. It is generated at `repo init`
|
|
||||||
and uses the `--manifest-name` to determine what manifest file to load next
|
|
||||||
out of `manifests/`.
|
|
||||||
|
|
||||||
Do not try to modify this to load other manifests as it will confuse repo.
|
|
||||||
If you want to switch manifest files, re-run `repo init` with the new
|
|
||||||
setting.
|
|
||||||
|
|
||||||
Older versions of repo managed this with symlinks.
|
|
||||||
|
|
||||||
* `manifest.xml -> manifests/<manifest-name>.xml`: A symlink to the manifest
|
|
||||||
that the user wishes to sync. It is specified at `repo init` time via
|
|
||||||
`--manifest-name`.
|
|
||||||
|
|
||||||
|
|
||||||
* `manifests.git/.repo_config.json`: JSON cache of the `manifests.git/config`
|
|
||||||
file for repo to read/process quickly.
|
|
||||||
|
|
||||||
* `local_manifest.xml` (*Deprecated*): User-authored tweaks to the manifest
|
|
||||||
used to sync. See [local manifests] for more details.
|
|
||||||
* `local_manifests/`: Directory of user-authored manifest fragments to tweak
|
|
||||||
the manifest used to sync. See [local manifests] for more details.
|
|
||||||
|
|
||||||
### Project objects
|
|
||||||
|
|
||||||
*** note
|
|
||||||
**Warning**: Please do not use repo's approach to projects/ & project-objects/
|
|
||||||
layouts as a model for other tools to implement similar approaches.
|
|
||||||
It has a number of known downsides like:
|
|
||||||
* [Symlinks do not work well under Windows](./windows.md).
|
|
||||||
* Git sometimes replaces symlinks under .git/ with real files (under unknown
|
|
||||||
circumstances), and then the internal state gets out of sync, and data loss
|
|
||||||
may ensue.
|
|
||||||
* When sharing project-objects between multiple project checkouts, Git might
|
|
||||||
automatically run `gc` or `prune` which may lead to data loss or corruption
|
|
||||||
(since those operate on leaf projects and miss refs in other leaves). See
|
|
||||||
https://gerrit-review.googlesource.com/c/git-repo/+/254392 for more details.
|
|
||||||
|
|
||||||
Instead, you should use standard Git workflows like [git worktree] or
|
|
||||||
[gitsubmodules] with [superprojects].
|
|
||||||
***
|
|
||||||
|
|
||||||
* `copy-link-files.json`: Tracking file used by `repo sync` to determine when
|
|
||||||
copyfile or linkfile are added or removed and need corresponding updates.
|
|
||||||
* `project.list`: Tracking file used by `repo sync` to determine when projects
|
|
||||||
are added or removed and need corresponding updates in the checkout.
|
|
||||||
* `projects/`: Bare checkouts of every project synced by the manifest. The
|
|
||||||
filesystem layout matches the `<project path=...` setting in the manifest
|
|
||||||
(i.e. where it's checked out in the repo client source tree). Those
|
|
||||||
checkouts will symlink their `.git/` state to paths under here.
|
|
||||||
|
|
||||||
Some git state is further split out under `project-objects/`.
|
|
||||||
* `project-objects/`: Git objects that are safe to share across multiple
|
|
||||||
git checkouts. The filesystem layout matches the `<project name=...`
|
|
||||||
setting in the manifest (i.e. the path on the remote server) with a `.git`
|
|
||||||
suffix. This allows for multiple checkouts of the same remote git repo to
|
|
||||||
share their objects. For example, you could have different branches of
|
|
||||||
`foo/bar.git` checked out to `foo/bar-main`, `foo/bar-release`, etc...
|
|
||||||
There will be multiple trees under `projects/` for each one, but only one
|
|
||||||
under `project-objects/`.
|
|
||||||
|
|
||||||
This layout is designed to allow people to sync against different remotes
|
|
||||||
(e.g. a local mirror & a public review server) while avoiding duplicating
|
|
||||||
the content. However, this can run into problems if different remotes use
|
|
||||||
the same path on their respective servers. Best to avoid that.
|
|
||||||
* `subprojects/`: Like `projects/`, but for git submodules.
|
|
||||||
* `subproject-objects/`: Like `project-objects/`, but for git submodules.
|
|
||||||
* `worktrees/`: Bare checkouts of every project synced by the manifest. The
|
|
||||||
filesystem layout matches the `<project name=...` setting in the manifest
|
|
||||||
(i.e. the path on the remote server) with a `.git` suffix. This has the
|
|
||||||
same advantages as the `project-objects/` layout above.
|
|
||||||
|
|
||||||
This is used when [git worktree]'s are enabled.
|
|
||||||
|
|
||||||
### Global settings
|
|
||||||
|
|
||||||
The `.repo/manifests.git/config` file is used to track settings for the entire
|
|
||||||
repo client checkout.
|
|
||||||
Most settings use the `[repo]` section to avoid conflicts with git.
|
|
||||||
User controlled settings are initialized when running `repo init`.
|
|
||||||
|
|
||||||
| Setting | `repo init` Option | Use/Meaning |
|
|
||||||
|------------------- |---------------------------|-------------|
|
|
||||||
| manifest.groups | `--groups` & `--platform` | The manifest groups to sync |
|
|
||||||
| repo.archive | `--archive` | Use `git archive` for checkouts |
|
|
||||||
| repo.clonebundle | `--clone-bundle` | Whether the initial sync used clone.bundle explicitly |
|
|
||||||
| repo.clonefilter | `--clone-filter` | Filter setting when using [partial git clones] |
|
|
||||||
| repo.depth | `--depth` | Create shallow checkouts when cloning |
|
|
||||||
| repo.dissociate | `--dissociate` | Dissociate from any reference/mirrors after initial clone |
|
|
||||||
| repo.mirror | `--mirror` | Checkout is a repo mirror |
|
|
||||||
| repo.partialclone | `--partial-clone` | Create [partial git clones] |
|
|
||||||
| repo.partialcloneexclude | `--partial-clone-exclude` | Comma-delimited list of project names (not paths) to exclude while using [partial git clones] |
|
|
||||||
| repo.reference | `--reference` | Reference repo client checkout |
|
|
||||||
| repo.submodules | `--submodules` | Sync git submodules |
|
|
||||||
| repo.superproject | `--use-superproject` | Sync [superproject] |
|
|
||||||
| repo.worktree | `--worktree` | Use [git worktree] for checkouts |
|
|
||||||
| user.email | `--config-name` | User's e-mail address; Copied into `.git/config` when checking out a new project |
|
|
||||||
| user.name | `--config-name` | User's name; Copied into `.git/config` when checking out a new project |
|
|
||||||
|
|
||||||
[partial git clones]: https://git-scm.com/docs/gitrepository-layout#_code_partialclone_code
|
|
||||||
[superproject]: https://en.wikibooks.org/wiki/Git/Submodules_and_Superprojects
|
|
||||||
|
|
||||||
### Repo hooks settings
|
|
||||||
|
|
||||||
For more details on this feature, see the [repo-hooks docs](./repo-hooks.md).
|
|
||||||
We'll just discuss the internal configuration settings.
|
|
||||||
These are stored in the registered `<repo-hooks>` project itself, so if the
|
|
||||||
manifest switches to a different project, the settings will not be copied.
|
|
||||||
|
|
||||||
| Setting | Use/Meaning |
|
|
||||||
|--------------------------------------|-------------|
|
|
||||||
| repo.hooks.\<hook\>.approvedmanifest | User approval for secure manifest sources (e.g. https://) |
|
|
||||||
| repo.hooks.\<hook\>.approvedhash | User approval for insecure manifest sources (e.g. http://) |
|
|
||||||
|
|
||||||
|
|
||||||
For example, if our manifest had the following entries, we would store settings
|
|
||||||
under `.repo/projects/src/repohooks.git/config` (which would be reachable via
|
|
||||||
`git --git-dir=src/repohooks/.git config`).
|
|
||||||
```xml
|
|
||||||
<project path="src/repohooks" name="chromiumos/repohooks" ... />
|
|
||||||
<repo-hooks in-project="chromiumos/repohooks" ... />
|
|
||||||
```
|
|
||||||
|
|
||||||
If `<hook>` is `pre-upload`, the `.git/config` setting might be:
|
|
||||||
```ini
|
|
||||||
[repo "hooks.pre-upload"]
|
|
||||||
approvedmanifest = https://chromium.googlesource.com/chromiumos/manifest
|
|
||||||
```
|
|
||||||
|
|
||||||
## Per-project settings
|
|
||||||
|
|
||||||
These settings are somewhat meant to be tweaked by the user on a per-project
|
|
||||||
basis (e.g. `git config` in a checked out source repo).
|
|
||||||
|
|
||||||
Where possible, we re-use standard git settings to avoid confusion, and we
|
|
||||||
refrain from documenting those, so see [git-config] documentation instead.
|
|
||||||
|
|
||||||
See `repo help upload` for documentation on `[review]` settings.
|
|
||||||
|
|
||||||
The `[remote]` settings are automatically populated/updated from the manifest.
|
|
||||||
|
|
||||||
The `[branch]` settings are updated by `repo start` and `git branch`.
|
|
||||||
|
|
||||||
| Setting | Subcommands | Use/Meaning |
|
|
||||||
|-------------------------------|---------------|-------------|
|
|
||||||
| review.\<url\>.autocopy | upload | Automatically add to `--cc=<value>` |
|
|
||||||
| review.\<url\>.autoreviewer | upload | Automatically add to `--reviewers=<value>` |
|
|
||||||
| review.\<url\>.autoupload | upload | Automatically answer "yes" or "no" to all prompts |
|
|
||||||
| review.\<url\>.uploadhashtags | upload | Automatically add to `--hashtag=<value>` |
|
|
||||||
| review.\<url\>.uploadlabels | upload | Automatically add to `--label=<value>` |
|
|
||||||
| review.\<url\>.uploadnotify | upload | [Notify setting][upload-notify] to use |
|
|
||||||
| review.\<url\>.uploadtopic | upload | Default [topic] to use |
|
|
||||||
| review.\<url\>.username | upload | Override username with `ssh://` review URIs |
|
|
||||||
| remote.\<remote\>.fetch | sync | Set of refs to fetch |
|
|
||||||
| remote.\<remote\>.projectname | \<network\> | The name of the project as it exists in Gerrit review |
|
|
||||||
| remote.\<remote\>.pushurl | upload | The base URI for pushing CLs |
|
|
||||||
| remote.\<remote\>.review | upload | The URI of the Gerrit review server |
|
|
||||||
| remote.\<remote\>.url | sync & upload | The URI of the git project to fetch |
|
|
||||||
| branch.\<branch\>.merge | sync & upload | The branch to merge & upload & track |
|
|
||||||
| branch.\<branch\>.remote | sync & upload | The remote to track |
|
|
||||||
|
|
||||||
## ~/ dotconfig layout
|
|
||||||
|
|
||||||
Repo will create & maintain a few files in the user's home directory.
|
|
||||||
|
|
||||||
* `.repoconfig/`: Repo's per-user directory for all random config files/state.
|
|
||||||
* `.repoconfig/config`: Per-user settings using [git-config] file format.
|
|
||||||
* `.repoconfig/keyring-version`: Cache file for checking if the gnupg subdir
|
|
||||||
has all the same keys as the repo launcher. Used to avoid running gpg
|
|
||||||
constantly as that can be quite slow.
|
|
||||||
* `.repoconfig/gnupg/`: GnuPG's internal state directory used when repo needs
|
|
||||||
to run `gpg`. This provides isolation from the user's normal `~/.gnupg/`.
|
|
||||||
|
|
||||||
* `.repoconfig/.repo_config.json`: JSON cache of the `.repoconfig/config`
|
|
||||||
file for repo to read/process quickly.
|
|
||||||
* `.repo_.gitconfig.json`: JSON cache of the `.gitconfig` file for repo to
|
|
||||||
read/process quickly.
|
|
||||||
|
|
||||||
|
|
||||||
[git-config]: https://git-scm.com/docs/git-config
|
|
||||||
[git worktree]: https://git-scm.com/docs/git-worktree
|
|
||||||
[gitsubmodules]: https://git-scm.com/docs/gitsubmodules
|
|
||||||
[manifest-format.md]: ./manifest-format.md
|
|
||||||
[local manifests]: ./manifest-format.md#Local-Manifests
|
|
||||||
[superprojects]: https://en.wikibooks.org/wiki/Git/Submodules_and_Superprojects
|
|
||||||
[topic]: https://gerrit-review.googlesource.com/Documentation/intro-user.html#topics
|
|
||||||
[upload-notify]: https://gerrit-review.googlesource.com/Documentation/user-upload.html#notify
|
|
@ -21,7 +21,6 @@ following DTD:
|
|||||||
|
|
||||||
```xml
|
```xml
|
||||||
<!DOCTYPE manifest [
|
<!DOCTYPE manifest [
|
||||||
|
|
||||||
<!ELEMENT manifest (notice?,
|
<!ELEMENT manifest (notice?,
|
||||||
remote*,
|
remote*,
|
||||||
default?,
|
default?,
|
||||||
@ -30,8 +29,6 @@ following DTD:
|
|||||||
project*,
|
project*,
|
||||||
extend-project*,
|
extend-project*,
|
||||||
repo-hooks?,
|
repo-hooks?,
|
||||||
superproject?,
|
|
||||||
contactinfo?,
|
|
||||||
include*)>
|
include*)>
|
||||||
|
|
||||||
<!ELEMENT notice (#PCDATA)>
|
<!ELEMENT notice (#PCDATA)>
|
||||||
@ -92,7 +89,6 @@ following DTD:
|
|||||||
<!ATTLIST extend-project path CDATA #IMPLIED>
|
<!ATTLIST extend-project path CDATA #IMPLIED>
|
||||||
<!ATTLIST extend-project groups CDATA #IMPLIED>
|
<!ATTLIST extend-project groups CDATA #IMPLIED>
|
||||||
<!ATTLIST extend-project revision CDATA #IMPLIED>
|
<!ATTLIST extend-project revision CDATA #IMPLIED>
|
||||||
<!ATTLIST extend-project remote CDATA #IMPLIED>
|
|
||||||
|
|
||||||
<!ELEMENT remove-project EMPTY>
|
<!ELEMENT remove-project EMPTY>
|
||||||
<!ATTLIST remove-project name CDATA #REQUIRED>
|
<!ATTLIST remove-project name CDATA #REQUIRED>
|
||||||
@ -101,25 +97,11 @@ following DTD:
|
|||||||
<!ATTLIST repo-hooks in-project CDATA #REQUIRED>
|
<!ATTLIST repo-hooks in-project CDATA #REQUIRED>
|
||||||
<!ATTLIST repo-hooks enabled-list CDATA #REQUIRED>
|
<!ATTLIST repo-hooks enabled-list CDATA #REQUIRED>
|
||||||
|
|
||||||
<!ELEMENT superproject EMPTY>
|
|
||||||
<!ATTLIST superproject name CDATA #REQUIRED>
|
|
||||||
<!ATTLIST superproject remote IDREF #IMPLIED>
|
|
||||||
|
|
||||||
<!ELEMENT contactinfo EMPTY>
|
|
||||||
<!ATTLIST contactinfo bugurl CDATA #REQUIRED>
|
|
||||||
|
|
||||||
<!ELEMENT include EMPTY>
|
<!ELEMENT include EMPTY>
|
||||||
<!ATTLIST include name CDATA #REQUIRED>
|
<!ATTLIST include name CDATA #REQUIRED>
|
||||||
<!ATTLIST include groups CDATA #IMPLIED>
|
|
||||||
]>
|
]>
|
||||||
```
|
```
|
||||||
|
|
||||||
For compatibility purposes across repo releases, all unknown elements are
|
|
||||||
silently ignored. However, repo reserves all possible names for itself for
|
|
||||||
future use. If you want to use custom elements, the `x-*` namespace is
|
|
||||||
reserved for that purpose, and repo guarantees to never allocate any
|
|
||||||
corresponding names.
|
|
||||||
|
|
||||||
A description of the elements and their attributes follows.
|
A description of the elements and their attributes follows.
|
||||||
|
|
||||||
|
|
||||||
@ -127,10 +109,6 @@ A description of the elements and their attributes follows.
|
|||||||
|
|
||||||
The root element of the file.
|
The root element of the file.
|
||||||
|
|
||||||
### Element notice
|
|
||||||
|
|
||||||
Arbitrary text that is displayed to users whenever `repo sync` finishes.
|
|
||||||
The content is simply passed through as it exists in the manifest.
|
|
||||||
|
|
||||||
### Element remote
|
### Element remote
|
||||||
|
|
||||||
@ -163,8 +141,8 @@ Attribute `review`: Hostname of the Gerrit server where reviews
|
|||||||
are uploaded to by `repo upload`. This attribute is optional;
|
are uploaded to by `repo upload`. This attribute is optional;
|
||||||
if not specified then `repo upload` will not function.
|
if not specified then `repo upload` will not function.
|
||||||
|
|
||||||
Attribute `revision`: Name of a Git branch (e.g. `main` or
|
Attribute `revision`: Name of a Git branch (e.g. `master` or
|
||||||
`refs/heads/main`). Remotes with their own revision will override
|
`refs/heads/master`). Remotes with their own revision will override
|
||||||
the default revision.
|
the default revision.
|
||||||
|
|
||||||
### Element default
|
### Element default
|
||||||
@ -177,11 +155,11 @@ Attribute `remote`: Name of a previously defined remote element.
|
|||||||
Project elements lacking a remote attribute of their own will use
|
Project elements lacking a remote attribute of their own will use
|
||||||
this remote.
|
this remote.
|
||||||
|
|
||||||
Attribute `revision`: Name of a Git branch (e.g. `main` or
|
Attribute `revision`: Name of a Git branch (e.g. `master` or
|
||||||
`refs/heads/main`). Project elements lacking their own
|
`refs/heads/master`). Project elements lacking their own
|
||||||
revision attribute will use this revision.
|
revision attribute will use this revision.
|
||||||
|
|
||||||
Attribute `dest-branch`: Name of a Git branch (e.g. `main`).
|
Attribute `dest-branch`: Name of a Git branch (e.g. `master`).
|
||||||
Project elements not setting their own `dest-branch` will inherit
|
Project elements not setting their own `dest-branch` will inherit
|
||||||
this value. If this value is not set, projects will use `revision`
|
this value. If this value is not set, projects will use `revision`
|
||||||
by default instead.
|
by default instead.
|
||||||
@ -257,37 +235,24 @@ name will be prefixed by the parent's.
|
|||||||
The project name must match the name Gerrit knows, if Gerrit is
|
The project name must match the name Gerrit knows, if Gerrit is
|
||||||
being used for code reviews.
|
being used for code reviews.
|
||||||
|
|
||||||
"name" must not be empty, and may not be an absolute path or use "." or ".."
|
|
||||||
path components. It is always interpreted relative to the remote's fetch
|
|
||||||
settings, so if a different base path is needed, declare a different remote
|
|
||||||
with the new settings needed.
|
|
||||||
These restrictions are not enforced for [Local Manifests].
|
|
||||||
|
|
||||||
Attribute `path`: An optional path relative to the top directory
|
Attribute `path`: An optional path relative to the top directory
|
||||||
of the repo client where the Git working directory for this project
|
of the repo client where the Git working directory for this project
|
||||||
should be placed. If not supplied the project "name" is used.
|
should be placed. If not supplied the project name is used.
|
||||||
If the project has a parent element, its path will be prefixed
|
If the project has a parent element, its path will be prefixed
|
||||||
by the parent's.
|
by the parent's.
|
||||||
|
|
||||||
"path" may not be an absolute path or use "." or ".." path components.
|
|
||||||
These restrictions are not enforced for [Local Manifests].
|
|
||||||
|
|
||||||
If you want to place files into the root of the checkout (e.g. a README or
|
|
||||||
Makefile or another build script), use the [copyfile] or [linkfile] elements
|
|
||||||
instead.
|
|
||||||
|
|
||||||
Attribute `remote`: Name of a previously defined remote element.
|
Attribute `remote`: Name of a previously defined remote element.
|
||||||
If not supplied the remote given by the default element is used.
|
If not supplied the remote given by the default element is used.
|
||||||
|
|
||||||
Attribute `revision`: Name of the Git branch the manifest wants
|
Attribute `revision`: Name of the Git branch the manifest wants
|
||||||
to track for this project. Names can be relative to refs/heads
|
to track for this project. Names can be relative to refs/heads
|
||||||
(e.g. just "main") or absolute (e.g. "refs/heads/main").
|
(e.g. just "master") or absolute (e.g. "refs/heads/master").
|
||||||
Tags and/or explicit SHA-1s should work in theory, but have not
|
Tags and/or explicit SHA-1s should work in theory, but have not
|
||||||
been extensively tested. If not supplied the revision given by
|
been extensively tested. If not supplied the revision given by
|
||||||
the remote element is used if applicable, else the default
|
the remote element is used if applicable, else the default
|
||||||
element is used.
|
element is used.
|
||||||
|
|
||||||
Attribute `dest-branch`: Name of a Git branch (e.g. `main`).
|
Attribute `dest-branch`: Name of a Git branch (e.g. `master`).
|
||||||
When using `repo upload`, changes will be submitted for code
|
When using `repo upload`, changes will be submitted for code
|
||||||
review on this branch. If unspecified both here and in the
|
review on this branch. If unspecified both here and in the
|
||||||
default element, `revision` is used instead.
|
default element, `revision` is used instead.
|
||||||
@ -296,7 +261,7 @@ Attribute `groups`: List of groups to which this project belongs,
|
|||||||
whitespace or comma separated. All projects belong to the group
|
whitespace or comma separated. All projects belong to the group
|
||||||
"all", and each project automatically belongs to a group of
|
"all", and each project automatically belongs to a group of
|
||||||
its name:`name` and path:`path`. E.g. for
|
its name:`name` and path:`path`. E.g. for
|
||||||
`<project name="monkeys" path="barrel-of"/>`, that project
|
<project name="monkeys" path="barrel-of"/>, that project
|
||||||
definition is implicitly in the following manifest groups:
|
definition is implicitly in the following manifest groups:
|
||||||
default, name:monkeys, and path:barrel-of. If you place a project in the
|
default, name:monkeys, and path:barrel-of. If you place a project in the
|
||||||
group "notdefault", it will not be automatically downloaded by repo.
|
group "notdefault", it will not be automatically downloaded by repo.
|
||||||
@ -341,9 +306,6 @@ belongs. Same syntax as the corresponding element of `project`.
|
|||||||
Attribute `revision`: If specified, overrides the revision of the original
|
Attribute `revision`: If specified, overrides the revision of the original
|
||||||
project. Same syntax as the corresponding element of `project`.
|
project. Same syntax as the corresponding element of `project`.
|
||||||
|
|
||||||
Attribute `remote`: If specified, overrides the remote of the original
|
|
||||||
project. Same syntax as the corresponding element of `project`.
|
|
||||||
|
|
||||||
### Element annotation
|
### Element annotation
|
||||||
|
|
||||||
Zero or more annotation elements may be specified as children of a
|
Zero or more annotation elements may be specified as children of a
|
||||||
@ -376,7 +338,7 @@ It's just like copyfile and runs at the same time as copyfile but
|
|||||||
instead of copying it creates a symlink.
|
instead of copying it creates a symlink.
|
||||||
|
|
||||||
The symlink is created at "dest" (relative to the top of the tree) and
|
The symlink is created at "dest" (relative to the top of the tree) and
|
||||||
points to the path specified by "src" which is a path in the project.
|
points to the path specified by "src".
|
||||||
|
|
||||||
Parent directories of "dest" will be automatically created if missing.
|
Parent directories of "dest" will be automatically created if missing.
|
||||||
|
|
||||||
@ -393,54 +355,6 @@ This element is mostly useful in a local manifest file, where
|
|||||||
the user can remove a project, and possibly replace it with their
|
the user can remove a project, and possibly replace it with their
|
||||||
own definition.
|
own definition.
|
||||||
|
|
||||||
### Element repo-hooks
|
|
||||||
|
|
||||||
NB: See the [practical documentation](./repo-hooks.md) for using repo hooks.
|
|
||||||
|
|
||||||
Only one repo-hooks element may be specified at a time.
|
|
||||||
Attempting to redefine it will fail to parse.
|
|
||||||
|
|
||||||
Attribute `in-project`: The project where the hooks are defined. The value
|
|
||||||
must match the `name` attribute (**not** the `path` attribute) of a previously
|
|
||||||
defined `project` element.
|
|
||||||
|
|
||||||
Attribute `enabled-list`: List of hooks to use, whitespace or comma separated.
|
|
||||||
|
|
||||||
### Element superproject
|
|
||||||
|
|
||||||
***
|
|
||||||
*Note*: This is currently a WIP.
|
|
||||||
***
|
|
||||||
|
|
||||||
NB: See the [git superprojects documentation](
|
|
||||||
https://en.wikibooks.org/wiki/Git/Submodules_and_Superprojects) for background
|
|
||||||
information.
|
|
||||||
|
|
||||||
This element is used to specify the URL of the superproject. It has "name" and
|
|
||||||
"remote" as atrributes. Only "name" is required while the others have
|
|
||||||
reasonable defaults. At most one superproject may be specified.
|
|
||||||
Attempting to redefine it will fail to parse.
|
|
||||||
|
|
||||||
Attribute `name`: A unique name for the superproject. This attribute has the
|
|
||||||
same meaning as project's name attribute. See the
|
|
||||||
[element project](#element-project) for more information.
|
|
||||||
|
|
||||||
Attribute `remote`: Name of a previously defined remote element.
|
|
||||||
If not supplied the remote given by the default element is used.
|
|
||||||
|
|
||||||
### Element contactinfo
|
|
||||||
|
|
||||||
***
|
|
||||||
*Note*: This is currently a WIP.
|
|
||||||
***
|
|
||||||
|
|
||||||
This element is used to let manifest authors self-register contact info.
|
|
||||||
It has "bugurl" as a required atrribute. This element can be repeated,
|
|
||||||
and any later entries will clobber earlier ones. This would allow manifest
|
|
||||||
authors who extend manifests to specify their own contact info.
|
|
||||||
|
|
||||||
Attribute `bugurl`: The URL to file a bug against the manifest owner.
|
|
||||||
|
|
||||||
### Element include
|
### Element include
|
||||||
|
|
||||||
This element provides the capability of including another manifest
|
This element provides the capability of including another manifest
|
||||||
@ -450,15 +364,8 @@ target manifest to include - it must be a usable manifest on its own.
|
|||||||
Attribute `name`: the manifest to include, specified relative to
|
Attribute `name`: the manifest to include, specified relative to
|
||||||
the manifest repository's root.
|
the manifest repository's root.
|
||||||
|
|
||||||
"name" may not be an absolute path or use "." or ".." path components.
|
|
||||||
These restrictions are not enforced for [Local Manifests].
|
|
||||||
|
|
||||||
Attribute `groups`: List of additional groups to which all projects
|
## Local Manifests
|
||||||
in the included manifest belong. This appends and recurses, meaning
|
|
||||||
all projects in sub-manifests carry all parent include groups.
|
|
||||||
Same syntax as the corresponding element of `project`.
|
|
||||||
|
|
||||||
## Local Manifests {#local-manifests}
|
|
||||||
|
|
||||||
Additional remotes and projects may be added through local manifest
|
Additional remotes and projects may be added through local manifest
|
||||||
files stored in `$TOP_DIR/.repo/local_manifests/*.xml`.
|
files stored in `$TOP_DIR/.repo/local_manifests/*.xml`.
|
||||||
@ -485,9 +392,10 @@ these extra projects.
|
|||||||
Manifest files stored in `$TOP_DIR/.repo/local_manifests/*.xml` will
|
Manifest files stored in `$TOP_DIR/.repo/local_manifests/*.xml` will
|
||||||
be loaded in alphabetical order.
|
be loaded in alphabetical order.
|
||||||
|
|
||||||
The legacy `$TOP_DIR/.repo/local_manifest.xml` path is no longer supported.
|
Additional remotes and projects may also be added through a local
|
||||||
|
manifest, stored in `$TOP_DIR/.repo/local_manifest.xml`. This method
|
||||||
|
is deprecated in favor of using multiple manifest files as mentioned
|
||||||
|
above.
|
||||||
|
|
||||||
|
If `$TOP_DIR/.repo/local_manifest.xml` exists, it will be loaded before
|
||||||
[copyfile]: #Element-copyfile
|
any manifest files stored in `$TOP_DIR/.repo/local_manifests/*.xml`.
|
||||||
[linkfile]: #Element-linkfile
|
|
||||||
[Local Manifests]: #local-manifests
|
|
||||||
|
@ -18,13 +18,13 @@ Bugfixes may be added on a best-effort basis or from the community, but largely
|
|||||||
no new features will be added, nor is support guaranteed.
|
no new features will be added, nor is support guaranteed.
|
||||||
|
|
||||||
Users can select this during `repo init` time via the [repo launcher].
|
Users can select this during `repo init` time via the [repo launcher].
|
||||||
Otherwise the default branches (e.g. stable & main) will be used which will
|
Otherwise the default branches (e.g. stable & master) will be used which will
|
||||||
require Python 3.
|
require Python 3.
|
||||||
|
|
||||||
This means the [repo launcher] needs to support both Python 2 & Python 3, but
|
This means the [repo launcher] needs to support both Python 2 & Python 3, but
|
||||||
since it doesn't import any other repo code, this shouldn't be too problematic.
|
since it doesn't import any other repo code, this shouldn't be too problematic.
|
||||||
|
|
||||||
The main branch will require Python 3.6 at a minimum.
|
The master branch will require Python 3.6 at a minimum.
|
||||||
If the system has an older version of Python 3, then users will have to select
|
If the system has an older version of Python 3, then users will have to select
|
||||||
the legacy Python 2 branch instead.
|
the legacy Python 2 branch instead.
|
||||||
|
|
||||||
|
@ -5,37 +5,6 @@ related topics and flows.
|
|||||||
|
|
||||||
[TOC]
|
[TOC]
|
||||||
|
|
||||||
## Schedule
|
|
||||||
|
|
||||||
There is no specific schedule for when releases are made.
|
|
||||||
Usually it's more along the lines of "enough minor changes have been merged",
|
|
||||||
or "there's a known issue the maintainers know should get fixed".
|
|
||||||
If you find a fix has been merged for an issue important to you, but hasn't been
|
|
||||||
released after a week or so, feel free to [contact] us to request a new release.
|
|
||||||
|
|
||||||
### Release Freezes {#freeze}
|
|
||||||
|
|
||||||
We try to observe a regular schedule for when **not** to release.
|
|
||||||
If something goes wrong, staff need to be active in order to respond quickly &
|
|
||||||
effectively.
|
|
||||||
We also don't want to disrupt non-Google organizations if possible.
|
|
||||||
|
|
||||||
We generally follow the rules:
|
|
||||||
|
|
||||||
* Release during Mon - Thu, 9:00 - 14:00 [US PT]
|
|
||||||
* Avoid holidays
|
|
||||||
* All regular [US holidays]
|
|
||||||
* Large international ones if possible
|
|
||||||
* All the various [New Years]
|
|
||||||
* Jan 1 in Gregorian calendar is the most obvious
|
|
||||||
* Check for large Lunar New Years too
|
|
||||||
* Follow the normal [Google production freeze schedule]
|
|
||||||
|
|
||||||
[US holidays]: https://en.wikipedia.org/wiki/Federal_holidays_in_the_United_States
|
|
||||||
[US PT]: https://en.wikipedia.org/wiki/Pacific_Time_Zone
|
|
||||||
[New Years]: https://en.wikipedia.org/wiki/New_Year
|
|
||||||
[Google production freeze schedule]: http://goto.google.com/prod-freeze
|
|
||||||
|
|
||||||
## Launcher script
|
## Launcher script
|
||||||
|
|
||||||
The main repo script serves as a standalone program and is often referred to as
|
The main repo script serves as a standalone program and is often referred to as
|
||||||
@ -80,12 +49,11 @@ control how repo finds updates:
|
|||||||
|
|
||||||
* `--repo-url`: This tells repo where to clone the full repo project itself.
|
* `--repo-url`: This tells repo where to clone the full repo project itself.
|
||||||
It defaults to the official project (`REPO_URL` in the launcher script).
|
It defaults to the official project (`REPO_URL` in the launcher script).
|
||||||
* `--repo-rev`: This tells repo which branch to use for the full project.
|
* `--repo-branch`: This tells repo which branch to use for the full project.
|
||||||
It defaults to the `stable` branch (`REPO_REV` in the launcher script).
|
It defaults to the `stable` branch (`REPO_REV` in the launcher script).
|
||||||
|
|
||||||
Whenever `repo sync` is run, repo will, once every 24 hours, see if an update
|
Whenever `repo sync` is run, repo will check to see if an update is available.
|
||||||
is available.
|
It fetches the latest repo-branch from the repo-url.
|
||||||
It fetches the latest repo-rev from the repo-url.
|
|
||||||
Then it verifies that the latest commit in the branch has a valid signed tag
|
Then it verifies that the latest commit in the branch has a valid signed tag
|
||||||
using `git tag -v` (which uses gpg).
|
using `git tag -v` (which uses gpg).
|
||||||
If the tag is valid, then repo will update its internal checkout to it.
|
If the tag is valid, then repo will update its internal checkout to it.
|
||||||
@ -96,14 +64,9 @@ If that tag is valid, then repo will warn and use that commit instead.
|
|||||||
|
|
||||||
If that tag cannot be verified, it gives up and forces the user to resolve.
|
If that tag cannot be verified, it gives up and forces the user to resolve.
|
||||||
|
|
||||||
### Force an update
|
|
||||||
|
|
||||||
The `repo selfupdate` command can be used to force an immediate update.
|
|
||||||
It is not subject to the 24 hour limitation.
|
|
||||||
|
|
||||||
## Branch management
|
## Branch management
|
||||||
|
|
||||||
All development happens on the `main` branch and should generally be stable.
|
All development happens on the `master` branch and should generally be stable.
|
||||||
|
|
||||||
Since the repo launcher defaults to tracking the `stable` branch, it is not
|
Since the repo launcher defaults to tracking the `stable` branch, it is not
|
||||||
normally updated until a new release is available.
|
normally updated until a new release is available.
|
||||||
@ -118,7 +81,7 @@ For example, when `stable` moves from `v1.10.x` to `v1.11.x`, then the `maint`
|
|||||||
branch will be updated from `v1.9.x` to `v1.10.x`.
|
branch will be updated from `v1.9.x` to `v1.10.x`.
|
||||||
|
|
||||||
We don't have parallel release branches/series.
|
We don't have parallel release branches/series.
|
||||||
Typically all tags are made against the `main` branch and then pushed to the
|
Typically all tags are made against the `master` branch and then pushed to the
|
||||||
`stable` branch to make it available to the rest of the world.
|
`stable` branch to make it available to the rest of the world.
|
||||||
Since repo doesn't typically see a lot of changes, this tends to be OK.
|
Since repo doesn't typically see a lot of changes, this tends to be OK.
|
||||||
|
|
||||||
@ -126,10 +89,10 @@ Since repo doesn't typically see a lot of changes, this tends to be OK.
|
|||||||
|
|
||||||
When you want to create a new release, you'll need to select a good version and
|
When you want to create a new release, you'll need to select a good version and
|
||||||
create a signed tag using a key registered in repo itself.
|
create a signed tag using a key registered in repo itself.
|
||||||
Typically we just tag the latest version of the `main` branch.
|
Typically we just tag the latest version of the `master` branch.
|
||||||
The tag could be pushed now, but it won't be used by clients normally (since the
|
The tag could be pushed now, but it won't be used by clients normally (since the
|
||||||
default `repo-rev` setting is `stable`).
|
default `repo-branch` setting is `stable`).
|
||||||
This would allow some early testing on systems who explicitly select `main`.
|
This would allow some early testing on systems who explicitly select `master`.
|
||||||
|
|
||||||
### Creating a signed tag
|
### Creating a signed tag
|
||||||
|
|
||||||
@ -150,7 +113,7 @@ $ export GNUPGHOME=~/.gnupg/repo/
|
|||||||
$ gpg -K
|
$ gpg -K
|
||||||
|
|
||||||
# Pick whatever branch or commit you want to tag.
|
# Pick whatever branch or commit you want to tag.
|
||||||
$ r=main
|
$ r=master
|
||||||
|
|
||||||
# Pick the new version.
|
# Pick the new version.
|
||||||
$ t=1.12.10
|
$ t=1.12.10
|
||||||
@ -198,92 +161,7 @@ You can create a short changelog using the command:
|
|||||||
$ git log --format="%h (%aN) %s" --no-merges origin/stable..$r
|
$ git log --format="%h (%aN) %s" --no-merges origin/stable..$r
|
||||||
```
|
```
|
||||||
|
|
||||||
## Project References
|
|
||||||
|
|
||||||
Here's a table showing the relationship of major tools, their EOL dates, and
|
|
||||||
their status in Ubuntu & Debian.
|
|
||||||
Those distros tend to be good indicators of how long we need to support things.
|
|
||||||
|
|
||||||
Things in bold indicate stuff to take note of, but does not guarantee that we
|
|
||||||
still support them.
|
|
||||||
Things in italics are things we used to care about but probably don't anymore.
|
|
||||||
|
|
||||||
| Date | EOL | [Git][rel-g] | [Python][rel-p] | [Ubuntu][rel-u] / [Debian][rel-d] | Git | Python |
|
|
||||||
|:--------:|:------------:|--------------|-----------------|-----------------------------------|-----|--------|
|
|
||||||
| Oct 2008 | *Oct 2013* | | 2.6.0 | *10.04 Lucid* - 10.10 Maverick / *Squeeze* |
|
|
||||||
| Dec 2008 | *Feb 2009* | | 3.0.0 |
|
|
||||||
| Feb 2009 | *Mar 2012* | | | Debian 5 Lenny | 1.5.6.5 | 2.5.2 |
|
|
||||||
| Jun 2009 | *Jun 2016* | | 3.1.0 | *10.04 Lucid* - 10.10 Maverick / *Squeeze* |
|
|
||||||
| Feb 2010 | *Oct 2012* | 1.7.0 | | *10.04 Lucid* - *12.04 Precise* - 12.10 Quantal |
|
|
||||||
| Apr 2010 | *Apr 2015* | | | *10.04 Lucid* | 1.7.0.4 | 2.6.5 3.1.2 |
|
|
||||||
| Jul 2010 | *Dec 2019* | | **2.7.0** | 11.04 Natty - **<current>** |
|
|
||||||
| Oct 2010 | | | | 10.10 Maverick | 1.7.1 | 2.6.6 3.1.3 |
|
|
||||||
| Feb 2011 | *Feb 2016* | | | Debian 6 Squeeze | 1.7.2.5 | 2.6.6 3.1.3 |
|
|
||||||
| Apr 2011 | | | | 11.04 Natty | 1.7.4 | 2.7.1 3.2.0 |
|
|
||||||
| Oct 2011 | *Feb 2016* | | 3.2.0 | 11.04 Natty - 12.10 Quantal |
|
|
||||||
| Oct 2011 | | | | 11.10 Ocelot | 1.7.5.4 | 2.7.2 3.2.2 |
|
|
||||||
| Apr 2012 | *Apr 2019* | | | *12.04 Precise* | 1.7.9.5 | 2.7.3 3.2.3 |
|
|
||||||
| Sep 2012 | *Sep 2017* | | 3.3.0 | 13.04 Raring - 13.10 Saucy |
|
|
||||||
| Oct 2012 | *Dec 2014* | 1.8.0 | | 13.04 Raring - 13.10 Saucy |
|
|
||||||
| Oct 2012 | | | | 12.10 Quantal | 1.7.10.4 | 2.7.3 3.2.3 |
|
|
||||||
| Apr 2013 | | | | 13.04 Raring | 1.8.1.2 | 2.7.4 3.3.1 |
|
|
||||||
| May 2013 | *May 2018* | | | Debian 7 Wheezy | 1.7.10.4 | 2.7.3 3.2.3 |
|
|
||||||
| Oct 2013 | | | | 13.10 Saucy | 1.8.3.2 | 2.7.5 3.3.2 |
|
|
||||||
| Feb 2014 | *Dec 2014* | **1.9.0** | | **14.04 Trusty** |
|
|
||||||
| Mar 2014 | *Mar 2019* | | **3.4.0** | **14.04 Trusty** - 15.10 Wily / **Jessie** |
|
|
||||||
| Apr 2014 | **Apr 2022** | | | **14.04 Trusty** | 1.9.1 | 2.7.5 3.4.0 |
|
|
||||||
| May 2014 | *Dec 2014* | 2.0.0 |
|
|
||||||
| Aug 2014 | *Dec 2014* | **2.1.0** | | 14.10 Utopic - 15.04 Vivid / **Jessie** |
|
|
||||||
| Oct 2014 | | | | 14.10 Utopic | 2.1.0 | 2.7.8 3.4.2 |
|
|
||||||
| Nov 2014 | *Sep 2015* | 2.2.0 |
|
|
||||||
| Feb 2015 | *Sep 2015* | 2.3.0 |
|
|
||||||
| Apr 2015 | *May 2017* | 2.4.0 |
|
|
||||||
| Apr 2015 | **Jun 2020** | | | **Debian 8 Jessie** | 2.1.4 | 2.7.9 3.4.2 |
|
|
||||||
| Apr 2015 | | | | 15.04 Vivid | 2.1.4 | 2.7.9 3.4.3 |
|
|
||||||
| Jul 2015 | *May 2017* | 2.5.0 | | 15.10 Wily |
|
|
||||||
| Sep 2015 | *May 2017* | 2.6.0 |
|
|
||||||
| Sep 2015 | **Sep 2020** | | **3.5.0** | **16.04 Xenial** - 17.04 Zesty / **Stretch** |
|
|
||||||
| Oct 2015 | | | | 15.10 Wily | 2.5.0 | 2.7.9 3.4.3 |
|
|
||||||
| Jan 2016 | *Jul 2017* | **2.7.0** | | **16.04 Xenial** |
|
|
||||||
| Mar 2016 | *Jul 2017* | 2.8.0 |
|
|
||||||
| Apr 2016 | **Apr 2024** | | | **16.04 Xenial** | 2.7.4 | 2.7.11 3.5.1 |
|
|
||||||
| Jun 2016 | *Jul 2017* | 2.9.0 | | 16.10 Yakkety |
|
|
||||||
| Sep 2016 | *Sep 2017* | 2.10.0 |
|
|
||||||
| Oct 2016 | | | | 16.10 Yakkety | 2.9.3 | 2.7.11 3.5.1 |
|
|
||||||
| Nov 2016 | *Sep 2017* | **2.11.0** | | 17.04 Zesty / **Stretch** |
|
|
||||||
| Dec 2016 | **Dec 2021** | | **3.6.0** | 17.10 Artful - **18.04 Bionic** - 18.10 Cosmic |
|
|
||||||
| Feb 2017 | *Sep 2017* | 2.12.0 |
|
|
||||||
| Apr 2017 | | | | 17.04 Zesty | 2.11.0 | 2.7.13 3.5.3 |
|
|
||||||
| May 2017 | *May 2018* | 2.13.0 |
|
|
||||||
| Jun 2017 | **Jun 2022** | | | **Debian 9 Stretch** | 2.11.0 | 2.7.13 3.5.3 |
|
|
||||||
| Aug 2017 | *Dec 2019* | 2.14.0 | | 17.10 Artful |
|
|
||||||
| Oct 2017 | *Dec 2019* | 2.15.0 |
|
|
||||||
| Oct 2017 | | | | 17.10 Artful | 2.14.1 | 2.7.14 3.6.3 |
|
|
||||||
| Jan 2018 | *Dec 2019* | 2.16.0 |
|
|
||||||
| Apr 2018 | *Dec 2019* | 2.17.0 | | **18.04 Bionic** |
|
|
||||||
| Apr 2018 | **Apr 2028** | | | **18.04 Bionic** | 2.17.0 | 2.7.15 3.6.5 |
|
|
||||||
| Jun 2018 | *Dec 2019* | 2.18.0 |
|
|
||||||
| Jun 2018 | **Jun 2023** | | 3.7.0 | 19.04 Disco - **20.04 Focal** / **Buster** |
|
|
||||||
| Sep 2018 | *Dec 2019* | 2.19.0 | | 18.10 Cosmic |
|
|
||||||
| Oct 2018 | | | | 18.10 Cosmic | 2.19.1 | 2.7.15 3.6.6 |
|
|
||||||
| Dec 2018 | *Dec 2019* | **2.20.0** | | 19.04 Disco / **Buster** |
|
|
||||||
| Feb 2019 | *Dec 2019* | 2.21.0 |
|
|
||||||
| Apr 2019 | | | | 19.04 Disco | 2.20.1 | 2.7.16 3.7.3 |
|
|
||||||
| Jun 2019 | | 2.22.0 |
|
|
||||||
| Jul 2019 | **Jul 2024** | | | **Debian 10 Buster** | 2.20.1 | 2.7.16 3.7.3 |
|
|
||||||
| Aug 2019 | | 2.23.0 |
|
|
||||||
| Oct 2019 | **Oct 2024** | | 3.8.0 |
|
|
||||||
| Oct 2019 | | | | 19.10 Eoan | 2.20.1 | 2.7.17 3.7.5 |
|
|
||||||
| Nov 2019 | | 2.24.0 |
|
|
||||||
| Jan 2020 | | 2.25.0 | | **20.04 Focal** |
|
|
||||||
| Apr 2020 | **Apr 2030** | | | **20.04 Focal** | 2.25.0 | 2.7.17 3.7.5 |
|
|
||||||
|
|
||||||
|
|
||||||
[contact]: ../README.md#contact
|
|
||||||
[rel-d]: https://en.wikipedia.org/wiki/Debian_version_history
|
|
||||||
[rel-g]: https://en.wikipedia.org/wiki/Git#Releases
|
|
||||||
[rel-p]: https://en.wikipedia.org/wiki/History_of_Python#Table_of_versions
|
|
||||||
[rel-u]: https://en.wikipedia.org/wiki/Ubuntu_version_history#Table_of_versions
|
|
||||||
[example announcement]: https://groups.google.com/d/topic/repo-discuss/UGBNismWo1M/discussion
|
[example announcement]: https://groups.google.com/d/topic/repo-discuss/UGBNismWo1M/discussion
|
||||||
[repo-discuss@googlegroups.com]: https://groups.google.com/forum/#!forum/repo-discuss
|
[repo-discuss@googlegroups.com]: https://groups.google.com/forum/#!forum/repo-discuss
|
||||||
[go/repo-release]: https://goto.google.com/repo-release
|
[go/repo-release]: https://goto.google.com/repo-release
|
||||||
|
@ -27,7 +27,7 @@ repohooks project is updated and a hook is triggered.
|
|||||||
For the full syntax, see the [repo manifest format](./manifest-format.md).
|
For the full syntax, see the [repo manifest format](./manifest-format.md).
|
||||||
|
|
||||||
Here's a short example from
|
Here's a short example from
|
||||||
[Android](https://android.googlesource.com/platform/manifest/+/HEAD/default.xml).
|
[Android](https://android.googlesource.com/platform/manifest/+/master/default.xml).
|
||||||
The `<project>` line checks out the repohooks git repo to the local
|
The `<project>` line checks out the repohooks git repo to the local
|
||||||
`tools/repohooks/` path. The `<repo-hooks>` line says to look in the project
|
`tools/repohooks/` path. The `<repo-hooks>` line says to look in the project
|
||||||
with the name `platform/tools/repohooks` for hooks to run during the
|
with the name `platform/tools/repohooks` for hooks to run during the
|
||||||
|
@ -19,33 +19,7 @@ also due to most developers not using Windows.
|
|||||||
We will never add code specific to older versions of Windows.
|
We will never add code specific to older versions of Windows.
|
||||||
It might work, but it most likely won't, so please don't bother asking.
|
It might work, but it most likely won't, so please don't bother asking.
|
||||||
|
|
||||||
## Git worktrees
|
## Symlinks
|
||||||
|
|
||||||
*** note
|
|
||||||
**Warning**: Repo's support for Git worktrees is new & experimental.
|
|
||||||
Please report any bugs and be sure to maintain backups!
|
|
||||||
***
|
|
||||||
|
|
||||||
The Repo 2.4 release introduced support for [Git worktrees][git-worktree].
|
|
||||||
You don't have to worry about or understand this particular feature, so don't
|
|
||||||
worry if this section of the Git manual is particularly impenetrable.
|
|
||||||
|
|
||||||
The salient point is that Git worktrees allow Repo to create repo client
|
|
||||||
checkouts that do not require symlinks at all under Windows.
|
|
||||||
This means users no longer need Administrator access to sync code.
|
|
||||||
|
|
||||||
Simply use `--worktree` when running `repo init` to opt in.
|
|
||||||
|
|
||||||
This does not effect specific Git repositories that use symlinks themselves.
|
|
||||||
|
|
||||||
[git-worktree]: https://git-scm.com/docs/git-worktree
|
|
||||||
|
|
||||||
## Symlinks by default
|
|
||||||
|
|
||||||
*** note
|
|
||||||
**NB**: This section applies to the default Repo behavior which does not use
|
|
||||||
Git worktrees (see the previous section for more info).
|
|
||||||
***
|
|
||||||
|
|
||||||
Repo will use symlinks heavily internally.
|
Repo will use symlinks heavily internally.
|
||||||
On *NIX platforms, this isn't an issue, but Windows makes it a bit difficult.
|
On *NIX platforms, this isn't an issue, but Windows makes it a bit difficult.
|
||||||
@ -88,8 +62,9 @@ This also helps `tar` unpack symlinks, so that's nice.
|
|||||||
|
|
||||||
## Python
|
## Python
|
||||||
|
|
||||||
Python 3.6 or newer is required.
|
You should make sure to be running Python 3.6 or newer under Windows.
|
||||||
Python 2 is known to be broken when running under Windows.
|
Python 2 might work, but due to already limited platform testing, you should
|
||||||
|
only run newer Python versions.
|
||||||
See our [Python Support](./python-support.md) document for more details.
|
See our [Python Support](./python-support.md) document for more details.
|
||||||
|
|
||||||
You can grab the latest Windows installer here:<br>
|
You can grab the latest Windows installer here:<br>
|
||||||
|
@ -1,3 +1,5 @@
|
|||||||
|
# -*- coding:utf-8 -*-
|
||||||
|
#
|
||||||
# Copyright (C) 2008 The Android Open Source Project
|
# Copyright (C) 2008 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
@ -12,6 +14,7 @@
|
|||||||
# See the License for the specific language governing permissions and
|
# See the License for the specific language governing permissions and
|
||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
|
|
||||||
|
from __future__ import print_function
|
||||||
import os
|
import os
|
||||||
import re
|
import re
|
||||||
import sys
|
import sys
|
||||||
@ -21,7 +24,6 @@ import tempfile
|
|||||||
from error import EditorError
|
from error import EditorError
|
||||||
import platform_utils
|
import platform_utils
|
||||||
|
|
||||||
|
|
||||||
class Editor(object):
|
class Editor(object):
|
||||||
"""Manages the user's preferred text editor."""
|
"""Manages the user's preferred text editor."""
|
||||||
|
|
||||||
@ -55,7 +57,7 @@ class Editor(object):
|
|||||||
|
|
||||||
if os.getenv('TERM') == 'dumb':
|
if os.getenv('TERM') == 'dumb':
|
||||||
print(
|
print(
|
||||||
"""No editor specified in GIT_EDITOR, core.editor, VISUAL or EDITOR.
|
"""No editor specified in GIT_EDITOR, core.editor, VISUAL or EDITOR.
|
||||||
Tried to fall back to vi but terminal is dumb. Please configure at
|
Tried to fall back to vi but terminal is dumb. Please configure at
|
||||||
least one of these before using this command.""", file=sys.stderr)
|
least one of these before using this command.""", file=sys.stderr)
|
||||||
sys.exit(1)
|
sys.exit(1)
|
||||||
|
43
error.py
43
error.py
@ -1,3 +1,5 @@
|
|||||||
|
# -*- coding:utf-8 -*-
|
||||||
|
#
|
||||||
# Copyright (C) 2008 The Android Open Source Project
|
# Copyright (C) 2008 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
@ -12,89 +14,70 @@
|
|||||||
# See the License for the specific language governing permissions and
|
# See the License for the specific language governing permissions and
|
||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
|
|
||||||
|
|
||||||
class ManifestParseError(Exception):
|
class ManifestParseError(Exception):
|
||||||
"""Failed to parse the manifest file.
|
"""Failed to parse the manifest file.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
|
class ManifestInvalidRevisionError(Exception):
|
||||||
class ManifestInvalidRevisionError(ManifestParseError):
|
|
||||||
"""The revision value in a project is incorrect.
|
"""The revision value in a project is incorrect.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
|
|
||||||
class ManifestInvalidPathError(ManifestParseError):
|
|
||||||
"""A path used in <copyfile> or <linkfile> is incorrect.
|
|
||||||
"""
|
|
||||||
|
|
||||||
|
|
||||||
class NoManifestException(Exception):
|
class NoManifestException(Exception):
|
||||||
"""The required manifest does not exist.
|
"""The required manifest does not exist.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
def __init__(self, path, reason):
|
def __init__(self, path, reason):
|
||||||
super().__init__(path, reason)
|
super(NoManifestException, self).__init__()
|
||||||
self.path = path
|
self.path = path
|
||||||
self.reason = reason
|
self.reason = reason
|
||||||
|
|
||||||
def __str__(self):
|
def __str__(self):
|
||||||
return self.reason
|
return self.reason
|
||||||
|
|
||||||
|
|
||||||
class EditorError(Exception):
|
class EditorError(Exception):
|
||||||
"""Unspecified error from the user's text editor.
|
"""Unspecified error from the user's text editor.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
def __init__(self, reason):
|
def __init__(self, reason):
|
||||||
super().__init__(reason)
|
super(EditorError, self).__init__()
|
||||||
self.reason = reason
|
self.reason = reason
|
||||||
|
|
||||||
def __str__(self):
|
def __str__(self):
|
||||||
return self.reason
|
return self.reason
|
||||||
|
|
||||||
|
|
||||||
class GitError(Exception):
|
class GitError(Exception):
|
||||||
"""Unspecified internal error from git.
|
"""Unspecified internal error from git.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
def __init__(self, command):
|
def __init__(self, command):
|
||||||
super().__init__(command)
|
super(GitError, self).__init__()
|
||||||
self.command = command
|
self.command = command
|
||||||
|
|
||||||
def __str__(self):
|
def __str__(self):
|
||||||
return self.command
|
return self.command
|
||||||
|
|
||||||
|
|
||||||
class UploadError(Exception):
|
class UploadError(Exception):
|
||||||
"""A bundle upload to Gerrit did not succeed.
|
"""A bundle upload to Gerrit did not succeed.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
def __init__(self, reason):
|
def __init__(self, reason):
|
||||||
super().__init__(reason)
|
super(UploadError, self).__init__()
|
||||||
self.reason = reason
|
self.reason = reason
|
||||||
|
|
||||||
def __str__(self):
|
def __str__(self):
|
||||||
return self.reason
|
return self.reason
|
||||||
|
|
||||||
|
|
||||||
class DownloadError(Exception):
|
class DownloadError(Exception):
|
||||||
"""Cannot download a repository.
|
"""Cannot download a repository.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
def __init__(self, reason):
|
def __init__(self, reason):
|
||||||
super().__init__(reason)
|
super(DownloadError, self).__init__()
|
||||||
self.reason = reason
|
self.reason = reason
|
||||||
|
|
||||||
def __str__(self):
|
def __str__(self):
|
||||||
return self.reason
|
return self.reason
|
||||||
|
|
||||||
|
|
||||||
class NoSuchProjectError(Exception):
|
class NoSuchProjectError(Exception):
|
||||||
"""A specified project does not exist in the work tree.
|
"""A specified project does not exist in the work tree.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
def __init__(self, name=None):
|
def __init__(self, name=None):
|
||||||
super().__init__(name)
|
super(NoSuchProjectError, self).__init__()
|
||||||
self.name = name
|
self.name = name
|
||||||
|
|
||||||
def __str__(self):
|
def __str__(self):
|
||||||
@ -106,9 +89,8 @@ class NoSuchProjectError(Exception):
|
|||||||
class InvalidProjectGroupsError(Exception):
|
class InvalidProjectGroupsError(Exception):
|
||||||
"""A specified project is not suitable for the specified groups
|
"""A specified project is not suitable for the specified groups
|
||||||
"""
|
"""
|
||||||
|
|
||||||
def __init__(self, name=None):
|
def __init__(self, name=None):
|
||||||
super().__init__(name)
|
super(InvalidProjectGroupsError, self).__init__()
|
||||||
self.name = name
|
self.name = name
|
||||||
|
|
||||||
def __str__(self):
|
def __str__(self):
|
||||||
@ -116,18 +98,15 @@ class InvalidProjectGroupsError(Exception):
|
|||||||
return 'in current directory'
|
return 'in current directory'
|
||||||
return self.name
|
return self.name
|
||||||
|
|
||||||
|
|
||||||
class RepoChangedException(Exception):
|
class RepoChangedException(Exception):
|
||||||
"""Thrown if 'repo sync' results in repo updating its internal
|
"""Thrown if 'repo sync' results in repo updating its internal
|
||||||
repo or manifest repositories. In this special case we must
|
repo or manifest repositories. In this special case we must
|
||||||
use exec to re-execute repo with the new code and manifest.
|
use exec to re-execute repo with the new code and manifest.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
def __init__(self, extra_args=None):
|
def __init__(self, extra_args=None):
|
||||||
super().__init__(extra_args)
|
super(RepoChangedException, self).__init__()
|
||||||
self.extra_args = extra_args or []
|
self.extra_args = extra_args or []
|
||||||
|
|
||||||
|
|
||||||
class HookError(Exception):
|
class HookError(Exception):
|
||||||
"""Thrown if a 'repo-hook' could not be run.
|
"""Thrown if a 'repo-hook' could not be run.
|
||||||
|
|
||||||
|
@ -1,3 +1,5 @@
|
|||||||
|
# -*- coding:utf-8 -*-
|
||||||
|
#
|
||||||
# Copyright (C) 2017 The Android Open Source Project
|
# Copyright (C) 2017 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
@ -12,6 +14,8 @@
|
|||||||
# See the License for the specific language governing permissions and
|
# See the License for the specific language governing permissions and
|
||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
|
|
||||||
|
from __future__ import print_function
|
||||||
|
|
||||||
import json
|
import json
|
||||||
import multiprocessing
|
import multiprocessing
|
||||||
|
|
||||||
@ -19,7 +23,6 @@ TASK_COMMAND = 'command'
|
|||||||
TASK_SYNC_NETWORK = 'sync-network'
|
TASK_SYNC_NETWORK = 'sync-network'
|
||||||
TASK_SYNC_LOCAL = 'sync-local'
|
TASK_SYNC_LOCAL = 'sync-local'
|
||||||
|
|
||||||
|
|
||||||
class EventLog(object):
|
class EventLog(object):
|
||||||
"""Event log that records events that occurred during a repo invocation.
|
"""Event log that records events that occurred during a repo invocation.
|
||||||
|
|
||||||
@ -162,7 +165,6 @@ class EventLog(object):
|
|||||||
# An integer id that is unique across this invocation of the program.
|
# An integer id that is unique across this invocation of the program.
|
||||||
_EVENT_ID = multiprocessing.Value('i', 1)
|
_EVENT_ID = multiprocessing.Value('i', 1)
|
||||||
|
|
||||||
|
|
||||||
def _NextEventId():
|
def _NextEventId():
|
||||||
"""Helper function for grabbing the next unique id.
|
"""Helper function for grabbing the next unique id.
|
||||||
|
|
||||||
|
202
git_command.py
202
git_command.py
@ -1,3 +1,5 @@
|
|||||||
|
# -*- coding:utf-8 -*-
|
||||||
|
#
|
||||||
# Copyright (C) 2008 The Android Open Source Project
|
# Copyright (C) 2008 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
@ -12,10 +14,12 @@
|
|||||||
# See the License for the specific language governing permissions and
|
# See the License for the specific language governing permissions and
|
||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
|
|
||||||
import functools
|
from __future__ import print_function
|
||||||
import os
|
import os
|
||||||
import sys
|
import sys
|
||||||
import subprocess
|
import subprocess
|
||||||
|
import tempfile
|
||||||
|
from signal import SIGTERM
|
||||||
|
|
||||||
from error import GitError
|
from error import GitError
|
||||||
from git_refs import HEAD
|
from git_refs import HEAD
|
||||||
@ -24,42 +28,75 @@ from repo_trace import REPO_TRACE, IsTrace, Trace
|
|||||||
from wrapper import Wrapper
|
from wrapper import Wrapper
|
||||||
|
|
||||||
GIT = 'git'
|
GIT = 'git'
|
||||||
# NB: These do not need to be kept in sync with the repo launcher script.
|
MIN_GIT_VERSION = (1, 5, 4)
|
||||||
# These may be much newer as it allows the repo launcher to roll between
|
|
||||||
# different repo releases while source versions might require a newer git.
|
|
||||||
#
|
|
||||||
# The soft version is when we start warning users that the version is old and
|
|
||||||
# we'll be dropping support for it. We'll refuse to work with versions older
|
|
||||||
# than the hard version.
|
|
||||||
#
|
|
||||||
# git-1.7 is in (EOL) Ubuntu Precise. git-1.9 is in Ubuntu Trusty.
|
|
||||||
MIN_GIT_VERSION_SOFT = (1, 9, 1)
|
|
||||||
MIN_GIT_VERSION_HARD = (1, 7, 2)
|
|
||||||
GIT_DIR = 'GIT_DIR'
|
GIT_DIR = 'GIT_DIR'
|
||||||
|
|
||||||
LAST_GITDIR = None
|
LAST_GITDIR = None
|
||||||
LAST_CWD = None
|
LAST_CWD = None
|
||||||
|
|
||||||
|
_ssh_proxy_path = None
|
||||||
|
_ssh_sock_path = None
|
||||||
|
_ssh_clients = []
|
||||||
|
|
||||||
|
def ssh_sock(create=True):
|
||||||
|
global _ssh_sock_path
|
||||||
|
if _ssh_sock_path is None:
|
||||||
|
if not create:
|
||||||
|
return None
|
||||||
|
tmp_dir = '/tmp'
|
||||||
|
if not os.path.exists(tmp_dir):
|
||||||
|
tmp_dir = tempfile.gettempdir()
|
||||||
|
_ssh_sock_path = os.path.join(
|
||||||
|
tempfile.mkdtemp('', 'ssh-', tmp_dir),
|
||||||
|
'master-%r@%h:%p')
|
||||||
|
return _ssh_sock_path
|
||||||
|
|
||||||
|
def _ssh_proxy():
|
||||||
|
global _ssh_proxy_path
|
||||||
|
if _ssh_proxy_path is None:
|
||||||
|
_ssh_proxy_path = os.path.join(
|
||||||
|
os.path.dirname(__file__),
|
||||||
|
'git_ssh')
|
||||||
|
return _ssh_proxy_path
|
||||||
|
|
||||||
|
def _add_ssh_client(p):
|
||||||
|
_ssh_clients.append(p)
|
||||||
|
|
||||||
|
def _remove_ssh_client(p):
|
||||||
|
try:
|
||||||
|
_ssh_clients.remove(p)
|
||||||
|
except ValueError:
|
||||||
|
pass
|
||||||
|
|
||||||
|
def terminate_ssh_clients():
|
||||||
|
global _ssh_clients
|
||||||
|
for p in _ssh_clients:
|
||||||
|
try:
|
||||||
|
os.kill(p.pid, SIGTERM)
|
||||||
|
p.wait()
|
||||||
|
except OSError:
|
||||||
|
pass
|
||||||
|
_ssh_clients = []
|
||||||
|
|
||||||
|
_git_version = None
|
||||||
|
|
||||||
class _GitCall(object):
|
class _GitCall(object):
|
||||||
@functools.lru_cache(maxsize=None)
|
|
||||||
def version_tuple(self):
|
def version_tuple(self):
|
||||||
ret = Wrapper().ParseGitVersion()
|
global _git_version
|
||||||
if ret is None:
|
if _git_version is None:
|
||||||
|
_git_version = Wrapper().ParseGitVersion()
|
||||||
|
if _git_version is None:
|
||||||
print('fatal: unable to detect git version', file=sys.stderr)
|
print('fatal: unable to detect git version', file=sys.stderr)
|
||||||
sys.exit(1)
|
sys.exit(1)
|
||||||
return ret
|
return _git_version
|
||||||
|
|
||||||
def __getattr__(self, name):
|
def __getattr__(self, name):
|
||||||
name = name.replace('_', '-')
|
name = name.replace('_','-')
|
||||||
|
|
||||||
def fun(*cmdv):
|
def fun(*cmdv):
|
||||||
command = [name]
|
command = [name]
|
||||||
command.extend(cmdv)
|
command.extend(cmdv)
|
||||||
return GitCommand(None, command).Wait() == 0
|
return GitCommand(None, command).Wait() == 0
|
||||||
return fun
|
return fun
|
||||||
|
|
||||||
|
|
||||||
git = _GitCall()
|
git = _GitCall()
|
||||||
|
|
||||||
|
|
||||||
@ -74,10 +111,11 @@ def RepoSourceVersion():
|
|||||||
|
|
||||||
proj = os.path.dirname(os.path.abspath(__file__))
|
proj = os.path.dirname(os.path.abspath(__file__))
|
||||||
env[GIT_DIR] = os.path.join(proj, '.git')
|
env[GIT_DIR] = os.path.join(proj, '.git')
|
||||||
result = subprocess.run([GIT, 'describe', HEAD], stdout=subprocess.PIPE,
|
|
||||||
encoding='utf-8', env=env, check=False)
|
p = subprocess.Popen([GIT, 'describe', HEAD], stdout=subprocess.PIPE,
|
||||||
if result.returncode == 0:
|
env=env)
|
||||||
ver = result.stdout.strip()
|
if p.wait() == 0:
|
||||||
|
ver = p.stdout.read().strip().decode('utf-8')
|
||||||
if ver.startswith('v'):
|
if ver.startswith('v'):
|
||||||
ver = ver[1:]
|
ver = ver[1:]
|
||||||
else:
|
else:
|
||||||
@ -139,10 +177,8 @@ class UserAgent(object):
|
|||||||
|
|
||||||
return self._git_ua
|
return self._git_ua
|
||||||
|
|
||||||
|
|
||||||
user_agent = UserAgent()
|
user_agent = UserAgent()
|
||||||
|
|
||||||
|
|
||||||
def git_require(min_version, fail=False, msg=''):
|
def git_require(min_version, fail=False, msg=''):
|
||||||
git_version = git.version_tuple()
|
git_version = git.version_tuple()
|
||||||
if min_version <= git_version:
|
if min_version <= git_version:
|
||||||
@ -155,38 +191,42 @@ def git_require(min_version, fail=False, msg=''):
|
|||||||
sys.exit(1)
|
sys.exit(1)
|
||||||
return False
|
return False
|
||||||
|
|
||||||
|
def _setenv(env, name, value):
|
||||||
|
env[name] = value.encode()
|
||||||
|
|
||||||
class GitCommand(object):
|
class GitCommand(object):
|
||||||
def __init__(self,
|
def __init__(self,
|
||||||
project,
|
project,
|
||||||
cmdv,
|
cmdv,
|
||||||
bare=False,
|
bare = False,
|
||||||
input=None,
|
provide_stdin = False,
|
||||||
capture_stdout=False,
|
capture_stdout = False,
|
||||||
capture_stderr=False,
|
capture_stderr = False,
|
||||||
merge_output=False,
|
disable_editor = False,
|
||||||
disable_editor=False,
|
ssh_proxy = False,
|
||||||
ssh_proxy=None,
|
cwd = None,
|
||||||
cwd=None,
|
gitdir = None):
|
||||||
gitdir=None):
|
|
||||||
env = self._GetBasicEnv()
|
env = self._GetBasicEnv()
|
||||||
|
|
||||||
|
# If we are not capturing std* then need to print it.
|
||||||
|
self.tee = {'stdout': not capture_stdout, 'stderr': not capture_stderr}
|
||||||
|
|
||||||
if disable_editor:
|
if disable_editor:
|
||||||
env['GIT_EDITOR'] = ':'
|
_setenv(env, 'GIT_EDITOR', ':')
|
||||||
if ssh_proxy:
|
if ssh_proxy:
|
||||||
env['REPO_SSH_SOCK'] = ssh_proxy.sock()
|
_setenv(env, 'REPO_SSH_SOCK', ssh_sock())
|
||||||
env['GIT_SSH'] = ssh_proxy.proxy
|
_setenv(env, 'GIT_SSH', _ssh_proxy())
|
||||||
env['GIT_SSH_VARIANT'] = 'ssh'
|
_setenv(env, 'GIT_SSH_VARIANT', 'ssh')
|
||||||
if 'http_proxy' in env and 'darwin' == sys.platform:
|
if 'http_proxy' in env and 'darwin' == sys.platform:
|
||||||
s = "'http.proxy=%s'" % (env['http_proxy'],)
|
s = "'http.proxy=%s'" % (env['http_proxy'],)
|
||||||
p = env.get('GIT_CONFIG_PARAMETERS')
|
p = env.get('GIT_CONFIG_PARAMETERS')
|
||||||
if p is not None:
|
if p is not None:
|
||||||
s = p + ' ' + s
|
s = p + ' ' + s
|
||||||
env['GIT_CONFIG_PARAMETERS'] = s
|
_setenv(env, 'GIT_CONFIG_PARAMETERS', s)
|
||||||
if 'GIT_ALLOW_PROTOCOL' not in env:
|
if 'GIT_ALLOW_PROTOCOL' not in env:
|
||||||
env['GIT_ALLOW_PROTOCOL'] = (
|
_setenv(env, 'GIT_ALLOW_PROTOCOL',
|
||||||
'file:git:http:https:ssh:persistent-http:persistent-https:sso:rpc')
|
'file:git:http:https:ssh:persistent-http:persistent-https:sso:rpc')
|
||||||
env['GIT_HTTP_USER_AGENT'] = user_agent.git
|
_setenv(env, 'GIT_HTTP_USER_AGENT', user_agent.git)
|
||||||
|
|
||||||
if project:
|
if project:
|
||||||
if not cwd:
|
if not cwd:
|
||||||
@ -197,10 +237,7 @@ class GitCommand(object):
|
|||||||
command = [GIT]
|
command = [GIT]
|
||||||
if bare:
|
if bare:
|
||||||
if gitdir:
|
if gitdir:
|
||||||
# Git on Windows wants its paths only using / for reliability.
|
_setenv(env, GIT_DIR, gitdir)
|
||||||
if platform_utils.isWindows():
|
|
||||||
gitdir = gitdir.replace('\\', '/')
|
|
||||||
env[GIT_DIR] = gitdir
|
|
||||||
cwd = None
|
cwd = None
|
||||||
command.append(cmdv[0])
|
command.append(cmdv[0])
|
||||||
# Need to use the --progress flag for fetch/clone so output will be
|
# Need to use the --progress flag for fetch/clone so output will be
|
||||||
@ -210,10 +247,13 @@ class GitCommand(object):
|
|||||||
command.append('--progress')
|
command.append('--progress')
|
||||||
command.extend(cmdv[1:])
|
command.extend(cmdv[1:])
|
||||||
|
|
||||||
stdin = subprocess.PIPE if input else None
|
if provide_stdin:
|
||||||
stdout = subprocess.PIPE if capture_stdout else None
|
stdin = subprocess.PIPE
|
||||||
stderr = (subprocess.STDOUT if merge_output else
|
else:
|
||||||
(subprocess.PIPE if capture_stderr else None))
|
stdin = None
|
||||||
|
|
||||||
|
stdout = subprocess.PIPE
|
||||||
|
stderr = subprocess.PIPE
|
||||||
|
|
||||||
if IsTrace():
|
if IsTrace():
|
||||||
global LAST_CWD
|
global LAST_CWD
|
||||||
@ -241,38 +281,23 @@ class GitCommand(object):
|
|||||||
dbg += ' 1>|'
|
dbg += ' 1>|'
|
||||||
if stderr == subprocess.PIPE:
|
if stderr == subprocess.PIPE:
|
||||||
dbg += ' 2>|'
|
dbg += ' 2>|'
|
||||||
elif stderr == subprocess.STDOUT:
|
|
||||||
dbg += ' 2>&1'
|
|
||||||
Trace('%s', dbg)
|
Trace('%s', dbg)
|
||||||
|
|
||||||
try:
|
try:
|
||||||
p = subprocess.Popen(command,
|
p = subprocess.Popen(command,
|
||||||
cwd=cwd,
|
cwd = cwd,
|
||||||
env=env,
|
env = env,
|
||||||
encoding='utf-8',
|
stdin = stdin,
|
||||||
errors='backslashreplace',
|
stdout = stdout,
|
||||||
stdin=stdin,
|
stderr = stderr)
|
||||||
stdout=stdout,
|
|
||||||
stderr=stderr)
|
|
||||||
except Exception as e:
|
except Exception as e:
|
||||||
raise GitError('%s: %s' % (command[1], e))
|
raise GitError('%s: %s' % (command[1], e))
|
||||||
|
|
||||||
if ssh_proxy:
|
if ssh_proxy:
|
||||||
ssh_proxy.add_client(p)
|
_add_ssh_client(p)
|
||||||
|
|
||||||
self.process = p
|
self.process = p
|
||||||
if input:
|
self.stdin = p.stdin
|
||||||
if isinstance(input, str):
|
|
||||||
input = input.encode('utf-8')
|
|
||||||
p.stdin.write(input)
|
|
||||||
p.stdin.close()
|
|
||||||
|
|
||||||
try:
|
|
||||||
self.stdout, self.stderr = p.communicate()
|
|
||||||
finally:
|
|
||||||
if ssh_proxy:
|
|
||||||
ssh_proxy.remove_client(p)
|
|
||||||
self.rc = p.wait()
|
|
||||||
|
|
||||||
@staticmethod
|
@staticmethod
|
||||||
def _GetBasicEnv():
|
def _GetBasicEnv():
|
||||||
@ -292,4 +317,35 @@ class GitCommand(object):
|
|||||||
return env
|
return env
|
||||||
|
|
||||||
def Wait(self):
|
def Wait(self):
|
||||||
return self.rc
|
try:
|
||||||
|
p = self.process
|
||||||
|
rc = self._CaptureOutput()
|
||||||
|
finally:
|
||||||
|
_remove_ssh_client(p)
|
||||||
|
return rc
|
||||||
|
|
||||||
|
def _CaptureOutput(self):
|
||||||
|
p = self.process
|
||||||
|
s_in = platform_utils.FileDescriptorStreams.create()
|
||||||
|
s_in.add(p.stdout, sys.stdout, 'stdout')
|
||||||
|
s_in.add(p.stderr, sys.stderr, 'stderr')
|
||||||
|
self.stdout = ''
|
||||||
|
self.stderr = ''
|
||||||
|
|
||||||
|
while not s_in.is_done:
|
||||||
|
in_ready = s_in.select()
|
||||||
|
for s in in_ready:
|
||||||
|
buf = s.read()
|
||||||
|
if not buf:
|
||||||
|
s_in.remove(s)
|
||||||
|
continue
|
||||||
|
if not hasattr(buf, 'encode'):
|
||||||
|
buf = buf.decode()
|
||||||
|
if s.std_name == 'stdout':
|
||||||
|
self.stdout += buf
|
||||||
|
else:
|
||||||
|
self.stderr += buf
|
||||||
|
if self.tee[s.std_name]:
|
||||||
|
s.dest.write(buf)
|
||||||
|
s.dest.flush()
|
||||||
|
return p.wait()
|
||||||
|
300
git_config.py
300
git_config.py
@ -1,3 +1,5 @@
|
|||||||
|
# -*- coding:utf-8 -*-
|
||||||
|
#
|
||||||
# Copyright (C) 2008 The Android Open Source Project
|
# Copyright (C) 2008 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
@ -12,69 +14,84 @@
|
|||||||
# See the License for the specific language governing permissions and
|
# See the License for the specific language governing permissions and
|
||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
|
|
||||||
|
from __future__ import print_function
|
||||||
|
|
||||||
import contextlib
|
import contextlib
|
||||||
import errno
|
import errno
|
||||||
from http.client import HTTPException
|
|
||||||
import json
|
import json
|
||||||
import os
|
import os
|
||||||
import re
|
import re
|
||||||
import ssl
|
import ssl
|
||||||
import subprocess
|
import subprocess
|
||||||
import sys
|
import sys
|
||||||
import urllib.error
|
try:
|
||||||
import urllib.request
|
import threading as _threading
|
||||||
|
except ImportError:
|
||||||
|
import dummy_threading as _threading
|
||||||
|
import time
|
||||||
|
|
||||||
|
from pyversion import is_python3
|
||||||
|
if is_python3():
|
||||||
|
import urllib.request
|
||||||
|
import urllib.error
|
||||||
|
else:
|
||||||
|
import urllib2
|
||||||
|
import imp
|
||||||
|
urllib = imp.new_module('urllib')
|
||||||
|
urllib.request = urllib2
|
||||||
|
urllib.error = urllib2
|
||||||
|
|
||||||
|
from signal import SIGTERM
|
||||||
from error import GitError, UploadError
|
from error import GitError, UploadError
|
||||||
import platform_utils
|
import platform_utils
|
||||||
from repo_trace import Trace
|
from repo_trace import Trace
|
||||||
|
if is_python3():
|
||||||
|
from http.client import HTTPException
|
||||||
|
else:
|
||||||
|
from httplib import HTTPException
|
||||||
|
|
||||||
from git_command import GitCommand
|
from git_command import GitCommand
|
||||||
|
from git_command import ssh_sock
|
||||||
|
from git_command import terminate_ssh_clients
|
||||||
from git_refs import R_CHANGES, R_HEADS, R_TAGS
|
from git_refs import R_CHANGES, R_HEADS, R_TAGS
|
||||||
|
|
||||||
ID_RE = re.compile(r'^[0-9a-f]{40}$')
|
ID_RE = re.compile(r'^[0-9a-f]{40}$')
|
||||||
|
|
||||||
REVIEW_CACHE = dict()
|
REVIEW_CACHE = dict()
|
||||||
|
|
||||||
|
|
||||||
def IsChange(rev):
|
def IsChange(rev):
|
||||||
return rev.startswith(R_CHANGES)
|
return rev.startswith(R_CHANGES)
|
||||||
|
|
||||||
|
|
||||||
def IsId(rev):
|
def IsId(rev):
|
||||||
return ID_RE.match(rev)
|
return ID_RE.match(rev)
|
||||||
|
|
||||||
|
|
||||||
def IsTag(rev):
|
def IsTag(rev):
|
||||||
return rev.startswith(R_TAGS)
|
return rev.startswith(R_TAGS)
|
||||||
|
|
||||||
|
|
||||||
def IsImmutable(rev):
|
def IsImmutable(rev):
|
||||||
return IsChange(rev) or IsId(rev) or IsTag(rev)
|
return IsChange(rev) or IsId(rev) or IsTag(rev)
|
||||||
|
|
||||||
|
|
||||||
def _key(name):
|
def _key(name):
|
||||||
parts = name.split('.')
|
parts = name.split('.')
|
||||||
if len(parts) < 2:
|
if len(parts) < 2:
|
||||||
return name.lower()
|
return name.lower()
|
||||||
parts[0] = parts[0].lower()
|
parts[ 0] = parts[ 0].lower()
|
||||||
parts[-1] = parts[-1].lower()
|
parts[-1] = parts[-1].lower()
|
||||||
return '.'.join(parts)
|
return '.'.join(parts)
|
||||||
|
|
||||||
|
|
||||||
class GitConfig(object):
|
class GitConfig(object):
|
||||||
_ForUser = None
|
_ForUser = None
|
||||||
|
|
||||||
_USER_CONFIG = '~/.gitconfig'
|
|
||||||
|
|
||||||
@classmethod
|
@classmethod
|
||||||
def ForUser(cls):
|
def ForUser(cls):
|
||||||
if cls._ForUser is None:
|
if cls._ForUser is None:
|
||||||
cls._ForUser = cls(configfile=os.path.expanduser(cls._USER_CONFIG))
|
cls._ForUser = cls(configfile = os.path.expanduser('~/.gitconfig'))
|
||||||
return cls._ForUser
|
return cls._ForUser
|
||||||
|
|
||||||
@classmethod
|
@classmethod
|
||||||
def ForRepository(cls, gitdir, defaults=None):
|
def ForRepository(cls, gitdir, defaults=None):
|
||||||
return cls(configfile=os.path.join(gitdir, 'config'),
|
return cls(configfile = os.path.join(gitdir, 'config'),
|
||||||
defaults=defaults)
|
defaults = defaults)
|
||||||
|
|
||||||
def __init__(self, configfile, defaults=None, jsonFile=None):
|
def __init__(self, configfile, defaults=None, jsonFile=None):
|
||||||
self.file = configfile
|
self.file = configfile
|
||||||
@ -90,67 +107,15 @@ class GitConfig(object):
|
|||||||
os.path.dirname(self.file),
|
os.path.dirname(self.file),
|
||||||
'.repo_' + os.path.basename(self.file) + '.json')
|
'.repo_' + os.path.basename(self.file) + '.json')
|
||||||
|
|
||||||
def Has(self, name, include_defaults=True):
|
def Has(self, name, include_defaults = True):
|
||||||
"""Return true if this configuration file has the key.
|
"""Return true if this configuration file has the key.
|
||||||
"""
|
"""
|
||||||
if _key(name) in self._cache:
|
if _key(name) in self._cache:
|
||||||
return True
|
return True
|
||||||
if include_defaults and self.defaults:
|
if include_defaults and self.defaults:
|
||||||
return self.defaults.Has(name, include_defaults=True)
|
return self.defaults.Has(name, include_defaults = True)
|
||||||
return False
|
return False
|
||||||
|
|
||||||
def GetInt(self, name):
|
|
||||||
"""Returns an integer from the configuration file.
|
|
||||||
|
|
||||||
This follows the git config syntax.
|
|
||||||
|
|
||||||
Args:
|
|
||||||
name: The key to lookup.
|
|
||||||
|
|
||||||
Returns:
|
|
||||||
None if the value was not defined, or is not a boolean.
|
|
||||||
Otherwise, the number itself.
|
|
||||||
"""
|
|
||||||
v = self.GetString(name)
|
|
||||||
if v is None:
|
|
||||||
return None
|
|
||||||
v = v.strip()
|
|
||||||
|
|
||||||
mult = 1
|
|
||||||
if v.endswith('k'):
|
|
||||||
v = v[:-1]
|
|
||||||
mult = 1024
|
|
||||||
elif v.endswith('m'):
|
|
||||||
v = v[:-1]
|
|
||||||
mult = 1024 * 1024
|
|
||||||
elif v.endswith('g'):
|
|
||||||
v = v[:-1]
|
|
||||||
mult = 1024 * 1024 * 1024
|
|
||||||
|
|
||||||
base = 10
|
|
||||||
if v.startswith('0x'):
|
|
||||||
base = 16
|
|
||||||
|
|
||||||
try:
|
|
||||||
return int(v, base=base) * mult
|
|
||||||
except ValueError:
|
|
||||||
return None
|
|
||||||
|
|
||||||
def DumpConfigDict(self):
|
|
||||||
"""Returns the current configuration dict.
|
|
||||||
|
|
||||||
Configuration data is information only (e.g. logging) and
|
|
||||||
should not be considered a stable data-source.
|
|
||||||
|
|
||||||
Returns:
|
|
||||||
dict of {<key>, <value>} for git configuration cache.
|
|
||||||
<value> are strings converted by GetString.
|
|
||||||
"""
|
|
||||||
config_dict = {}
|
|
||||||
for key in self._cache:
|
|
||||||
config_dict[key] = self.GetString(key)
|
|
||||||
return config_dict
|
|
||||||
|
|
||||||
def GetBoolean(self, name):
|
def GetBoolean(self, name):
|
||||||
"""Returns a boolean from the configuration file.
|
"""Returns a boolean from the configuration file.
|
||||||
None : The value was not defined, or is not a boolean.
|
None : The value was not defined, or is not a boolean.
|
||||||
@ -167,12 +132,6 @@ class GitConfig(object):
|
|||||||
return False
|
return False
|
||||||
return None
|
return None
|
||||||
|
|
||||||
def SetBoolean(self, name, value):
|
|
||||||
"""Set the truthy value for a key."""
|
|
||||||
if value is not None:
|
|
||||||
value = 'true' if value else 'false'
|
|
||||||
self.SetString(name, value)
|
|
||||||
|
|
||||||
def GetString(self, name, all_keys=False):
|
def GetString(self, name, all_keys=False):
|
||||||
"""Get the first value for a key, or None if it is not defined.
|
"""Get the first value for a key, or None if it is not defined.
|
||||||
|
|
||||||
@ -183,7 +142,7 @@ class GitConfig(object):
|
|||||||
v = self._cache[_key(name)]
|
v = self._cache[_key(name)]
|
||||||
except KeyError:
|
except KeyError:
|
||||||
if self.defaults:
|
if self.defaults:
|
||||||
return self.defaults.GetString(name, all_keys=all_keys)
|
return self.defaults.GetString(name, all_keys = all_keys)
|
||||||
v = []
|
v = []
|
||||||
|
|
||||||
if not all_keys:
|
if not all_keys:
|
||||||
@ -194,7 +153,7 @@ class GitConfig(object):
|
|||||||
r = []
|
r = []
|
||||||
r.extend(v)
|
r.extend(v)
|
||||||
if self.defaults:
|
if self.defaults:
|
||||||
r.extend(self.defaults.GetString(name, all_keys=True))
|
r.extend(self.defaults.GetString(name, all_keys = True))
|
||||||
return r
|
return r
|
||||||
|
|
||||||
def SetString(self, name, value):
|
def SetString(self, name, value):
|
||||||
@ -258,7 +217,7 @@ class GitConfig(object):
|
|||||||
"""
|
"""
|
||||||
return self._sections.get(section, set())
|
return self._sections.get(section, set())
|
||||||
|
|
||||||
def HasSection(self, section, subsection=''):
|
def HasSection(self, section, subsection = ''):
|
||||||
"""Does at least one key in section.subsection exist?
|
"""Does at least one key in section.subsection exist?
|
||||||
"""
|
"""
|
||||||
try:
|
try:
|
||||||
@ -309,7 +268,8 @@ class GitConfig(object):
|
|||||||
|
|
||||||
def _ReadJson(self):
|
def _ReadJson(self):
|
||||||
try:
|
try:
|
||||||
if os.path.getmtime(self._json) <= os.path.getmtime(self.file):
|
if os.path.getmtime(self._json) \
|
||||||
|
<= os.path.getmtime(self.file):
|
||||||
platform_utils.remove(self._json)
|
platform_utils.remove(self._json)
|
||||||
return None
|
return None
|
||||||
except OSError:
|
except OSError:
|
||||||
@ -341,6 +301,8 @@ class GitConfig(object):
|
|||||||
d = self._do('--null', '--list')
|
d = self._do('--null', '--list')
|
||||||
if d is None:
|
if d is None:
|
||||||
return c
|
return c
|
||||||
|
if not is_python3():
|
||||||
|
d = d.decode('utf-8')
|
||||||
for line in d.rstrip('\0').split('\0'):
|
for line in d.rstrip('\0').split('\0'):
|
||||||
if '\n' in line:
|
if '\n' in line:
|
||||||
key, val = line.split('\n', 1)
|
key, val = line.split('\n', 1)
|
||||||
@ -356,25 +318,19 @@ class GitConfig(object):
|
|||||||
return c
|
return c
|
||||||
|
|
||||||
def _do(self, *args):
|
def _do(self, *args):
|
||||||
command = ['config', '--file', self.file, '--includes']
|
command = ['config', '--file', self.file]
|
||||||
command.extend(args)
|
command.extend(args)
|
||||||
|
|
||||||
p = GitCommand(None,
|
p = GitCommand(None,
|
||||||
command,
|
command,
|
||||||
capture_stdout=True,
|
capture_stdout = True,
|
||||||
capture_stderr=True)
|
capture_stderr = True)
|
||||||
if p.Wait() == 0:
|
if p.Wait() == 0:
|
||||||
return p.stdout
|
return p.stdout
|
||||||
else:
|
else:
|
||||||
GitError('git config %s: %s' % (str(args), p.stderr))
|
GitError('git config %s: %s' % (str(args), p.stderr))
|
||||||
|
|
||||||
|
|
||||||
class RepoConfig(GitConfig):
|
|
||||||
"""User settings for repo itself."""
|
|
||||||
|
|
||||||
_USER_CONFIG = '~/.repoconfig/config'
|
|
||||||
|
|
||||||
|
|
||||||
class RefSpec(object):
|
class RefSpec(object):
|
||||||
"""A Git refspec line, split into its components:
|
"""A Git refspec line, split into its components:
|
||||||
|
|
||||||
@ -431,8 +387,126 @@ class RefSpec(object):
|
|||||||
return s
|
return s
|
||||||
|
|
||||||
|
|
||||||
URI_ALL = re.compile(r'^([a-z][a-z+-]*)://([^@/]*@?[^/]*)/')
|
_master_processes = []
|
||||||
|
_master_keys = set()
|
||||||
|
_ssh_master = True
|
||||||
|
_master_keys_lock = None
|
||||||
|
|
||||||
|
def init_ssh():
|
||||||
|
"""Should be called once at the start of repo to init ssh master handling.
|
||||||
|
|
||||||
|
At the moment, all we do is to create our lock.
|
||||||
|
"""
|
||||||
|
global _master_keys_lock
|
||||||
|
assert _master_keys_lock is None, "Should only call init_ssh once"
|
||||||
|
_master_keys_lock = _threading.Lock()
|
||||||
|
|
||||||
|
def _open_ssh(host, port=None):
|
||||||
|
global _ssh_master
|
||||||
|
|
||||||
|
# Acquire the lock. This is needed to prevent opening multiple masters for
|
||||||
|
# the same host when we're running "repo sync -jN" (for N > 1) _and_ the
|
||||||
|
# manifest <remote fetch="ssh://xyz"> specifies a different host from the
|
||||||
|
# one that was passed to repo init.
|
||||||
|
_master_keys_lock.acquire()
|
||||||
|
try:
|
||||||
|
|
||||||
|
# Check to see whether we already think that the master is running; if we
|
||||||
|
# think it's already running, return right away.
|
||||||
|
if port is not None:
|
||||||
|
key = '%s:%s' % (host, port)
|
||||||
|
else:
|
||||||
|
key = host
|
||||||
|
|
||||||
|
if key in _master_keys:
|
||||||
|
return True
|
||||||
|
|
||||||
|
if not _ssh_master \
|
||||||
|
or 'GIT_SSH' in os.environ \
|
||||||
|
or sys.platform in ('win32', 'cygwin'):
|
||||||
|
# failed earlier, or cygwin ssh can't do this
|
||||||
|
#
|
||||||
|
return False
|
||||||
|
|
||||||
|
# We will make two calls to ssh; this is the common part of both calls.
|
||||||
|
command_base = ['ssh',
|
||||||
|
'-o','ControlPath %s' % ssh_sock(),
|
||||||
|
host]
|
||||||
|
if port is not None:
|
||||||
|
command_base[1:1] = ['-p', str(port)]
|
||||||
|
|
||||||
|
# Since the key wasn't in _master_keys, we think that master isn't running.
|
||||||
|
# ...but before actually starting a master, we'll double-check. This can
|
||||||
|
# be important because we can't tell that that 'git@myhost.com' is the same
|
||||||
|
# as 'myhost.com' where "User git" is setup in the user's ~/.ssh/config file.
|
||||||
|
check_command = command_base + ['-O','check']
|
||||||
|
try:
|
||||||
|
Trace(': %s', ' '.join(check_command))
|
||||||
|
check_process = subprocess.Popen(check_command,
|
||||||
|
stdout=subprocess.PIPE,
|
||||||
|
stderr=subprocess.PIPE)
|
||||||
|
check_process.communicate() # read output, but ignore it...
|
||||||
|
isnt_running = check_process.wait()
|
||||||
|
|
||||||
|
if not isnt_running:
|
||||||
|
# Our double-check found that the master _was_ infact running. Add to
|
||||||
|
# the list of keys.
|
||||||
|
_master_keys.add(key)
|
||||||
|
return True
|
||||||
|
except Exception:
|
||||||
|
# Ignore excpetions. We we will fall back to the normal command and print
|
||||||
|
# to the log there.
|
||||||
|
pass
|
||||||
|
|
||||||
|
command = command_base[:1] + \
|
||||||
|
['-M', '-N'] + \
|
||||||
|
command_base[1:]
|
||||||
|
try:
|
||||||
|
Trace(': %s', ' '.join(command))
|
||||||
|
p = subprocess.Popen(command)
|
||||||
|
except Exception as e:
|
||||||
|
_ssh_master = False
|
||||||
|
print('\nwarn: cannot enable ssh control master for %s:%s\n%s'
|
||||||
|
% (host,port, str(e)), file=sys.stderr)
|
||||||
|
return False
|
||||||
|
|
||||||
|
time.sleep(1)
|
||||||
|
ssh_died = (p.poll() is not None)
|
||||||
|
if ssh_died:
|
||||||
|
return False
|
||||||
|
|
||||||
|
_master_processes.append(p)
|
||||||
|
_master_keys.add(key)
|
||||||
|
return True
|
||||||
|
finally:
|
||||||
|
_master_keys_lock.release()
|
||||||
|
|
||||||
|
def close_ssh():
|
||||||
|
global _master_keys_lock
|
||||||
|
|
||||||
|
terminate_ssh_clients()
|
||||||
|
|
||||||
|
for p in _master_processes:
|
||||||
|
try:
|
||||||
|
os.kill(p.pid, SIGTERM)
|
||||||
|
p.wait()
|
||||||
|
except OSError:
|
||||||
|
pass
|
||||||
|
del _master_processes[:]
|
||||||
|
_master_keys.clear()
|
||||||
|
|
||||||
|
d = ssh_sock(create=False)
|
||||||
|
if d:
|
||||||
|
try:
|
||||||
|
platform_utils.rmdir(os.path.dirname(d))
|
||||||
|
except OSError:
|
||||||
|
pass
|
||||||
|
|
||||||
|
# We're done with the lock, so we can delete it.
|
||||||
|
_master_keys_lock = None
|
||||||
|
|
||||||
|
URI_SCP = re.compile(r'^([^@:]*@?[^:/]{1,}):')
|
||||||
|
URI_ALL = re.compile(r'^([a-z][a-z+-]*)://([^@/]*@?[^/]*)/')
|
||||||
|
|
||||||
def GetSchemeFromUrl(url):
|
def GetSchemeFromUrl(url):
|
||||||
m = URI_ALL.match(url)
|
m = URI_ALL.match(url)
|
||||||
@ -440,7 +514,6 @@ def GetSchemeFromUrl(url):
|
|||||||
return m.group(1)
|
return m.group(1)
|
||||||
return None
|
return None
|
||||||
|
|
||||||
|
|
||||||
@contextlib.contextmanager
|
@contextlib.contextmanager
|
||||||
def GetUrlCookieFile(url, quiet):
|
def GetUrlCookieFile(url, quiet):
|
||||||
if url.startswith('persistent-'):
|
if url.startswith('persistent-'):
|
||||||
@ -481,11 +554,29 @@ def GetUrlCookieFile(url, quiet):
|
|||||||
cookiefile = os.path.expanduser(cookiefile)
|
cookiefile = os.path.expanduser(cookiefile)
|
||||||
yield cookiefile, None
|
yield cookiefile, None
|
||||||
|
|
||||||
|
def _preconnect(url):
|
||||||
|
m = URI_ALL.match(url)
|
||||||
|
if m:
|
||||||
|
scheme = m.group(1)
|
||||||
|
host = m.group(2)
|
||||||
|
if ':' in host:
|
||||||
|
host, port = host.split(':')
|
||||||
|
else:
|
||||||
|
port = None
|
||||||
|
if scheme in ('ssh', 'git+ssh', 'ssh+git'):
|
||||||
|
return _open_ssh(host, port)
|
||||||
|
return False
|
||||||
|
|
||||||
|
m = URI_SCP.match(url)
|
||||||
|
if m:
|
||||||
|
host = m.group(1)
|
||||||
|
return _open_ssh(host)
|
||||||
|
|
||||||
|
return False
|
||||||
|
|
||||||
class Remote(object):
|
class Remote(object):
|
||||||
"""Configuration options related to a remote.
|
"""Configuration options related to a remote.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
def __init__(self, config, name):
|
def __init__(self, config, name):
|
||||||
self._config = config
|
self._config = config
|
||||||
self.name = name
|
self.name = name
|
||||||
@ -508,8 +599,8 @@ class Remote(object):
|
|||||||
insteadOfList = globCfg.GetString(key, all_keys=True)
|
insteadOfList = globCfg.GetString(key, all_keys=True)
|
||||||
|
|
||||||
for insteadOf in insteadOfList:
|
for insteadOf in insteadOfList:
|
||||||
if (self.url.startswith(insteadOf)
|
if self.url.startswith(insteadOf) \
|
||||||
and len(insteadOf) > len(longest)):
|
and len(insteadOf) > len(longest):
|
||||||
longest = insteadOf
|
longest = insteadOf
|
||||||
longestUrl = url
|
longestUrl = url
|
||||||
|
|
||||||
@ -518,23 +609,9 @@ class Remote(object):
|
|||||||
|
|
||||||
return self.url.replace(longest, longestUrl, 1)
|
return self.url.replace(longest, longestUrl, 1)
|
||||||
|
|
||||||
def PreConnectFetch(self, ssh_proxy):
|
def PreConnectFetch(self):
|
||||||
"""Run any setup for this remote before we connect to it.
|
|
||||||
|
|
||||||
In practice, if the remote is using SSH, we'll attempt to create a new
|
|
||||||
SSH master session to it for reuse across projects.
|
|
||||||
|
|
||||||
Args:
|
|
||||||
ssh_proxy: The SSH settings for managing master sessions.
|
|
||||||
|
|
||||||
Returns:
|
|
||||||
Whether the preconnect phase for this remote was successful.
|
|
||||||
"""
|
|
||||||
if not ssh_proxy:
|
|
||||||
return True
|
|
||||||
|
|
||||||
connectionUrl = self._InsteadOf()
|
connectionUrl = self._InsteadOf()
|
||||||
return ssh_proxy.preconnect(connectionUrl)
|
return _preconnect(connectionUrl)
|
||||||
|
|
||||||
def ReviewUrl(self, userEmail, validate_certs):
|
def ReviewUrl(self, userEmail, validate_certs):
|
||||||
if self._review_url is None:
|
if self._review_url is None:
|
||||||
@ -654,13 +731,12 @@ class Remote(object):
|
|||||||
|
|
||||||
def _Get(self, key, all_keys=False):
|
def _Get(self, key, all_keys=False):
|
||||||
key = 'remote.%s.%s' % (self.name, key)
|
key = 'remote.%s.%s' % (self.name, key)
|
||||||
return self._config.GetString(key, all_keys=all_keys)
|
return self._config.GetString(key, all_keys = all_keys)
|
||||||
|
|
||||||
|
|
||||||
class Branch(object):
|
class Branch(object):
|
||||||
"""Configuration options related to a single branch.
|
"""Configuration options related to a single branch.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
def __init__(self, config, name):
|
def __init__(self, config, name):
|
||||||
self._config = config
|
self._config = config
|
||||||
self.name = name
|
self.name = name
|
||||||
@ -704,4 +780,4 @@ class Branch(object):
|
|||||||
|
|
||||||
def _Get(self, key, all_keys=False):
|
def _Get(self, key, all_keys=False):
|
||||||
key = 'branch.%s.%s' % (self.name, key)
|
key = 'branch.%s.%s' % (self.name, key)
|
||||||
return self._config.GetString(key, all_keys=all_keys)
|
return self._config.GetString(key, all_keys = all_keys)
|
||||||
|
15
git_refs.py
15
git_refs.py
@ -1,3 +1,5 @@
|
|||||||
|
# -*- coding:utf-8 -*-
|
||||||
|
#
|
||||||
# Copyright (C) 2009 The Android Open Source Project
|
# Copyright (C) 2009 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
@ -21,8 +23,6 @@ R_CHANGES = 'refs/changes/'
|
|||||||
R_HEADS = 'refs/heads/'
|
R_HEADS = 'refs/heads/'
|
||||||
R_TAGS = 'refs/tags/'
|
R_TAGS = 'refs/tags/'
|
||||||
R_PUB = 'refs/published/'
|
R_PUB = 'refs/published/'
|
||||||
R_WORKTREE = 'refs/worktree/'
|
|
||||||
R_WORKTREE_M = R_WORKTREE + 'm/'
|
|
||||||
R_M = 'refs/remotes/m/'
|
R_M = 'refs/remotes/m/'
|
||||||
|
|
||||||
|
|
||||||
@ -131,14 +131,11 @@ class GitRefs(object):
|
|||||||
base = os.path.join(self._gitdir, prefix)
|
base = os.path.join(self._gitdir, prefix)
|
||||||
for name in platform_utils.listdir(base):
|
for name in platform_utils.listdir(base):
|
||||||
p = os.path.join(base, name)
|
p = os.path.join(base, name)
|
||||||
# We don't implement the full ref validation algorithm, just the simple
|
if platform_utils.isdir(p):
|
||||||
# rules that would show up in local filesystems.
|
|
||||||
# https://git-scm.com/docs/git-check-ref-format
|
|
||||||
if name.startswith('.') or name.endswith('.lock'):
|
|
||||||
pass
|
|
||||||
elif platform_utils.isdir(p):
|
|
||||||
self._mtime[prefix] = os.path.getmtime(base)
|
self._mtime[prefix] = os.path.getmtime(base)
|
||||||
self._ReadLoose(prefix + name + '/')
|
self._ReadLoose(prefix + name + '/')
|
||||||
|
elif name.endswith('.lock'):
|
||||||
|
pass
|
||||||
else:
|
else:
|
||||||
self._ReadLoose1(p, prefix + name)
|
self._ReadLoose1(p, prefix + name)
|
||||||
|
|
||||||
@ -147,7 +144,7 @@ class GitRefs(object):
|
|||||||
with open(path) as fd:
|
with open(path) as fd:
|
||||||
mtime = os.path.getmtime(path)
|
mtime = os.path.getmtime(path)
|
||||||
ref_id = fd.readline()
|
ref_id = fd.readline()
|
||||||
except (OSError, UnicodeError):
|
except (IOError, OSError):
|
||||||
return
|
return
|
||||||
|
|
||||||
try:
|
try:
|
||||||
|
@ -1,290 +0,0 @@
|
|||||||
# Copyright (C) 2021 The Android Open Source Project
|
|
||||||
#
|
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
|
||||||
# you may not use this file except in compliance with the License.
|
|
||||||
# You may obtain a copy of the License at
|
|
||||||
#
|
|
||||||
# http://www.apache.org/licenses/LICENSE-2.0
|
|
||||||
#
|
|
||||||
# Unless required by applicable law or agreed to in writing, software
|
|
||||||
# distributed under the License is distributed on an "AS IS" BASIS,
|
|
||||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
|
||||||
# See the License for the specific language governing permissions and
|
|
||||||
# limitations under the License.
|
|
||||||
|
|
||||||
"""Provide functionality to get all projects and their commit ids from Superproject.
|
|
||||||
|
|
||||||
For more information on superproject, check out:
|
|
||||||
https://en.wikibooks.org/wiki/Git/Submodules_and_Superprojects
|
|
||||||
|
|
||||||
Examples:
|
|
||||||
superproject = Superproject()
|
|
||||||
project_commit_ids = superproject.UpdateProjectsRevisionId(projects)
|
|
||||||
"""
|
|
||||||
|
|
||||||
import hashlib
|
|
||||||
import os
|
|
||||||
import sys
|
|
||||||
|
|
||||||
from git_command import GitCommand
|
|
||||||
from git_refs import R_HEADS
|
|
||||||
from wrapper import Wrapper
|
|
||||||
|
|
||||||
_SUPERPROJECT_GIT_NAME = 'superproject.git'
|
|
||||||
_SUPERPROJECT_MANIFEST_NAME = 'superproject_override.xml'
|
|
||||||
|
|
||||||
|
|
||||||
class Superproject(object):
|
|
||||||
"""Get commit ids from superproject.
|
|
||||||
|
|
||||||
Initializes a local copy of a superproject for the manifest. This allows
|
|
||||||
lookup of commit ids for all projects. It contains _project_commit_ids which
|
|
||||||
is a dictionary with project/commit id entries.
|
|
||||||
"""
|
|
||||||
def __init__(self, manifest, repodir, superproject_dir='exp-superproject',
|
|
||||||
quiet=False):
|
|
||||||
"""Initializes superproject.
|
|
||||||
|
|
||||||
Args:
|
|
||||||
manifest: A Manifest object that is to be written to a file.
|
|
||||||
repodir: Path to the .repo/ dir for holding all internal checkout state.
|
|
||||||
It must be in the top directory of the repo client checkout.
|
|
||||||
superproject_dir: Relative path under |repodir| to checkout superproject.
|
|
||||||
quiet: If True then only print the progress messages.
|
|
||||||
"""
|
|
||||||
self._project_commit_ids = None
|
|
||||||
self._manifest = manifest
|
|
||||||
self._quiet = quiet
|
|
||||||
self._branch = self._GetBranch()
|
|
||||||
self._repodir = os.path.abspath(repodir)
|
|
||||||
self._superproject_dir = superproject_dir
|
|
||||||
self._superproject_path = os.path.join(self._repodir, superproject_dir)
|
|
||||||
self._manifest_path = os.path.join(self._superproject_path,
|
|
||||||
_SUPERPROJECT_MANIFEST_NAME)
|
|
||||||
git_name = ''
|
|
||||||
if self._manifest.superproject:
|
|
||||||
remote_name = self._manifest.superproject['remote'].name
|
|
||||||
git_name = hashlib.md5(remote_name.encode('utf8')).hexdigest() + '-'
|
|
||||||
self._work_git_name = git_name + _SUPERPROJECT_GIT_NAME
|
|
||||||
self._work_git = os.path.join(self._superproject_path, self._work_git_name)
|
|
||||||
|
|
||||||
@property
|
|
||||||
def project_commit_ids(self):
|
|
||||||
"""Returns a dictionary of projects and their commit ids."""
|
|
||||||
return self._project_commit_ids
|
|
||||||
|
|
||||||
def _GetBranch(self):
|
|
||||||
"""Returns the branch name for getting the approved manifest."""
|
|
||||||
p = self._manifest.manifestProject
|
|
||||||
b = p.GetBranch(p.CurrentBranch)
|
|
||||||
if not b:
|
|
||||||
return None
|
|
||||||
branch = b.merge
|
|
||||||
if branch and branch.startswith(R_HEADS):
|
|
||||||
branch = branch[len(R_HEADS):]
|
|
||||||
return branch
|
|
||||||
|
|
||||||
def _Init(self):
|
|
||||||
"""Sets up a local Git repository to get a copy of a superproject.
|
|
||||||
|
|
||||||
Returns:
|
|
||||||
True if initialization is successful, or False.
|
|
||||||
"""
|
|
||||||
if not os.path.exists(self._superproject_path):
|
|
||||||
os.mkdir(self._superproject_path)
|
|
||||||
if not self._quiet and not os.path.exists(self._work_git):
|
|
||||||
print('%s: Performing initial setup for superproject; this might take '
|
|
||||||
'several minutes.' % self._work_git)
|
|
||||||
cmd = ['init', '--bare', self._work_git_name]
|
|
||||||
p = GitCommand(None,
|
|
||||||
cmd,
|
|
||||||
cwd=self._superproject_path,
|
|
||||||
capture_stdout=True,
|
|
||||||
capture_stderr=True)
|
|
||||||
retval = p.Wait()
|
|
||||||
if retval:
|
|
||||||
print('repo: error: git init call failed with return code: %r, stderr: %r' %
|
|
||||||
(retval, p.stderr), file=sys.stderr)
|
|
||||||
return False
|
|
||||||
return True
|
|
||||||
|
|
||||||
def _Fetch(self, url):
|
|
||||||
"""Fetches a local copy of a superproject for the manifest based on url.
|
|
||||||
|
|
||||||
Args:
|
|
||||||
url: superproject's url.
|
|
||||||
|
|
||||||
Returns:
|
|
||||||
True if fetch is successful, or False.
|
|
||||||
"""
|
|
||||||
if not os.path.exists(self._work_git):
|
|
||||||
print('git fetch missing drectory: %s' % self._work_git,
|
|
||||||
file=sys.stderr)
|
|
||||||
return False
|
|
||||||
cmd = ['fetch', url, '--depth', '1', '--force', '--no-tags', '--filter', 'blob:none']
|
|
||||||
if self._branch:
|
|
||||||
cmd += [self._branch + ':' + self._branch]
|
|
||||||
p = GitCommand(None,
|
|
||||||
cmd,
|
|
||||||
cwd=self._work_git,
|
|
||||||
capture_stdout=True,
|
|
||||||
capture_stderr=True)
|
|
||||||
retval = p.Wait()
|
|
||||||
if retval:
|
|
||||||
print('repo: error: git fetch call failed with return code: %r, stderr: %r' %
|
|
||||||
(retval, p.stderr), file=sys.stderr)
|
|
||||||
return False
|
|
||||||
return True
|
|
||||||
|
|
||||||
def _LsTree(self):
|
|
||||||
"""Gets the commit ids for all projects.
|
|
||||||
|
|
||||||
Works only in git repositories.
|
|
||||||
|
|
||||||
Returns:
|
|
||||||
data: data returned from 'git ls-tree ...' instead of None.
|
|
||||||
"""
|
|
||||||
if not os.path.exists(self._work_git):
|
|
||||||
print('git ls-tree missing drectory: %s' % self._work_git,
|
|
||||||
file=sys.stderr)
|
|
||||||
return None
|
|
||||||
data = None
|
|
||||||
branch = 'HEAD' if not self._branch else self._branch
|
|
||||||
cmd = ['ls-tree', '-z', '-r', branch]
|
|
||||||
|
|
||||||
p = GitCommand(None,
|
|
||||||
cmd,
|
|
||||||
cwd=self._work_git,
|
|
||||||
capture_stdout=True,
|
|
||||||
capture_stderr=True)
|
|
||||||
retval = p.Wait()
|
|
||||||
if retval == 0:
|
|
||||||
data = p.stdout
|
|
||||||
else:
|
|
||||||
print('repo: error: git ls-tree call failed with return code: %r, stderr: %r' % (
|
|
||||||
retval, p.stderr), file=sys.stderr)
|
|
||||||
return data
|
|
||||||
|
|
||||||
def Sync(self):
|
|
||||||
"""Gets a local copy of a superproject for the manifest.
|
|
||||||
|
|
||||||
Returns:
|
|
||||||
True if sync of superproject is successful, or False.
|
|
||||||
"""
|
|
||||||
print('WARNING: --use-superproject is experimental and not '
|
|
||||||
'for general use', file=sys.stderr)
|
|
||||||
|
|
||||||
if not self._manifest.superproject:
|
|
||||||
print('error: superproject tag is not defined in manifest',
|
|
||||||
file=sys.stderr)
|
|
||||||
return False
|
|
||||||
|
|
||||||
url = self._manifest.superproject['remote'].url
|
|
||||||
if not url:
|
|
||||||
print('error: superproject URL is not defined in manifest',
|
|
||||||
file=sys.stderr)
|
|
||||||
return False
|
|
||||||
|
|
||||||
if not self._Init():
|
|
||||||
return False
|
|
||||||
if not self._Fetch(url):
|
|
||||||
return False
|
|
||||||
if not self._quiet:
|
|
||||||
print('%s: Initial setup for superproject completed.' % self._work_git)
|
|
||||||
return True
|
|
||||||
|
|
||||||
def _GetAllProjectsCommitIds(self):
|
|
||||||
"""Get commit ids for all projects from superproject and save them in _project_commit_ids.
|
|
||||||
|
|
||||||
Returns:
|
|
||||||
A dictionary with the projects/commit ids on success, otherwise None.
|
|
||||||
"""
|
|
||||||
if not self.Sync():
|
|
||||||
return None
|
|
||||||
|
|
||||||
data = self._LsTree()
|
|
||||||
if not data:
|
|
||||||
print('error: git ls-tree failed to return data for superproject',
|
|
||||||
file=sys.stderr)
|
|
||||||
return None
|
|
||||||
|
|
||||||
# Parse lines like the following to select lines starting with '160000' and
|
|
||||||
# build a dictionary with project path (last element) and its commit id (3rd element).
|
|
||||||
#
|
|
||||||
# 160000 commit 2c2724cb36cd5a9cec6c852c681efc3b7c6b86ea\tart\x00
|
|
||||||
# 120000 blob acc2cbdf438f9d2141f0ae424cec1d8fc4b5d97f\tbootstrap.bash\x00
|
|
||||||
commit_ids = {}
|
|
||||||
for line in data.split('\x00'):
|
|
||||||
ls_data = line.split(None, 3)
|
|
||||||
if not ls_data:
|
|
||||||
break
|
|
||||||
if ls_data[0] == '160000':
|
|
||||||
commit_ids[ls_data[3]] = ls_data[2]
|
|
||||||
|
|
||||||
self._project_commit_ids = commit_ids
|
|
||||||
return commit_ids
|
|
||||||
|
|
||||||
def _WriteManfiestFile(self):
|
|
||||||
"""Writes manifest to a file.
|
|
||||||
|
|
||||||
Returns:
|
|
||||||
manifest_path: Path name of the file into which manifest is written instead of None.
|
|
||||||
"""
|
|
||||||
if not os.path.exists(self._superproject_path):
|
|
||||||
print('error: missing superproject directory %s' %
|
|
||||||
self._superproject_path,
|
|
||||||
file=sys.stderr)
|
|
||||||
return None
|
|
||||||
manifest_str = self._manifest.ToXml(groups=self._manifest.GetGroupsStr()).toxml()
|
|
||||||
manifest_path = self._manifest_path
|
|
||||||
try:
|
|
||||||
with open(manifest_path, 'w', encoding='utf-8') as fp:
|
|
||||||
fp.write(manifest_str)
|
|
||||||
except IOError as e:
|
|
||||||
print('error: cannot write manifest to %s:\n%s'
|
|
||||||
% (manifest_path, e),
|
|
||||||
file=sys.stderr)
|
|
||||||
return None
|
|
||||||
return manifest_path
|
|
||||||
|
|
||||||
def UpdateProjectsRevisionId(self, projects):
|
|
||||||
"""Update revisionId of every project in projects with the commit id.
|
|
||||||
|
|
||||||
Args:
|
|
||||||
projects: List of projects whose revisionId needs to be updated.
|
|
||||||
|
|
||||||
Returns:
|
|
||||||
manifest_path: Path name of the overriding manfiest file instead of None.
|
|
||||||
"""
|
|
||||||
commit_ids = self._GetAllProjectsCommitIds()
|
|
||||||
if not commit_ids:
|
|
||||||
print('error: Cannot get project commit ids from manifest', file=sys.stderr)
|
|
||||||
return None
|
|
||||||
|
|
||||||
projects_missing_commit_ids = []
|
|
||||||
superproject_fetchUrl = self._manifest.superproject['remote'].fetchUrl
|
|
||||||
for project in projects:
|
|
||||||
path = project.relpath
|
|
||||||
if not path:
|
|
||||||
continue
|
|
||||||
# Some manifests that pull projects from the "chromium" GoB
|
|
||||||
# (remote="chromium"), and have a private manifest that pulls projects
|
|
||||||
# from both the chromium GoB and "chrome-internal" GoB (remote="chrome").
|
|
||||||
# For such projects, one of the remotes will be different from
|
|
||||||
# superproject's remote. Until superproject, supports multiple remotes,
|
|
||||||
# don't update the commit ids of remotes that don't match superproject's
|
|
||||||
# remote.
|
|
||||||
if project.remote.fetchUrl != superproject_fetchUrl:
|
|
||||||
continue
|
|
||||||
commit_id = commit_ids.get(path)
|
|
||||||
if commit_id:
|
|
||||||
project.SetRevisionId(commit_id)
|
|
||||||
else:
|
|
||||||
projects_missing_commit_ids.append(path)
|
|
||||||
if projects_missing_commit_ids:
|
|
||||||
print('error: please file a bug using %s to report missing commit_ids for: %s' %
|
|
||||||
(Wrapper().BUG_URL, projects_missing_commit_ids), file=sys.stderr)
|
|
||||||
return None
|
|
||||||
|
|
||||||
manifest_path = self._WriteManfiestFile()
|
|
||||||
return manifest_path
|
|
@ -1,238 +0,0 @@
|
|||||||
# Copyright (C) 2020 The Android Open Source Project
|
|
||||||
#
|
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
|
||||||
# you may not use this file except in compliance with the License.
|
|
||||||
# You may obtain a copy of the License at
|
|
||||||
#
|
|
||||||
# http://www.apache.org/licenses/LICENSE-2.0
|
|
||||||
#
|
|
||||||
# Unless required by applicable law or agreed to in writing, software
|
|
||||||
# distributed under the License is distributed on an "AS IS" BASIS,
|
|
||||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
|
||||||
# See the License for the specific language governing permissions and
|
|
||||||
# limitations under the License.
|
|
||||||
|
|
||||||
"""Provide event logging in the git trace2 EVENT format.
|
|
||||||
|
|
||||||
The git trace2 EVENT format is defined at:
|
|
||||||
https://www.kernel.org/pub/software/scm/git/docs/technical/api-trace2.html#_event_format
|
|
||||||
https://git-scm.com/docs/api-trace2#_the_event_format_target
|
|
||||||
|
|
||||||
Usage:
|
|
||||||
|
|
||||||
git_trace_log = EventLog()
|
|
||||||
git_trace_log.StartEvent()
|
|
||||||
...
|
|
||||||
git_trace_log.ExitEvent()
|
|
||||||
git_trace_log.Write()
|
|
||||||
"""
|
|
||||||
|
|
||||||
|
|
||||||
import datetime
|
|
||||||
import json
|
|
||||||
import os
|
|
||||||
import sys
|
|
||||||
import tempfile
|
|
||||||
import threading
|
|
||||||
|
|
||||||
from git_command import GitCommand, RepoSourceVersion
|
|
||||||
|
|
||||||
|
|
||||||
class EventLog(object):
|
|
||||||
"""Event log that records events that occurred during a repo invocation.
|
|
||||||
|
|
||||||
Events are written to the log as a consecutive JSON entries, one per line.
|
|
||||||
Entries follow the git trace2 EVENT format.
|
|
||||||
|
|
||||||
Each entry contains the following common keys:
|
|
||||||
- event: The event name
|
|
||||||
- sid: session-id - Unique string to allow process instance to be identified.
|
|
||||||
- thread: The thread name.
|
|
||||||
- time: is the UTC time of the event.
|
|
||||||
|
|
||||||
Valid 'event' names and event specific fields are documented here:
|
|
||||||
https://git-scm.com/docs/api-trace2#_event_format
|
|
||||||
"""
|
|
||||||
|
|
||||||
def __init__(self, env=None):
|
|
||||||
"""Initializes the event log."""
|
|
||||||
self._log = []
|
|
||||||
# Try to get session-id (sid) from environment (setup in repo launcher).
|
|
||||||
KEY = 'GIT_TRACE2_PARENT_SID'
|
|
||||||
if env is None:
|
|
||||||
env = os.environ
|
|
||||||
|
|
||||||
now = datetime.datetime.utcnow()
|
|
||||||
|
|
||||||
# Save both our sid component and the complete sid.
|
|
||||||
# We use our sid component (self._sid) as the unique filename prefix and
|
|
||||||
# the full sid (self._full_sid) in the log itself.
|
|
||||||
self._sid = 'repo-%s-P%08x' % (now.strftime('%Y%m%dT%H%M%SZ'), os.getpid())
|
|
||||||
parent_sid = env.get(KEY)
|
|
||||||
# Append our sid component to the parent sid (if it exists).
|
|
||||||
if parent_sid is not None:
|
|
||||||
self._full_sid = parent_sid + '/' + self._sid
|
|
||||||
else:
|
|
||||||
self._full_sid = self._sid
|
|
||||||
|
|
||||||
# Set/update the environment variable.
|
|
||||||
# Environment handling across systems is messy.
|
|
||||||
try:
|
|
||||||
env[KEY] = self._full_sid
|
|
||||||
except UnicodeEncodeError:
|
|
||||||
env[KEY] = self._full_sid.encode()
|
|
||||||
|
|
||||||
# Add a version event to front of the log.
|
|
||||||
self._AddVersionEvent()
|
|
||||||
|
|
||||||
@property
|
|
||||||
def full_sid(self):
|
|
||||||
return self._full_sid
|
|
||||||
|
|
||||||
def _AddVersionEvent(self):
|
|
||||||
"""Adds a 'version' event at the beginning of current log."""
|
|
||||||
version_event = self._CreateEventDict('version')
|
|
||||||
version_event['evt'] = "2"
|
|
||||||
version_event['exe'] = RepoSourceVersion()
|
|
||||||
self._log.insert(0, version_event)
|
|
||||||
|
|
||||||
def _CreateEventDict(self, event_name):
|
|
||||||
"""Returns a dictionary with the common keys/values for git trace2 events.
|
|
||||||
|
|
||||||
Args:
|
|
||||||
event_name: The event name.
|
|
||||||
|
|
||||||
Returns:
|
|
||||||
Dictionary with the common event fields populated.
|
|
||||||
"""
|
|
||||||
return {
|
|
||||||
'event': event_name,
|
|
||||||
'sid': self._full_sid,
|
|
||||||
'thread': threading.currentThread().getName(),
|
|
||||||
'time': datetime.datetime.utcnow().isoformat() + 'Z',
|
|
||||||
}
|
|
||||||
|
|
||||||
def StartEvent(self):
|
|
||||||
"""Append a 'start' event to the current log."""
|
|
||||||
start_event = self._CreateEventDict('start')
|
|
||||||
start_event['argv'] = sys.argv
|
|
||||||
self._log.append(start_event)
|
|
||||||
|
|
||||||
def ExitEvent(self, result):
|
|
||||||
"""Append an 'exit' event to the current log.
|
|
||||||
|
|
||||||
Args:
|
|
||||||
result: Exit code of the event
|
|
||||||
"""
|
|
||||||
exit_event = self._CreateEventDict('exit')
|
|
||||||
|
|
||||||
# Consider 'None' success (consistent with event_log result handling).
|
|
||||||
if result is None:
|
|
||||||
result = 0
|
|
||||||
exit_event['code'] = result
|
|
||||||
self._log.append(exit_event)
|
|
||||||
|
|
||||||
def CommandEvent(self, name, subcommands):
|
|
||||||
"""Append a 'command' event to the current log.
|
|
||||||
|
|
||||||
Args:
|
|
||||||
name: Name of the primary command (ex: repo, git)
|
|
||||||
subcommands: List of the sub-commands (ex: version, init, sync)
|
|
||||||
"""
|
|
||||||
command_event = self._CreateEventDict('command')
|
|
||||||
command_event['name'] = name
|
|
||||||
command_event['subcommands'] = subcommands
|
|
||||||
self._log.append(command_event)
|
|
||||||
|
|
||||||
def DefParamRepoEvents(self, config):
|
|
||||||
"""Append a 'def_param' event for each repo.* config key to the current log.
|
|
||||||
|
|
||||||
Args:
|
|
||||||
config: Repo configuration dictionary
|
|
||||||
"""
|
|
||||||
# Only output the repo.* config parameters.
|
|
||||||
repo_config = {k: v for k, v in config.items() if k.startswith('repo.')}
|
|
||||||
|
|
||||||
for param, value in repo_config.items():
|
|
||||||
def_param_event = self._CreateEventDict('def_param')
|
|
||||||
def_param_event['param'] = param
|
|
||||||
def_param_event['value'] = value
|
|
||||||
self._log.append(def_param_event)
|
|
||||||
|
|
||||||
def _GetEventTargetPath(self):
|
|
||||||
"""Get the 'trace2.eventtarget' path from git configuration.
|
|
||||||
|
|
||||||
Returns:
|
|
||||||
path: git config's 'trace2.eventtarget' path if it exists, or None
|
|
||||||
"""
|
|
||||||
path = None
|
|
||||||
cmd = ['config', '--get', 'trace2.eventtarget']
|
|
||||||
# TODO(https://crbug.com/gerrit/13706): Use GitConfig when it supports
|
|
||||||
# system git config variables.
|
|
||||||
p = GitCommand(None, cmd, capture_stdout=True, capture_stderr=True,
|
|
||||||
bare=True)
|
|
||||||
retval = p.Wait()
|
|
||||||
if retval == 0:
|
|
||||||
# Strip trailing carriage-return in path.
|
|
||||||
path = p.stdout.rstrip('\n')
|
|
||||||
elif retval != 1:
|
|
||||||
# `git config --get` is documented to produce an exit status of `1` if
|
|
||||||
# the requested variable is not present in the configuration. Report any
|
|
||||||
# other return value as an error.
|
|
||||||
print("repo: error: 'git config --get' call failed with return code: %r, stderr: %r" % (
|
|
||||||
retval, p.stderr), file=sys.stderr)
|
|
||||||
return path
|
|
||||||
|
|
||||||
def Write(self, path=None):
|
|
||||||
"""Writes the log out to a file.
|
|
||||||
|
|
||||||
Log is only written if 'path' or 'git config --get trace2.eventtarget'
|
|
||||||
provide a valid path to write logs to.
|
|
||||||
|
|
||||||
Logging filename format follows the git trace2 style of being a unique
|
|
||||||
(exclusive writable) file.
|
|
||||||
|
|
||||||
Args:
|
|
||||||
path: Path to where logs should be written.
|
|
||||||
|
|
||||||
Returns:
|
|
||||||
log_path: Path to the log file if log is written, otherwise None
|
|
||||||
"""
|
|
||||||
log_path = None
|
|
||||||
# If no logging path is specified, get the path from 'trace2.eventtarget'.
|
|
||||||
if path is None:
|
|
||||||
path = self._GetEventTargetPath()
|
|
||||||
|
|
||||||
# If no logging path is specified, exit.
|
|
||||||
if path is None:
|
|
||||||
return None
|
|
||||||
|
|
||||||
if isinstance(path, str):
|
|
||||||
# Get absolute path.
|
|
||||||
path = os.path.abspath(os.path.expanduser(path))
|
|
||||||
else:
|
|
||||||
raise TypeError('path: str required but got %s.' % type(path))
|
|
||||||
|
|
||||||
# Git trace2 requires a directory to write log to.
|
|
||||||
|
|
||||||
# TODO(https://crbug.com/gerrit/13706): Support file (append) mode also.
|
|
||||||
if not os.path.isdir(path):
|
|
||||||
return None
|
|
||||||
# Use NamedTemporaryFile to generate a unique filename as required by git trace2.
|
|
||||||
try:
|
|
||||||
with tempfile.NamedTemporaryFile(mode='x', prefix=self._sid, dir=path,
|
|
||||||
delete=False) as f:
|
|
||||||
# TODO(https://crbug.com/gerrit/13706): Support writing events as they
|
|
||||||
# occur.
|
|
||||||
for e in self._log:
|
|
||||||
# Dump in compact encoding mode.
|
|
||||||
# See 'Compact encoding' in Python docs:
|
|
||||||
# https://docs.python.org/3/library/json.html#module-json
|
|
||||||
json.dump(e, f, indent=None, separators=(',', ':'))
|
|
||||||
f.write('\n')
|
|
||||||
log_path = f.name
|
|
||||||
except FileExistsError as err:
|
|
||||||
print('repo: warning: git trace2 logging failed: %r' % err,
|
|
||||||
file=sys.stderr)
|
|
||||||
return None
|
|
||||||
return log_path
|
|
@ -1,3 +1,5 @@
|
|||||||
|
# -*- coding:utf-8 -*-
|
||||||
|
#
|
||||||
# Copyright (C) 2015 The Android Open Source Project
|
# Copyright (C) 2015 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
@ -12,8 +14,8 @@
|
|||||||
# See the License for the specific language governing permissions and
|
# See the License for the specific language governing permissions and
|
||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
|
|
||||||
|
from __future__ import print_function
|
||||||
import os
|
import os
|
||||||
import multiprocessing
|
|
||||||
import platform
|
import platform
|
||||||
import re
|
import re
|
||||||
import sys
|
import sys
|
||||||
@ -27,24 +29,12 @@ from error import ManifestParseError
|
|||||||
|
|
||||||
NUM_BATCH_RETRIEVE_REVISIONID = 32
|
NUM_BATCH_RETRIEVE_REVISIONID = 32
|
||||||
|
|
||||||
|
|
||||||
def get_gitc_manifest_dir():
|
def get_gitc_manifest_dir():
|
||||||
return wrapper.Wrapper().get_gitc_manifest_dir()
|
return wrapper.Wrapper().get_gitc_manifest_dir()
|
||||||
|
|
||||||
|
|
||||||
def parse_clientdir(gitc_fs_path):
|
def parse_clientdir(gitc_fs_path):
|
||||||
return wrapper.Wrapper().gitc_parse_clientdir(gitc_fs_path)
|
return wrapper.Wrapper().gitc_parse_clientdir(gitc_fs_path)
|
||||||
|
|
||||||
|
|
||||||
def _get_project_revision(args):
|
|
||||||
"""Worker for _set_project_revisions to lookup one project remote."""
|
|
||||||
(i, url, expr) = args
|
|
||||||
gitcmd = git_command.GitCommand(
|
|
||||||
None, ['ls-remote', url, expr], capture_stdout=True, cwd='/tmp')
|
|
||||||
rc = gitcmd.Wait()
|
|
||||||
return (i, rc, gitcmd.stdout.split('\t', 1)[0])
|
|
||||||
|
|
||||||
|
|
||||||
def _set_project_revisions(projects):
|
def _set_project_revisions(projects):
|
||||||
"""Sets the revisionExpr for a list of projects.
|
"""Sets the revisionExpr for a list of projects.
|
||||||
|
|
||||||
@ -52,38 +42,47 @@ def _set_project_revisions(projects):
|
|||||||
should not be overly large. Recommend calling this function multiple times
|
should not be overly large. Recommend calling this function multiple times
|
||||||
with each call not exceeding NUM_BATCH_RETRIEVE_REVISIONID projects.
|
with each call not exceeding NUM_BATCH_RETRIEVE_REVISIONID projects.
|
||||||
|
|
||||||
Args:
|
@param projects: List of project objects to set the revionExpr for.
|
||||||
projects: List of project objects to set the revionExpr for.
|
|
||||||
"""
|
"""
|
||||||
# Retrieve the commit id for each project based off of it's current
|
# Retrieve the commit id for each project based off of it's current
|
||||||
# revisionExpr and it is not already a commit id.
|
# revisionExpr and it is not already a commit id.
|
||||||
with multiprocessing.Pool(NUM_BATCH_RETRIEVE_REVISIONID) as pool:
|
project_gitcmds = [(
|
||||||
results_iter = pool.imap_unordered(
|
project, git_command.GitCommand(None,
|
||||||
_get_project_revision,
|
['ls-remote',
|
||||||
((i, project.remote.url, project.revisionExpr)
|
project.remote.url,
|
||||||
for i, project in enumerate(projects)
|
project.revisionExpr],
|
||||||
if not git_config.IsId(project.revisionExpr)),
|
capture_stdout=True, cwd='/tmp'))
|
||||||
chunksize=8)
|
for project in projects if not git_config.IsId(project.revisionExpr)]
|
||||||
for (i, rc, revisionExpr) in results_iter:
|
for proj, gitcmd in project_gitcmds:
|
||||||
project = projects[i]
|
if gitcmd.Wait():
|
||||||
if rc:
|
print('FATAL: Failed to retrieve revisionExpr for %s' % proj)
|
||||||
print('FATAL: Failed to retrieve revisionExpr for %s' % project.name)
|
|
||||||
pool.terminate()
|
|
||||||
sys.exit(1)
|
sys.exit(1)
|
||||||
|
revisionExpr = gitcmd.stdout.split('\t')[0]
|
||||||
if not revisionExpr:
|
if not revisionExpr:
|
||||||
pool.terminate()
|
|
||||||
raise ManifestParseError('Invalid SHA-1 revision project %s (%s)' %
|
raise ManifestParseError('Invalid SHA-1 revision project %s (%s)' %
|
||||||
(project.remote.url, project.revisionExpr))
|
(proj.remote.url, proj.revisionExpr))
|
||||||
project.revisionExpr = revisionExpr
|
proj.revisionExpr = revisionExpr
|
||||||
|
|
||||||
|
def _manifest_groups(manifest):
|
||||||
|
"""Returns the manifest group string that should be synced
|
||||||
|
|
||||||
|
This is the same logic used by Command.GetProjects(), which is used during
|
||||||
|
repo sync
|
||||||
|
|
||||||
|
@param manifest: The XmlManifest object
|
||||||
|
"""
|
||||||
|
mp = manifest.manifestProject
|
||||||
|
groups = mp.config.GetString('manifest.groups')
|
||||||
|
if not groups:
|
||||||
|
groups = 'default,platform-' + platform.system().lower()
|
||||||
|
return groups
|
||||||
|
|
||||||
def generate_gitc_manifest(gitc_manifest, manifest, paths=None):
|
def generate_gitc_manifest(gitc_manifest, manifest, paths=None):
|
||||||
"""Generate a manifest for shafsd to use for this GITC client.
|
"""Generate a manifest for shafsd to use for this GITC client.
|
||||||
|
|
||||||
Args:
|
@param gitc_manifest: Current gitc manifest, or None if there isn't one yet.
|
||||||
gitc_manifest: Current gitc manifest, or None if there isn't one yet.
|
@param manifest: A GitcManifest object loaded with the current repo manifest.
|
||||||
manifest: A GitcManifest object loaded with the current repo manifest.
|
@param paths: List of project paths we want to update.
|
||||||
paths: List of project paths we want to update.
|
|
||||||
"""
|
"""
|
||||||
|
|
||||||
print('Generating GITC Manifest by fetching revision SHAs for each '
|
print('Generating GITC Manifest by fetching revision SHAs for each '
|
||||||
@ -91,7 +90,7 @@ def generate_gitc_manifest(gitc_manifest, manifest, paths=None):
|
|||||||
if paths is None:
|
if paths is None:
|
||||||
paths = list(manifest.paths.keys())
|
paths = list(manifest.paths.keys())
|
||||||
|
|
||||||
groups = [x for x in re.split(r'[,\s]+', manifest.GetGroupsStr()) if x]
|
groups = [x for x in re.split(r'[,\s]+', _manifest_groups(manifest)) if x]
|
||||||
|
|
||||||
# Convert the paths to projects, and filter them to the matched groups.
|
# Convert the paths to projects, and filter them to the matched groups.
|
||||||
projects = [manifest.paths[p] for p in paths]
|
projects = [manifest.paths[p] for p in paths]
|
||||||
@ -105,11 +104,11 @@ def generate_gitc_manifest(gitc_manifest, manifest, paths=None):
|
|||||||
if not proj.upstream and not git_config.IsId(proj.revisionExpr):
|
if not proj.upstream and not git_config.IsId(proj.revisionExpr):
|
||||||
proj.upstream = proj.revisionExpr
|
proj.upstream = proj.revisionExpr
|
||||||
|
|
||||||
if path not in gitc_manifest.paths:
|
if not path in gitc_manifest.paths:
|
||||||
# Any new projects need their first revision, even if we weren't asked
|
# Any new projects need their first revision, even if we weren't asked
|
||||||
# for them.
|
# for them.
|
||||||
projects.append(proj)
|
projects.append(proj)
|
||||||
elif path not in paths:
|
elif not path in paths:
|
||||||
# And copy revisions from the previous manifest if we're not updating
|
# And copy revisions from the previous manifest if we're not updating
|
||||||
# them now.
|
# them now.
|
||||||
gitc_proj = gitc_manifest.paths[path]
|
gitc_proj = gitc_manifest.paths[path]
|
||||||
@ -119,7 +118,11 @@ def generate_gitc_manifest(gitc_manifest, manifest, paths=None):
|
|||||||
else:
|
else:
|
||||||
proj.revisionExpr = gitc_proj.revisionExpr
|
proj.revisionExpr = gitc_proj.revisionExpr
|
||||||
|
|
||||||
_set_project_revisions(projects)
|
index = 0
|
||||||
|
while index < len(projects):
|
||||||
|
_set_project_revisions(
|
||||||
|
projects[index:(index+NUM_BATCH_RETRIEVE_REVISIONID)])
|
||||||
|
index += NUM_BATCH_RETRIEVE_REVISIONID
|
||||||
|
|
||||||
if gitc_manifest is not None:
|
if gitc_manifest is not None:
|
||||||
for path, proj in gitc_manifest.paths.items():
|
for path, proj in gitc_manifest.paths.items():
|
||||||
@ -137,20 +140,16 @@ def generate_gitc_manifest(gitc_manifest, manifest, paths=None):
|
|||||||
# Save the manifest.
|
# Save the manifest.
|
||||||
save_manifest(manifest)
|
save_manifest(manifest)
|
||||||
|
|
||||||
|
|
||||||
def save_manifest(manifest, client_dir=None):
|
def save_manifest(manifest, client_dir=None):
|
||||||
"""Save the manifest file in the client_dir.
|
"""Save the manifest file in the client_dir.
|
||||||
|
|
||||||
Args:
|
@param client_dir: Client directory to save the manifest in.
|
||||||
manifest: Manifest object to save.
|
@param manifest: Manifest object to save.
|
||||||
client_dir: Client directory to save the manifest in.
|
|
||||||
"""
|
"""
|
||||||
if not client_dir:
|
if not client_dir:
|
||||||
manifest_file = manifest.manifestFile
|
client_dir = manifest.gitc_client_dir
|
||||||
else:
|
with open(os.path.join(client_dir, '.manifest'), 'w') as f:
|
||||||
manifest_file = os.path.join(client_dir, '.manifest')
|
manifest.Save(f, groups=_manifest_groups(manifest))
|
||||||
with open(manifest_file, 'w') as f:
|
|
||||||
manifest.Save(f, groups=manifest.GetGroupsStr())
|
|
||||||
# TODO(sbasi/jorg): Come up with a solution to remove the sleep below.
|
# TODO(sbasi/jorg): Come up with a solution to remove the sleep below.
|
||||||
# Give the GITC filesystem time to register the manifest changes.
|
# Give the GITC filesystem time to register the manifest changes.
|
||||||
time.sleep(3)
|
time.sleep(3)
|
||||||
|
509
hooks.py
509
hooks.py
@ -1,509 +0,0 @@
|
|||||||
# Copyright (C) 2008 The Android Open Source Project
|
|
||||||
#
|
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
|
||||||
# you may not use this file except in compliance with the License.
|
|
||||||
# You may obtain a copy of the License at
|
|
||||||
#
|
|
||||||
# http://www.apache.org/licenses/LICENSE-2.0
|
|
||||||
#
|
|
||||||
# Unless required by applicable law or agreed to in writing, software
|
|
||||||
# distributed under the License is distributed on an "AS IS" BASIS,
|
|
||||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
|
||||||
# See the License for the specific language governing permissions and
|
|
||||||
# limitations under the License.
|
|
||||||
|
|
||||||
import errno
|
|
||||||
import json
|
|
||||||
import os
|
|
||||||
import re
|
|
||||||
import subprocess
|
|
||||||
import sys
|
|
||||||
import traceback
|
|
||||||
import urllib.parse
|
|
||||||
|
|
||||||
from error import HookError
|
|
||||||
from git_refs import HEAD
|
|
||||||
|
|
||||||
|
|
||||||
class RepoHook(object):
|
|
||||||
"""A RepoHook contains information about a script to run as a hook.
|
|
||||||
|
|
||||||
Hooks are used to run a python script before running an upload (for instance,
|
|
||||||
to run presubmit checks). Eventually, we may have hooks for other actions.
|
|
||||||
|
|
||||||
This shouldn't be confused with files in the 'repo/hooks' directory. Those
|
|
||||||
files are copied into each '.git/hooks' folder for each project. Repo-level
|
|
||||||
hooks are associated instead with repo actions.
|
|
||||||
|
|
||||||
Hooks are always python. When a hook is run, we will load the hook into the
|
|
||||||
interpreter and execute its main() function.
|
|
||||||
|
|
||||||
Combinations of hook option flags:
|
|
||||||
- no-verify=False, verify=False (DEFAULT):
|
|
||||||
If stdout is a tty, can prompt about running hooks if needed.
|
|
||||||
If user denies running hooks, the action is cancelled. If stdout is
|
|
||||||
not a tty and we would need to prompt about hooks, action is
|
|
||||||
cancelled.
|
|
||||||
- no-verify=False, verify=True:
|
|
||||||
Always run hooks with no prompt.
|
|
||||||
- no-verify=True, verify=False:
|
|
||||||
Never run hooks, but run action anyway (AKA bypass hooks).
|
|
||||||
- no-verify=True, verify=True:
|
|
||||||
Invalid
|
|
||||||
"""
|
|
||||||
|
|
||||||
def __init__(self,
|
|
||||||
hook_type,
|
|
||||||
hooks_project,
|
|
||||||
repo_topdir,
|
|
||||||
manifest_url,
|
|
||||||
bypass_hooks=False,
|
|
||||||
allow_all_hooks=False,
|
|
||||||
ignore_hooks=False,
|
|
||||||
abort_if_user_denies=False):
|
|
||||||
"""RepoHook constructor.
|
|
||||||
|
|
||||||
Params:
|
|
||||||
hook_type: A string representing the type of hook. This is also used
|
|
||||||
to figure out the name of the file containing the hook. For
|
|
||||||
example: 'pre-upload'.
|
|
||||||
hooks_project: The project containing the repo hooks.
|
|
||||||
If you have a manifest, this is manifest.repo_hooks_project.
|
|
||||||
OK if this is None, which will make the hook a no-op.
|
|
||||||
repo_topdir: The top directory of the repo client checkout.
|
|
||||||
This is the one containing the .repo directory. Scripts will
|
|
||||||
run with CWD as this directory.
|
|
||||||
If you have a manifest, this is manifest.topdir.
|
|
||||||
manifest_url: The URL to the manifest git repo.
|
|
||||||
bypass_hooks: If True, then 'Do not run the hook'.
|
|
||||||
allow_all_hooks: If True, then 'Run the hook without prompting'.
|
|
||||||
ignore_hooks: If True, then 'Do not abort action if hooks fail'.
|
|
||||||
abort_if_user_denies: If True, we'll abort running the hook if the user
|
|
||||||
doesn't allow us to run the hook.
|
|
||||||
"""
|
|
||||||
self._hook_type = hook_type
|
|
||||||
self._hooks_project = hooks_project
|
|
||||||
self._repo_topdir = repo_topdir
|
|
||||||
self._manifest_url = manifest_url
|
|
||||||
self._bypass_hooks = bypass_hooks
|
|
||||||
self._allow_all_hooks = allow_all_hooks
|
|
||||||
self._ignore_hooks = ignore_hooks
|
|
||||||
self._abort_if_user_denies = abort_if_user_denies
|
|
||||||
|
|
||||||
# Store the full path to the script for convenience.
|
|
||||||
if self._hooks_project:
|
|
||||||
self._script_fullpath = os.path.join(self._hooks_project.worktree,
|
|
||||||
self._hook_type + '.py')
|
|
||||||
else:
|
|
||||||
self._script_fullpath = None
|
|
||||||
|
|
||||||
def _GetHash(self):
|
|
||||||
"""Return a hash of the contents of the hooks directory.
|
|
||||||
|
|
||||||
We'll just use git to do this. This hash has the property that if anything
|
|
||||||
changes in the directory we will return a different has.
|
|
||||||
|
|
||||||
SECURITY CONSIDERATION:
|
|
||||||
This hash only represents the contents of files in the hook directory, not
|
|
||||||
any other files imported or called by hooks. Changes to imported files
|
|
||||||
can change the script behavior without affecting the hash.
|
|
||||||
|
|
||||||
Returns:
|
|
||||||
A string representing the hash. This will always be ASCII so that it can
|
|
||||||
be printed to the user easily.
|
|
||||||
"""
|
|
||||||
assert self._hooks_project, "Must have hooks to calculate their hash."
|
|
||||||
|
|
||||||
# We will use the work_git object rather than just calling GetRevisionId().
|
|
||||||
# That gives us a hash of the latest checked in version of the files that
|
|
||||||
# the user will actually be executing. Specifically, GetRevisionId()
|
|
||||||
# doesn't appear to change even if a user checks out a different version
|
|
||||||
# of the hooks repo (via git checkout) nor if a user commits their own revs.
|
|
||||||
#
|
|
||||||
# NOTE: Local (non-committed) changes will not be factored into this hash.
|
|
||||||
# I think this is OK, since we're really only worried about warning the user
|
|
||||||
# about upstream changes.
|
|
||||||
return self._hooks_project.work_git.rev_parse(HEAD)
|
|
||||||
|
|
||||||
def _GetMustVerb(self):
|
|
||||||
"""Return 'must' if the hook is required; 'should' if not."""
|
|
||||||
if self._abort_if_user_denies:
|
|
||||||
return 'must'
|
|
||||||
else:
|
|
||||||
return 'should'
|
|
||||||
|
|
||||||
def _CheckForHookApproval(self):
|
|
||||||
"""Check to see whether this hook has been approved.
|
|
||||||
|
|
||||||
We'll accept approval of manifest URLs if they're using secure transports.
|
|
||||||
This way the user can say they trust the manifest hoster. For insecure
|
|
||||||
hosts, we fall back to checking the hash of the hooks repo.
|
|
||||||
|
|
||||||
Note that we ask permission for each individual hook even though we use
|
|
||||||
the hash of all hooks when detecting changes. We'd like the user to be
|
|
||||||
able to approve / deny each hook individually. We only use the hash of all
|
|
||||||
hooks because there is no other easy way to detect changes to local imports.
|
|
||||||
|
|
||||||
Returns:
|
|
||||||
True if this hook is approved to run; False otherwise.
|
|
||||||
|
|
||||||
Raises:
|
|
||||||
HookError: Raised if the user doesn't approve and abort_if_user_denies
|
|
||||||
was passed to the consturctor.
|
|
||||||
"""
|
|
||||||
if self._ManifestUrlHasSecureScheme():
|
|
||||||
return self._CheckForHookApprovalManifest()
|
|
||||||
else:
|
|
||||||
return self._CheckForHookApprovalHash()
|
|
||||||
|
|
||||||
def _CheckForHookApprovalHelper(self, subkey, new_val, main_prompt,
|
|
||||||
changed_prompt):
|
|
||||||
"""Check for approval for a particular attribute and hook.
|
|
||||||
|
|
||||||
Args:
|
|
||||||
subkey: The git config key under [repo.hooks.<hook_type>] to store the
|
|
||||||
last approved string.
|
|
||||||
new_val: The new value to compare against the last approved one.
|
|
||||||
main_prompt: Message to display to the user to ask for approval.
|
|
||||||
changed_prompt: Message explaining why we're re-asking for approval.
|
|
||||||
|
|
||||||
Returns:
|
|
||||||
True if this hook is approved to run; False otherwise.
|
|
||||||
|
|
||||||
Raises:
|
|
||||||
HookError: Raised if the user doesn't approve and abort_if_user_denies
|
|
||||||
was passed to the consturctor.
|
|
||||||
"""
|
|
||||||
hooks_config = self._hooks_project.config
|
|
||||||
git_approval_key = 'repo.hooks.%s.%s' % (self._hook_type, subkey)
|
|
||||||
|
|
||||||
# Get the last value that the user approved for this hook; may be None.
|
|
||||||
old_val = hooks_config.GetString(git_approval_key)
|
|
||||||
|
|
||||||
if old_val is not None:
|
|
||||||
# User previously approved hook and asked not to be prompted again.
|
|
||||||
if new_val == old_val:
|
|
||||||
# Approval matched. We're done.
|
|
||||||
return True
|
|
||||||
else:
|
|
||||||
# Give the user a reason why we're prompting, since they last told
|
|
||||||
# us to "never ask again".
|
|
||||||
prompt = 'WARNING: %s\n\n' % (changed_prompt,)
|
|
||||||
else:
|
|
||||||
prompt = ''
|
|
||||||
|
|
||||||
# Prompt the user if we're not on a tty; on a tty we'll assume "no".
|
|
||||||
if sys.stdout.isatty():
|
|
||||||
prompt += main_prompt + ' (yes/always/NO)? '
|
|
||||||
response = input(prompt).lower()
|
|
||||||
print()
|
|
||||||
|
|
||||||
# User is doing a one-time approval.
|
|
||||||
if response in ('y', 'yes'):
|
|
||||||
return True
|
|
||||||
elif response == 'always':
|
|
||||||
hooks_config.SetString(git_approval_key, new_val)
|
|
||||||
return True
|
|
||||||
|
|
||||||
# For anything else, we'll assume no approval.
|
|
||||||
if self._abort_if_user_denies:
|
|
||||||
raise HookError('You must allow the %s hook or use --no-verify.' %
|
|
||||||
self._hook_type)
|
|
||||||
|
|
||||||
return False
|
|
||||||
|
|
||||||
def _ManifestUrlHasSecureScheme(self):
|
|
||||||
"""Check if the URI for the manifest is a secure transport."""
|
|
||||||
secure_schemes = ('file', 'https', 'ssh', 'persistent-https', 'sso', 'rpc')
|
|
||||||
parse_results = urllib.parse.urlparse(self._manifest_url)
|
|
||||||
return parse_results.scheme in secure_schemes
|
|
||||||
|
|
||||||
def _CheckForHookApprovalManifest(self):
|
|
||||||
"""Check whether the user has approved this manifest host.
|
|
||||||
|
|
||||||
Returns:
|
|
||||||
True if this hook is approved to run; False otherwise.
|
|
||||||
"""
|
|
||||||
return self._CheckForHookApprovalHelper(
|
|
||||||
'approvedmanifest',
|
|
||||||
self._manifest_url,
|
|
||||||
'Run hook scripts from %s' % (self._manifest_url,),
|
|
||||||
'Manifest URL has changed since %s was allowed.' % (self._hook_type,))
|
|
||||||
|
|
||||||
def _CheckForHookApprovalHash(self):
|
|
||||||
"""Check whether the user has approved the hooks repo.
|
|
||||||
|
|
||||||
Returns:
|
|
||||||
True if this hook is approved to run; False otherwise.
|
|
||||||
"""
|
|
||||||
prompt = ('Repo %s run the script:\n'
|
|
||||||
' %s\n'
|
|
||||||
'\n'
|
|
||||||
'Do you want to allow this script to run')
|
|
||||||
return self._CheckForHookApprovalHelper(
|
|
||||||
'approvedhash',
|
|
||||||
self._GetHash(),
|
|
||||||
prompt % (self._GetMustVerb(), self._script_fullpath),
|
|
||||||
'Scripts have changed since %s was allowed.' % (self._hook_type,))
|
|
||||||
|
|
||||||
@staticmethod
|
|
||||||
def _ExtractInterpFromShebang(data):
|
|
||||||
"""Extract the interpreter used in the shebang.
|
|
||||||
|
|
||||||
Try to locate the interpreter the script is using (ignoring `env`).
|
|
||||||
|
|
||||||
Args:
|
|
||||||
data: The file content of the script.
|
|
||||||
|
|
||||||
Returns:
|
|
||||||
The basename of the main script interpreter, or None if a shebang is not
|
|
||||||
used or could not be parsed out.
|
|
||||||
"""
|
|
||||||
firstline = data.splitlines()[:1]
|
|
||||||
if not firstline:
|
|
||||||
return None
|
|
||||||
|
|
||||||
# The format here can be tricky.
|
|
||||||
shebang = firstline[0].strip()
|
|
||||||
m = re.match(r'^#!\s*([^\s]+)(?:\s+([^\s]+))?', shebang)
|
|
||||||
if not m:
|
|
||||||
return None
|
|
||||||
|
|
||||||
# If the using `env`, find the target program.
|
|
||||||
interp = m.group(1)
|
|
||||||
if os.path.basename(interp) == 'env':
|
|
||||||
interp = m.group(2)
|
|
||||||
|
|
||||||
return interp
|
|
||||||
|
|
||||||
def _ExecuteHookViaReexec(self, interp, context, **kwargs):
|
|
||||||
"""Execute the hook script through |interp|.
|
|
||||||
|
|
||||||
Note: Support for this feature should be dropped ~Jun 2021.
|
|
||||||
|
|
||||||
Args:
|
|
||||||
interp: The Python program to run.
|
|
||||||
context: Basic Python context to execute the hook inside.
|
|
||||||
kwargs: Arbitrary arguments to pass to the hook script.
|
|
||||||
|
|
||||||
Raises:
|
|
||||||
HookError: When the hooks failed for any reason.
|
|
||||||
"""
|
|
||||||
# This logic needs to be kept in sync with _ExecuteHookViaImport below.
|
|
||||||
script = """
|
|
||||||
import json, os, sys
|
|
||||||
path = '''%(path)s'''
|
|
||||||
kwargs = json.loads('''%(kwargs)s''')
|
|
||||||
context = json.loads('''%(context)s''')
|
|
||||||
sys.path.insert(0, os.path.dirname(path))
|
|
||||||
data = open(path).read()
|
|
||||||
exec(compile(data, path, 'exec'), context)
|
|
||||||
context['main'](**kwargs)
|
|
||||||
""" % {
|
|
||||||
'path': self._script_fullpath,
|
|
||||||
'kwargs': json.dumps(kwargs),
|
|
||||||
'context': json.dumps(context),
|
|
||||||
}
|
|
||||||
|
|
||||||
# We pass the script via stdin to avoid OS argv limits. It also makes
|
|
||||||
# unhandled exception tracebacks less verbose/confusing for users.
|
|
||||||
cmd = [interp, '-c', 'import sys; exec(sys.stdin.read())']
|
|
||||||
proc = subprocess.Popen(cmd, stdin=subprocess.PIPE)
|
|
||||||
proc.communicate(input=script.encode('utf-8'))
|
|
||||||
if proc.returncode:
|
|
||||||
raise HookError('Failed to run %s hook.' % (self._hook_type,))
|
|
||||||
|
|
||||||
def _ExecuteHookViaImport(self, data, context, **kwargs):
|
|
||||||
"""Execute the hook code in |data| directly.
|
|
||||||
|
|
||||||
Args:
|
|
||||||
data: The code of the hook to execute.
|
|
||||||
context: Basic Python context to execute the hook inside.
|
|
||||||
kwargs: Arbitrary arguments to pass to the hook script.
|
|
||||||
|
|
||||||
Raises:
|
|
||||||
HookError: When the hooks failed for any reason.
|
|
||||||
"""
|
|
||||||
# Exec, storing global context in the context dict. We catch exceptions
|
|
||||||
# and convert to a HookError w/ just the failing traceback.
|
|
||||||
try:
|
|
||||||
exec(compile(data, self._script_fullpath, 'exec'), context)
|
|
||||||
except Exception:
|
|
||||||
raise HookError('%s\nFailed to import %s hook; see traceback above.' %
|
|
||||||
(traceback.format_exc(), self._hook_type))
|
|
||||||
|
|
||||||
# Running the script should have defined a main() function.
|
|
||||||
if 'main' not in context:
|
|
||||||
raise HookError('Missing main() in: "%s"' % self._script_fullpath)
|
|
||||||
|
|
||||||
# Call the main function in the hook. If the hook should cause the
|
|
||||||
# build to fail, it will raise an Exception. We'll catch that convert
|
|
||||||
# to a HookError w/ just the failing traceback.
|
|
||||||
try:
|
|
||||||
context['main'](**kwargs)
|
|
||||||
except Exception:
|
|
||||||
raise HookError('%s\nFailed to run main() for %s hook; see traceback '
|
|
||||||
'above.' % (traceback.format_exc(), self._hook_type))
|
|
||||||
|
|
||||||
def _ExecuteHook(self, **kwargs):
|
|
||||||
"""Actually execute the given hook.
|
|
||||||
|
|
||||||
This will run the hook's 'main' function in our python interpreter.
|
|
||||||
|
|
||||||
Args:
|
|
||||||
kwargs: Keyword arguments to pass to the hook. These are often specific
|
|
||||||
to the hook type. For instance, pre-upload hooks will contain
|
|
||||||
a project_list.
|
|
||||||
"""
|
|
||||||
# Keep sys.path and CWD stashed away so that we can always restore them
|
|
||||||
# upon function exit.
|
|
||||||
orig_path = os.getcwd()
|
|
||||||
orig_syspath = sys.path
|
|
||||||
|
|
||||||
try:
|
|
||||||
# Always run hooks with CWD as topdir.
|
|
||||||
os.chdir(self._repo_topdir)
|
|
||||||
|
|
||||||
# Put the hook dir as the first item of sys.path so hooks can do
|
|
||||||
# relative imports. We want to replace the repo dir as [0] so
|
|
||||||
# hooks can't import repo files.
|
|
||||||
sys.path = [os.path.dirname(self._script_fullpath)] + sys.path[1:]
|
|
||||||
|
|
||||||
# Initial global context for the hook to run within.
|
|
||||||
context = {'__file__': self._script_fullpath}
|
|
||||||
|
|
||||||
# Add 'hook_should_take_kwargs' to the arguments to be passed to main.
|
|
||||||
# We don't actually want hooks to define their main with this argument--
|
|
||||||
# it's there to remind them that their hook should always take **kwargs.
|
|
||||||
# For instance, a pre-upload hook should be defined like:
|
|
||||||
# def main(project_list, **kwargs):
|
|
||||||
#
|
|
||||||
# This allows us to later expand the API without breaking old hooks.
|
|
||||||
kwargs = kwargs.copy()
|
|
||||||
kwargs['hook_should_take_kwargs'] = True
|
|
||||||
|
|
||||||
# See what version of python the hook has been written against.
|
|
||||||
data = open(self._script_fullpath).read()
|
|
||||||
interp = self._ExtractInterpFromShebang(data)
|
|
||||||
reexec = False
|
|
||||||
if interp:
|
|
||||||
prog = os.path.basename(interp)
|
|
||||||
if prog.startswith('python2') and sys.version_info.major != 2:
|
|
||||||
reexec = True
|
|
||||||
elif prog.startswith('python3') and sys.version_info.major == 2:
|
|
||||||
reexec = True
|
|
||||||
|
|
||||||
# Attempt to execute the hooks through the requested version of Python.
|
|
||||||
if reexec:
|
|
||||||
try:
|
|
||||||
self._ExecuteHookViaReexec(interp, context, **kwargs)
|
|
||||||
except OSError as e:
|
|
||||||
if e.errno == errno.ENOENT:
|
|
||||||
# We couldn't find the interpreter, so fallback to importing.
|
|
||||||
reexec = False
|
|
||||||
else:
|
|
||||||
raise
|
|
||||||
|
|
||||||
# Run the hook by importing directly.
|
|
||||||
if not reexec:
|
|
||||||
self._ExecuteHookViaImport(data, context, **kwargs)
|
|
||||||
finally:
|
|
||||||
# Restore sys.path and CWD.
|
|
||||||
sys.path = orig_syspath
|
|
||||||
os.chdir(orig_path)
|
|
||||||
|
|
||||||
def _CheckHook(self):
|
|
||||||
# Bail with a nice error if we can't find the hook.
|
|
||||||
if not os.path.isfile(self._script_fullpath):
|
|
||||||
raise HookError('Couldn\'t find repo hook: %s' % self._script_fullpath)
|
|
||||||
|
|
||||||
def Run(self, **kwargs):
|
|
||||||
"""Run the hook.
|
|
||||||
|
|
||||||
If the hook doesn't exist (because there is no hooks project or because
|
|
||||||
this particular hook is not enabled), this is a no-op.
|
|
||||||
|
|
||||||
Args:
|
|
||||||
user_allows_all_hooks: If True, we will never prompt about running the
|
|
||||||
hook--we'll just assume it's OK to run it.
|
|
||||||
kwargs: Keyword arguments to pass to the hook. These are often specific
|
|
||||||
to the hook type. For instance, pre-upload hooks will contain
|
|
||||||
a project_list.
|
|
||||||
|
|
||||||
Returns:
|
|
||||||
True: On success or ignore hooks by user-request
|
|
||||||
False: The hook failed. The caller should respond with aborting the action.
|
|
||||||
Some examples in which False is returned:
|
|
||||||
* Finding the hook failed while it was enabled, or
|
|
||||||
* the user declined to run a required hook (from _CheckForHookApproval)
|
|
||||||
In all these cases the user did not pass the proper arguments to
|
|
||||||
ignore the result through the option combinations as listed in
|
|
||||||
AddHookOptionGroup().
|
|
||||||
"""
|
|
||||||
# Do not do anything in case bypass_hooks is set, or
|
|
||||||
# no-op if there is no hooks project or if hook is disabled.
|
|
||||||
if (self._bypass_hooks or
|
|
||||||
not self._hooks_project or
|
|
||||||
self._hook_type not in self._hooks_project.enabled_repo_hooks):
|
|
||||||
return True
|
|
||||||
|
|
||||||
passed = True
|
|
||||||
try:
|
|
||||||
self._CheckHook()
|
|
||||||
|
|
||||||
# Make sure the user is OK with running the hook.
|
|
||||||
if self._allow_all_hooks or self._CheckForHookApproval():
|
|
||||||
# Run the hook with the same version of python we're using.
|
|
||||||
self._ExecuteHook(**kwargs)
|
|
||||||
except SystemExit as e:
|
|
||||||
passed = False
|
|
||||||
print('ERROR: %s hooks exited with exit code: %s' % (self._hook_type, str(e)),
|
|
||||||
file=sys.stderr)
|
|
||||||
except HookError as e:
|
|
||||||
passed = False
|
|
||||||
print('ERROR: %s' % str(e), file=sys.stderr)
|
|
||||||
|
|
||||||
if not passed and self._ignore_hooks:
|
|
||||||
print('\nWARNING: %s hooks failed, but continuing anyways.' % self._hook_type,
|
|
||||||
file=sys.stderr)
|
|
||||||
passed = True
|
|
||||||
|
|
||||||
return passed
|
|
||||||
|
|
||||||
@classmethod
|
|
||||||
def FromSubcmd(cls, manifest, opt, *args, **kwargs):
|
|
||||||
"""Method to construct the repo hook class
|
|
||||||
|
|
||||||
Args:
|
|
||||||
manifest: The current active manifest for this command from which we
|
|
||||||
extract a couple of fields.
|
|
||||||
opt: Contains the commandline options for the action of this hook.
|
|
||||||
It should contain the options added by AddHookOptionGroup() in which
|
|
||||||
we are interested in RepoHook execution.
|
|
||||||
"""
|
|
||||||
for key in ('bypass_hooks', 'allow_all_hooks', 'ignore_hooks'):
|
|
||||||
kwargs.setdefault(key, getattr(opt, key))
|
|
||||||
kwargs.update({
|
|
||||||
'hooks_project': manifest.repo_hooks_project,
|
|
||||||
'repo_topdir': manifest.topdir,
|
|
||||||
'manifest_url': manifest.manifestProject.GetRemote('origin').url,
|
|
||||||
})
|
|
||||||
return cls(*args, **kwargs)
|
|
||||||
|
|
||||||
@staticmethod
|
|
||||||
def AddOptionGroup(parser, name):
|
|
||||||
"""Help options relating to the various hooks."""
|
|
||||||
|
|
||||||
# Note that verify and no-verify are NOT opposites of each other, which
|
|
||||||
# is why they store to different locations. We are using them to match
|
|
||||||
# 'git commit' syntax.
|
|
||||||
group = parser.add_option_group(name + ' hooks')
|
|
||||||
group.add_option('--no-verify',
|
|
||||||
dest='bypass_hooks', action='store_true',
|
|
||||||
help='Do not run the %s hook.' % name)
|
|
||||||
group.add_option('--verify',
|
|
||||||
dest='allow_all_hooks', action='store_true',
|
|
||||||
help='Run the %s hook without prompting.' % name)
|
|
||||||
group.add_option('--ignore-hooks',
|
|
||||||
action='store_true',
|
|
||||||
help='Do not abort if %s hooks fail.' % name)
|
|
202
hooks/commit-msg
202
hooks/commit-msg
@ -1,5 +1,5 @@
|
|||||||
#!/bin/sh
|
#!/bin/sh
|
||||||
# From Gerrit Code Review 3.1.3
|
# From Gerrit Code Review 2.14.6
|
||||||
#
|
#
|
||||||
# Part of Gerrit Code Review (https://www.gerritcodereview.com/)
|
# Part of Gerrit Code Review (https://www.gerritcodereview.com/)
|
||||||
#
|
#
|
||||||
@ -16,48 +16,176 @@
|
|||||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
# See the License for the specific language governing permissions and
|
# See the License for the specific language governing permissions and
|
||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
|
#
|
||||||
|
|
||||||
# avoid [[ which is not POSIX sh.
|
unset GREP_OPTIONS
|
||||||
if test "$#" != 1 ; then
|
|
||||||
echo "$0 requires an argument."
|
|
||||||
exit 1
|
|
||||||
fi
|
|
||||||
|
|
||||||
if test ! -f "$1" ; then
|
CHANGE_ID_AFTER="Bug|Depends-On|Issue|Test|Feature|Fixes|Fixed"
|
||||||
echo "file does not exist: $1"
|
MSG="$1"
|
||||||
exit 1
|
|
||||||
fi
|
|
||||||
|
|
||||||
# Do not create a change id if requested
|
# Check for, and add if missing, a unique Change-Id
|
||||||
if test "false" = "`git config --bool --get gerrit.createChangeId`" ; then
|
#
|
||||||
exit 0
|
add_ChangeId() {
|
||||||
fi
|
clean_message=`sed -e '
|
||||||
|
/^diff --git .*/{
|
||||||
|
s///
|
||||||
|
q
|
||||||
|
}
|
||||||
|
/^Signed-off-by:/d
|
||||||
|
/^#/d
|
||||||
|
' "$MSG" | git stripspace`
|
||||||
|
if test -z "$clean_message"
|
||||||
|
then
|
||||||
|
return
|
||||||
|
fi
|
||||||
|
|
||||||
# $RANDOM will be undefined if not using bash, so don't use set -u
|
# Do not add Change-Id to temp commits
|
||||||
random=$( (whoami ; hostname ; date; cat $1 ; echo $RANDOM) | git hash-object --stdin)
|
if echo "$clean_message" | head -1 | grep -q '^\(fixup\|squash\)!'
|
||||||
dest="$1.tmp.${random}"
|
then
|
||||||
|
return
|
||||||
|
fi
|
||||||
|
|
||||||
trap 'rm -f "${dest}"' EXIT
|
if test "false" = "`git config --bool --get gerrit.createChangeId`"
|
||||||
|
then
|
||||||
|
return
|
||||||
|
fi
|
||||||
|
|
||||||
if ! git stripspace --strip-comments < "$1" > "${dest}" ; then
|
# Does Change-Id: already exist? if so, exit (no change).
|
||||||
echo "cannot strip comments from $1"
|
if grep -i '^Change-Id:' "$MSG" >/dev/null
|
||||||
exit 1
|
then
|
||||||
fi
|
return
|
||||||
|
fi
|
||||||
|
|
||||||
if test ! -s "${dest}" ; then
|
id=`_gen_ChangeId`
|
||||||
echo "file is empty: $1"
|
T="$MSG.tmp.$$"
|
||||||
exit 1
|
AWK=awk
|
||||||
fi
|
if [ -x /usr/xpg4/bin/awk ]; then
|
||||||
|
# Solaris AWK is just too broken
|
||||||
|
AWK=/usr/xpg4/bin/awk
|
||||||
|
fi
|
||||||
|
|
||||||
# Avoid the --in-place option which only appeared in Git 2.8
|
# Get core.commentChar from git config or use default symbol
|
||||||
# Avoid the --if-exists option which only appeared in Git 2.15
|
commentChar=`git config --get core.commentChar`
|
||||||
if ! git -c trailer.ifexists=doNothing interpret-trailers \
|
commentChar=${commentChar:-#}
|
||||||
--trailer "Change-Id: I${random}" < "$1" > "${dest}" ; then
|
|
||||||
echo "cannot insert change-id line in $1"
|
|
||||||
exit 1
|
|
||||||
fi
|
|
||||||
|
|
||||||
if ! mv "${dest}" "$1" ; then
|
# How this works:
|
||||||
echo "cannot mv ${dest} to $1"
|
# - parse the commit message as (textLine+ blankLine*)*
|
||||||
exit 1
|
# - assume textLine+ to be a footer until proven otherwise
|
||||||
fi
|
# - exception: the first block is not footer (as it is the title)
|
||||||
|
# - read textLine+ into a variable
|
||||||
|
# - then count blankLines
|
||||||
|
# - once the next textLine appears, print textLine+ blankLine* as these
|
||||||
|
# aren't footer
|
||||||
|
# - in END, the last textLine+ block is available for footer parsing
|
||||||
|
$AWK '
|
||||||
|
BEGIN {
|
||||||
|
# while we start with the assumption that textLine+
|
||||||
|
# is a footer, the first block is not.
|
||||||
|
isFooter = 0
|
||||||
|
footerComment = 0
|
||||||
|
blankLines = 0
|
||||||
|
}
|
||||||
|
|
||||||
|
# Skip lines starting with commentChar without any spaces before it.
|
||||||
|
/^'"$commentChar"'/ { next }
|
||||||
|
|
||||||
|
# Skip the line starting with the diff command and everything after it,
|
||||||
|
# up to the end of the file, assuming it is only patch data.
|
||||||
|
# If more than one line before the diff was empty, strip all but one.
|
||||||
|
/^diff --git / {
|
||||||
|
blankLines = 0
|
||||||
|
while (getline) { }
|
||||||
|
next
|
||||||
|
}
|
||||||
|
|
||||||
|
# Count blank lines outside footer comments
|
||||||
|
/^$/ && (footerComment == 0) {
|
||||||
|
blankLines++
|
||||||
|
next
|
||||||
|
}
|
||||||
|
|
||||||
|
# Catch footer comment
|
||||||
|
/^\[[a-zA-Z0-9-]+:/ && (isFooter == 1) {
|
||||||
|
footerComment = 1
|
||||||
|
}
|
||||||
|
|
||||||
|
/]$/ && (footerComment == 1) {
|
||||||
|
footerComment = 2
|
||||||
|
}
|
||||||
|
|
||||||
|
# We have a non-blank line after blank lines. Handle this.
|
||||||
|
(blankLines > 0) {
|
||||||
|
print lines
|
||||||
|
for (i = 0; i < blankLines; i++) {
|
||||||
|
print ""
|
||||||
|
}
|
||||||
|
|
||||||
|
lines = ""
|
||||||
|
blankLines = 0
|
||||||
|
isFooter = 1
|
||||||
|
footerComment = 0
|
||||||
|
}
|
||||||
|
|
||||||
|
# Detect that the current block is not the footer
|
||||||
|
(footerComment == 0) && (!/^\[?[a-zA-Z0-9-]+:/ || /^[a-zA-Z0-9-]+:\/\//) {
|
||||||
|
isFooter = 0
|
||||||
|
}
|
||||||
|
|
||||||
|
{
|
||||||
|
# We need this information about the current last comment line
|
||||||
|
if (footerComment == 2) {
|
||||||
|
footerComment = 0
|
||||||
|
}
|
||||||
|
if (lines != "") {
|
||||||
|
lines = lines "\n";
|
||||||
|
}
|
||||||
|
lines = lines $0
|
||||||
|
}
|
||||||
|
|
||||||
|
# Footer handling:
|
||||||
|
# If the last block is considered a footer, splice in the Change-Id at the
|
||||||
|
# right place.
|
||||||
|
# Look for the right place to inject Change-Id by considering
|
||||||
|
# CHANGE_ID_AFTER. Keys listed in it (case insensitive) come first,
|
||||||
|
# then Change-Id, then everything else (eg. Signed-off-by:).
|
||||||
|
#
|
||||||
|
# Otherwise just print the last block, a new line and the Change-Id as a
|
||||||
|
# block of its own.
|
||||||
|
END {
|
||||||
|
unprinted = 1
|
||||||
|
if (isFooter == 0) {
|
||||||
|
print lines "\n"
|
||||||
|
lines = ""
|
||||||
|
}
|
||||||
|
changeIdAfter = "^(" tolower("'"$CHANGE_ID_AFTER"'") "):"
|
||||||
|
numlines = split(lines, footer, "\n")
|
||||||
|
for (line = 1; line <= numlines; line++) {
|
||||||
|
if (unprinted && match(tolower(footer[line]), changeIdAfter) != 1) {
|
||||||
|
unprinted = 0
|
||||||
|
print "Change-Id: I'"$id"'"
|
||||||
|
}
|
||||||
|
print footer[line]
|
||||||
|
}
|
||||||
|
if (unprinted) {
|
||||||
|
print "Change-Id: I'"$id"'"
|
||||||
|
}
|
||||||
|
}' "$MSG" > "$T" && mv "$T" "$MSG" || rm -f "$T"
|
||||||
|
}
|
||||||
|
_gen_ChangeIdInput() {
|
||||||
|
echo "tree `git write-tree`"
|
||||||
|
if parent=`git rev-parse "HEAD^0" 2>/dev/null`
|
||||||
|
then
|
||||||
|
echo "parent $parent"
|
||||||
|
fi
|
||||||
|
echo "author `git var GIT_AUTHOR_IDENT`"
|
||||||
|
echo "committer `git var GIT_COMMITTER_IDENT`"
|
||||||
|
echo
|
||||||
|
printf '%s' "$clean_message"
|
||||||
|
}
|
||||||
|
_gen_ChangeId() {
|
||||||
|
_gen_ChangeIdInput |
|
||||||
|
git hash-object -t commit --stdin
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
add_ChangeId
|
||||||
|
184
main.py
184
main.py
@ -1,4 +1,5 @@
|
|||||||
#!/usr/bin/env python3
|
#!/usr/bin/env python
|
||||||
|
# -*- coding:utf-8 -*-
|
||||||
#
|
#
|
||||||
# Copyright (C) 2008 The Android Open Source Project
|
# Copyright (C) 2008 The Android Open Source Project
|
||||||
#
|
#
|
||||||
@ -20,15 +21,23 @@ People shouldn't run this directly; instead, they should use the `repo` wrapper
|
|||||||
which takes care of execing this entry point.
|
which takes care of execing this entry point.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
|
from __future__ import print_function
|
||||||
import getpass
|
import getpass
|
||||||
import netrc
|
import netrc
|
||||||
import optparse
|
import optparse
|
||||||
import os
|
import os
|
||||||
import shlex
|
|
||||||
import sys
|
import sys
|
||||||
import textwrap
|
import textwrap
|
||||||
import time
|
import time
|
||||||
import urllib.request
|
|
||||||
|
from pyversion import is_python3
|
||||||
|
if is_python3():
|
||||||
|
import urllib.request
|
||||||
|
else:
|
||||||
|
import imp
|
||||||
|
import urllib2
|
||||||
|
urllib = imp.new_module('urllib')
|
||||||
|
urllib.request = urllib2
|
||||||
|
|
||||||
try:
|
try:
|
||||||
import kerberos
|
import kerberos
|
||||||
@ -38,9 +47,8 @@ except ImportError:
|
|||||||
from color import SetDefaultColoring
|
from color import SetDefaultColoring
|
||||||
import event_log
|
import event_log
|
||||||
from repo_trace import SetTrace
|
from repo_trace import SetTrace
|
||||||
from git_command import user_agent
|
from git_command import git, GitCommand, user_agent
|
||||||
from git_config import RepoConfig
|
from git_config import init_ssh, close_ssh
|
||||||
from git_trace2_event_log import EventLog
|
|
||||||
from command import InteractiveCommand
|
from command import InteractiveCommand
|
||||||
from command import MirrorSafeCommand
|
from command import MirrorSafeCommand
|
||||||
from command import GitcAvailableCommand, GitcClientCommand
|
from command import GitcAvailableCommand, GitcClientCommand
|
||||||
@ -54,41 +62,14 @@ from error import NoManifestException
|
|||||||
from error import NoSuchProjectError
|
from error import NoSuchProjectError
|
||||||
from error import RepoChangedException
|
from error import RepoChangedException
|
||||||
import gitc_utils
|
import gitc_utils
|
||||||
from manifest_xml import GitcClient, RepoClient
|
from manifest_xml import GitcManifest, XmlManifest
|
||||||
from pager import RunPager, TerminatePager
|
from pager import RunPager, TerminatePager
|
||||||
from wrapper import WrapperPath, Wrapper
|
from wrapper import WrapperPath, Wrapper
|
||||||
|
|
||||||
from subcmds import all_commands
|
from subcmds import all_commands
|
||||||
|
|
||||||
|
if not is_python3():
|
||||||
# NB: These do not need to be kept in sync with the repo launcher script.
|
input = raw_input
|
||||||
# These may be much newer as it allows the repo launcher to roll between
|
|
||||||
# different repo releases while source versions might require a newer python.
|
|
||||||
#
|
|
||||||
# The soft version is when we start warning users that the version is old and
|
|
||||||
# we'll be dropping support for it. We'll refuse to work with versions older
|
|
||||||
# than the hard version.
|
|
||||||
#
|
|
||||||
# python-3.6 is in Ubuntu Bionic.
|
|
||||||
MIN_PYTHON_VERSION_SOFT = (3, 6)
|
|
||||||
MIN_PYTHON_VERSION_HARD = (3, 5)
|
|
||||||
|
|
||||||
if sys.version_info.major < 3:
|
|
||||||
print('repo: error: Python 2 is no longer supported; '
|
|
||||||
'Please upgrade to Python {}.{}+.'.format(*MIN_PYTHON_VERSION_SOFT),
|
|
||||||
file=sys.stderr)
|
|
||||||
sys.exit(1)
|
|
||||||
else:
|
|
||||||
if sys.version_info < MIN_PYTHON_VERSION_HARD:
|
|
||||||
print('repo: error: Python 3 version is too old; '
|
|
||||||
'Please upgrade to Python {}.{}+.'.format(*MIN_PYTHON_VERSION_SOFT),
|
|
||||||
file=sys.stderr)
|
|
||||||
sys.exit(1)
|
|
||||||
elif sys.version_info < MIN_PYTHON_VERSION_SOFT:
|
|
||||||
print('repo: warning: your Python 3 version is no longer supported; '
|
|
||||||
'Please upgrade to Python {}.{}+.'.format(*MIN_PYTHON_VERSION_SOFT),
|
|
||||||
file=sys.stderr)
|
|
||||||
|
|
||||||
|
|
||||||
global_options = optparse.OptionParser(
|
global_options = optparse.OptionParser(
|
||||||
usage='repo [-p|--paginate|--no-pager] COMMAND [ARGS]',
|
usage='repo [-p|--paginate|--no-pager] COMMAND [ARGS]',
|
||||||
@ -99,7 +80,7 @@ global_options.add_option('-p', '--paginate',
|
|||||||
dest='pager', action='store_true',
|
dest='pager', action='store_true',
|
||||||
help='display command output in the pager')
|
help='display command output in the pager')
|
||||||
global_options.add_option('--no-pager',
|
global_options.add_option('--no-pager',
|
||||||
dest='pager', action='store_false',
|
dest='no_pager', action='store_true',
|
||||||
help='disable the pager')
|
help='disable the pager')
|
||||||
global_options.add_option('--color',
|
global_options.add_option('--color',
|
||||||
choices=('auto', 'always', 'never'), default=None,
|
choices=('auto', 'always', 'never'), default=None,
|
||||||
@ -119,14 +100,13 @@ global_options.add_option('--version',
|
|||||||
global_options.add_option('--event-log',
|
global_options.add_option('--event-log',
|
||||||
dest='event_log', action='store',
|
dest='event_log', action='store',
|
||||||
help='filename of event log to append timeline to')
|
help='filename of event log to append timeline to')
|
||||||
global_options.add_option('--git-trace2-event-log', action='store',
|
|
||||||
help='directory to write git trace2 event log to')
|
|
||||||
|
|
||||||
|
|
||||||
class _Repo(object):
|
class _Repo(object):
|
||||||
def __init__(self, repodir):
|
def __init__(self, repodir):
|
||||||
self.repodir = repodir
|
self.repodir = repodir
|
||||||
self.commands = all_commands
|
self.commands = all_commands
|
||||||
|
# add 'branch' as an alias for 'branches'
|
||||||
|
all_commands['branch'] = all_commands['branches']
|
||||||
|
|
||||||
def _ParseArgs(self, argv):
|
def _ParseArgs(self, argv):
|
||||||
"""Parse the main `repo` command line options."""
|
"""Parse the main `repo` command line options."""
|
||||||
@ -146,9 +126,6 @@ class _Repo(object):
|
|||||||
argv = []
|
argv = []
|
||||||
gopts, _gargs = global_options.parse_args(glob)
|
gopts, _gargs = global_options.parse_args(glob)
|
||||||
|
|
||||||
name, alias_args = self._ExpandAlias(name)
|
|
||||||
argv = alias_args + argv
|
|
||||||
|
|
||||||
if gopts.help:
|
if gopts.help:
|
||||||
global_options.print_help()
|
global_options.print_help()
|
||||||
commands = ' '.join(sorted(self.commands))
|
commands = ' '.join(sorted(self.commands))
|
||||||
@ -159,27 +136,6 @@ class _Repo(object):
|
|||||||
|
|
||||||
return (name, gopts, argv)
|
return (name, gopts, argv)
|
||||||
|
|
||||||
def _ExpandAlias(self, name):
|
|
||||||
"""Look up user registered aliases."""
|
|
||||||
# We don't resolve aliases for existing subcommands. This matches git.
|
|
||||||
if name in self.commands:
|
|
||||||
return name, []
|
|
||||||
|
|
||||||
key = 'alias.%s' % (name,)
|
|
||||||
alias = RepoConfig.ForRepository(self.repodir).GetString(key)
|
|
||||||
if alias is None:
|
|
||||||
alias = RepoConfig.ForUser().GetString(key)
|
|
||||||
if alias is None:
|
|
||||||
return name, []
|
|
||||||
|
|
||||||
args = alias.strip().split(' ', 1)
|
|
||||||
name = args[0]
|
|
||||||
if len(args) == 2:
|
|
||||||
args = shlex.split(args[1])
|
|
||||||
else:
|
|
||||||
args = []
|
|
||||||
return name, args
|
|
||||||
|
|
||||||
def _Run(self, name, gopts, argv):
|
def _Run(self, name, gopts, argv):
|
||||||
"""Execute the requested subcommand."""
|
"""Execute the requested subcommand."""
|
||||||
result = 0
|
result = 0
|
||||||
@ -196,23 +152,21 @@ class _Repo(object):
|
|||||||
SetDefaultColoring(gopts.color)
|
SetDefaultColoring(gopts.color)
|
||||||
|
|
||||||
try:
|
try:
|
||||||
cmd = self.commands[name]()
|
cmd = self.commands[name]
|
||||||
except KeyError:
|
except KeyError:
|
||||||
print("repo: '%s' is not a repo command. See 'repo help'." % name,
|
print("repo: '%s' is not a repo command. See 'repo help'." % name,
|
||||||
file=sys.stderr)
|
file=sys.stderr)
|
||||||
return 1
|
return 1
|
||||||
|
|
||||||
git_trace2_event_log = EventLog()
|
|
||||||
cmd.repodir = self.repodir
|
cmd.repodir = self.repodir
|
||||||
cmd.client = RepoClient(cmd.repodir)
|
cmd.manifest = XmlManifest(cmd.repodir)
|
||||||
cmd.manifest = cmd.client.manifest
|
|
||||||
cmd.gitc_manifest = None
|
cmd.gitc_manifest = None
|
||||||
gitc_client_name = gitc_utils.parse_clientdir(os.getcwd())
|
gitc_client_name = gitc_utils.parse_clientdir(os.getcwd())
|
||||||
if gitc_client_name:
|
if gitc_client_name:
|
||||||
cmd.gitc_manifest = GitcClient(cmd.repodir, gitc_client_name)
|
cmd.gitc_manifest = GitcManifest(cmd.repodir, gitc_client_name)
|
||||||
cmd.client.isGitcClient = True
|
cmd.manifest.isGitcClient = True
|
||||||
|
|
||||||
Editor.globalConfig = cmd.client.globalConfig
|
Editor.globalConfig = cmd.manifest.globalConfig
|
||||||
|
|
||||||
if not isinstance(cmd, MirrorSafeCommand) and cmd.manifest.IsMirror:
|
if not isinstance(cmd, MirrorSafeCommand) and cmd.manifest.IsMirror:
|
||||||
print("fatal: '%s' requires a working directory" % name,
|
print("fatal: '%s' requires a working directory" % name,
|
||||||
@ -239,8 +193,8 @@ class _Repo(object):
|
|||||||
file=sys.stderr)
|
file=sys.stderr)
|
||||||
return 1
|
return 1
|
||||||
|
|
||||||
if gopts.pager is not False and not isinstance(cmd, InteractiveCommand):
|
if not gopts.no_pager and not isinstance(cmd, InteractiveCommand):
|
||||||
config = cmd.client.globalConfig
|
config = cmd.manifest.globalConfig
|
||||||
if gopts.pager:
|
if gopts.pager:
|
||||||
use_pager = True
|
use_pager = True
|
||||||
else:
|
else:
|
||||||
@ -253,11 +207,7 @@ class _Repo(object):
|
|||||||
start = time.time()
|
start = time.time()
|
||||||
cmd_event = cmd.event_log.Add(name, event_log.TASK_COMMAND, start)
|
cmd_event = cmd.event_log.Add(name, event_log.TASK_COMMAND, start)
|
||||||
cmd.event_log.SetParent(cmd_event)
|
cmd.event_log.SetParent(cmd_event)
|
||||||
git_trace2_event_log.StartEvent()
|
|
||||||
git_trace2_event_log.CommandEvent(name='repo', subcommands=[name])
|
|
||||||
|
|
||||||
try:
|
try:
|
||||||
cmd.CommonValidateOptions(copts, cargs)
|
|
||||||
cmd.ValidateOptions(copts, cargs)
|
cmd.ValidateOptions(copts, cargs)
|
||||||
result = cmd.Execute(copts, cargs)
|
result = cmd.Execute(copts, cargs)
|
||||||
except (DownloadError, ManifestInvalidRevisionError,
|
except (DownloadError, ManifestInvalidRevisionError,
|
||||||
@ -278,8 +228,7 @@ class _Repo(object):
|
|||||||
if e.name:
|
if e.name:
|
||||||
print('error: project group must be enabled for project %s' % e.name, file=sys.stderr)
|
print('error: project group must be enabled for project %s' % e.name, file=sys.stderr)
|
||||||
else:
|
else:
|
||||||
print('error: project group must be enabled for the project in the current directory',
|
print('error: project group must be enabled for the project in the current directory', file=sys.stderr)
|
||||||
file=sys.stderr)
|
|
||||||
result = 1
|
result = 1
|
||||||
except SystemExit as e:
|
except SystemExit as e:
|
||||||
if e.code:
|
if e.code:
|
||||||
@ -299,78 +248,49 @@ class _Repo(object):
|
|||||||
|
|
||||||
cmd.event_log.FinishEvent(cmd_event, finish,
|
cmd.event_log.FinishEvent(cmd_event, finish,
|
||||||
result is None or result == 0)
|
result is None or result == 0)
|
||||||
git_trace2_event_log.DefParamRepoEvents(
|
|
||||||
cmd.manifest.manifestProject.config.DumpConfigDict())
|
|
||||||
git_trace2_event_log.ExitEvent(result)
|
|
||||||
|
|
||||||
if gopts.event_log:
|
if gopts.event_log:
|
||||||
cmd.event_log.Write(os.path.abspath(
|
cmd.event_log.Write(os.path.abspath(
|
||||||
os.path.expanduser(gopts.event_log)))
|
os.path.expanduser(gopts.event_log)))
|
||||||
|
|
||||||
git_trace2_event_log.Write(gopts.git_trace2_event_log)
|
|
||||||
return result
|
return result
|
||||||
|
|
||||||
|
|
||||||
def _CheckWrapperVersion(ver_str, repo_path):
|
def _CheckWrapperVersion(ver, repo_path):
|
||||||
"""Verify the repo launcher is new enough for this checkout.
|
|
||||||
|
|
||||||
Args:
|
|
||||||
ver_str: The version string passed from the repo launcher when it ran us.
|
|
||||||
repo_path: The path to the repo launcher that loaded us.
|
|
||||||
"""
|
|
||||||
# Refuse to work with really old wrapper versions. We don't test these,
|
|
||||||
# so might as well require a somewhat recent sane version.
|
|
||||||
# v1.15 of the repo launcher was released in ~Mar 2012.
|
|
||||||
MIN_REPO_VERSION = (1, 15)
|
|
||||||
min_str = '.'.join(str(x) for x in MIN_REPO_VERSION)
|
|
||||||
|
|
||||||
if not repo_path:
|
if not repo_path:
|
||||||
repo_path = '~/bin/repo'
|
repo_path = '~/bin/repo'
|
||||||
|
|
||||||
if not ver_str:
|
if not ver:
|
||||||
print('no --wrapper-version argument', file=sys.stderr)
|
print('no --wrapper-version argument', file=sys.stderr)
|
||||||
sys.exit(1)
|
sys.exit(1)
|
||||||
|
|
||||||
# Pull out the version of the repo launcher we know about to compare.
|
|
||||||
exp = Wrapper().VERSION
|
exp = Wrapper().VERSION
|
||||||
ver = tuple(map(int, ver_str.split('.')))
|
ver = tuple(map(int, ver.split('.')))
|
||||||
|
if len(ver) == 1:
|
||||||
|
ver = (0, ver[0])
|
||||||
|
|
||||||
exp_str = '.'.join(map(str, exp))
|
exp_str = '.'.join(map(str, exp))
|
||||||
if ver < MIN_REPO_VERSION:
|
if exp[0] > ver[0] or ver < (0, 4):
|
||||||
print("""
|
print("""
|
||||||
repo: error:
|
!!! A new repo command (%5s) is available. !!!
|
||||||
!!! Your version of repo %s is too old.
|
!!! You must upgrade before you can continue: !!!
|
||||||
!!! We need at least version %s.
|
|
||||||
!!! A new version of repo (%s) is available.
|
|
||||||
!!! You must upgrade before you can continue:
|
|
||||||
|
|
||||||
cp %s %s
|
cp %s %s
|
||||||
""" % (ver_str, min_str, exp_str, WrapperPath(), repo_path), file=sys.stderr)
|
""" % (exp_str, WrapperPath(), repo_path), file=sys.stderr)
|
||||||
sys.exit(1)
|
sys.exit(1)
|
||||||
|
|
||||||
if exp > ver:
|
if exp > ver:
|
||||||
print('\n... A new version of repo (%s) is available.' % (exp_str,),
|
print("""
|
||||||
file=sys.stderr)
|
... A new repo command (%5s) is available.
|
||||||
if os.access(repo_path, os.W_OK):
|
|
||||||
print("""\
|
|
||||||
... You should upgrade soon:
|
... You should upgrade soon:
|
||||||
cp %s %s
|
|
||||||
""" % (WrapperPath(), repo_path), file=sys.stderr)
|
|
||||||
else:
|
|
||||||
print("""\
|
|
||||||
... New version is available at: %s
|
|
||||||
... The launcher is run from: %s
|
|
||||||
!!! The launcher is not writable. Please talk to your sysadmin or distro
|
|
||||||
!!! to get an update installed.
|
|
||||||
""" % (WrapperPath(), repo_path), file=sys.stderr)
|
|
||||||
|
|
||||||
|
cp %s %s
|
||||||
|
""" % (exp_str, WrapperPath(), repo_path), file=sys.stderr)
|
||||||
|
|
||||||
def _CheckRepoDir(repo_dir):
|
def _CheckRepoDir(repo_dir):
|
||||||
if not repo_dir:
|
if not repo_dir:
|
||||||
print('no --repo-dir argument', file=sys.stderr)
|
print('no --repo-dir argument', file=sys.stderr)
|
||||||
sys.exit(1)
|
sys.exit(1)
|
||||||
|
|
||||||
|
|
||||||
def _PruneOptions(argv, opt):
|
def _PruneOptions(argv, opt):
|
||||||
i = 0
|
i = 0
|
||||||
while i < len(argv):
|
while i < len(argv):
|
||||||
@ -386,7 +306,6 @@ def _PruneOptions(argv, opt):
|
|||||||
continue
|
continue
|
||||||
i += 1
|
i += 1
|
||||||
|
|
||||||
|
|
||||||
class _UserAgentHandler(urllib.request.BaseHandler):
|
class _UserAgentHandler(urllib.request.BaseHandler):
|
||||||
def http_request(self, req):
|
def http_request(self, req):
|
||||||
req.add_header('User-Agent', user_agent.repo)
|
req.add_header('User-Agent', user_agent.repo)
|
||||||
@ -396,7 +315,6 @@ class _UserAgentHandler(urllib.request.BaseHandler):
|
|||||||
req.add_header('User-Agent', user_agent.repo)
|
req.add_header('User-Agent', user_agent.repo)
|
||||||
return req
|
return req
|
||||||
|
|
||||||
|
|
||||||
def _AddPasswordFromUserInput(handler, msg, req):
|
def _AddPasswordFromUserInput(handler, msg, req):
|
||||||
# If repo could not find auth info from netrc, try to get it from user input
|
# If repo could not find auth info from netrc, try to get it from user input
|
||||||
url = req.get_full_url()
|
url = req.get_full_url()
|
||||||
@ -410,7 +328,6 @@ def _AddPasswordFromUserInput(handler, msg, req):
|
|||||||
return
|
return
|
||||||
handler.passwd.add_password(None, url, user, password)
|
handler.passwd.add_password(None, url, user, password)
|
||||||
|
|
||||||
|
|
||||||
class _BasicAuthHandler(urllib.request.HTTPBasicAuthHandler):
|
class _BasicAuthHandler(urllib.request.HTTPBasicAuthHandler):
|
||||||
def http_error_401(self, req, fp, code, msg, headers):
|
def http_error_401(self, req, fp, code, msg, headers):
|
||||||
_AddPasswordFromUserInput(self, msg, req)
|
_AddPasswordFromUserInput(self, msg, req)
|
||||||
@ -420,14 +337,13 @@ class _BasicAuthHandler(urllib.request.HTTPBasicAuthHandler):
|
|||||||
def http_error_auth_reqed(self, authreq, host, req, headers):
|
def http_error_auth_reqed(self, authreq, host, req, headers):
|
||||||
try:
|
try:
|
||||||
old_add_header = req.add_header
|
old_add_header = req.add_header
|
||||||
|
|
||||||
def _add_header(name, val):
|
def _add_header(name, val):
|
||||||
val = val.replace('\n', '')
|
val = val.replace('\n', '')
|
||||||
old_add_header(name, val)
|
old_add_header(name, val)
|
||||||
req.add_header = _add_header
|
req.add_header = _add_header
|
||||||
return urllib.request.AbstractBasicAuthHandler.http_error_auth_reqed(
|
return urllib.request.AbstractBasicAuthHandler.http_error_auth_reqed(
|
||||||
self, authreq, host, req, headers)
|
self, authreq, host, req, headers)
|
||||||
except Exception:
|
except:
|
||||||
reset = getattr(self, 'reset_retry_count', None)
|
reset = getattr(self, 'reset_retry_count', None)
|
||||||
if reset is not None:
|
if reset is not None:
|
||||||
reset()
|
reset()
|
||||||
@ -435,7 +351,6 @@ class _BasicAuthHandler(urllib.request.HTTPBasicAuthHandler):
|
|||||||
self.retried = 0
|
self.retried = 0
|
||||||
raise
|
raise
|
||||||
|
|
||||||
|
|
||||||
class _DigestAuthHandler(urllib.request.HTTPDigestAuthHandler):
|
class _DigestAuthHandler(urllib.request.HTTPDigestAuthHandler):
|
||||||
def http_error_401(self, req, fp, code, msg, headers):
|
def http_error_401(self, req, fp, code, msg, headers):
|
||||||
_AddPasswordFromUserInput(self, msg, req)
|
_AddPasswordFromUserInput(self, msg, req)
|
||||||
@ -445,14 +360,13 @@ class _DigestAuthHandler(urllib.request.HTTPDigestAuthHandler):
|
|||||||
def http_error_auth_reqed(self, auth_header, host, req, headers):
|
def http_error_auth_reqed(self, auth_header, host, req, headers):
|
||||||
try:
|
try:
|
||||||
old_add_header = req.add_header
|
old_add_header = req.add_header
|
||||||
|
|
||||||
def _add_header(name, val):
|
def _add_header(name, val):
|
||||||
val = val.replace('\n', '')
|
val = val.replace('\n', '')
|
||||||
old_add_header(name, val)
|
old_add_header(name, val)
|
||||||
req.add_header = _add_header
|
req.add_header = _add_header
|
||||||
return urllib.request.AbstractDigestAuthHandler.http_error_auth_reqed(
|
return urllib.request.AbstractDigestAuthHandler.http_error_auth_reqed(
|
||||||
self, auth_header, host, req, headers)
|
self, auth_header, host, req, headers)
|
||||||
except Exception:
|
except:
|
||||||
reset = getattr(self, 'reset_retry_count', None)
|
reset = getattr(self, 'reset_retry_count', None)
|
||||||
if reset is not None:
|
if reset is not None:
|
||||||
reset()
|
reset()
|
||||||
@ -460,7 +374,6 @@ class _DigestAuthHandler(urllib.request.HTTPDigestAuthHandler):
|
|||||||
self.retried = 0
|
self.retried = 0
|
||||||
raise
|
raise
|
||||||
|
|
||||||
|
|
||||||
class _KerberosAuthHandler(urllib.request.BaseHandler):
|
class _KerberosAuthHandler(urllib.request.BaseHandler):
|
||||||
def __init__(self):
|
def __init__(self):
|
||||||
self.retried = 0
|
self.retried = 0
|
||||||
@ -495,7 +408,7 @@ class _KerberosAuthHandler(urllib.request.BaseHandler):
|
|||||||
return response
|
return response
|
||||||
except kerberos.GSSError:
|
except kerberos.GSSError:
|
||||||
return None
|
return None
|
||||||
except Exception:
|
except:
|
||||||
self.reset_retry_count()
|
self.reset_retry_count()
|
||||||
raise
|
raise
|
||||||
finally:
|
finally:
|
||||||
@ -541,7 +454,6 @@ class _KerberosAuthHandler(urllib.request.BaseHandler):
|
|||||||
kerberos.authGSSClientClean(self.context)
|
kerberos.authGSSClientClean(self.context)
|
||||||
self.context = None
|
self.context = None
|
||||||
|
|
||||||
|
|
||||||
def init_http():
|
def init_http():
|
||||||
handlers = [_UserAgentHandler()]
|
handlers = [_UserAgentHandler()]
|
||||||
|
|
||||||
@ -569,7 +481,6 @@ def init_http():
|
|||||||
handlers.append(urllib.request.HTTPSHandler(debuglevel=1))
|
handlers.append(urllib.request.HTTPSHandler(debuglevel=1))
|
||||||
urllib.request.install_opener(urllib.request.build_opener(*handlers))
|
urllib.request.install_opener(urllib.request.build_opener(*handlers))
|
||||||
|
|
||||||
|
|
||||||
def _Main(argv):
|
def _Main(argv):
|
||||||
result = 0
|
result = 0
|
||||||
|
|
||||||
@ -591,6 +502,8 @@ def _Main(argv):
|
|||||||
|
|
||||||
repo = _Repo(opt.repodir)
|
repo = _Repo(opt.repodir)
|
||||||
try:
|
try:
|
||||||
|
try:
|
||||||
|
init_ssh()
|
||||||
init_http()
|
init_http()
|
||||||
name, gopts, argv = repo._ParseArgs(argv)
|
name, gopts, argv = repo._ParseArgs(argv)
|
||||||
run = lambda: repo._Run(name, gopts, argv) or 0
|
run = lambda: repo._Run(name, gopts, argv) or 0
|
||||||
@ -601,6 +514,8 @@ def _Main(argv):
|
|||||||
result = tracer.runfunc(run)
|
result = tracer.runfunc(run)
|
||||||
else:
|
else:
|
||||||
result = run()
|
result = run()
|
||||||
|
finally:
|
||||||
|
close_ssh()
|
||||||
except KeyboardInterrupt:
|
except KeyboardInterrupt:
|
||||||
print('aborted by user', file=sys.stderr)
|
print('aborted by user', file=sys.stderr)
|
||||||
result = 1
|
result = 1
|
||||||
@ -613,7 +528,7 @@ def _Main(argv):
|
|||||||
argv = list(sys.argv)
|
argv = list(sys.argv)
|
||||||
argv.extend(rce.extra_args)
|
argv.extend(rce.extra_args)
|
||||||
try:
|
try:
|
||||||
os.execv(sys.executable, [__file__] + argv)
|
os.execv(__file__, argv)
|
||||||
except OSError as e:
|
except OSError as e:
|
||||||
print('fatal: cannot restart repo after upgrade', file=sys.stderr)
|
print('fatal: cannot restart repo after upgrade', file=sys.stderr)
|
||||||
print('fatal: %s' % e, file=sys.stderr)
|
print('fatal: %s' % e, file=sys.stderr)
|
||||||
@ -622,6 +537,5 @@ def _Main(argv):
|
|||||||
TerminatePager()
|
TerminatePager()
|
||||||
sys.exit(result)
|
sys.exit(result)
|
||||||
|
|
||||||
|
|
||||||
if __name__ == '__main__':
|
if __name__ == '__main__':
|
||||||
_Main(sys.argv[1:])
|
_Main(sys.argv[1:])
|
||||||
|
731
manifest_xml.py
731
manifest_xml.py
File diff suppressed because it is too large
Load Diff
16
pager.py
16
pager.py
@ -1,3 +1,5 @@
|
|||||||
|
# -*- coding:utf-8 -*-
|
||||||
|
#
|
||||||
# Copyright (C) 2008 The Android Open Source Project
|
# Copyright (C) 2008 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
@ -12,6 +14,7 @@
|
|||||||
# See the License for the specific language governing permissions and
|
# See the License for the specific language governing permissions and
|
||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
|
|
||||||
|
from __future__ import print_function
|
||||||
import os
|
import os
|
||||||
import select
|
import select
|
||||||
import subprocess
|
import subprocess
|
||||||
@ -24,7 +27,6 @@ pager_process = None
|
|||||||
old_stdout = None
|
old_stdout = None
|
||||||
old_stderr = None
|
old_stderr = None
|
||||||
|
|
||||||
|
|
||||||
def RunPager(globalConfig):
|
def RunPager(globalConfig):
|
||||||
if not os.isatty(0) or not os.isatty(1):
|
if not os.isatty(0) or not os.isatty(1):
|
||||||
return
|
return
|
||||||
@ -33,37 +35,33 @@ def RunPager(globalConfig):
|
|||||||
return
|
return
|
||||||
|
|
||||||
if platform_utils.isWindows():
|
if platform_utils.isWindows():
|
||||||
_PipePager(pager)
|
_PipePager(pager);
|
||||||
else:
|
else:
|
||||||
_ForkPager(pager)
|
_ForkPager(pager)
|
||||||
|
|
||||||
|
|
||||||
def TerminatePager():
|
def TerminatePager():
|
||||||
global pager_process, old_stdout, old_stderr
|
global pager_process, old_stdout, old_stderr
|
||||||
if pager_process:
|
if pager_process:
|
||||||
sys.stdout.flush()
|
sys.stdout.flush()
|
||||||
sys.stderr.flush()
|
sys.stderr.flush()
|
||||||
pager_process.stdin.close()
|
pager_process.stdin.close()
|
||||||
pager_process.wait()
|
pager_process.wait();
|
||||||
pager_process = None
|
pager_process = None
|
||||||
# Restore initial stdout/err in case there is more output in this process
|
# Restore initial stdout/err in case there is more output in this process
|
||||||
# after shutting down the pager process
|
# after shutting down the pager process
|
||||||
sys.stdout = old_stdout
|
sys.stdout = old_stdout
|
||||||
sys.stderr = old_stderr
|
sys.stderr = old_stderr
|
||||||
|
|
||||||
|
|
||||||
def _PipePager(pager):
|
def _PipePager(pager):
|
||||||
global pager_process, old_stdout, old_stderr
|
global pager_process, old_stdout, old_stderr
|
||||||
assert pager_process is None, "Only one active pager process at a time"
|
assert pager_process is None, "Only one active pager process at a time"
|
||||||
# Create pager process, piping stdout/err into its stdin
|
# Create pager process, piping stdout/err into its stdin
|
||||||
pager_process = subprocess.Popen([pager], stdin=subprocess.PIPE, stdout=sys.stdout,
|
pager_process = subprocess.Popen([pager], stdin=subprocess.PIPE, stdout=sys.stdout, stderr=sys.stderr)
|
||||||
stderr=sys.stderr)
|
|
||||||
old_stdout = sys.stdout
|
old_stdout = sys.stdout
|
||||||
old_stderr = sys.stderr
|
old_stderr = sys.stderr
|
||||||
sys.stdout = pager_process.stdin
|
sys.stdout = pager_process.stdin
|
||||||
sys.stderr = pager_process.stdin
|
sys.stderr = pager_process.stdin
|
||||||
|
|
||||||
|
|
||||||
def _ForkPager(pager):
|
def _ForkPager(pager):
|
||||||
global active
|
global active
|
||||||
# This process turns into the pager; a child it forks will
|
# This process turns into the pager; a child it forks will
|
||||||
@ -90,7 +88,6 @@ def _ForkPager(pager):
|
|||||||
print("fatal: cannot start pager '%s'" % pager, file=sys.stderr)
|
print("fatal: cannot start pager '%s'" % pager, file=sys.stderr)
|
||||||
sys.exit(255)
|
sys.exit(255)
|
||||||
|
|
||||||
|
|
||||||
def _SelectPager(globalConfig):
|
def _SelectPager(globalConfig):
|
||||||
try:
|
try:
|
||||||
return os.environ['GIT_PAGER']
|
return os.environ['GIT_PAGER']
|
||||||
@ -108,7 +105,6 @@ def _SelectPager(globalConfig):
|
|||||||
|
|
||||||
return 'less'
|
return 'less'
|
||||||
|
|
||||||
|
|
||||||
def _BecomePager(pager):
|
def _BecomePager(pager):
|
||||||
# Delaying execution of the pager until we have output
|
# Delaying execution of the pager until we have output
|
||||||
# ready works around a long-standing bug in popularly
|
# ready works around a long-standing bug in popularly
|
||||||
|
@ -1,3 +1,5 @@
|
|||||||
|
# -*- coding:utf-8 -*-
|
||||||
|
#
|
||||||
# Copyright (C) 2016 The Android Open Source Project
|
# Copyright (C) 2016 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
@ -15,9 +17,18 @@
|
|||||||
import errno
|
import errno
|
||||||
import os
|
import os
|
||||||
import platform
|
import platform
|
||||||
|
import select
|
||||||
import shutil
|
import shutil
|
||||||
import stat
|
import stat
|
||||||
|
|
||||||
|
from pyversion import is_python3
|
||||||
|
if is_python3():
|
||||||
|
from queue import Queue
|
||||||
|
else:
|
||||||
|
from Queue import Queue
|
||||||
|
|
||||||
|
from threading import Thread
|
||||||
|
|
||||||
|
|
||||||
def isWindows():
|
def isWindows():
|
||||||
""" Returns True when running with the native port of Python for Windows,
|
""" Returns True when running with the native port of Python for Windows,
|
||||||
@ -28,6 +39,145 @@ def isWindows():
|
|||||||
return platform.system() == "Windows"
|
return platform.system() == "Windows"
|
||||||
|
|
||||||
|
|
||||||
|
class FileDescriptorStreams(object):
|
||||||
|
""" Platform agnostic abstraction enabling non-blocking I/O over a
|
||||||
|
collection of file descriptors. This abstraction is required because
|
||||||
|
fctnl(os.O_NONBLOCK) is not supported on Windows.
|
||||||
|
"""
|
||||||
|
@classmethod
|
||||||
|
def create(cls):
|
||||||
|
""" Factory method: instantiates the concrete class according to the
|
||||||
|
current platform.
|
||||||
|
"""
|
||||||
|
if isWindows():
|
||||||
|
return _FileDescriptorStreamsThreads()
|
||||||
|
else:
|
||||||
|
return _FileDescriptorStreamsNonBlocking()
|
||||||
|
|
||||||
|
def __init__(self):
|
||||||
|
self.streams = []
|
||||||
|
|
||||||
|
def add(self, fd, dest, std_name):
|
||||||
|
""" Wraps an existing file descriptor as a stream.
|
||||||
|
"""
|
||||||
|
self.streams.append(self._create_stream(fd, dest, std_name))
|
||||||
|
|
||||||
|
def remove(self, stream):
|
||||||
|
""" Removes a stream, when done with it.
|
||||||
|
"""
|
||||||
|
self.streams.remove(stream)
|
||||||
|
|
||||||
|
@property
|
||||||
|
def is_done(self):
|
||||||
|
""" Returns True when all streams have been processed.
|
||||||
|
"""
|
||||||
|
return len(self.streams) == 0
|
||||||
|
|
||||||
|
def select(self):
|
||||||
|
""" Returns the set of streams that have data available to read.
|
||||||
|
The returned streams each expose a read() and a close() method.
|
||||||
|
When done with a stream, call the remove(stream) method.
|
||||||
|
"""
|
||||||
|
raise NotImplementedError
|
||||||
|
|
||||||
|
def _create_stream(self, fd, dest, std_name):
|
||||||
|
""" Creates a new stream wrapping an existing file descriptor.
|
||||||
|
"""
|
||||||
|
raise NotImplementedError
|
||||||
|
|
||||||
|
|
||||||
|
class _FileDescriptorStreamsNonBlocking(FileDescriptorStreams):
|
||||||
|
""" Implementation of FileDescriptorStreams for platforms that support
|
||||||
|
non blocking I/O.
|
||||||
|
"""
|
||||||
|
class Stream(object):
|
||||||
|
""" Encapsulates a file descriptor """
|
||||||
|
def __init__(self, fd, dest, std_name):
|
||||||
|
self.fd = fd
|
||||||
|
self.dest = dest
|
||||||
|
self.std_name = std_name
|
||||||
|
self.set_non_blocking()
|
||||||
|
|
||||||
|
def set_non_blocking(self):
|
||||||
|
import fcntl
|
||||||
|
flags = fcntl.fcntl(self.fd, fcntl.F_GETFL)
|
||||||
|
fcntl.fcntl(self.fd, fcntl.F_SETFL, flags | os.O_NONBLOCK)
|
||||||
|
|
||||||
|
def fileno(self):
|
||||||
|
return self.fd.fileno()
|
||||||
|
|
||||||
|
def read(self):
|
||||||
|
return self.fd.read(4096)
|
||||||
|
|
||||||
|
def close(self):
|
||||||
|
self.fd.close()
|
||||||
|
|
||||||
|
def _create_stream(self, fd, dest, std_name):
|
||||||
|
return self.Stream(fd, dest, std_name)
|
||||||
|
|
||||||
|
def select(self):
|
||||||
|
ready_streams, _, _ = select.select(self.streams, [], [])
|
||||||
|
return ready_streams
|
||||||
|
|
||||||
|
|
||||||
|
class _FileDescriptorStreamsThreads(FileDescriptorStreams):
|
||||||
|
""" Implementation of FileDescriptorStreams for platforms that don't support
|
||||||
|
non blocking I/O. This implementation requires creating threads issuing
|
||||||
|
blocking read operations on file descriptors.
|
||||||
|
"""
|
||||||
|
def __init__(self):
|
||||||
|
super(_FileDescriptorStreamsThreads, self).__init__()
|
||||||
|
# The queue is shared accross all threads so we can simulate the
|
||||||
|
# behavior of the select() function
|
||||||
|
self.queue = Queue(10) # Limit incoming data from streams
|
||||||
|
|
||||||
|
def _create_stream(self, fd, dest, std_name):
|
||||||
|
return self.Stream(fd, dest, std_name, self.queue)
|
||||||
|
|
||||||
|
def select(self):
|
||||||
|
# Return only one stream at a time, as it is the most straighforward
|
||||||
|
# thing to do and it is compatible with the select() function.
|
||||||
|
item = self.queue.get()
|
||||||
|
stream = item.stream
|
||||||
|
stream.data = item.data
|
||||||
|
return [stream]
|
||||||
|
|
||||||
|
class QueueItem(object):
|
||||||
|
""" Item put in the shared queue """
|
||||||
|
def __init__(self, stream, data):
|
||||||
|
self.stream = stream
|
||||||
|
self.data = data
|
||||||
|
|
||||||
|
class Stream(object):
|
||||||
|
""" Encapsulates a file descriptor """
|
||||||
|
def __init__(self, fd, dest, std_name, queue):
|
||||||
|
self.fd = fd
|
||||||
|
self.dest = dest
|
||||||
|
self.std_name = std_name
|
||||||
|
self.queue = queue
|
||||||
|
self.data = None
|
||||||
|
self.thread = Thread(target=self.read_to_queue)
|
||||||
|
self.thread.daemon = True
|
||||||
|
self.thread.start()
|
||||||
|
|
||||||
|
def close(self):
|
||||||
|
self.fd.close()
|
||||||
|
|
||||||
|
def read(self):
|
||||||
|
data = self.data
|
||||||
|
self.data = None
|
||||||
|
return data
|
||||||
|
|
||||||
|
def read_to_queue(self):
|
||||||
|
""" The thread function: reads everything from the file descriptor into
|
||||||
|
the shared queue and terminates when reaching EOF.
|
||||||
|
"""
|
||||||
|
for line in iter(self.fd.readline, b''):
|
||||||
|
self.queue.put(_FileDescriptorStreamsThreads.QueueItem(self, line))
|
||||||
|
self.fd.close()
|
||||||
|
self.queue.put(_FileDescriptorStreamsThreads.QueueItem(self, None))
|
||||||
|
|
||||||
|
|
||||||
def symlink(source, link_name):
|
def symlink(source, link_name):
|
||||||
"""Creates a symbolic link pointing to source named link_name.
|
"""Creates a symbolic link pointing to source named link_name.
|
||||||
Note: On Windows, source must exist on disk, as the implementation needs
|
Note: On Windows, source must exist on disk, as the implementation needs
|
||||||
|
@ -1,3 +1,5 @@
|
|||||||
|
# -*- coding:utf-8 -*-
|
||||||
|
#
|
||||||
# Copyright (C) 2016 The Android Open Source Project
|
# Copyright (C) 2016 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
@ -14,13 +16,16 @@
|
|||||||
|
|
||||||
import errno
|
import errno
|
||||||
|
|
||||||
|
from pyversion import is_python3
|
||||||
from ctypes import WinDLL, get_last_error, FormatError, WinError, addressof
|
from ctypes import WinDLL, get_last_error, FormatError, WinError, addressof
|
||||||
from ctypes import c_buffer, c_ubyte, Structure, Union, byref
|
from ctypes import c_buffer
|
||||||
from ctypes.wintypes import BOOL, BOOLEAN, LPCWSTR, DWORD, HANDLE
|
from ctypes.wintypes import BOOL, BOOLEAN, LPCWSTR, DWORD, HANDLE, POINTER, c_ubyte
|
||||||
from ctypes.wintypes import WCHAR, USHORT, LPVOID, ULONG, LPDWORD
|
from ctypes.wintypes import WCHAR, USHORT, LPVOID, Structure, Union, ULONG
|
||||||
|
from ctypes.wintypes import byref
|
||||||
|
|
||||||
kernel32 = WinDLL('kernel32', use_last_error=True)
|
kernel32 = WinDLL('kernel32', use_last_error=True)
|
||||||
|
|
||||||
|
LPDWORD = POINTER(DWORD)
|
||||||
UCHAR = c_ubyte
|
UCHAR = c_ubyte
|
||||||
|
|
||||||
# Win32 error codes
|
# Win32 error codes
|
||||||
@ -142,8 +147,7 @@ def create_dirsymlink(source, link_name):
|
|||||||
|
|
||||||
|
|
||||||
def _create_symlink(source, link_name, dwFlags):
|
def _create_symlink(source, link_name, dwFlags):
|
||||||
if not CreateSymbolicLinkW(link_name, source,
|
if not CreateSymbolicLinkW(link_name, source, dwFlags | SYMBOLIC_LINK_FLAG_ALLOW_UNPRIVILEGED_CREATE):
|
||||||
dwFlags | SYMBOLIC_LINK_FLAG_ALLOW_UNPRIVILEGED_CREATE):
|
|
||||||
# See https://github.com/golang/go/pull/24307/files#diff-b87bc12e4da2497308f9ef746086e4f0
|
# See https://github.com/golang/go/pull/24307/files#diff-b87bc12e4da2497308f9ef746086e4f0
|
||||||
# "the unprivileged create flag is unsupported below Windows 10 (1703, v10.0.14972).
|
# "the unprivileged create flag is unsupported below Windows 10 (1703, v10.0.14972).
|
||||||
# retry without it."
|
# retry without it."
|
||||||
@ -194,15 +198,26 @@ def readlink(path):
|
|||||||
'Error reading symbolic link \"%s\"'.format(path))
|
'Error reading symbolic link \"%s\"'.format(path))
|
||||||
rdb = REPARSE_DATA_BUFFER.from_buffer(target_buffer)
|
rdb = REPARSE_DATA_BUFFER.from_buffer(target_buffer)
|
||||||
if rdb.ReparseTag == IO_REPARSE_TAG_SYMLINK:
|
if rdb.ReparseTag == IO_REPARSE_TAG_SYMLINK:
|
||||||
return rdb.SymbolicLinkReparseBuffer.PrintName
|
return _preserve_encoding(path, rdb.SymbolicLinkReparseBuffer.PrintName)
|
||||||
elif rdb.ReparseTag == IO_REPARSE_TAG_MOUNT_POINT:
|
elif rdb.ReparseTag == IO_REPARSE_TAG_MOUNT_POINT:
|
||||||
return rdb.MountPointReparseBuffer.PrintName
|
return _preserve_encoding(path, rdb.MountPointReparseBuffer.PrintName)
|
||||||
# Unsupported reparse point type
|
# Unsupported reparse point type
|
||||||
_raise_winerror(
|
_raise_winerror(
|
||||||
ERROR_NOT_SUPPORTED,
|
ERROR_NOT_SUPPORTED,
|
||||||
'Error reading symbolic link \"%s\"'.format(path))
|
'Error reading symbolic link \"%s\"'.format(path))
|
||||||
|
|
||||||
|
|
||||||
|
def _preserve_encoding(source, target):
|
||||||
|
"""Ensures target is the same string type (i.e. unicode or str) as source."""
|
||||||
|
|
||||||
|
if is_python3():
|
||||||
|
return target
|
||||||
|
|
||||||
|
if isinstance(source, unicode):
|
||||||
|
return unicode(target)
|
||||||
|
return str(target)
|
||||||
|
|
||||||
|
|
||||||
def _raise_winerror(code, error_desc):
|
def _raise_winerror(code, error_desc):
|
||||||
win_error_desc = FormatError(code).strip()
|
win_error_desc = FormatError(code).strip()
|
||||||
error_desc = "%s: %s".format(error_desc, win_error_desc)
|
error_desc = "%s: %s".format(error_desc, win_error_desc)
|
||||||
|
70
progress.py
70
progress.py
@ -1,3 +1,5 @@
|
|||||||
|
# -*- coding:utf-8 -*-
|
||||||
|
#
|
||||||
# Copyright (C) 2009 The Android Open Source Project
|
# Copyright (C) 2009 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
@ -24,53 +26,18 @@ _NOT_TTY = not os.isatty(2)
|
|||||||
# column 0.
|
# column 0.
|
||||||
CSI_ERASE_LINE = '\x1b[2K'
|
CSI_ERASE_LINE = '\x1b[2K'
|
||||||
|
|
||||||
|
|
||||||
def duration_str(total):
|
|
||||||
"""A less noisy timedelta.__str__.
|
|
||||||
|
|
||||||
The default timedelta stringification contains a lot of leading zeros and
|
|
||||||
uses microsecond resolution. This makes for noisy output.
|
|
||||||
"""
|
|
||||||
hours, rem = divmod(total, 3600)
|
|
||||||
mins, secs = divmod(rem, 60)
|
|
||||||
ret = '%.3fs' % (secs,)
|
|
||||||
if mins:
|
|
||||||
ret = '%im%s' % (mins, ret)
|
|
||||||
if hours:
|
|
||||||
ret = '%ih%s' % (hours, ret)
|
|
||||||
return ret
|
|
||||||
|
|
||||||
|
|
||||||
class Progress(object):
|
class Progress(object):
|
||||||
def __init__(self, title, total=0, units='', print_newline=False, delay=True,
|
def __init__(self, title, total=0, units='', print_newline=False,
|
||||||
quiet=False):
|
always_print_percentage=False):
|
||||||
self._title = title
|
self._title = title
|
||||||
self._total = total
|
self._total = total
|
||||||
self._done = 0
|
self._done = 0
|
||||||
|
self._lastp = -1
|
||||||
self._start = time()
|
self._start = time()
|
||||||
self._show = not delay
|
self._show = False
|
||||||
self._units = units
|
self._units = units
|
||||||
self._print_newline = print_newline
|
self._print_newline = print_newline
|
||||||
# Only show the active jobs section if we run more than one in parallel.
|
self._always_print_percentage = always_print_percentage
|
||||||
self._show_jobs = False
|
|
||||||
self._active = 0
|
|
||||||
|
|
||||||
# When quiet, never show any output. It's a bit hacky, but reusing the
|
|
||||||
# existing logic that delays initial output keeps the rest of the class
|
|
||||||
# clean. Basically we set the start time to years in the future.
|
|
||||||
if quiet:
|
|
||||||
self._show = False
|
|
||||||
self._start += 2**32
|
|
||||||
|
|
||||||
def start(self, name):
|
|
||||||
self._active += 1
|
|
||||||
if not self._show_jobs:
|
|
||||||
self._show_jobs = self._active > 1
|
|
||||||
self.update(inc=0, msg='started ' + name)
|
|
||||||
|
|
||||||
def finish(self, name):
|
|
||||||
self.update(msg='finished ' + name)
|
|
||||||
self._active -= 1
|
|
||||||
|
|
||||||
def update(self, inc=1, msg=''):
|
def update(self, inc=1, msg=''):
|
||||||
self._done += inc
|
self._done += inc
|
||||||
@ -92,40 +59,35 @@ class Progress(object):
|
|||||||
sys.stderr.flush()
|
sys.stderr.flush()
|
||||||
else:
|
else:
|
||||||
p = (100 * self._done) / self._total
|
p = (100 * self._done) / self._total
|
||||||
if self._show_jobs:
|
|
||||||
jobs = '[%d job%s] ' % (self._active, 's' if self._active > 1 else '')
|
if self._lastp != p or self._always_print_percentage:
|
||||||
else:
|
self._lastp = p
|
||||||
jobs = ''
|
sys.stderr.write('%s\r%s: %3d%% (%d%s/%d%s)%s%s%s' % (
|
||||||
sys.stderr.write('%s\r%s: %2d%% %s(%d%s/%d%s)%s%s%s' % (
|
|
||||||
CSI_ERASE_LINE,
|
CSI_ERASE_LINE,
|
||||||
self._title,
|
self._title,
|
||||||
p,
|
p,
|
||||||
jobs,
|
|
||||||
self._done, self._units,
|
self._done, self._units,
|
||||||
self._total, self._units,
|
self._total, self._units,
|
||||||
' ' if msg else '', msg,
|
' ' if msg else '', msg,
|
||||||
'\n' if self._print_newline else ''))
|
"\n" if self._print_newline else ""))
|
||||||
sys.stderr.flush()
|
sys.stderr.flush()
|
||||||
|
|
||||||
def end(self):
|
def end(self):
|
||||||
if _NOT_TTY or IsTrace() or not self._show:
|
if _NOT_TTY or IsTrace() or not self._show:
|
||||||
return
|
return
|
||||||
|
|
||||||
duration = duration_str(time() - self._start)
|
|
||||||
if self._total <= 0:
|
if self._total <= 0:
|
||||||
sys.stderr.write('%s\r%s: %d, done in %s\n' % (
|
sys.stderr.write('%s\r%s: %d, done.\n' % (
|
||||||
CSI_ERASE_LINE,
|
CSI_ERASE_LINE,
|
||||||
self._title,
|
self._title,
|
||||||
self._done,
|
self._done))
|
||||||
duration))
|
|
||||||
sys.stderr.flush()
|
sys.stderr.flush()
|
||||||
else:
|
else:
|
||||||
p = (100 * self._done) / self._total
|
p = (100 * self._done) / self._total
|
||||||
sys.stderr.write('%s\r%s: %3d%% (%d%s/%d%s), done in %s\n' % (
|
sys.stderr.write('%s\r%s: %3d%% (%d%s/%d%s), done.\n' % (
|
||||||
CSI_ERASE_LINE,
|
CSI_ERASE_LINE,
|
||||||
self._title,
|
self._title,
|
||||||
p,
|
p,
|
||||||
self._done, self._units,
|
self._done, self._units,
|
||||||
self._total, self._units,
|
self._total, self._units))
|
||||||
duration))
|
|
||||||
sys.stderr.flush()
|
sys.stderr.flush()
|
||||||
|
1239
project.py
1239
project.py
File diff suppressed because it is too large
Load Diff
20
pyversion.py
Normal file
20
pyversion.py
Normal file
@ -0,0 +1,20 @@
|
|||||||
|
# -*- coding:utf-8 -*-
|
||||||
|
#
|
||||||
|
# Copyright (C) 2013 The Android Open Source Project
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
|
import sys
|
||||||
|
|
||||||
|
def is_python3():
|
||||||
|
return sys.version_info[0] == 3
|
@ -1,2 +0,0 @@
|
|||||||
These are helper tools for managing official releases.
|
|
||||||
See the [release process](../docs/release-process.md) document for more details.
|
|
@ -1,114 +0,0 @@
|
|||||||
#!/usr/bin/env python3
|
|
||||||
# Copyright (C) 2020 The Android Open Source Project
|
|
||||||
#
|
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
|
||||||
# you may not use this file except in compliance with the License.
|
|
||||||
# You may obtain a copy of the License at
|
|
||||||
#
|
|
||||||
# http://www.apache.org/licenses/LICENSE-2.0
|
|
||||||
#
|
|
||||||
# Unless required by applicable law or agreed to in writing, software
|
|
||||||
# distributed under the License is distributed on an "AS IS" BASIS,
|
|
||||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
|
||||||
# See the License for the specific language governing permissions and
|
|
||||||
# limitations under the License.
|
|
||||||
|
|
||||||
"""Helper tool for signing repo launcher scripts correctly.
|
|
||||||
|
|
||||||
This is intended to be run only by the official Repo release managers.
|
|
||||||
"""
|
|
||||||
|
|
||||||
import argparse
|
|
||||||
import os
|
|
||||||
import subprocess
|
|
||||||
import sys
|
|
||||||
|
|
||||||
import util
|
|
||||||
|
|
||||||
|
|
||||||
def sign(opts):
|
|
||||||
"""Sign the launcher!"""
|
|
||||||
output = ''
|
|
||||||
for key in opts.keys:
|
|
||||||
# We use ! at the end of the key so that gpg uses this specific key.
|
|
||||||
# Otherwise it uses the key as a lookup into the overall key and uses the
|
|
||||||
# default signing key. i.e. It will see that KEYID_RSA is a subkey of
|
|
||||||
# another key, and use the primary key to sign instead of the subkey.
|
|
||||||
cmd = ['gpg', '--homedir', opts.gpgdir, '-u', f'{key}!', '--batch', '--yes',
|
|
||||||
'--armor', '--detach-sign', '--output', '-', opts.launcher]
|
|
||||||
ret = util.run(opts, cmd, encoding='utf-8', stdout=subprocess.PIPE)
|
|
||||||
output += ret.stdout
|
|
||||||
|
|
||||||
# Save the combined signatures into one file.
|
|
||||||
with open(f'{opts.launcher}.asc', 'w', encoding='utf-8') as fp:
|
|
||||||
fp.write(output)
|
|
||||||
|
|
||||||
|
|
||||||
def check(opts):
|
|
||||||
"""Check the signature."""
|
|
||||||
util.run(opts, ['gpg', '--verify', f'{opts.launcher}.asc'])
|
|
||||||
|
|
||||||
|
|
||||||
def postmsg(opts):
|
|
||||||
"""Helpful info to show at the end for release manager."""
|
|
||||||
print(f"""
|
|
||||||
Repo launcher bucket:
|
|
||||||
gs://git-repo-downloads/
|
|
||||||
|
|
||||||
To upload this launcher directly:
|
|
||||||
gsutil cp -a public-read {opts.launcher} {opts.launcher}.asc gs://git-repo-downloads/
|
|
||||||
|
|
||||||
NB: You probably want to upload it with a specific version first, e.g.:
|
|
||||||
gsutil cp -a public-read {opts.launcher} gs://git-repo-downloads/repo-3.0
|
|
||||||
gsutil cp -a public-read {opts.launcher}.asc gs://git-repo-downloads/repo-3.0.asc
|
|
||||||
""")
|
|
||||||
|
|
||||||
|
|
||||||
def get_parser():
|
|
||||||
"""Get a CLI parser."""
|
|
||||||
parser = argparse.ArgumentParser(description=__doc__)
|
|
||||||
parser.add_argument('-n', '--dry-run',
|
|
||||||
dest='dryrun', action='store_true',
|
|
||||||
help='show everything that would be done')
|
|
||||||
parser.add_argument('--gpgdir',
|
|
||||||
default=os.path.join(util.HOMEDIR, '.gnupg', 'repo'),
|
|
||||||
help='path to dedicated gpg dir with release keys '
|
|
||||||
'(default: ~/.gnupg/repo/)')
|
|
||||||
parser.add_argument('--keyid', dest='keys', default=[], action='append',
|
|
||||||
help='alternative signing keys to use')
|
|
||||||
parser.add_argument('launcher',
|
|
||||||
default=os.path.join(util.TOPDIR, 'repo'), nargs='?',
|
|
||||||
help='the launcher script to sign')
|
|
||||||
return parser
|
|
||||||
|
|
||||||
|
|
||||||
def main(argv):
|
|
||||||
"""The main func!"""
|
|
||||||
parser = get_parser()
|
|
||||||
opts = parser.parse_args(argv)
|
|
||||||
|
|
||||||
if not os.path.exists(opts.gpgdir):
|
|
||||||
parser.error(f'--gpgdir does not exist: {opts.gpgdir}')
|
|
||||||
if not os.path.exists(opts.launcher):
|
|
||||||
parser.error(f'launcher does not exist: {opts.launcher}')
|
|
||||||
|
|
||||||
opts.launcher = os.path.relpath(opts.launcher)
|
|
||||||
print(f'Signing "{opts.launcher}" launcher script and saving to '
|
|
||||||
f'"{opts.launcher}.asc"')
|
|
||||||
|
|
||||||
if opts.keys:
|
|
||||||
print(f'Using custom keys to sign: {" ".join(opts.keys)}')
|
|
||||||
else:
|
|
||||||
print('Using official Repo release keys to sign')
|
|
||||||
opts.keys = [util.KEYID_DSA, util.KEYID_RSA, util.KEYID_ECC]
|
|
||||||
util.import_release_key(opts)
|
|
||||||
|
|
||||||
sign(opts)
|
|
||||||
check(opts)
|
|
||||||
postmsg(opts)
|
|
||||||
|
|
||||||
return 0
|
|
||||||
|
|
||||||
|
|
||||||
if __name__ == '__main__':
|
|
||||||
sys.exit(main(sys.argv[1:]))
|
|
@ -1,140 +0,0 @@
|
|||||||
#!/usr/bin/env python3
|
|
||||||
# Copyright (C) 2020 The Android Open Source Project
|
|
||||||
#
|
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
|
||||||
# you may not use this file except in compliance with the License.
|
|
||||||
# You may obtain a copy of the License at
|
|
||||||
#
|
|
||||||
# http://www.apache.org/licenses/LICENSE-2.0
|
|
||||||
#
|
|
||||||
# Unless required by applicable law or agreed to in writing, software
|
|
||||||
# distributed under the License is distributed on an "AS IS" BASIS,
|
|
||||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
|
||||||
# See the License for the specific language governing permissions and
|
|
||||||
# limitations under the License.
|
|
||||||
|
|
||||||
"""Helper tool for signing repo release tags correctly.
|
|
||||||
|
|
||||||
This is intended to be run only by the official Repo release managers, but it
|
|
||||||
could be run by people maintaining their own fork of the project.
|
|
||||||
|
|
||||||
NB: Check docs/release-process.md for production freeze information.
|
|
||||||
"""
|
|
||||||
|
|
||||||
import argparse
|
|
||||||
import os
|
|
||||||
import re
|
|
||||||
import subprocess
|
|
||||||
import sys
|
|
||||||
|
|
||||||
import util
|
|
||||||
|
|
||||||
|
|
||||||
# We currently sign with the old DSA key as it's been around the longest.
|
|
||||||
# We should transition to RSA by Jun 2020, and ECC by Jun 2021.
|
|
||||||
KEYID = util.KEYID_DSA
|
|
||||||
|
|
||||||
# Regular expression to validate tag names.
|
|
||||||
RE_VALID_TAG = r'^v([0-9]+[.])+[0-9]+$'
|
|
||||||
|
|
||||||
|
|
||||||
def sign(opts):
|
|
||||||
"""Tag the commit & sign it!"""
|
|
||||||
# We use ! at the end of the key so that gpg uses this specific key.
|
|
||||||
# Otherwise it uses the key as a lookup into the overall key and uses the
|
|
||||||
# default signing key. i.e. It will see that KEYID_RSA is a subkey of
|
|
||||||
# another key, and use the primary key to sign instead of the subkey.
|
|
||||||
cmd = ['git', 'tag', '-s', opts.tag, '-u', f'{opts.key}!',
|
|
||||||
'-m', f'repo {opts.tag}', opts.commit]
|
|
||||||
|
|
||||||
key = 'GNUPGHOME'
|
|
||||||
print('+', f'export {key}="{opts.gpgdir}"')
|
|
||||||
oldvalue = os.getenv(key)
|
|
||||||
os.putenv(key, opts.gpgdir)
|
|
||||||
util.run(opts, cmd)
|
|
||||||
if oldvalue is None:
|
|
||||||
os.unsetenv(key)
|
|
||||||
else:
|
|
||||||
os.putenv(key, oldvalue)
|
|
||||||
|
|
||||||
|
|
||||||
def check(opts):
|
|
||||||
"""Check the signature."""
|
|
||||||
util.run(opts, ['git', 'tag', '--verify', opts.tag])
|
|
||||||
|
|
||||||
|
|
||||||
def postmsg(opts):
|
|
||||||
"""Helpful info to show at the end for release manager."""
|
|
||||||
cmd = ['git', 'rev-parse', 'remotes/origin/stable']
|
|
||||||
ret = util.run(opts, cmd, encoding='utf-8', stdout=subprocess.PIPE)
|
|
||||||
current_release = ret.stdout.strip()
|
|
||||||
|
|
||||||
cmd = ['git', 'log', '--format=%h (%aN) %s', '--no-merges',
|
|
||||||
f'remotes/origin/stable..{opts.tag}']
|
|
||||||
ret = util.run(opts, cmd, encoding='utf-8', stdout=subprocess.PIPE)
|
|
||||||
shortlog = ret.stdout.strip()
|
|
||||||
|
|
||||||
print(f"""
|
|
||||||
Here's the short log since the last release.
|
|
||||||
{shortlog}
|
|
||||||
|
|
||||||
To push release to the public:
|
|
||||||
git push origin {opts.commit}:stable {opts.tag} -n
|
|
||||||
NB: People will start upgrading to this version immediately.
|
|
||||||
|
|
||||||
To roll back a release:
|
|
||||||
git push origin --force {current_release}:stable -n
|
|
||||||
""")
|
|
||||||
|
|
||||||
|
|
||||||
def get_parser():
|
|
||||||
"""Get a CLI parser."""
|
|
||||||
parser = argparse.ArgumentParser(
|
|
||||||
description=__doc__,
|
|
||||||
formatter_class=argparse.RawDescriptionHelpFormatter)
|
|
||||||
parser.add_argument('-n', '--dry-run',
|
|
||||||
dest='dryrun', action='store_true',
|
|
||||||
help='show everything that would be done')
|
|
||||||
parser.add_argument('--gpgdir',
|
|
||||||
default=os.path.join(util.HOMEDIR, '.gnupg', 'repo'),
|
|
||||||
help='path to dedicated gpg dir with release keys '
|
|
||||||
'(default: ~/.gnupg/repo/)')
|
|
||||||
parser.add_argument('-f', '--force', action='store_true',
|
|
||||||
help='force signing of any tag')
|
|
||||||
parser.add_argument('--keyid', dest='key',
|
|
||||||
help='alternative signing key to use')
|
|
||||||
parser.add_argument('tag',
|
|
||||||
help='the tag to create (e.g. "v2.0")')
|
|
||||||
parser.add_argument('commit', default='HEAD', nargs='?',
|
|
||||||
help='the commit to tag')
|
|
||||||
return parser
|
|
||||||
|
|
||||||
|
|
||||||
def main(argv):
|
|
||||||
"""The main func!"""
|
|
||||||
parser = get_parser()
|
|
||||||
opts = parser.parse_args(argv)
|
|
||||||
|
|
||||||
if not os.path.exists(opts.gpgdir):
|
|
||||||
parser.error(f'--gpgdir does not exist: {opts.gpgdir}')
|
|
||||||
|
|
||||||
if not opts.force and not re.match(RE_VALID_TAG, opts.tag):
|
|
||||||
parser.error(f'tag "{opts.tag}" does not match regex "{RE_VALID_TAG}"; '
|
|
||||||
'use --force to sign anyways')
|
|
||||||
|
|
||||||
if opts.key:
|
|
||||||
print(f'Using custom key to sign: {opts.key}')
|
|
||||||
else:
|
|
||||||
print('Using official Repo release key to sign')
|
|
||||||
opts.key = KEYID
|
|
||||||
util.import_release_key(opts)
|
|
||||||
|
|
||||||
sign(opts)
|
|
||||||
check(opts)
|
|
||||||
postmsg(opts)
|
|
||||||
|
|
||||||
return 0
|
|
||||||
|
|
||||||
|
|
||||||
if __name__ == '__main__':
|
|
||||||
sys.exit(main(sys.argv[1:]))
|
|
@ -1,73 +0,0 @@
|
|||||||
# Copyright (C) 2020 The Android Open Source Project
|
|
||||||
#
|
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
|
||||||
# you may not use this file except in compliance with the License.
|
|
||||||
# You may obtain a copy of the License at
|
|
||||||
#
|
|
||||||
# http://www.apache.org/licenses/LICENSE-2.0
|
|
||||||
#
|
|
||||||
# Unless required by applicable law or agreed to in writing, software
|
|
||||||
# distributed under the License is distributed on an "AS IS" BASIS,
|
|
||||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
|
||||||
# See the License for the specific language governing permissions and
|
|
||||||
# limitations under the License.
|
|
||||||
|
|
||||||
"""Random utility code for release tools."""
|
|
||||||
|
|
||||||
import os
|
|
||||||
import re
|
|
||||||
import subprocess
|
|
||||||
import sys
|
|
||||||
|
|
||||||
|
|
||||||
assert sys.version_info >= (3, 6), 'This module requires Python 3.6+'
|
|
||||||
|
|
||||||
|
|
||||||
TOPDIR = os.path.dirname(os.path.dirname(os.path.abspath(__file__)))
|
|
||||||
HOMEDIR = os.path.expanduser('~')
|
|
||||||
|
|
||||||
|
|
||||||
# These are the release keys we sign with.
|
|
||||||
KEYID_DSA = '8BB9AD793E8E6153AF0F9A4416530D5E920F5C65'
|
|
||||||
KEYID_RSA = 'A34A13BE8E76BFF46A0C022DA2E75A824AAB9624'
|
|
||||||
KEYID_ECC = 'E1F9040D7A3F6DAFAC897CD3D3B95DA243E48A39'
|
|
||||||
|
|
||||||
|
|
||||||
def cmdstr(cmd):
|
|
||||||
"""Get a nicely quoted shell command."""
|
|
||||||
ret = []
|
|
||||||
for arg in cmd:
|
|
||||||
if not re.match(r'^[a-zA-Z0-9/_.=-]+$', arg):
|
|
||||||
arg = f'"{arg}"'
|
|
||||||
ret.append(arg)
|
|
||||||
return ' '.join(ret)
|
|
||||||
|
|
||||||
|
|
||||||
def run(opts, cmd, check=True, **kwargs):
|
|
||||||
"""Helper around subprocess.run to include logging."""
|
|
||||||
print('+', cmdstr(cmd))
|
|
||||||
if opts.dryrun:
|
|
||||||
cmd = ['true', '--'] + cmd
|
|
||||||
try:
|
|
||||||
return subprocess.run(cmd, check=check, **kwargs)
|
|
||||||
except subprocess.CalledProcessError as e:
|
|
||||||
print(f'aborting: {e}', file=sys.stderr)
|
|
||||||
sys.exit(1)
|
|
||||||
|
|
||||||
|
|
||||||
def import_release_key(opts):
|
|
||||||
"""Import the public key of the official release repo signing key."""
|
|
||||||
# Extract the key from our repo launcher.
|
|
||||||
launcher = getattr(opts, 'launcher', os.path.join(TOPDIR, 'repo'))
|
|
||||||
print(f'Importing keys from "{launcher}" launcher script')
|
|
||||||
with open(launcher, encoding='utf-8') as fp:
|
|
||||||
data = fp.read()
|
|
||||||
|
|
||||||
keys = re.findall(
|
|
||||||
r'\n-----BEGIN PGP PUBLIC KEY BLOCK-----\n[^-]*'
|
|
||||||
r'\n-----END PGP PUBLIC KEY BLOCK-----\n', data, flags=re.M)
|
|
||||||
run(opts, ['gpg', '--import'], input='\n'.join(keys).encode('utf-8'))
|
|
||||||
|
|
||||||
print('Marking keys as fully trusted')
|
|
||||||
run(opts, ['gpg', '--import-ownertrust'],
|
|
||||||
input=f'{KEYID_DSA}:6:\n'.encode('utf-8'))
|
|
@ -1,3 +1,5 @@
|
|||||||
|
# -*- coding:utf-8 -*-
|
||||||
|
#
|
||||||
# Copyright (C) 2008 The Android Open Source Project
|
# Copyright (C) 2008 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
@ -17,6 +19,7 @@
|
|||||||
Activated via `repo --trace ...` or `REPO_TRACE=1 repo ...`.
|
Activated via `repo --trace ...` or `REPO_TRACE=1 repo ...`.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
|
from __future__ import print_function
|
||||||
import sys
|
import sys
|
||||||
import os
|
import os
|
||||||
|
|
||||||
@ -25,16 +28,13 @@ REPO_TRACE = 'REPO_TRACE'
|
|||||||
|
|
||||||
_TRACE = os.environ.get(REPO_TRACE) == '1'
|
_TRACE = os.environ.get(REPO_TRACE) == '1'
|
||||||
|
|
||||||
|
|
||||||
def IsTrace():
|
def IsTrace():
|
||||||
return _TRACE
|
return _TRACE
|
||||||
|
|
||||||
|
|
||||||
def SetTrace():
|
def SetTrace():
|
||||||
global _TRACE
|
global _TRACE
|
||||||
_TRACE = True
|
_TRACE = True
|
||||||
|
|
||||||
|
|
||||||
def Trace(fmt, *args):
|
def Trace(fmt, *args):
|
||||||
if IsTrace():
|
if IsTrace():
|
||||||
print(fmt % args, file=sys.stderr)
|
print(fmt % args, file=sys.stderr)
|
||||||
|
@ -1,57 +0,0 @@
|
|||||||
# This file declares various requirements for this version of repo. The
|
|
||||||
# launcher script will load it and check the constraints before trying to run
|
|
||||||
# us. This avoids issues of the launcher using an old version of Python (e.g.
|
|
||||||
# 3.5) while the codebase has moved on to requiring something much newer (e.g.
|
|
||||||
# 3.8). If the launcher tried to import us, it would fail with syntax errors.
|
|
||||||
|
|
||||||
# This is a JSON file with line-level comments allowed.
|
|
||||||
|
|
||||||
# Always keep backwards compatibility in mine. The launcher script is robust
|
|
||||||
# against missing values, but when a field is renamed/removed, it means older
|
|
||||||
# versions of the launcher script won't be able to enforce the constraint.
|
|
||||||
|
|
||||||
# When requiring versions, always use lists as they are easy to parse & compare
|
|
||||||
# in Python. Strings would require futher processing to turn into a list.
|
|
||||||
|
|
||||||
# Version constraints should be expressed in pairs: soft & hard. Soft versions
|
|
||||||
# are when we start warning users that their software too old and we're planning
|
|
||||||
# on dropping support for it, so they need to start planning system upgrades.
|
|
||||||
# Hard versions are when we refuse to work the tool. Users will be shown an
|
|
||||||
# error message before we abort entirely.
|
|
||||||
|
|
||||||
# When deciding whether to upgrade a version requirement, check out the distro
|
|
||||||
# lists to see who will be impacted:
|
|
||||||
# https://gerrit.googlesource.com/git-repo/+/HEAD/docs/release-process.md#Project-References
|
|
||||||
|
|
||||||
{
|
|
||||||
# The repo launcher itself. This allows us to force people to upgrade as some
|
|
||||||
# ignore the warnings about it being out of date, or install ancient versions
|
|
||||||
# to start with for whatever reason.
|
|
||||||
#
|
|
||||||
# NB: Repo launchers started checking this file with repo-2.12, so listing
|
|
||||||
# versions older than that won't make a difference.
|
|
||||||
"repo": {
|
|
||||||
"hard": [2, 11],
|
|
||||||
"soft": [2, 11]
|
|
||||||
},
|
|
||||||
|
|
||||||
# Supported Python versions.
|
|
||||||
#
|
|
||||||
# python-3.6 is in Ubuntu Bionic.
|
|
||||||
# python-3.5 is in Debian Stretch.
|
|
||||||
"python": {
|
|
||||||
"hard": [3, 5],
|
|
||||||
"soft": [3, 6]
|
|
||||||
},
|
|
||||||
|
|
||||||
# Supported git versions.
|
|
||||||
#
|
|
||||||
# git-1.7.2 is in Debian Squeeze.
|
|
||||||
# git-1.7.9 is in Ubuntu Precise.
|
|
||||||
# git-1.9.1 is in Ubuntu Trusty.
|
|
||||||
# git-1.7.10 is in Debian Wheezy.
|
|
||||||
"git": {
|
|
||||||
"hard": [1, 7, 2],
|
|
||||||
"soft": [1, 9, 1]
|
|
||||||
}
|
|
||||||
}
|
|
44
run_tests
44
run_tests
@ -1,4 +1,5 @@
|
|||||||
#!/usr/bin/env python3
|
#!/usr/bin/env python
|
||||||
|
# -*- coding:utf-8 -*-
|
||||||
# Copyright 2019 The Android Open Source Project
|
# Copyright 2019 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
@ -15,42 +16,37 @@
|
|||||||
|
|
||||||
"""Wrapper to run pytest with the right settings."""
|
"""Wrapper to run pytest with the right settings."""
|
||||||
|
|
||||||
|
from __future__ import print_function
|
||||||
|
|
||||||
import errno
|
import errno
|
||||||
import os
|
import os
|
||||||
import shutil
|
|
||||||
import subprocess
|
import subprocess
|
||||||
import sys
|
import sys
|
||||||
|
|
||||||
|
|
||||||
def find_pytest():
|
def run_pytest(cmd, argv):
|
||||||
"""Try to locate a good version of pytest."""
|
"""Run the unittests via |cmd|."""
|
||||||
# Use the Python 3 version if available.
|
try:
|
||||||
ret = shutil.which('pytest-3')
|
return subprocess.call([cmd] + argv)
|
||||||
if ret:
|
except OSError as e:
|
||||||
return ret
|
if e.errno == errno.ENOENT:
|
||||||
|
print('%s: unable to run `%s`: %s' % (__file__, cmd, e), file=sys.stderr)
|
||||||
# Hopefully this is a Python 3 version.
|
print('%s: Try installing pytest: sudo apt-get install python-pytest' %
|
||||||
ret = shutil.which('pytest')
|
(__file__,), file=sys.stderr)
|
||||||
if ret:
|
return 127
|
||||||
return ret
|
else:
|
||||||
|
raise
|
||||||
print('%s: unable to find pytest.' % (__file__,), file=sys.stderr)
|
|
||||||
print('%s: Try installing: sudo apt-get install python-pytest' % (__file__,),
|
|
||||||
file=sys.stderr)
|
|
||||||
|
|
||||||
|
|
||||||
def main(argv):
|
def main(argv):
|
||||||
"""The main entry."""
|
"""The main entry."""
|
||||||
# Add the repo tree to PYTHONPATH as the tests expect to be able to import
|
# Add the repo tree to PYTHONPATH as the tests expect to be able to import
|
||||||
# modules directly.
|
# modules directly.
|
||||||
pythonpath = os.path.dirname(os.path.realpath(__file__))
|
topdir = os.path.dirname(os.path.realpath(__file__))
|
||||||
oldpythonpath = os.environ.get('PYTHONPATH', None)
|
pythonpath = os.environ.get('PYTHONPATH', '')
|
||||||
if oldpythonpath is not None:
|
os.environ['PYTHONPATH'] = '%s:%s' % (topdir, pythonpath)
|
||||||
pythonpath += os.pathsep + oldpythonpath
|
|
||||||
os.environ['PYTHONPATH'] = pythonpath
|
|
||||||
|
|
||||||
pytest = find_pytest()
|
return run_pytest('pytest', argv)
|
||||||
return subprocess.run([pytest] + argv, check=False).returncode
|
|
||||||
|
|
||||||
|
|
||||||
if __name__ == '__main__':
|
if __name__ == '__main__':
|
||||||
|
12
setup.py
12
setup.py
@ -1,4 +1,5 @@
|
|||||||
#!/usr/bin/env python3
|
#!/usr/bin/env python
|
||||||
|
# -*- coding:utf-8 -*-
|
||||||
# Copyright 2019 The Android Open Source Project
|
# Copyright 2019 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the 'License");
|
# Licensed under the Apache License, Version 2.0 (the 'License");
|
||||||
@ -15,6 +16,8 @@
|
|||||||
|
|
||||||
"""Python packaging for repo."""
|
"""Python packaging for repo."""
|
||||||
|
|
||||||
|
from __future__ import print_function
|
||||||
|
|
||||||
import os
|
import os
|
||||||
import setuptools
|
import setuptools
|
||||||
|
|
||||||
@ -32,7 +35,7 @@ with open(os.path.join(TOPDIR, 'README.md')) as fp:
|
|||||||
# https://packaging.python.org/tutorials/packaging-projects/
|
# https://packaging.python.org/tutorials/packaging-projects/
|
||||||
setuptools.setup(
|
setuptools.setup(
|
||||||
name='repo',
|
name='repo',
|
||||||
version='2',
|
version='1.13.8',
|
||||||
maintainer='Various',
|
maintainer='Various',
|
||||||
maintainer_email='repo-discuss@googlegroups.com',
|
maintainer_email='repo-discuss@googlegroups.com',
|
||||||
description='Repo helps manage many Git repositories',
|
description='Repo helps manage many Git repositories',
|
||||||
@ -52,10 +55,9 @@ setuptools.setup(
|
|||||||
'Operating System :: MacOS :: MacOS X',
|
'Operating System :: MacOS :: MacOS X',
|
||||||
'Operating System :: Microsoft :: Windows :: Windows 10',
|
'Operating System :: Microsoft :: Windows :: Windows 10',
|
||||||
'Operating System :: POSIX :: Linux',
|
'Operating System :: POSIX :: Linux',
|
||||||
'Programming Language :: Python :: 3',
|
|
||||||
'Programming Language :: Python :: 3 :: Only',
|
|
||||||
'Topic :: Software Development :: Version Control :: Git',
|
'Topic :: Software Development :: Version Control :: Git',
|
||||||
],
|
],
|
||||||
python_requires='>=3.5',
|
# We support Python 2.7 and Python 3.6+.
|
||||||
|
python_requires='>=2.7, ' + ', '.join('!=3.%i.*' % x for x in range(0, 6)),
|
||||||
packages=['subcmds'],
|
packages=['subcmds'],
|
||||||
)
|
)
|
||||||
|
277
ssh.py
277
ssh.py
@ -1,277 +0,0 @@
|
|||||||
# Copyright (C) 2008 The Android Open Source Project
|
|
||||||
#
|
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
|
||||||
# you may not use this file except in compliance with the License.
|
|
||||||
# You may obtain a copy of the License at
|
|
||||||
#
|
|
||||||
# http://www.apache.org/licenses/LICENSE-2.0
|
|
||||||
#
|
|
||||||
# Unless required by applicable law or agreed to in writing, software
|
|
||||||
# distributed under the License is distributed on an "AS IS" BASIS,
|
|
||||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
|
||||||
# See the License for the specific language governing permissions and
|
|
||||||
# limitations under the License.
|
|
||||||
|
|
||||||
"""Common SSH management logic."""
|
|
||||||
|
|
||||||
import functools
|
|
||||||
import multiprocessing
|
|
||||||
import os
|
|
||||||
import re
|
|
||||||
import signal
|
|
||||||
import subprocess
|
|
||||||
import sys
|
|
||||||
import tempfile
|
|
||||||
import time
|
|
||||||
|
|
||||||
import platform_utils
|
|
||||||
from repo_trace import Trace
|
|
||||||
|
|
||||||
|
|
||||||
PROXY_PATH = os.path.join(os.path.dirname(__file__), 'git_ssh')
|
|
||||||
|
|
||||||
|
|
||||||
def _run_ssh_version():
|
|
||||||
"""run ssh -V to display the version number"""
|
|
||||||
return subprocess.check_output(['ssh', '-V'], stderr=subprocess.STDOUT).decode()
|
|
||||||
|
|
||||||
|
|
||||||
def _parse_ssh_version(ver_str=None):
|
|
||||||
"""parse a ssh version string into a tuple"""
|
|
||||||
if ver_str is None:
|
|
||||||
ver_str = _run_ssh_version()
|
|
||||||
m = re.match(r'^OpenSSH_([0-9.]+)(p[0-9]+)?\s', ver_str)
|
|
||||||
if m:
|
|
||||||
return tuple(int(x) for x in m.group(1).split('.'))
|
|
||||||
else:
|
|
||||||
return ()
|
|
||||||
|
|
||||||
|
|
||||||
@functools.lru_cache(maxsize=None)
|
|
||||||
def version():
|
|
||||||
"""return ssh version as a tuple"""
|
|
||||||
try:
|
|
||||||
return _parse_ssh_version()
|
|
||||||
except subprocess.CalledProcessError:
|
|
||||||
print('fatal: unable to detect ssh version', file=sys.stderr)
|
|
||||||
sys.exit(1)
|
|
||||||
|
|
||||||
|
|
||||||
URI_SCP = re.compile(r'^([^@:]*@?[^:/]{1,}):')
|
|
||||||
URI_ALL = re.compile(r'^([a-z][a-z+-]*)://([^@/]*@?[^/]*)/')
|
|
||||||
|
|
||||||
|
|
||||||
class ProxyManager:
|
|
||||||
"""Manage various ssh clients & masters that we spawn.
|
|
||||||
|
|
||||||
This will take care of sharing state between multiprocessing children, and
|
|
||||||
make sure that if we crash, we don't leak any of the ssh sessions.
|
|
||||||
|
|
||||||
The code should work with a single-process scenario too, and not add too much
|
|
||||||
overhead due to the manager.
|
|
||||||
"""
|
|
||||||
|
|
||||||
# Path to the ssh program to run which will pass our master settings along.
|
|
||||||
# Set here more as a convenience API.
|
|
||||||
proxy = PROXY_PATH
|
|
||||||
|
|
||||||
def __init__(self, manager):
|
|
||||||
# Protect access to the list of active masters.
|
|
||||||
self._lock = multiprocessing.Lock()
|
|
||||||
# List of active masters (pid). These will be spawned on demand, and we are
|
|
||||||
# responsible for shutting them all down at the end.
|
|
||||||
self._masters = manager.list()
|
|
||||||
# Set of active masters indexed by "host:port" information.
|
|
||||||
# The value isn't used, but multiprocessing doesn't provide a set class.
|
|
||||||
self._master_keys = manager.dict()
|
|
||||||
# Whether ssh masters are known to be broken, so we give up entirely.
|
|
||||||
self._master_broken = manager.Value('b', False)
|
|
||||||
# List of active ssh sesssions. Clients will be added & removed as
|
|
||||||
# connections finish, so this list is just for safety & cleanup if we crash.
|
|
||||||
self._clients = manager.list()
|
|
||||||
# Path to directory for holding master sockets.
|
|
||||||
self._sock_path = None
|
|
||||||
|
|
||||||
def __enter__(self):
|
|
||||||
"""Enter a new context."""
|
|
||||||
return self
|
|
||||||
|
|
||||||
def __exit__(self, exc_type, exc_value, traceback):
|
|
||||||
"""Exit a context & clean up all resources."""
|
|
||||||
self.close()
|
|
||||||
|
|
||||||
def add_client(self, proc):
|
|
||||||
"""Track a new ssh session."""
|
|
||||||
self._clients.append(proc.pid)
|
|
||||||
|
|
||||||
def remove_client(self, proc):
|
|
||||||
"""Remove a completed ssh session."""
|
|
||||||
try:
|
|
||||||
self._clients.remove(proc.pid)
|
|
||||||
except ValueError:
|
|
||||||
pass
|
|
||||||
|
|
||||||
def add_master(self, proc):
|
|
||||||
"""Track a new master connection."""
|
|
||||||
self._masters.append(proc.pid)
|
|
||||||
|
|
||||||
def _terminate(self, procs):
|
|
||||||
"""Kill all |procs|."""
|
|
||||||
for pid in procs:
|
|
||||||
try:
|
|
||||||
os.kill(pid, signal.SIGTERM)
|
|
||||||
os.waitpid(pid, 0)
|
|
||||||
except OSError:
|
|
||||||
pass
|
|
||||||
|
|
||||||
# The multiprocessing.list() API doesn't provide many standard list()
|
|
||||||
# methods, so we have to manually clear the list.
|
|
||||||
while True:
|
|
||||||
try:
|
|
||||||
procs.pop(0)
|
|
||||||
except:
|
|
||||||
break
|
|
||||||
|
|
||||||
def close(self):
|
|
||||||
"""Close this active ssh session.
|
|
||||||
|
|
||||||
Kill all ssh clients & masters we created, and nuke the socket dir.
|
|
||||||
"""
|
|
||||||
self._terminate(self._clients)
|
|
||||||
self._terminate(self._masters)
|
|
||||||
|
|
||||||
d = self.sock(create=False)
|
|
||||||
if d:
|
|
||||||
try:
|
|
||||||
platform_utils.rmdir(os.path.dirname(d))
|
|
||||||
except OSError:
|
|
||||||
pass
|
|
||||||
|
|
||||||
def _open_unlocked(self, host, port=None):
|
|
||||||
"""Make sure a ssh master session exists for |host| & |port|.
|
|
||||||
|
|
||||||
If one doesn't exist already, we'll create it.
|
|
||||||
|
|
||||||
We won't grab any locks, so the caller has to do that. This helps keep the
|
|
||||||
business logic of actually creating the master separate from grabbing locks.
|
|
||||||
"""
|
|
||||||
# Check to see whether we already think that the master is running; if we
|
|
||||||
# think it's already running, return right away.
|
|
||||||
if port is not None:
|
|
||||||
key = '%s:%s' % (host, port)
|
|
||||||
else:
|
|
||||||
key = host
|
|
||||||
|
|
||||||
if key in self._master_keys:
|
|
||||||
return True
|
|
||||||
|
|
||||||
if self._master_broken.value or 'GIT_SSH' in os.environ:
|
|
||||||
# Failed earlier, so don't retry.
|
|
||||||
return False
|
|
||||||
|
|
||||||
# We will make two calls to ssh; this is the common part of both calls.
|
|
||||||
command_base = ['ssh', '-o', 'ControlPath %s' % self.sock(), host]
|
|
||||||
if port is not None:
|
|
||||||
command_base[1:1] = ['-p', str(port)]
|
|
||||||
|
|
||||||
# Since the key wasn't in _master_keys, we think that master isn't running.
|
|
||||||
# ...but before actually starting a master, we'll double-check. This can
|
|
||||||
# be important because we can't tell that that 'git@myhost.com' is the same
|
|
||||||
# as 'myhost.com' where "User git" is setup in the user's ~/.ssh/config file.
|
|
||||||
check_command = command_base + ['-O', 'check']
|
|
||||||
try:
|
|
||||||
Trace(': %s', ' '.join(check_command))
|
|
||||||
check_process = subprocess.Popen(check_command,
|
|
||||||
stdout=subprocess.PIPE,
|
|
||||||
stderr=subprocess.PIPE)
|
|
||||||
check_process.communicate() # read output, but ignore it...
|
|
||||||
isnt_running = check_process.wait()
|
|
||||||
|
|
||||||
if not isnt_running:
|
|
||||||
# Our double-check found that the master _was_ infact running. Add to
|
|
||||||
# the list of keys.
|
|
||||||
self._master_keys[key] = True
|
|
||||||
return True
|
|
||||||
except Exception:
|
|
||||||
# Ignore excpetions. We we will fall back to the normal command and print
|
|
||||||
# to the log there.
|
|
||||||
pass
|
|
||||||
|
|
||||||
command = command_base[:1] + ['-M', '-N'] + command_base[1:]
|
|
||||||
try:
|
|
||||||
Trace(': %s', ' '.join(command))
|
|
||||||
p = subprocess.Popen(command)
|
|
||||||
except Exception as e:
|
|
||||||
self._master_broken.value = True
|
|
||||||
print('\nwarn: cannot enable ssh control master for %s:%s\n%s'
|
|
||||||
% (host, port, str(e)), file=sys.stderr)
|
|
||||||
return False
|
|
||||||
|
|
||||||
time.sleep(1)
|
|
||||||
ssh_died = (p.poll() is not None)
|
|
||||||
if ssh_died:
|
|
||||||
return False
|
|
||||||
|
|
||||||
self.add_master(p)
|
|
||||||
self._master_keys[key] = True
|
|
||||||
return True
|
|
||||||
|
|
||||||
def _open(self, host, port=None):
|
|
||||||
"""Make sure a ssh master session exists for |host| & |port|.
|
|
||||||
|
|
||||||
If one doesn't exist already, we'll create it.
|
|
||||||
|
|
||||||
This will obtain any necessary locks to avoid inter-process races.
|
|
||||||
"""
|
|
||||||
# Bail before grabbing the lock if we already know that we aren't going to
|
|
||||||
# try creating new masters below.
|
|
||||||
if sys.platform in ('win32', 'cygwin'):
|
|
||||||
return False
|
|
||||||
|
|
||||||
# Acquire the lock. This is needed to prevent opening multiple masters for
|
|
||||||
# the same host when we're running "repo sync -jN" (for N > 1) _and_ the
|
|
||||||
# manifest <remote fetch="ssh://xyz"> specifies a different host from the
|
|
||||||
# one that was passed to repo init.
|
|
||||||
with self._lock:
|
|
||||||
return self._open_unlocked(host, port)
|
|
||||||
|
|
||||||
def preconnect(self, url):
|
|
||||||
"""If |uri| will create a ssh connection, setup the ssh master for it."""
|
|
||||||
m = URI_ALL.match(url)
|
|
||||||
if m:
|
|
||||||
scheme = m.group(1)
|
|
||||||
host = m.group(2)
|
|
||||||
if ':' in host:
|
|
||||||
host, port = host.split(':')
|
|
||||||
else:
|
|
||||||
port = None
|
|
||||||
if scheme in ('ssh', 'git+ssh', 'ssh+git'):
|
|
||||||
return self._open(host, port)
|
|
||||||
return False
|
|
||||||
|
|
||||||
m = URI_SCP.match(url)
|
|
||||||
if m:
|
|
||||||
host = m.group(1)
|
|
||||||
return self._open(host)
|
|
||||||
|
|
||||||
return False
|
|
||||||
|
|
||||||
def sock(self, create=True):
|
|
||||||
"""Return the path to the ssh socket dir.
|
|
||||||
|
|
||||||
This has all the master sockets so clients can talk to them.
|
|
||||||
"""
|
|
||||||
if self._sock_path is None:
|
|
||||||
if not create:
|
|
||||||
return None
|
|
||||||
tmp_dir = '/tmp'
|
|
||||||
if not os.path.exists(tmp_dir):
|
|
||||||
tmp_dir = tempfile.gettempdir()
|
|
||||||
if version() < (6, 7):
|
|
||||||
tokens = '%r@%h:%p'
|
|
||||||
else:
|
|
||||||
tokens = '%C' # hash of %l%h%p%r
|
|
||||||
self._sock_path = os.path.join(
|
|
||||||
tempfile.mkdtemp('', 'ssh-', tmp_dir),
|
|
||||||
'master-' + tokens)
|
|
||||||
return self._sock_path
|
|
@ -1,3 +1,5 @@
|
|||||||
|
# -*- coding:utf-8 -*-
|
||||||
|
#
|
||||||
# Copyright (C) 2008 The Android Open Source Project
|
# Copyright (C) 2008 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
@ -14,7 +16,6 @@
|
|||||||
|
|
||||||
import os
|
import os
|
||||||
|
|
||||||
# A mapping of the subcommand name to the class that implements it.
|
|
||||||
all_commands = {}
|
all_commands = {}
|
||||||
|
|
||||||
my_dir = os.path.dirname(__file__)
|
my_dir = os.path.dirname(__file__)
|
||||||
@ -36,7 +37,7 @@ for py in os.listdir(my_dir):
|
|||||||
['%s' % name])
|
['%s' % name])
|
||||||
mod = getattr(mod, name)
|
mod = getattr(mod, name)
|
||||||
try:
|
try:
|
||||||
cmd = getattr(mod, clsn)
|
cmd = getattr(mod, clsn)()
|
||||||
except AttributeError:
|
except AttributeError:
|
||||||
raise SyntaxError('%s/%s does not define class %s' % (
|
raise SyntaxError('%s/%s does not define class %s' % (
|
||||||
__name__, py, clsn))
|
__name__, py, clsn))
|
||||||
@ -45,5 +46,5 @@ for py in os.listdir(my_dir):
|
|||||||
cmd.NAME = name
|
cmd.NAME = name
|
||||||
all_commands[name] = cmd
|
all_commands[name] = cmd
|
||||||
|
|
||||||
# Add 'branch' as an alias for 'branches'.
|
if 'help' in all_commands:
|
||||||
all_commands['branch'] = all_commands['branches']
|
all_commands['help'].commands = all_commands
|
||||||
|
@ -1,3 +1,5 @@
|
|||||||
|
# -*- coding:utf-8 -*-
|
||||||
|
#
|
||||||
# Copyright (C) 2008 The Android Open Source Project
|
# Copyright (C) 2008 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
@ -12,16 +14,13 @@
|
|||||||
# See the License for the specific language governing permissions and
|
# See the License for the specific language governing permissions and
|
||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
|
|
||||||
from collections import defaultdict
|
from __future__ import print_function
|
||||||
import functools
|
|
||||||
import itertools
|
|
||||||
import sys
|
import sys
|
||||||
|
from command import Command
|
||||||
from command import Command, DEFAULT_LOCAL_JOBS
|
from collections import defaultdict
|
||||||
from git_command import git
|
from git_command import git
|
||||||
from progress import Progress
|
from progress import Progress
|
||||||
|
|
||||||
|
|
||||||
class Abandon(Command):
|
class Abandon(Command):
|
||||||
common = True
|
common = True
|
||||||
helpSummary = "Permanently abandon a development branch"
|
helpSummary = "Permanently abandon a development branch"
|
||||||
@ -33,8 +32,6 @@ deleting it (and all its history) from your local repository.
|
|||||||
|
|
||||||
It is equivalent to "git branch -D <branchname>".
|
It is equivalent to "git branch -D <branchname>".
|
||||||
"""
|
"""
|
||||||
PARALLEL_JOBS = DEFAULT_LOCAL_JOBS
|
|
||||||
|
|
||||||
def _Options(self, p):
|
def _Options(self, p):
|
||||||
p.add_option('--all',
|
p.add_option('--all',
|
||||||
dest='all', action='store_true',
|
dest='all', action='store_true',
|
||||||
@ -51,64 +48,52 @@ It is equivalent to "git branch -D <branchname>".
|
|||||||
else:
|
else:
|
||||||
args.insert(0, "'All local branches'")
|
args.insert(0, "'All local branches'")
|
||||||
|
|
||||||
def _ExecuteOne(self, all_branches, nb, project):
|
|
||||||
"""Abandon one project."""
|
|
||||||
if all_branches:
|
|
||||||
branches = project.GetBranches()
|
|
||||||
else:
|
|
||||||
branches = [nb]
|
|
||||||
|
|
||||||
ret = {}
|
|
||||||
for name in branches:
|
|
||||||
status = project.AbandonBranch(name)
|
|
||||||
if status is not None:
|
|
||||||
ret[name] = status
|
|
||||||
return (ret, project)
|
|
||||||
|
|
||||||
def Execute(self, opt, args):
|
def Execute(self, opt, args):
|
||||||
nb = args[0]
|
nb = args[0]
|
||||||
err = defaultdict(list)
|
err = defaultdict(list)
|
||||||
success = defaultdict(list)
|
success = defaultdict(list)
|
||||||
all_projects = self.GetProjects(args[1:])
|
all_projects = self.GetProjects(args[1:])
|
||||||
|
|
||||||
def _ProcessResults(_pool, pm, states):
|
pm = Progress('Abandon %s' % nb, len(all_projects))
|
||||||
for (results, project) in states:
|
for project in all_projects:
|
||||||
for branch, status in results.items():
|
|
||||||
if status:
|
|
||||||
success[branch].append(project)
|
|
||||||
else:
|
|
||||||
err[branch].append(project)
|
|
||||||
pm.update()
|
pm.update()
|
||||||
|
|
||||||
self.ExecuteInParallel(
|
if opt.all:
|
||||||
opt.jobs,
|
branches = list(project.GetBranches().keys())
|
||||||
functools.partial(self._ExecuteOne, opt.all, nb),
|
else:
|
||||||
all_projects,
|
branches = [nb]
|
||||||
callback=_ProcessResults,
|
|
||||||
output=Progress('Abandon %s' % (nb,), len(all_projects), quiet=opt.quiet))
|
for name in branches:
|
||||||
|
status = project.AbandonBranch(name)
|
||||||
|
if status is not None:
|
||||||
|
if status:
|
||||||
|
success[name].append(project)
|
||||||
|
else:
|
||||||
|
err[name].append(project)
|
||||||
|
pm.end()
|
||||||
|
|
||||||
|
width = 25
|
||||||
|
for name in branches:
|
||||||
|
if width < len(name):
|
||||||
|
width = len(name)
|
||||||
|
|
||||||
width = max(itertools.chain(
|
|
||||||
[25], (len(x) for x in itertools.chain(success, err))))
|
|
||||||
if err:
|
if err:
|
||||||
for br in err.keys():
|
for br in err.keys():
|
||||||
err_msg = "error: cannot abandon %s" % br
|
err_msg = "error: cannot abandon %s" %br
|
||||||
print(err_msg, file=sys.stderr)
|
print(err_msg, file=sys.stderr)
|
||||||
for proj in err[br]:
|
for proj in err[br]:
|
||||||
print(' ' * len(err_msg) + " | %s" % proj.relpath, file=sys.stderr)
|
print(' '*len(err_msg) + " | %s" % proj.relpath, file=sys.stderr)
|
||||||
sys.exit(1)
|
sys.exit(1)
|
||||||
elif not success:
|
elif not success:
|
||||||
print('error: no project has local branch(es) : %s' % nb,
|
print('error: no project has local branch(es) : %s' % nb,
|
||||||
file=sys.stderr)
|
file=sys.stderr)
|
||||||
sys.exit(1)
|
sys.exit(1)
|
||||||
else:
|
else:
|
||||||
# Everything below here is displaying status.
|
print('Abandoned branches:', file=sys.stderr)
|
||||||
if opt.quiet:
|
|
||||||
return
|
|
||||||
print('Abandoned branches:')
|
|
||||||
for br in success.keys():
|
for br in success.keys():
|
||||||
if len(all_projects) > 1 and len(all_projects) == len(success[br]):
|
if len(all_projects) > 1 and len(all_projects) == len(success[br]):
|
||||||
result = "all project"
|
result = "all project"
|
||||||
else:
|
else:
|
||||||
result = "%s" % (
|
result = "%s" % (
|
||||||
('\n' + ' ' * width + '| ').join(p.relpath for p in success[br]))
|
('\n'+' '*width + '| ').join(p.relpath for p in success[br]))
|
||||||
print("%s%s| %s\n" % (br, ' ' * (width - len(br)), result))
|
print("%s%s| %s\n" % (br,' '*(width-len(br)), result),file=sys.stderr)
|
||||||
|
@ -1,3 +1,5 @@
|
|||||||
|
# -*- coding:utf-8 -*-
|
||||||
|
#
|
||||||
# Copyright (C) 2009 The Android Open Source Project
|
# Copyright (C) 2009 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
@ -12,12 +14,10 @@
|
|||||||
# See the License for the specific language governing permissions and
|
# See the License for the specific language governing permissions and
|
||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
|
|
||||||
import itertools
|
from __future__ import print_function
|
||||||
import sys
|
import sys
|
||||||
|
|
||||||
from color import Coloring
|
from color import Coloring
|
||||||
from command import Command, DEFAULT_LOCAL_JOBS
|
from command import Command
|
||||||
|
|
||||||
|
|
||||||
class BranchColoring(Coloring):
|
class BranchColoring(Coloring):
|
||||||
def __init__(self, config):
|
def __init__(self, config):
|
||||||
@ -26,7 +26,6 @@ class BranchColoring(Coloring):
|
|||||||
self.local = self.printer('local')
|
self.local = self.printer('local')
|
||||||
self.notinproject = self.printer('notinproject', fg='red')
|
self.notinproject = self.printer('notinproject', fg='red')
|
||||||
|
|
||||||
|
|
||||||
class BranchInfo(object):
|
class BranchInfo(object):
|
||||||
def __init__(self, name):
|
def __init__(self, name):
|
||||||
self.name = name
|
self.name = name
|
||||||
@ -95,7 +94,6 @@ the branch appears in, or does not appear in. If no project list
|
|||||||
is shown, then the branch appears in all projects.
|
is shown, then the branch appears in all projects.
|
||||||
|
|
||||||
"""
|
"""
|
||||||
PARALLEL_JOBS = DEFAULT_LOCAL_JOBS
|
|
||||||
|
|
||||||
def Execute(self, opt, args):
|
def Execute(self, opt, args):
|
||||||
projects = self.GetProjects(args)
|
projects = self.GetProjects(args)
|
||||||
@ -103,19 +101,14 @@ is shown, then the branch appears in all projects.
|
|||||||
all_branches = {}
|
all_branches = {}
|
||||||
project_cnt = len(projects)
|
project_cnt = len(projects)
|
||||||
|
|
||||||
def _ProcessResults(_pool, _output, results):
|
for project in projects:
|
||||||
for name, b in itertools.chain.from_iterable(results):
|
for name, b in project.GetBranches().items():
|
||||||
|
b.project = project
|
||||||
if name not in all_branches:
|
if name not in all_branches:
|
||||||
all_branches[name] = BranchInfo(name)
|
all_branches[name] = BranchInfo(name)
|
||||||
all_branches[name].add(b)
|
all_branches[name].add(b)
|
||||||
|
|
||||||
self.ExecuteInParallel(
|
names = list(sorted(all_branches))
|
||||||
opt.jobs,
|
|
||||||
expand_project_to_branches,
|
|
||||||
projects,
|
|
||||||
callback=_ProcessResults)
|
|
||||||
|
|
||||||
names = sorted(all_branches)
|
|
||||||
|
|
||||||
if not names:
|
if not names:
|
||||||
print(' (no branches)', file=sys.stderr)
|
print(' (no branches)', file=sys.stderr)
|
||||||
@ -165,7 +158,7 @@ is shown, then the branch appears in all projects.
|
|||||||
for b in i.projects:
|
for b in i.projects:
|
||||||
have.add(b.project)
|
have.add(b.project)
|
||||||
for p in projects:
|
for p in projects:
|
||||||
if p not in have:
|
if not p in have:
|
||||||
paths.append(p.relpath)
|
paths.append(p.relpath)
|
||||||
|
|
||||||
s = ' %s %s' % (in_type, ', '.join(paths))
|
s = ' %s %s' % (in_type, ', '.join(paths))
|
||||||
@ -177,27 +170,11 @@ is shown, then the branch appears in all projects.
|
|||||||
fmt = out.current if i.IsCurrent else out.write
|
fmt = out.current if i.IsCurrent else out.write
|
||||||
for p in paths:
|
for p in paths:
|
||||||
out.nl()
|
out.nl()
|
||||||
fmt(width * ' ' + ' %s' % p)
|
fmt(width*' ' + ' %s' % p)
|
||||||
fmt = out.write
|
fmt = out.write
|
||||||
for p in non_cur_paths:
|
for p in non_cur_paths:
|
||||||
out.nl()
|
out.nl()
|
||||||
fmt(width * ' ' + ' %s' % p)
|
fmt(width*' ' + ' %s' % p)
|
||||||
else:
|
else:
|
||||||
out.write(' in all projects')
|
out.write(' in all projects')
|
||||||
out.nl()
|
out.nl()
|
||||||
|
|
||||||
|
|
||||||
def expand_project_to_branches(project):
|
|
||||||
"""Expands a project into a list of branch names & associated information.
|
|
||||||
|
|
||||||
Args:
|
|
||||||
project: project.Project
|
|
||||||
|
|
||||||
Returns:
|
|
||||||
List[Tuple[str, git_config.Branch]]
|
|
||||||
"""
|
|
||||||
branches = []
|
|
||||||
for name, b in project.GetBranches().items():
|
|
||||||
b.project = project
|
|
||||||
branches.append((name, b))
|
|
||||||
return branches
|
|
||||||
|
@ -1,3 +1,5 @@
|
|||||||
|
# -*- coding:utf-8 -*-
|
||||||
|
#
|
||||||
# Copyright (C) 2009 The Android Open Source Project
|
# Copyright (C) 2009 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
@ -12,13 +14,11 @@
|
|||||||
# See the License for the specific language governing permissions and
|
# See the License for the specific language governing permissions and
|
||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
|
|
||||||
import functools
|
from __future__ import print_function
|
||||||
import sys
|
import sys
|
||||||
|
from command import Command
|
||||||
from command import Command, DEFAULT_LOCAL_JOBS
|
|
||||||
from progress import Progress
|
from progress import Progress
|
||||||
|
|
||||||
|
|
||||||
class Checkout(Command):
|
class Checkout(Command):
|
||||||
common = True
|
common = True
|
||||||
helpSummary = "Checkout a branch for development"
|
helpSummary = "Checkout a branch for development"
|
||||||
@ -33,37 +33,28 @@ The command is equivalent to:
|
|||||||
|
|
||||||
repo forall [<project>...] -c git checkout <branchname>
|
repo forall [<project>...] -c git checkout <branchname>
|
||||||
"""
|
"""
|
||||||
PARALLEL_JOBS = DEFAULT_LOCAL_JOBS
|
|
||||||
|
|
||||||
def ValidateOptions(self, opt, args):
|
def ValidateOptions(self, opt, args):
|
||||||
if not args:
|
if not args:
|
||||||
self.Usage()
|
self.Usage()
|
||||||
|
|
||||||
def _ExecuteOne(self, nb, project):
|
|
||||||
"""Checkout one project."""
|
|
||||||
return (project.CheckoutBranch(nb), project)
|
|
||||||
|
|
||||||
def Execute(self, opt, args):
|
def Execute(self, opt, args):
|
||||||
nb = args[0]
|
nb = args[0]
|
||||||
err = []
|
err = []
|
||||||
success = []
|
success = []
|
||||||
all_projects = self.GetProjects(args[1:])
|
all_projects = self.GetProjects(args[1:])
|
||||||
|
|
||||||
def _ProcessResults(_pool, pm, results):
|
pm = Progress('Checkout %s' % nb, len(all_projects))
|
||||||
for status, project in results:
|
for project in all_projects:
|
||||||
|
pm.update()
|
||||||
|
|
||||||
|
status = project.CheckoutBranch(nb)
|
||||||
if status is not None:
|
if status is not None:
|
||||||
if status:
|
if status:
|
||||||
success.append(project)
|
success.append(project)
|
||||||
else:
|
else:
|
||||||
err.append(project)
|
err.append(project)
|
||||||
pm.update()
|
pm.end()
|
||||||
|
|
||||||
self.ExecuteInParallel(
|
|
||||||
opt.jobs,
|
|
||||||
functools.partial(self._ExecuteOne, nb),
|
|
||||||
all_projects,
|
|
||||||
callback=_ProcessResults,
|
|
||||||
output=Progress('Checkout %s' % (nb,), len(all_projects), quiet=opt.quiet))
|
|
||||||
|
|
||||||
if err:
|
if err:
|
||||||
for p in err:
|
for p in err:
|
||||||
|
@ -1,3 +1,5 @@
|
|||||||
|
# -*- coding:utf-8 -*-
|
||||||
|
#
|
||||||
# Copyright (C) 2010 The Android Open Source Project
|
# Copyright (C) 2010 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
@ -12,6 +14,7 @@
|
|||||||
# See the License for the specific language governing permissions and
|
# See the License for the specific language governing permissions and
|
||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
|
|
||||||
|
from __future__ import print_function
|
||||||
import re
|
import re
|
||||||
import sys
|
import sys
|
||||||
from command import Command
|
from command import Command
|
||||||
@ -19,7 +22,6 @@ from git_command import GitCommand
|
|||||||
|
|
||||||
CHANGE_ID_RE = re.compile(r'^\s*Change-Id: I([0-9a-f]{40})\s*$')
|
CHANGE_ID_RE = re.compile(r'^\s*Change-Id: I([0-9a-f]{40})\s*$')
|
||||||
|
|
||||||
|
|
||||||
class CherryPick(Command):
|
class CherryPick(Command):
|
||||||
common = True
|
common = True
|
||||||
helpSummary = "Cherry-pick a change."
|
helpSummary = "Cherry-pick a change."
|
||||||
@ -32,6 +34,9 @@ The change id will be updated, and a reference to the old
|
|||||||
change id will be added.
|
change id will be added.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
|
def _Options(self, p):
|
||||||
|
pass
|
||||||
|
|
||||||
def ValidateOptions(self, opt, args):
|
def ValidateOptions(self, opt, args):
|
||||||
if len(args) != 1:
|
if len(args) != 1:
|
||||||
self.Usage()
|
self.Usage()
|
||||||
@ -41,8 +46,8 @@ change id will be added.
|
|||||||
|
|
||||||
p = GitCommand(None,
|
p = GitCommand(None,
|
||||||
['rev-parse', '--verify', reference],
|
['rev-parse', '--verify', reference],
|
||||||
capture_stdout=True,
|
capture_stdout = True,
|
||||||
capture_stderr=True)
|
capture_stderr = True)
|
||||||
if p.Wait() != 0:
|
if p.Wait() != 0:
|
||||||
print(p.stderr, file=sys.stderr)
|
print(p.stderr, file=sys.stderr)
|
||||||
sys.exit(1)
|
sys.exit(1)
|
||||||
@ -56,8 +61,8 @@ change id will be added.
|
|||||||
|
|
||||||
p = GitCommand(None,
|
p = GitCommand(None,
|
||||||
['cherry-pick', sha1],
|
['cherry-pick', sha1],
|
||||||
capture_stdout=True,
|
capture_stdout = True,
|
||||||
capture_stderr=True)
|
capture_stderr = True)
|
||||||
status = p.Wait()
|
status = p.Wait()
|
||||||
|
|
||||||
print(p.stdout, file=sys.stdout)
|
print(p.stdout, file=sys.stdout)
|
||||||
@ -69,9 +74,11 @@ change id will be added.
|
|||||||
new_msg = self._Reformat(old_msg, sha1)
|
new_msg = self._Reformat(old_msg, sha1)
|
||||||
|
|
||||||
p = GitCommand(None, ['commit', '--amend', '-F', '-'],
|
p = GitCommand(None, ['commit', '--amend', '-F', '-'],
|
||||||
input=new_msg,
|
provide_stdin = True,
|
||||||
capture_stdout=True,
|
capture_stdout = True,
|
||||||
capture_stderr=True)
|
capture_stderr = True)
|
||||||
|
p.stdin.write(new_msg)
|
||||||
|
p.stdin.close()
|
||||||
if p.Wait() != 0:
|
if p.Wait() != 0:
|
||||||
print("error: Failed to update commit message", file=sys.stderr)
|
print("error: Failed to update commit message", file=sys.stderr)
|
||||||
sys.exit(1)
|
sys.exit(1)
|
||||||
@ -90,7 +97,7 @@ change id will be added.
|
|||||||
|
|
||||||
def _StripHeader(self, commit_msg):
|
def _StripHeader(self, commit_msg):
|
||||||
lines = commit_msg.splitlines()
|
lines = commit_msg.splitlines()
|
||||||
return "\n".join(lines[lines.index("") + 1:])
|
return "\n".join(lines[lines.index("")+1:])
|
||||||
|
|
||||||
def _Reformat(self, old_msg, sha1):
|
def _Reformat(self, old_msg, sha1):
|
||||||
new_msg = []
|
new_msg = []
|
||||||
|
@ -1,3 +1,5 @@
|
|||||||
|
# -*- coding:utf-8 -*-
|
||||||
|
#
|
||||||
# Copyright (C) 2008 The Android Open Source Project
|
# Copyright (C) 2008 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
@ -12,11 +14,7 @@
|
|||||||
# See the License for the specific language governing permissions and
|
# See the License for the specific language governing permissions and
|
||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
|
|
||||||
import functools
|
from command import PagedCommand
|
||||||
import io
|
|
||||||
|
|
||||||
from command import DEFAULT_LOCAL_JOBS, PagedCommand
|
|
||||||
|
|
||||||
|
|
||||||
class Diff(PagedCommand):
|
class Diff(PagedCommand):
|
||||||
common = True
|
common = True
|
||||||
@ -28,42 +26,19 @@ The -u option causes '%prog' to generate diff output with file paths
|
|||||||
relative to the repository root, so the output can be applied
|
relative to the repository root, so the output can be applied
|
||||||
to the Unix 'patch' command.
|
to the Unix 'patch' command.
|
||||||
"""
|
"""
|
||||||
PARALLEL_JOBS = DEFAULT_LOCAL_JOBS
|
|
||||||
|
|
||||||
def _Options(self, p):
|
def _Options(self, p):
|
||||||
|
def cmd(option, opt_str, value, parser):
|
||||||
|
setattr(parser.values, option.dest, list(parser.rargs))
|
||||||
|
while parser.rargs:
|
||||||
|
del parser.rargs[0]
|
||||||
p.add_option('-u', '--absolute',
|
p.add_option('-u', '--absolute',
|
||||||
dest='absolute', action='store_true',
|
dest='absolute', action='store_true',
|
||||||
help='paths are relative to the repository root')
|
help='Paths are relative to the repository root')
|
||||||
|
|
||||||
def _ExecuteOne(self, absolute, project):
|
|
||||||
"""Obtains the diff for a specific project.
|
|
||||||
|
|
||||||
Args:
|
|
||||||
absolute: Paths are relative to the root.
|
|
||||||
project: Project to get status of.
|
|
||||||
|
|
||||||
Returns:
|
|
||||||
The status of the project.
|
|
||||||
"""
|
|
||||||
buf = io.StringIO()
|
|
||||||
ret = project.PrintWorkTreeDiff(absolute, output_redir=buf)
|
|
||||||
return (ret, buf.getvalue())
|
|
||||||
|
|
||||||
def Execute(self, opt, args):
|
def Execute(self, opt, args):
|
||||||
all_projects = self.GetProjects(args)
|
|
||||||
|
|
||||||
def _ProcessResults(_pool, _output, results):
|
|
||||||
ret = 0
|
ret = 0
|
||||||
for (state, output) in results:
|
for project in self.GetProjects(args):
|
||||||
if output:
|
if not project.PrintWorkTreeDiff(opt.absolute):
|
||||||
print(output, end='')
|
|
||||||
if not state:
|
|
||||||
ret = 1
|
ret = 1
|
||||||
return ret
|
return ret
|
||||||
|
|
||||||
return self.ExecuteInParallel(
|
|
||||||
opt.jobs,
|
|
||||||
functools.partial(self._ExecuteOne, opt.absolute),
|
|
||||||
all_projects,
|
|
||||||
callback=_ProcessResults,
|
|
||||||
ordered=True)
|
|
||||||
|
@ -1,3 +1,5 @@
|
|||||||
|
# -*- coding:utf-8 -*-
|
||||||
|
#
|
||||||
# Copyright (C) 2014 The Android Open Source Project
|
# Copyright (C) 2014 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
@ -14,14 +16,12 @@
|
|||||||
|
|
||||||
from color import Coloring
|
from color import Coloring
|
||||||
from command import PagedCommand
|
from command import PagedCommand
|
||||||
from manifest_xml import RepoClient
|
from manifest_xml import XmlManifest
|
||||||
|
|
||||||
|
|
||||||
class _Coloring(Coloring):
|
class _Coloring(Coloring):
|
||||||
def __init__(self, config):
|
def __init__(self, config):
|
||||||
Coloring.__init__(self, config, "status")
|
Coloring.__init__(self, config, "status")
|
||||||
|
|
||||||
|
|
||||||
class Diffmanifests(PagedCommand):
|
class Diffmanifests(PagedCommand):
|
||||||
""" A command to see logs in projects represented by manifests
|
""" A command to see logs in projects represented by manifests
|
||||||
|
|
||||||
@ -68,16 +68,16 @@ synced and their revisions won't be found.
|
|||||||
def _Options(self, p):
|
def _Options(self, p):
|
||||||
p.add_option('--raw',
|
p.add_option('--raw',
|
||||||
dest='raw', action='store_true',
|
dest='raw', action='store_true',
|
||||||
help='display raw diff')
|
help='Display raw diff.')
|
||||||
p.add_option('--no-color',
|
p.add_option('--no-color',
|
||||||
dest='color', action='store_false', default=True,
|
dest='color', action='store_false', default=True,
|
||||||
help='does not display the diff in color')
|
help='does not display the diff in color.')
|
||||||
p.add_option('--pretty-format',
|
p.add_option('--pretty-format',
|
||||||
dest='pretty_format', action='store',
|
dest='pretty_format', action='store',
|
||||||
metavar='<FORMAT>',
|
metavar='<FORMAT>',
|
||||||
help='print the log using a custom git pretty format string')
|
help='print the log using a custom git pretty format string')
|
||||||
|
|
||||||
def _printRawDiff(self, diff, pretty_format=None):
|
def _printRawDiff(self, diff):
|
||||||
for project in diff['added']:
|
for project in diff['added']:
|
||||||
self.printText("A %s %s" % (project.relpath, project.revisionExpr))
|
self.printText("A %s %s" % (project.relpath, project.revisionExpr))
|
||||||
self.out.nl()
|
self.out.nl()
|
||||||
@ -90,7 +90,7 @@ synced and their revisions won't be found.
|
|||||||
self.printText("C %s %s %s" % (project.relpath, project.revisionExpr,
|
self.printText("C %s %s %s" % (project.relpath, project.revisionExpr,
|
||||||
otherProject.revisionExpr))
|
otherProject.revisionExpr))
|
||||||
self.out.nl()
|
self.out.nl()
|
||||||
self._printLogs(project, otherProject, raw=True, color=False, pretty_format=pretty_format)
|
self._printLogs(project, otherProject, raw=True, color=False)
|
||||||
|
|
||||||
for project, otherProject in diff['unreachable']:
|
for project, otherProject in diff['unreachable']:
|
||||||
self.printText("U %s %s %s" % (project.relpath, project.revisionExpr,
|
self.printText("U %s %s %s" % (project.relpath, project.revisionExpr,
|
||||||
@ -181,26 +181,26 @@ synced and their revisions won't be found.
|
|||||||
self.OptionParser.error('missing manifests to diff')
|
self.OptionParser.error('missing manifests to diff')
|
||||||
|
|
||||||
def Execute(self, opt, args):
|
def Execute(self, opt, args):
|
||||||
self.out = _Coloring(self.client.globalConfig)
|
self.out = _Coloring(self.manifest.globalConfig)
|
||||||
self.printText = self.out.nofmt_printer('text')
|
self.printText = self.out.nofmt_printer('text')
|
||||||
if opt.color:
|
if opt.color:
|
||||||
self.printProject = self.out.nofmt_printer('project', attr='bold')
|
self.printProject = self.out.nofmt_printer('project', attr = 'bold')
|
||||||
self.printAdded = self.out.nofmt_printer('green', fg='green', attr='bold')
|
self.printAdded = self.out.nofmt_printer('green', fg = 'green', attr = 'bold')
|
||||||
self.printRemoved = self.out.nofmt_printer('red', fg='red', attr='bold')
|
self.printRemoved = self.out.nofmt_printer('red', fg = 'red', attr = 'bold')
|
||||||
self.printRevision = self.out.nofmt_printer('revision', fg='yellow')
|
self.printRevision = self.out.nofmt_printer('revision', fg = 'yellow')
|
||||||
else:
|
else:
|
||||||
self.printProject = self.printAdded = self.printRemoved = self.printRevision = self.printText
|
self.printProject = self.printAdded = self.printRemoved = self.printRevision = self.printText
|
||||||
|
|
||||||
manifest1 = RepoClient(self.repodir)
|
manifest1 = XmlManifest(self.manifest.repodir)
|
||||||
manifest1.Override(args[0], load_local_manifests=False)
|
manifest1.Override(args[0], load_local_manifests=False)
|
||||||
if len(args) == 1:
|
if len(args) == 1:
|
||||||
manifest2 = self.manifest
|
manifest2 = self.manifest
|
||||||
else:
|
else:
|
||||||
manifest2 = RepoClient(self.repodir)
|
manifest2 = XmlManifest(self.manifest.repodir)
|
||||||
manifest2.Override(args[1], load_local_manifests=False)
|
manifest2.Override(args[1], load_local_manifests=False)
|
||||||
|
|
||||||
diff = manifest1.projectsDiff(manifest2)
|
diff = manifest1.projectsDiff(manifest2)
|
||||||
if opt.raw:
|
if opt.raw:
|
||||||
self._printRawDiff(diff, pretty_format=opt.pretty_format)
|
self._printRawDiff(diff)
|
||||||
else:
|
else:
|
||||||
self._printDiff(diff, color=opt.color, pretty_format=opt.pretty_format)
|
self._printDiff(diff, color=opt.color, pretty_format=opt.pretty_format)
|
||||||
|
@ -1,3 +1,5 @@
|
|||||||
|
# -*- coding:utf-8 -*-
|
||||||
|
#
|
||||||
# Copyright (C) 2008 The Android Open Source Project
|
# Copyright (C) 2008 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
@ -12,15 +14,15 @@
|
|||||||
# See the License for the specific language governing permissions and
|
# See the License for the specific language governing permissions and
|
||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
|
|
||||||
|
from __future__ import print_function
|
||||||
import re
|
import re
|
||||||
import sys
|
import sys
|
||||||
|
|
||||||
from command import Command
|
from command import Command
|
||||||
from error import GitError, NoSuchProjectError
|
from error import GitError
|
||||||
|
|
||||||
CHANGE_RE = re.compile(r'^([1-9][0-9]*)(?:[/\.-]([1-9][0-9]*))?$')
|
CHANGE_RE = re.compile(r'^([1-9][0-9]*)(?:[/\.-]([1-9][0-9]*))?$')
|
||||||
|
|
||||||
|
|
||||||
class Download(Command):
|
class Download(Command):
|
||||||
common = True
|
common = True
|
||||||
helpSummary = "Download and checkout a change"
|
helpSummary = "Download and checkout a change"
|
||||||
@ -34,13 +36,9 @@ If no project is specified try to use current directory as a project.
|
|||||||
"""
|
"""
|
||||||
|
|
||||||
def _Options(self, p):
|
def _Options(self, p):
|
||||||
p.add_option('-b', '--branch',
|
|
||||||
help='create a new branch first')
|
|
||||||
p.add_option('-c', '--cherry-pick',
|
p.add_option('-c', '--cherry-pick',
|
||||||
dest='cherrypick', action='store_true',
|
dest='cherrypick', action='store_true',
|
||||||
help="cherry-pick instead of checkout")
|
help="cherry-pick instead of checkout")
|
||||||
p.add_option('-x', '--record-origin', action='store_true',
|
|
||||||
help='pass -x when cherry-picking')
|
|
||||||
p.add_option('-r', '--revert',
|
p.add_option('-r', '--revert',
|
||||||
dest='revert', action='store_true',
|
dest='revert', action='store_true',
|
||||||
help="revert instead of checkout")
|
help="revert instead of checkout")
|
||||||
@ -60,7 +58,6 @@ If no project is specified try to use current directory as a project.
|
|||||||
if m:
|
if m:
|
||||||
if not project:
|
if not project:
|
||||||
project = self.GetProjects(".")[0]
|
project = self.GetProjects(".")[0]
|
||||||
print('Defaulting to cwd project', project.name)
|
|
||||||
chg_id = int(m.group(1))
|
chg_id = int(m.group(1))
|
||||||
if m.group(2):
|
if m.group(2):
|
||||||
ps_id = int(m.group(2))
|
ps_id = int(m.group(2))
|
||||||
@ -77,33 +74,9 @@ If no project is specified try to use current directory as a project.
|
|||||||
ps_id = max(int(match.group(1)), ps_id)
|
ps_id = max(int(match.group(1)), ps_id)
|
||||||
to_get.append((project, chg_id, ps_id))
|
to_get.append((project, chg_id, ps_id))
|
||||||
else:
|
else:
|
||||||
projects = self.GetProjects([a])
|
project = self.GetProjects([a])[0]
|
||||||
if len(projects) > 1:
|
|
||||||
# If the cwd is one of the projects, assume they want that.
|
|
||||||
try:
|
|
||||||
project = self.GetProjects('.')[0]
|
|
||||||
except NoSuchProjectError:
|
|
||||||
project = None
|
|
||||||
if project not in projects:
|
|
||||||
print('error: %s matches too many projects; please re-run inside '
|
|
||||||
'the project checkout.' % (a,), file=sys.stderr)
|
|
||||||
for project in projects:
|
|
||||||
print(' %s/ @ %s' % (project.relpath, project.revisionExpr),
|
|
||||||
file=sys.stderr)
|
|
||||||
sys.exit(1)
|
|
||||||
else:
|
|
||||||
project = projects[0]
|
|
||||||
print('Defaulting to cwd project', project.name)
|
|
||||||
return to_get
|
return to_get
|
||||||
|
|
||||||
def ValidateOptions(self, opt, args):
|
|
||||||
if opt.record_origin:
|
|
||||||
if not opt.cherrypick:
|
|
||||||
self.OptionParser.error('-x only makes sense with --cherry-pick')
|
|
||||||
|
|
||||||
if opt.ffonly:
|
|
||||||
self.OptionParser.error('-x and --ff are mutually exclusive options')
|
|
||||||
|
|
||||||
def Execute(self, opt, args):
|
def Execute(self, opt, args):
|
||||||
for project, change_id, ps_id in self._ParseChangeIds(args):
|
for project, change_id, ps_id in self._ParseChangeIds(args):
|
||||||
dl = project.DownloadPatchSet(change_id, ps_id)
|
dl = project.DownloadPatchSet(change_id, ps_id)
|
||||||
@ -120,41 +93,22 @@ If no project is specified try to use current directory as a project.
|
|||||||
continue
|
continue
|
||||||
|
|
||||||
if len(dl.commits) > 1:
|
if len(dl.commits) > 1:
|
||||||
print('[%s] %d/%d depends on %d unmerged changes:'
|
print('[%s] %d/%d depends on %d unmerged changes:' \
|
||||||
% (project.name, change_id, ps_id, len(dl.commits)),
|
% (project.name, change_id, ps_id, len(dl.commits)),
|
||||||
file=sys.stderr)
|
file=sys.stderr)
|
||||||
for c in dl.commits:
|
for c in dl.commits:
|
||||||
print(' %s' % (c), file=sys.stderr)
|
print(' %s' % (c), file=sys.stderr)
|
||||||
|
|
||||||
if opt.cherrypick:
|
if opt.cherrypick:
|
||||||
mode = 'cherry-pick'
|
|
||||||
elif opt.revert:
|
|
||||||
mode = 'revert'
|
|
||||||
elif opt.ffonly:
|
|
||||||
mode = 'fast-forward merge'
|
|
||||||
else:
|
|
||||||
mode = 'checkout'
|
|
||||||
|
|
||||||
# We'll combine the branch+checkout operation, but all the rest need a
|
|
||||||
# dedicated branch start.
|
|
||||||
if opt.branch and mode != 'checkout':
|
|
||||||
project.StartBranch(opt.branch)
|
|
||||||
|
|
||||||
try:
|
try:
|
||||||
if opt.cherrypick:
|
project._CherryPick(dl.commit)
|
||||||
project._CherryPick(dl.commit, ffonly=opt.ffonly,
|
except GitError:
|
||||||
record_origin=opt.record_origin)
|
print('[%s] Could not complete the cherry-pick of %s' \
|
||||||
|
% (project.name, dl.commit), file=sys.stderr)
|
||||||
|
sys.exit(1)
|
||||||
|
|
||||||
elif opt.revert:
|
elif opt.revert:
|
||||||
project._Revert(dl.commit)
|
project._Revert(dl.commit)
|
||||||
elif opt.ffonly:
|
elif opt.ffonly:
|
||||||
project._FastForward(dl.commit, ffonly=True)
|
project._FastForward(dl.commit, ffonly=True)
|
||||||
else:
|
|
||||||
if opt.branch:
|
|
||||||
project.StartBranch(opt.branch, revision=dl.commit)
|
|
||||||
else:
|
else:
|
||||||
project._Checkout(dl.commit)
|
project._Checkout(dl.commit)
|
||||||
|
|
||||||
except GitError:
|
|
||||||
print('[%s] Could not complete the %s of %s'
|
|
||||||
% (project.name, mode, dl.commit), file=sys.stderr)
|
|
||||||
sys.exit(1)
|
|
||||||
|
@ -1,3 +1,5 @@
|
|||||||
|
# -*- coding:utf-8 -*-
|
||||||
|
#
|
||||||
# Copyright (C) 2008 The Android Open Source Project
|
# Copyright (C) 2008 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
@ -12,9 +14,8 @@
|
|||||||
# See the License for the specific language governing permissions and
|
# See the License for the specific language governing permissions and
|
||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
|
|
||||||
|
from __future__ import print_function
|
||||||
import errno
|
import errno
|
||||||
import functools
|
|
||||||
import io
|
|
||||||
import multiprocessing
|
import multiprocessing
|
||||||
import re
|
import re
|
||||||
import os
|
import os
|
||||||
@ -23,8 +24,8 @@ import sys
|
|||||||
import subprocess
|
import subprocess
|
||||||
|
|
||||||
from color import Coloring
|
from color import Coloring
|
||||||
from command import DEFAULT_LOCAL_JOBS, Command, MirrorSafeCommand, WORKER_BATCH_SIZE
|
from command import Command, MirrorSafeCommand
|
||||||
from error import ManifestInvalidRevisionError
|
import platform_utils
|
||||||
|
|
||||||
_CAN_COLOR = [
|
_CAN_COLOR = [
|
||||||
'branch',
|
'branch',
|
||||||
@ -45,7 +46,7 @@ class Forall(Command, MirrorSafeCommand):
|
|||||||
helpSummary = "Run a shell command in each project"
|
helpSummary = "Run a shell command in each project"
|
||||||
helpUsage = """
|
helpUsage = """
|
||||||
%prog [<project>...] -c <command> [<arg>...]
|
%prog [<project>...] -c <command> [<arg>...]
|
||||||
%prog -r str1 [str2] ... -c <command> [<arg>...]
|
%prog -r str1 [str2] ... -c <command> [<arg>...]"
|
||||||
"""
|
"""
|
||||||
helpDescription = """
|
helpDescription = """
|
||||||
Executes the same shell command in each project.
|
Executes the same shell command in each project.
|
||||||
@ -53,11 +54,6 @@ Executes the same shell command in each project.
|
|||||||
The -r option allows running the command only on projects matching
|
The -r option allows running the command only on projects matching
|
||||||
regex or wildcard expression.
|
regex or wildcard expression.
|
||||||
|
|
||||||
By default, projects are processed non-interactively in parallel. If you want
|
|
||||||
to run interactive commands, make sure to pass --interactive to force --jobs 1.
|
|
||||||
While the processing order of projects is not guaranteed, the order of project
|
|
||||||
output is stable.
|
|
||||||
|
|
||||||
# Output Formatting
|
# Output Formatting
|
||||||
|
|
||||||
The -p option causes '%prog' to bind pipes to the command's stdin,
|
The -p option causes '%prog' to bind pipes to the command's stdin,
|
||||||
@ -120,48 +116,70 @@ terminal and are not redirected.
|
|||||||
If -e is used, when a command exits unsuccessfully, '%prog' will abort
|
If -e is used, when a command exits unsuccessfully, '%prog' will abort
|
||||||
without iterating through the remaining projects.
|
without iterating through the remaining projects.
|
||||||
"""
|
"""
|
||||||
PARALLEL_JOBS = DEFAULT_LOCAL_JOBS
|
|
||||||
|
|
||||||
@staticmethod
|
def _Options(self, p):
|
||||||
def _cmd_option(option, _opt_str, _value, parser):
|
def cmd(option, opt_str, value, parser):
|
||||||
setattr(parser.values, option.dest, list(parser.rargs))
|
setattr(parser.values, option.dest, list(parser.rargs))
|
||||||
while parser.rargs:
|
while parser.rargs:
|
||||||
del parser.rargs[0]
|
del parser.rargs[0]
|
||||||
|
|
||||||
def _Options(self, p):
|
|
||||||
p.add_option('-r', '--regex',
|
p.add_option('-r', '--regex',
|
||||||
dest='regex', action='store_true',
|
dest='regex', action='store_true',
|
||||||
help='execute the command only on projects matching regex or wildcard expression')
|
help="Execute the command only on projects matching regex or wildcard expression")
|
||||||
p.add_option('-i', '--inverse-regex',
|
p.add_option('-i', '--inverse-regex',
|
||||||
dest='inverse_regex', action='store_true',
|
dest='inverse_regex', action='store_true',
|
||||||
help='execute the command only on projects not matching regex or '
|
help="Execute the command only on projects not matching regex or wildcard expression")
|
||||||
'wildcard expression')
|
|
||||||
p.add_option('-g', '--groups',
|
p.add_option('-g', '--groups',
|
||||||
dest='groups',
|
dest='groups',
|
||||||
help='execute the command only on projects matching the specified groups')
|
help="Execute the command only on projects matching the specified groups")
|
||||||
p.add_option('-c', '--command',
|
p.add_option('-c', '--command',
|
||||||
help='command (and arguments) to execute',
|
help='Command (and arguments) to execute',
|
||||||
dest='command',
|
dest='command',
|
||||||
action='callback',
|
action='callback',
|
||||||
callback=self._cmd_option)
|
callback=cmd)
|
||||||
p.add_option('-e', '--abort-on-errors',
|
p.add_option('-e', '--abort-on-errors',
|
||||||
dest='abort_on_errors', action='store_true',
|
dest='abort_on_errors', action='store_true',
|
||||||
help='abort if a command exits unsuccessfully')
|
help='Abort if a command exits unsuccessfully')
|
||||||
p.add_option('--ignore-missing', action='store_true',
|
p.add_option('--ignore-missing', action='store_true',
|
||||||
help='silently skip & do not exit non-zero due missing '
|
help='Silently skip & do not exit non-zero due missing '
|
||||||
'checkouts')
|
'checkouts')
|
||||||
|
|
||||||
g = p.get_option_group('--quiet')
|
g = p.add_option_group('Output')
|
||||||
g.add_option('-p',
|
g.add_option('-p',
|
||||||
dest='project_header', action='store_true',
|
dest='project_header', action='store_true',
|
||||||
help='show project headers before output')
|
help='Show project headers before output')
|
||||||
p.add_option('--interactive',
|
g.add_option('-v', '--verbose',
|
||||||
action='store_true',
|
dest='verbose', action='store_true',
|
||||||
help='force interactive usage')
|
help='Show command error messages')
|
||||||
|
g.add_option('-j', '--jobs',
|
||||||
|
dest='jobs', action='store', type='int', default=1,
|
||||||
|
help='number of commands to execute simultaneously')
|
||||||
|
|
||||||
def WantPager(self, opt):
|
def WantPager(self, opt):
|
||||||
return opt.project_header and opt.jobs == 1
|
return opt.project_header and opt.jobs == 1
|
||||||
|
|
||||||
|
def _SerializeProject(self, project):
|
||||||
|
""" Serialize a project._GitGetByExec instance.
|
||||||
|
|
||||||
|
project._GitGetByExec is not pickle-able. Instead of trying to pass it
|
||||||
|
around between processes, make a dict ourselves containing only the
|
||||||
|
attributes that we need.
|
||||||
|
|
||||||
|
"""
|
||||||
|
if not self.manifest.IsMirror:
|
||||||
|
lrev = project.GetRevisionId()
|
||||||
|
else:
|
||||||
|
lrev = None
|
||||||
|
return {
|
||||||
|
'name': project.name,
|
||||||
|
'relpath': project.relpath,
|
||||||
|
'remote_name': project.remote.name,
|
||||||
|
'lrev': lrev,
|
||||||
|
'rrev': project.revisionExpr,
|
||||||
|
'annotations': dict((a.name, a.value) for a in project.annotations),
|
||||||
|
'gitdir': project.gitdir,
|
||||||
|
'worktree': project.worktree,
|
||||||
|
}
|
||||||
|
|
||||||
def ValidateOptions(self, opt, args):
|
def ValidateOptions(self, opt, args):
|
||||||
if not opt.command:
|
if not opt.command:
|
||||||
self.Usage()
|
self.Usage()
|
||||||
@ -177,11 +195,6 @@ without iterating through the remaining projects.
|
|||||||
cmd.append(cmd[0])
|
cmd.append(cmd[0])
|
||||||
cmd.extend(opt.command[1:])
|
cmd.extend(opt.command[1:])
|
||||||
|
|
||||||
# Historically, forall operated interactively, and in serial. If the user
|
|
||||||
# has selected 1 job, then default to interacive mode.
|
|
||||||
if opt.jobs == 1:
|
|
||||||
opt.interactive = True
|
|
||||||
|
|
||||||
if opt.project_header \
|
if opt.project_header \
|
||||||
and not shell \
|
and not shell \
|
||||||
and cmd[0] == 'git':
|
and cmd[0] == 'git':
|
||||||
@ -221,50 +234,58 @@ without iterating through the remaining projects.
|
|||||||
|
|
||||||
os.environ['REPO_COUNT'] = str(len(projects))
|
os.environ['REPO_COUNT'] = str(len(projects))
|
||||||
|
|
||||||
|
pool = multiprocessing.Pool(opt.jobs, InitWorker)
|
||||||
try:
|
try:
|
||||||
config = self.manifest.manifestProject.config
|
config = self.manifest.manifestProject.config
|
||||||
with multiprocessing.Pool(opt.jobs, InitWorker) as pool:
|
|
||||||
results_it = pool.imap(
|
results_it = pool.imap(
|
||||||
functools.partial(DoWorkWrapper, mirror, opt, cmd, shell, config),
|
DoWorkWrapper,
|
||||||
enumerate(projects),
|
self.ProjectArgs(projects, mirror, opt, cmd, shell, config))
|
||||||
chunksize=WORKER_BATCH_SIZE)
|
pool.close()
|
||||||
first = True
|
for r in results_it:
|
||||||
for (r, output) in results_it:
|
|
||||||
if output:
|
|
||||||
if first:
|
|
||||||
first = False
|
|
||||||
elif opt.project_header:
|
|
||||||
print()
|
|
||||||
# To simplify the DoWorkWrapper, take care of automatic newlines.
|
|
||||||
end = '\n'
|
|
||||||
if output[-1] == '\n':
|
|
||||||
end = ''
|
|
||||||
print(output, end=end)
|
|
||||||
rc = rc or r
|
rc = rc or r
|
||||||
if r != 0 and opt.abort_on_errors:
|
if r != 0 and opt.abort_on_errors:
|
||||||
raise Exception('Aborting due to previous error')
|
raise Exception('Aborting due to previous error')
|
||||||
except (KeyboardInterrupt, WorkerKeyboardInterrupt):
|
except (KeyboardInterrupt, WorkerKeyboardInterrupt):
|
||||||
# Catch KeyboardInterrupt raised inside and outside of workers
|
# Catch KeyboardInterrupt raised inside and outside of workers
|
||||||
|
print('Interrupted - terminating the pool')
|
||||||
|
pool.terminate()
|
||||||
rc = rc or errno.EINTR
|
rc = rc or errno.EINTR
|
||||||
except Exception as e:
|
except Exception as e:
|
||||||
# Catch any other exceptions raised
|
# Catch any other exceptions raised
|
||||||
print('forall: unhandled error, terminating the pool: %s: %s' %
|
print('Got an error, terminating the pool: %s: %s' %
|
||||||
(type(e).__name__, e),
|
(type(e).__name__, e),
|
||||||
file=sys.stderr)
|
file=sys.stderr)
|
||||||
|
pool.terminate()
|
||||||
rc = rc or getattr(e, 'errno', 1)
|
rc = rc or getattr(e, 'errno', 1)
|
||||||
|
finally:
|
||||||
|
pool.join()
|
||||||
if rc != 0:
|
if rc != 0:
|
||||||
sys.exit(rc)
|
sys.exit(rc)
|
||||||
|
|
||||||
|
def ProjectArgs(self, projects, mirror, opt, cmd, shell, config):
|
||||||
|
for cnt, p in enumerate(projects):
|
||||||
|
try:
|
||||||
|
project = self._SerializeProject(p)
|
||||||
|
except Exception as e:
|
||||||
|
print('Project list error on project %s: %s: %s' %
|
||||||
|
(p.name, type(e).__name__, e),
|
||||||
|
file=sys.stderr)
|
||||||
|
return
|
||||||
|
except KeyboardInterrupt:
|
||||||
|
print('Project list interrupted',
|
||||||
|
file=sys.stderr)
|
||||||
|
return
|
||||||
|
yield [mirror, opt, cmd, shell, cnt, config, project]
|
||||||
|
|
||||||
class WorkerKeyboardInterrupt(Exception):
|
class WorkerKeyboardInterrupt(Exception):
|
||||||
""" Keyboard interrupt exception for worker processes. """
|
""" Keyboard interrupt exception for worker processes. """
|
||||||
|
pass
|
||||||
|
|
||||||
|
|
||||||
def InitWorker():
|
def InitWorker():
|
||||||
signal.signal(signal.SIGINT, signal.SIG_IGN)
|
signal.signal(signal.SIGINT, signal.SIG_IGN)
|
||||||
|
|
||||||
|
def DoWorkWrapper(args):
|
||||||
def DoWorkWrapper(mirror, opt, cmd, shell, config, args):
|
|
||||||
""" A wrapper around the DoWork() method.
|
""" A wrapper around the DoWork() method.
|
||||||
|
|
||||||
Catch the KeyboardInterrupt exceptions here and re-raise them as a different,
|
Catch the KeyboardInterrupt exceptions here and re-raise them as a different,
|
||||||
@ -272,81 +293,109 @@ def DoWorkWrapper(mirror, opt, cmd, shell, config, args):
|
|||||||
and making the parent hang indefinitely.
|
and making the parent hang indefinitely.
|
||||||
|
|
||||||
"""
|
"""
|
||||||
cnt, project = args
|
project = args.pop()
|
||||||
try:
|
try:
|
||||||
return DoWork(project, mirror, opt, cmd, shell, cnt, config)
|
return DoWork(project, *args)
|
||||||
except KeyboardInterrupt:
|
except KeyboardInterrupt:
|
||||||
print('%s: Worker interrupted' % project.name)
|
print('%s: Worker interrupted' % project['name'])
|
||||||
raise WorkerKeyboardInterrupt()
|
raise WorkerKeyboardInterrupt()
|
||||||
|
|
||||||
|
|
||||||
def DoWork(project, mirror, opt, cmd, shell, cnt, config):
|
def DoWork(project, mirror, opt, cmd, shell, cnt, config):
|
||||||
env = os.environ.copy()
|
env = os.environ.copy()
|
||||||
|
|
||||||
def setenv(name, val):
|
def setenv(name, val):
|
||||||
if val is None:
|
if val is None:
|
||||||
val = ''
|
val = ''
|
||||||
|
if hasattr(val, 'encode'):
|
||||||
|
val = val.encode()
|
||||||
env[name] = val
|
env[name] = val
|
||||||
|
|
||||||
setenv('REPO_PROJECT', project.name)
|
setenv('REPO_PROJECT', project['name'])
|
||||||
setenv('REPO_PATH', project.relpath)
|
setenv('REPO_PATH', project['relpath'])
|
||||||
setenv('REPO_REMOTE', project.remote.name)
|
setenv('REPO_REMOTE', project['remote_name'])
|
||||||
try:
|
setenv('REPO_LREV', project['lrev'])
|
||||||
# If we aren't in a fully synced state and we don't have the ref the manifest
|
setenv('REPO_RREV', project['rrev'])
|
||||||
# wants, then this will fail. Ignore it for the purposes of this code.
|
|
||||||
lrev = '' if mirror else project.GetRevisionId()
|
|
||||||
except ManifestInvalidRevisionError:
|
|
||||||
lrev = ''
|
|
||||||
setenv('REPO_LREV', lrev)
|
|
||||||
setenv('REPO_RREV', project.revisionExpr)
|
|
||||||
setenv('REPO_UPSTREAM', project.upstream)
|
|
||||||
setenv('REPO_DEST_BRANCH', project.dest_branch)
|
|
||||||
setenv('REPO_I', str(cnt + 1))
|
setenv('REPO_I', str(cnt + 1))
|
||||||
for annotation in project.annotations:
|
for name in project['annotations']:
|
||||||
setenv("REPO__%s" % (annotation.name), annotation.value)
|
setenv("REPO__%s" % (name), project['annotations'][name])
|
||||||
|
|
||||||
if mirror:
|
if mirror:
|
||||||
setenv('GIT_DIR', project.gitdir)
|
setenv('GIT_DIR', project['gitdir'])
|
||||||
cwd = project.gitdir
|
cwd = project['gitdir']
|
||||||
else:
|
else:
|
||||||
cwd = project.worktree
|
cwd = project['worktree']
|
||||||
|
|
||||||
if not os.path.exists(cwd):
|
if not os.path.exists(cwd):
|
||||||
# Allow the user to silently ignore missing checkouts so they can run on
|
# Allow the user to silently ignore missing checkouts so they can run on
|
||||||
# partial checkouts (good for infra recovery tools).
|
# partial checkouts (good for infra recovery tools).
|
||||||
if opt.ignore_missing:
|
if opt.ignore_missing:
|
||||||
return (0, '')
|
return 0
|
||||||
|
|
||||||
output = ''
|
|
||||||
if ((opt.project_header and opt.verbose)
|
if ((opt.project_header and opt.verbose)
|
||||||
or not opt.project_header):
|
or not opt.project_header):
|
||||||
output = 'skipping %s/' % project.relpath
|
print('skipping %s/' % project['relpath'], file=sys.stderr)
|
||||||
return (1, output)
|
return 1
|
||||||
|
|
||||||
if opt.verbose:
|
|
||||||
stderr = subprocess.STDOUT
|
|
||||||
else:
|
|
||||||
stderr = subprocess.DEVNULL
|
|
||||||
|
|
||||||
stdin = None if opt.interactive else subprocess.DEVNULL
|
|
||||||
|
|
||||||
result = subprocess.run(
|
|
||||||
cmd, cwd=cwd, shell=shell, env=env, check=False,
|
|
||||||
encoding='utf-8', errors='replace',
|
|
||||||
stdin=stdin, stdout=subprocess.PIPE, stderr=stderr)
|
|
||||||
|
|
||||||
output = result.stdout
|
|
||||||
if opt.project_header:
|
if opt.project_header:
|
||||||
if output:
|
stdin = subprocess.PIPE
|
||||||
buf = io.StringIO()
|
stdout = subprocess.PIPE
|
||||||
out = ForallColoring(config)
|
stderr = subprocess.PIPE
|
||||||
out.redirect(buf)
|
|
||||||
if mirror:
|
|
||||||
project_header_path = project.name
|
|
||||||
else:
|
else:
|
||||||
project_header_path = project.relpath
|
stdin = None
|
||||||
out.project('project %s/' % project_header_path)
|
stdout = None
|
||||||
|
stderr = None
|
||||||
|
|
||||||
|
p = subprocess.Popen(cmd,
|
||||||
|
cwd=cwd,
|
||||||
|
shell=shell,
|
||||||
|
env=env,
|
||||||
|
stdin=stdin,
|
||||||
|
stdout=stdout,
|
||||||
|
stderr=stderr)
|
||||||
|
|
||||||
|
if opt.project_header:
|
||||||
|
out = ForallColoring(config)
|
||||||
|
out.redirect(sys.stdout)
|
||||||
|
empty = True
|
||||||
|
errbuf = ''
|
||||||
|
|
||||||
|
p.stdin.close()
|
||||||
|
s_in = platform_utils.FileDescriptorStreams.create()
|
||||||
|
s_in.add(p.stdout, sys.stdout, 'stdout')
|
||||||
|
s_in.add(p.stderr, sys.stderr, 'stderr')
|
||||||
|
|
||||||
|
while not s_in.is_done:
|
||||||
|
in_ready = s_in.select()
|
||||||
|
for s in in_ready:
|
||||||
|
buf = s.read().decode()
|
||||||
|
if not buf:
|
||||||
|
s.close()
|
||||||
|
s_in.remove(s)
|
||||||
|
continue
|
||||||
|
|
||||||
|
if not opt.verbose:
|
||||||
|
if s.std_name == 'stderr':
|
||||||
|
errbuf += buf
|
||||||
|
continue
|
||||||
|
|
||||||
|
if empty and out:
|
||||||
|
if not cnt == 0:
|
||||||
out.nl()
|
out.nl()
|
||||||
buf.write(output)
|
|
||||||
output = buf.getvalue()
|
if mirror:
|
||||||
return (result.returncode, output)
|
project_header_path = project['name']
|
||||||
|
else:
|
||||||
|
project_header_path = project['relpath']
|
||||||
|
out.project('project %s/', project_header_path)
|
||||||
|
out.nl()
|
||||||
|
out.flush()
|
||||||
|
if errbuf:
|
||||||
|
sys.stderr.write(errbuf)
|
||||||
|
sys.stderr.flush()
|
||||||
|
errbuf = ''
|
||||||
|
empty = False
|
||||||
|
|
||||||
|
s.dest.write(buf)
|
||||||
|
s.dest.flush()
|
||||||
|
|
||||||
|
r = p.wait()
|
||||||
|
return r
|
||||||
|
@ -1,3 +1,5 @@
|
|||||||
|
# -*- coding:utf-8 -*-
|
||||||
|
#
|
||||||
# Copyright (C) 2015 The Android Open Source Project
|
# Copyright (C) 2015 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
@ -12,11 +14,15 @@
|
|||||||
# See the License for the specific language governing permissions and
|
# See the License for the specific language governing permissions and
|
||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
|
|
||||||
|
from __future__ import print_function
|
||||||
import sys
|
import sys
|
||||||
|
|
||||||
from command import Command, GitcClientCommand
|
from command import Command, GitcClientCommand
|
||||||
import platform_utils
|
import platform_utils
|
||||||
|
|
||||||
|
from pyversion import is_python3
|
||||||
|
if not is_python3():
|
||||||
|
input = raw_input
|
||||||
|
|
||||||
class GitcDelete(Command, GitcClientCommand):
|
class GitcDelete(Command, GitcClientCommand):
|
||||||
common = True
|
common = True
|
||||||
@ -33,7 +39,7 @@ and all locally downloaded sources.
|
|||||||
def _Options(self, p):
|
def _Options(self, p):
|
||||||
p.add_option('-f', '--force',
|
p.add_option('-f', '--force',
|
||||||
dest='force', action='store_true',
|
dest='force', action='store_true',
|
||||||
help='force the deletion (no prompt)')
|
help='Force the deletion (no prompt).')
|
||||||
|
|
||||||
def Execute(self, opt, args):
|
def Execute(self, opt, args):
|
||||||
if not opt.force:
|
if not opt.force:
|
||||||
|
@ -1,3 +1,5 @@
|
|||||||
|
# -*- coding:utf-8 -*-
|
||||||
|
#
|
||||||
# Copyright (C) 2015 The Android Open Source Project
|
# Copyright (C) 2015 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
@ -12,6 +14,7 @@
|
|||||||
# See the License for the specific language governing permissions and
|
# See the License for the specific language governing permissions and
|
||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
|
|
||||||
|
from __future__ import print_function
|
||||||
import os
|
import os
|
||||||
import sys
|
import sys
|
||||||
|
|
||||||
@ -47,17 +50,23 @@ use for this GITC client.
|
|||||||
"""
|
"""
|
||||||
|
|
||||||
def _Options(self, p):
|
def _Options(self, p):
|
||||||
super()._Options(p, gitc_init=True)
|
super(GitcInit, self)._Options(p, gitc_init=True)
|
||||||
|
g = p.add_option_group('GITC options')
|
||||||
|
g.add_option('-f', '--manifest-file',
|
||||||
|
dest='manifest_file',
|
||||||
|
help='Optional manifest file to use for this GITC client.')
|
||||||
|
g.add_option('-c', '--gitc-client',
|
||||||
|
dest='gitc_client',
|
||||||
|
help='The name of the gitc_client instance to create or modify.')
|
||||||
|
|
||||||
def Execute(self, opt, args):
|
def Execute(self, opt, args):
|
||||||
gitc_client = gitc_utils.parse_clientdir(os.getcwd())
|
gitc_client = gitc_utils.parse_clientdir(os.getcwd())
|
||||||
if not gitc_client or (opt.gitc_client and gitc_client != opt.gitc_client):
|
if not gitc_client or (opt.gitc_client and gitc_client != opt.gitc_client):
|
||||||
print('fatal: Please update your repo command. See go/gitc for instructions.',
|
print('fatal: Please update your repo command. See go/gitc for instructions.', file=sys.stderr)
|
||||||
file=sys.stderr)
|
|
||||||
sys.exit(1)
|
sys.exit(1)
|
||||||
self.client_dir = os.path.join(gitc_utils.get_gitc_manifest_dir(),
|
self.client_dir = os.path.join(gitc_utils.get_gitc_manifest_dir(),
|
||||||
gitc_client)
|
gitc_client)
|
||||||
super().Execute(opt, args)
|
super(GitcInit, self).Execute(opt, args)
|
||||||
|
|
||||||
manifest_file = self.manifest.manifestFile
|
manifest_file = self.manifest.manifestFile
|
||||||
if opt.manifest_file:
|
if opt.manifest_file:
|
||||||
|
192
subcmds/grep.py
192
subcmds/grep.py
@ -1,3 +1,5 @@
|
|||||||
|
# -*- coding:utf-8 -*-
|
||||||
|
#
|
||||||
# Copyright (C) 2009 The Android Open Source Project
|
# Copyright (C) 2009 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
@ -12,14 +14,14 @@
|
|||||||
# See the License for the specific language governing permissions and
|
# See the License for the specific language governing permissions and
|
||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
|
|
||||||
import functools
|
from __future__ import print_function
|
||||||
|
|
||||||
import sys
|
import sys
|
||||||
|
|
||||||
from color import Coloring
|
from color import Coloring
|
||||||
from command import DEFAULT_LOCAL_JOBS, PagedCommand
|
from command import PagedCommand
|
||||||
from error import GitError
|
from error import GitError
|
||||||
from git_command import GitCommand
|
from git_command import git_require, GitCommand
|
||||||
|
|
||||||
|
|
||||||
class GrepColoring(Coloring):
|
class GrepColoring(Coloring):
|
||||||
def __init__(self, config):
|
def __init__(self, config):
|
||||||
@ -27,7 +29,6 @@ class GrepColoring(Coloring):
|
|||||||
self.project = self.printer('project', attr='bold')
|
self.project = self.printer('project', attr='bold')
|
||||||
self.fail = self.printer('fail', fg='red')
|
self.fail = self.printer('fail', fg='red')
|
||||||
|
|
||||||
|
|
||||||
class Grep(PagedCommand):
|
class Grep(PagedCommand):
|
||||||
common = True
|
common = True
|
||||||
helpSummary = "Print lines matching a pattern"
|
helpSummary = "Print lines matching a pattern"
|
||||||
@ -62,10 +63,12 @@ contain a line that matches both expressions:
|
|||||||
repo grep --all-match -e NODE -e Unexpected
|
repo grep --all-match -e NODE -e Unexpected
|
||||||
|
|
||||||
"""
|
"""
|
||||||
PARALLEL_JOBS = DEFAULT_LOCAL_JOBS
|
|
||||||
|
|
||||||
@staticmethod
|
def _Options(self, p):
|
||||||
def _carry_option(_option, opt_str, value, parser):
|
def carry(option,
|
||||||
|
opt_str,
|
||||||
|
value,
|
||||||
|
parser):
|
||||||
pt = getattr(parser.values, 'cmd_argv', None)
|
pt = getattr(parser.values, 'cmd_argv', None)
|
||||||
if pt is None:
|
if pt is None:
|
||||||
pt = []
|
pt = []
|
||||||
@ -81,14 +84,9 @@ contain a line that matches both expressions:
|
|||||||
if value is not None:
|
if value is not None:
|
||||||
pt.append(value)
|
pt.append(value)
|
||||||
|
|
||||||
def _CommonOptions(self, p):
|
|
||||||
"""Override common options slightly."""
|
|
||||||
super()._CommonOptions(p, opt_v=False)
|
|
||||||
|
|
||||||
def _Options(self, p):
|
|
||||||
g = p.add_option_group('Sources')
|
g = p.add_option_group('Sources')
|
||||||
g.add_option('--cached',
|
g.add_option('--cached',
|
||||||
action='callback', callback=self._carry_option,
|
action='callback', callback=carry,
|
||||||
help='Search the index, instead of the work tree')
|
help='Search the index, instead of the work tree')
|
||||||
g.add_option('-r', '--revision',
|
g.add_option('-r', '--revision',
|
||||||
dest='revision', action='append', metavar='TREEish',
|
dest='revision', action='append', metavar='TREEish',
|
||||||
@ -96,139 +94,74 @@ contain a line that matches both expressions:
|
|||||||
|
|
||||||
g = p.add_option_group('Pattern')
|
g = p.add_option_group('Pattern')
|
||||||
g.add_option('-e',
|
g.add_option('-e',
|
||||||
action='callback', callback=self._carry_option,
|
action='callback', callback=carry,
|
||||||
metavar='PATTERN', type='str',
|
metavar='PATTERN', type='str',
|
||||||
help='Pattern to search for')
|
help='Pattern to search for')
|
||||||
g.add_option('-i', '--ignore-case',
|
g.add_option('-i', '--ignore-case',
|
||||||
action='callback', callback=self._carry_option,
|
action='callback', callback=carry,
|
||||||
help='Ignore case differences')
|
help='Ignore case differences')
|
||||||
g.add_option('-a', '--text',
|
g.add_option('-a', '--text',
|
||||||
action='callback', callback=self._carry_option,
|
action='callback', callback=carry,
|
||||||
help="Process binary files as if they were text")
|
help="Process binary files as if they were text")
|
||||||
g.add_option('-I',
|
g.add_option('-I',
|
||||||
action='callback', callback=self._carry_option,
|
action='callback', callback=carry,
|
||||||
help="Don't match the pattern in binary files")
|
help="Don't match the pattern in binary files")
|
||||||
g.add_option('-w', '--word-regexp',
|
g.add_option('-w', '--word-regexp',
|
||||||
action='callback', callback=self._carry_option,
|
action='callback', callback=carry,
|
||||||
help='Match the pattern only at word boundaries')
|
help='Match the pattern only at word boundaries')
|
||||||
g.add_option('-v', '--invert-match',
|
g.add_option('-v', '--invert-match',
|
||||||
action='callback', callback=self._carry_option,
|
action='callback', callback=carry,
|
||||||
help='Select non-matching lines')
|
help='Select non-matching lines')
|
||||||
g.add_option('-G', '--basic-regexp',
|
g.add_option('-G', '--basic-regexp',
|
||||||
action='callback', callback=self._carry_option,
|
action='callback', callback=carry,
|
||||||
help='Use POSIX basic regexp for patterns (default)')
|
help='Use POSIX basic regexp for patterns (default)')
|
||||||
g.add_option('-E', '--extended-regexp',
|
g.add_option('-E', '--extended-regexp',
|
||||||
action='callback', callback=self._carry_option,
|
action='callback', callback=carry,
|
||||||
help='Use POSIX extended regexp for patterns')
|
help='Use POSIX extended regexp for patterns')
|
||||||
g.add_option('-F', '--fixed-strings',
|
g.add_option('-F', '--fixed-strings',
|
||||||
action='callback', callback=self._carry_option,
|
action='callback', callback=carry,
|
||||||
help='Use fixed strings (not regexp) for pattern')
|
help='Use fixed strings (not regexp) for pattern')
|
||||||
|
|
||||||
g = p.add_option_group('Pattern Grouping')
|
g = p.add_option_group('Pattern Grouping')
|
||||||
g.add_option('--all-match',
|
g.add_option('--all-match',
|
||||||
action='callback', callback=self._carry_option,
|
action='callback', callback=carry,
|
||||||
help='Limit match to lines that have all patterns')
|
help='Limit match to lines that have all patterns')
|
||||||
g.add_option('--and', '--or', '--not',
|
g.add_option('--and', '--or', '--not',
|
||||||
action='callback', callback=self._carry_option,
|
action='callback', callback=carry,
|
||||||
help='Boolean operators to combine patterns')
|
help='Boolean operators to combine patterns')
|
||||||
g.add_option('-(', '-)',
|
g.add_option('-(', '-)',
|
||||||
action='callback', callback=self._carry_option,
|
action='callback', callback=carry,
|
||||||
help='Boolean operator grouping')
|
help='Boolean operator grouping')
|
||||||
|
|
||||||
g = p.add_option_group('Output')
|
g = p.add_option_group('Output')
|
||||||
g.add_option('-n',
|
g.add_option('-n',
|
||||||
action='callback', callback=self._carry_option,
|
action='callback', callback=carry,
|
||||||
help='Prefix the line number to matching lines')
|
help='Prefix the line number to matching lines')
|
||||||
g.add_option('-C',
|
g.add_option('-C',
|
||||||
action='callback', callback=self._carry_option,
|
action='callback', callback=carry,
|
||||||
metavar='CONTEXT', type='str',
|
metavar='CONTEXT', type='str',
|
||||||
help='Show CONTEXT lines around match')
|
help='Show CONTEXT lines around match')
|
||||||
g.add_option('-B',
|
g.add_option('-B',
|
||||||
action='callback', callback=self._carry_option,
|
action='callback', callback=carry,
|
||||||
metavar='CONTEXT', type='str',
|
metavar='CONTEXT', type='str',
|
||||||
help='Show CONTEXT lines before match')
|
help='Show CONTEXT lines before match')
|
||||||
g.add_option('-A',
|
g.add_option('-A',
|
||||||
action='callback', callback=self._carry_option,
|
action='callback', callback=carry,
|
||||||
metavar='CONTEXT', type='str',
|
metavar='CONTEXT', type='str',
|
||||||
help='Show CONTEXT lines after match')
|
help='Show CONTEXT lines after match')
|
||||||
g.add_option('-l', '--name-only', '--files-with-matches',
|
g.add_option('-l', '--name-only', '--files-with-matches',
|
||||||
action='callback', callback=self._carry_option,
|
action='callback', callback=carry,
|
||||||
help='Show only file names containing matching lines')
|
help='Show only file names containing matching lines')
|
||||||
g.add_option('-L', '--files-without-match',
|
g.add_option('-L', '--files-without-match',
|
||||||
action='callback', callback=self._carry_option,
|
action='callback', callback=carry,
|
||||||
help='Show only file names not containing matching lines')
|
help='Show only file names not containing matching lines')
|
||||||
|
|
||||||
def _ExecuteOne(self, cmd_argv, project):
|
|
||||||
"""Process one project."""
|
|
||||||
try:
|
|
||||||
p = GitCommand(project,
|
|
||||||
cmd_argv,
|
|
||||||
bare=False,
|
|
||||||
capture_stdout=True,
|
|
||||||
capture_stderr=True)
|
|
||||||
except GitError as e:
|
|
||||||
return (project, -1, None, str(e))
|
|
||||||
|
|
||||||
return (project, p.Wait(), p.stdout, p.stderr)
|
|
||||||
|
|
||||||
@staticmethod
|
|
||||||
def _ProcessResults(full_name, have_rev, _pool, out, results):
|
|
||||||
git_failed = False
|
|
||||||
bad_rev = False
|
|
||||||
have_match = False
|
|
||||||
|
|
||||||
for project, rc, stdout, stderr in results:
|
|
||||||
if rc < 0:
|
|
||||||
git_failed = True
|
|
||||||
out.project('--- project %s ---' % project.relpath)
|
|
||||||
out.nl()
|
|
||||||
out.fail('%s', stderr)
|
|
||||||
out.nl()
|
|
||||||
continue
|
|
||||||
|
|
||||||
if rc:
|
|
||||||
# no results
|
|
||||||
if stderr:
|
|
||||||
if have_rev and 'fatal: ambiguous argument' in stderr:
|
|
||||||
bad_rev = True
|
|
||||||
else:
|
|
||||||
out.project('--- project %s ---' % project.relpath)
|
|
||||||
out.nl()
|
|
||||||
out.fail('%s', stderr.strip())
|
|
||||||
out.nl()
|
|
||||||
continue
|
|
||||||
have_match = True
|
|
||||||
|
|
||||||
# We cut the last element, to avoid a blank line.
|
|
||||||
r = stdout.split('\n')
|
|
||||||
r = r[0:-1]
|
|
||||||
|
|
||||||
if have_rev and full_name:
|
|
||||||
for line in r:
|
|
||||||
rev, line = line.split(':', 1)
|
|
||||||
out.write("%s", rev)
|
|
||||||
out.write(':')
|
|
||||||
out.project(project.relpath)
|
|
||||||
out.write('/')
|
|
||||||
out.write("%s", line)
|
|
||||||
out.nl()
|
|
||||||
elif full_name:
|
|
||||||
for line in r:
|
|
||||||
out.project(project.relpath)
|
|
||||||
out.write('/')
|
|
||||||
out.write("%s", line)
|
|
||||||
out.nl()
|
|
||||||
else:
|
|
||||||
for line in r:
|
|
||||||
print(line)
|
|
||||||
|
|
||||||
return (git_failed, bad_rev, have_match)
|
|
||||||
|
|
||||||
def Execute(self, opt, args):
|
def Execute(self, opt, args):
|
||||||
out = GrepColoring(self.manifest.manifestProject.config)
|
out = GrepColoring(self.manifest.manifestProject.config)
|
||||||
|
|
||||||
cmd_argv = ['grep']
|
cmd_argv = ['grep']
|
||||||
if out.is_on:
|
if out.is_on and git_require((1, 6, 3)):
|
||||||
cmd_argv.append('--color')
|
cmd_argv.append('--color')
|
||||||
cmd_argv.extend(getattr(opt, 'cmd_argv', []))
|
cmd_argv.extend(getattr(opt, 'cmd_argv', []))
|
||||||
|
|
||||||
@ -255,13 +188,62 @@ contain a line that matches both expressions:
|
|||||||
cmd_argv.extend(opt.revision)
|
cmd_argv.extend(opt.revision)
|
||||||
cmd_argv.append('--')
|
cmd_argv.append('--')
|
||||||
|
|
||||||
git_failed, bad_rev, have_match = self.ExecuteInParallel(
|
git_failed = False
|
||||||
opt.jobs,
|
bad_rev = False
|
||||||
functools.partial(self._ExecuteOne, cmd_argv),
|
have_match = False
|
||||||
projects,
|
|
||||||
callback=functools.partial(self._ProcessResults, full_name, have_rev),
|
for project in projects:
|
||||||
output=out,
|
try:
|
||||||
ordered=True)
|
p = GitCommand(project,
|
||||||
|
cmd_argv,
|
||||||
|
bare=False,
|
||||||
|
capture_stdout=True,
|
||||||
|
capture_stderr=True)
|
||||||
|
except GitError as e:
|
||||||
|
git_failed = True
|
||||||
|
out.project('--- project %s ---' % project.relpath)
|
||||||
|
out.nl()
|
||||||
|
out.fail('%s', str(e))
|
||||||
|
out.nl()
|
||||||
|
continue
|
||||||
|
|
||||||
|
if p.Wait() != 0:
|
||||||
|
# no results
|
||||||
|
#
|
||||||
|
if p.stderr:
|
||||||
|
if have_rev and 'fatal: ambiguous argument' in p.stderr:
|
||||||
|
bad_rev = True
|
||||||
|
else:
|
||||||
|
out.project('--- project %s ---' % project.relpath)
|
||||||
|
out.nl()
|
||||||
|
out.fail('%s', p.stderr.strip())
|
||||||
|
out.nl()
|
||||||
|
continue
|
||||||
|
have_match = True
|
||||||
|
|
||||||
|
# We cut the last element, to avoid a blank line.
|
||||||
|
#
|
||||||
|
r = p.stdout.split('\n')
|
||||||
|
r = r[0:-1]
|
||||||
|
|
||||||
|
if have_rev and full_name:
|
||||||
|
for line in r:
|
||||||
|
rev, line = line.split(':', 1)
|
||||||
|
out.write("%s", rev)
|
||||||
|
out.write(':')
|
||||||
|
out.project(project.relpath)
|
||||||
|
out.write('/')
|
||||||
|
out.write("%s", line)
|
||||||
|
out.nl()
|
||||||
|
elif full_name:
|
||||||
|
for line in r:
|
||||||
|
out.project(project.relpath)
|
||||||
|
out.write('/')
|
||||||
|
out.write("%s", line)
|
||||||
|
out.nl()
|
||||||
|
else:
|
||||||
|
for line in r:
|
||||||
|
print(line)
|
||||||
|
|
||||||
if git_failed:
|
if git_failed:
|
||||||
sys.exit(1)
|
sys.exit(1)
|
||||||
|
@ -1,3 +1,5 @@
|
|||||||
|
# -*- coding:utf-8 -*-
|
||||||
|
#
|
||||||
# Copyright (C) 2008 The Android Open Source Project
|
# Copyright (C) 2008 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
@ -12,16 +14,14 @@
|
|||||||
# See the License for the specific language governing permissions and
|
# See the License for the specific language governing permissions and
|
||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
|
|
||||||
|
from __future__ import print_function
|
||||||
import re
|
import re
|
||||||
import sys
|
import sys
|
||||||
import textwrap
|
from formatter import AbstractFormatter, DumbWriter
|
||||||
|
|
||||||
from subcmds import all_commands
|
|
||||||
from color import Coloring
|
from color import Coloring
|
||||||
from command import PagedCommand, MirrorSafeCommand, GitcAvailableCommand, GitcClientCommand
|
from command import PagedCommand, MirrorSafeCommand, GitcAvailableCommand, GitcClientCommand
|
||||||
import gitc_utils
|
import gitc_utils
|
||||||
from wrapper import Wrapper
|
|
||||||
|
|
||||||
|
|
||||||
class Help(PagedCommand, MirrorSafeCommand):
|
class Help(PagedCommand, MirrorSafeCommand):
|
||||||
common = False
|
common = False
|
||||||
@ -41,7 +41,7 @@ Displays detailed usage information about a command.
|
|||||||
fmt = ' %%-%ds %%s' % maxlen
|
fmt = ' %%-%ds %%s' % maxlen
|
||||||
|
|
||||||
for name in commandNames:
|
for name in commandNames:
|
||||||
command = all_commands[name]()
|
command = self.commands[name]
|
||||||
try:
|
try:
|
||||||
summary = command.helpSummary.strip()
|
summary = command.helpSummary.strip()
|
||||||
except AttributeError:
|
except AttributeError:
|
||||||
@ -51,7 +51,7 @@ Displays detailed usage information about a command.
|
|||||||
def _PrintAllCommands(self):
|
def _PrintAllCommands(self):
|
||||||
print('usage: repo COMMAND [ARGS]')
|
print('usage: repo COMMAND [ARGS]')
|
||||||
print('The complete list of recognized repo commands are:')
|
print('The complete list of recognized repo commands are:')
|
||||||
commandNames = list(sorted(all_commands))
|
commandNames = list(sorted(self.commands))
|
||||||
self._PrintCommands(commandNames)
|
self._PrintCommands(commandNames)
|
||||||
print("See 'repo help <command>' for more information on a "
|
print("See 'repo help <command>' for more information on a "
|
||||||
'specific command.')
|
'specific command.')
|
||||||
@ -63,7 +63,7 @@ Displays detailed usage information about a command.
|
|||||||
def gitc_supported(cmd):
|
def gitc_supported(cmd):
|
||||||
if not isinstance(cmd, GitcAvailableCommand) and not isinstance(cmd, GitcClientCommand):
|
if not isinstance(cmd, GitcAvailableCommand) and not isinstance(cmd, GitcClientCommand):
|
||||||
return True
|
return True
|
||||||
if self.client.isGitcClient:
|
if self.manifest.isGitcClient:
|
||||||
return True
|
return True
|
||||||
if isinstance(cmd, GitcClientCommand):
|
if isinstance(cmd, GitcClientCommand):
|
||||||
return False
|
return False
|
||||||
@ -72,21 +72,21 @@ Displays detailed usage information about a command.
|
|||||||
return False
|
return False
|
||||||
|
|
||||||
commandNames = list(sorted([name
|
commandNames = list(sorted([name
|
||||||
for name, command in all_commands.items()
|
for name, command in self.commands.items()
|
||||||
if command.common and gitc_supported(command)]))
|
if command.common and gitc_supported(command)]))
|
||||||
self._PrintCommands(commandNames)
|
self._PrintCommands(commandNames)
|
||||||
|
|
||||||
print(
|
print(
|
||||||
"See 'repo help <command>' for more information on a specific command.\n"
|
"See 'repo help <command>' for more information on a specific command.\n"
|
||||||
"See 'repo help --all' for a complete list of recognized commands.")
|
"See 'repo help --all' for a complete list of recognized commands.")
|
||||||
print('Bug reports:', Wrapper().BUG_URL)
|
|
||||||
|
|
||||||
def _PrintCommandHelp(self, cmd, header_prefix=''):
|
def _PrintCommandHelp(self, cmd, header_prefix=''):
|
||||||
class _Out(Coloring):
|
class _Out(Coloring):
|
||||||
def __init__(self, gc):
|
def __init__(self, gc):
|
||||||
Coloring.__init__(self, gc, 'help')
|
Coloring.__init__(self, gc, 'help')
|
||||||
self.heading = self.printer('heading', attr='bold')
|
self.heading = self.printer('heading', attr='bold')
|
||||||
self._first = True
|
|
||||||
|
self.wrap = AbstractFormatter(DumbWriter())
|
||||||
|
|
||||||
def _PrintSection(self, heading, bodyAttr):
|
def _PrintSection(self, heading, bodyAttr):
|
||||||
try:
|
try:
|
||||||
@ -96,9 +96,7 @@ Displays detailed usage information about a command.
|
|||||||
if body == '' or body is None:
|
if body == '' or body is None:
|
||||||
return
|
return
|
||||||
|
|
||||||
if not self._first:
|
|
||||||
self.nl()
|
self.nl()
|
||||||
self._first = False
|
|
||||||
|
|
||||||
self.heading('%s%s', header_prefix, heading)
|
self.heading('%s%s', header_prefix, heading)
|
||||||
self.nl()
|
self.nl()
|
||||||
@ -108,8 +106,7 @@ Displays detailed usage information about a command.
|
|||||||
body = body.strip()
|
body = body.strip()
|
||||||
body = body.replace('%prog', me)
|
body = body.replace('%prog', me)
|
||||||
|
|
||||||
# Extract the title, but skip any trailing {#anchors}.
|
asciidoc_hdr = re.compile(r'^\n?#+ (.+)$')
|
||||||
asciidoc_hdr = re.compile(r'^\n?#+ ([^{]+)(\{#.+\})?$')
|
|
||||||
for para in body.split("\n\n"):
|
for para in body.split("\n\n"):
|
||||||
if para.startswith(' '):
|
if para.startswith(' '):
|
||||||
self.write('%s', para)
|
self.write('%s', para)
|
||||||
@ -124,21 +121,18 @@ Displays detailed usage information about a command.
|
|||||||
self.nl()
|
self.nl()
|
||||||
continue
|
continue
|
||||||
|
|
||||||
lines = textwrap.wrap(para.replace(' ', ' '), width=80,
|
self.wrap.add_flowing_data(para)
|
||||||
break_long_words=False, break_on_hyphens=False)
|
self.wrap.end_paragraph(1)
|
||||||
for line in lines:
|
self.wrap.end_paragraph(0)
|
||||||
self.write('%s', line)
|
|
||||||
self.nl()
|
|
||||||
self.nl()
|
|
||||||
|
|
||||||
out = _Out(self.client.globalConfig)
|
out = _Out(self.manifest.globalConfig)
|
||||||
out._PrintSection('Summary', 'helpSummary')
|
out._PrintSection('Summary', 'helpSummary')
|
||||||
cmd.OptionParser.print_help()
|
cmd.OptionParser.print_help()
|
||||||
out._PrintSection('Description', 'helpDescription')
|
out._PrintSection('Description', 'helpDescription')
|
||||||
|
|
||||||
def _PrintAllCommandHelp(self):
|
def _PrintAllCommandHelp(self):
|
||||||
for name in sorted(all_commands):
|
for name in sorted(self.commands):
|
||||||
cmd = all_commands[name]()
|
cmd = self.commands[name]
|
||||||
cmd.manifest = self.manifest
|
cmd.manifest = self.manifest
|
||||||
self._PrintCommandHelp(cmd, header_prefix='[%s] ' % (name,))
|
self._PrintCommandHelp(cmd, header_prefix='[%s] ' % (name,))
|
||||||
|
|
||||||
@ -163,7 +157,7 @@ Displays detailed usage information about a command.
|
|||||||
name = args[0]
|
name = args[0]
|
||||||
|
|
||||||
try:
|
try:
|
||||||
cmd = all_commands[name]()
|
cmd = self.commands[name]
|
||||||
except KeyError:
|
except KeyError:
|
||||||
print("repo: '%s' is not a repo command." % name, file=sys.stderr)
|
print("repo: '%s' is not a repo command." % name, file=sys.stderr)
|
||||||
sys.exit(1)
|
sys.exit(1)
|
||||||
|
@ -1,3 +1,5 @@
|
|||||||
|
# -*- coding:utf-8 -*-
|
||||||
|
#
|
||||||
# Copyright (C) 2012 The Android Open Source Project
|
# Copyright (C) 2012 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
@ -12,22 +14,18 @@
|
|||||||
# See the License for the specific language governing permissions and
|
# See the License for the specific language governing permissions and
|
||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
|
|
||||||
import optparse
|
|
||||||
|
|
||||||
from command import PagedCommand
|
from command import PagedCommand
|
||||||
from color import Coloring
|
from color import Coloring
|
||||||
from git_refs import R_M, R_HEADS
|
from git_refs import R_M
|
||||||
|
|
||||||
|
|
||||||
class _Coloring(Coloring):
|
class _Coloring(Coloring):
|
||||||
def __init__(self, config):
|
def __init__(self, config):
|
||||||
Coloring.__init__(self, config, "status")
|
Coloring.__init__(self, config, "status")
|
||||||
|
|
||||||
|
|
||||||
class Info(PagedCommand):
|
class Info(PagedCommand):
|
||||||
common = True
|
common = True
|
||||||
helpSummary = "Get info on the manifest branch, current branch or unmerged branches"
|
helpSummary = "Get info on the manifest branch, current branch or unmerged branches"
|
||||||
helpUsage = "%prog [-dl] [-o [-c]] [<project>...]"
|
helpUsage = "%prog [-dl] [-o [-b]] [<project>...]"
|
||||||
|
|
||||||
def _Options(self, p):
|
def _Options(self, p):
|
||||||
p.add_option('-d', '--diff',
|
p.add_option('-d', '--diff',
|
||||||
@ -36,28 +34,22 @@ class Info(PagedCommand):
|
|||||||
p.add_option('-o', '--overview',
|
p.add_option('-o', '--overview',
|
||||||
dest='overview', action='store_true',
|
dest='overview', action='store_true',
|
||||||
help='show overview of all local commits')
|
help='show overview of all local commits')
|
||||||
p.add_option('-c', '--current-branch',
|
p.add_option('-b', '--current-branch',
|
||||||
dest="current_branch", action="store_true",
|
dest="current_branch", action="store_true",
|
||||||
help="consider only checked out branches")
|
help="consider only checked out branches")
|
||||||
p.add_option('--no-current-branch',
|
|
||||||
dest='current_branch', action='store_false',
|
|
||||||
help='consider all local branches')
|
|
||||||
# Turn this into a warning & remove this someday.
|
|
||||||
p.add_option('-b',
|
|
||||||
dest='current_branch', action='store_true',
|
|
||||||
help=optparse.SUPPRESS_HELP)
|
|
||||||
p.add_option('-l', '--local-only',
|
p.add_option('-l', '--local-only',
|
||||||
dest="local", action="store_true",
|
dest="local", action="store_true",
|
||||||
help="disable all remote operations")
|
help="Disable all remote operations")
|
||||||
|
|
||||||
|
|
||||||
def Execute(self, opt, args):
|
def Execute(self, opt, args):
|
||||||
self.out = _Coloring(self.client.globalConfig)
|
self.out = _Coloring(self.manifest.globalConfig)
|
||||||
self.heading = self.out.printer('heading', attr='bold')
|
self.heading = self.out.printer('heading', attr = 'bold')
|
||||||
self.headtext = self.out.nofmt_printer('headtext', fg='yellow')
|
self.headtext = self.out.nofmt_printer('headtext', fg = 'yellow')
|
||||||
self.redtext = self.out.printer('redtext', fg='red')
|
self.redtext = self.out.printer('redtext', fg = 'red')
|
||||||
self.sha = self.out.printer("sha", fg='yellow')
|
self.sha = self.out.printer("sha", fg = 'yellow')
|
||||||
self.text = self.out.nofmt_printer('text')
|
self.text = self.out.nofmt_printer('text')
|
||||||
self.dimtext = self.out.printer('dimtext', attr='dim')
|
self.dimtext = self.out.printer('dimtext', attr = 'dim')
|
||||||
|
|
||||||
self.opt = opt
|
self.opt = opt
|
||||||
|
|
||||||
@ -130,14 +122,11 @@ class Info(PagedCommand):
|
|||||||
self.printSeparator()
|
self.printSeparator()
|
||||||
|
|
||||||
def findRemoteLocalDiff(self, project):
|
def findRemoteLocalDiff(self, project):
|
||||||
# Fetch all the latest commits.
|
#Fetch all the latest commits
|
||||||
if not self.opt.local:
|
if not self.opt.local:
|
||||||
project.Sync_NetworkHalf(quiet=True, current_branch_only=True)
|
project.Sync_NetworkHalf(quiet=True, current_branch_only=True)
|
||||||
|
|
||||||
branch = self.manifest.manifestProject.config.GetBranch('default').merge
|
logTarget = R_M + self.manifest.manifestProject.config.GetBranch("default").merge
|
||||||
if branch.startswith(R_HEADS):
|
|
||||||
branch = branch[len(R_HEADS):]
|
|
||||||
logTarget = R_M + branch
|
|
||||||
|
|
||||||
bareTmp = project.bare_git._bare
|
bareTmp = project.bare_git._bare
|
||||||
project.bare_git._bare = False
|
project.bare_git._bare = False
|
||||||
@ -215,7 +204,7 @@ class Info(PagedCommand):
|
|||||||
|
|
||||||
for commit in commits:
|
for commit in commits:
|
||||||
split = commit.split()
|
split = commit.split()
|
||||||
self.text('{0:38}{1} '.format('', '-'))
|
self.text('{0:38}{1} '.format('','-'))
|
||||||
self.sha(split[0] + " ")
|
self.sha(split[0] + " ")
|
||||||
self.text(" ".join(split[1:]))
|
self.text(" ".join(split[1:]))
|
||||||
self.out.nl()
|
self.out.nl()
|
||||||
|
285
subcmds/init.py
285
subcmds/init.py
@ -1,3 +1,5 @@
|
|||||||
|
# -*- coding:utf-8 -*-
|
||||||
|
#
|
||||||
# Copyright (C) 2008 The Android Open Source Project
|
# Copyright (C) 2008 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
@ -12,29 +14,34 @@
|
|||||||
# See the License for the specific language governing permissions and
|
# See the License for the specific language governing permissions and
|
||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
|
|
||||||
import optparse
|
from __future__ import print_function
|
||||||
import os
|
import os
|
||||||
import platform
|
import platform
|
||||||
import re
|
import re
|
||||||
import sys
|
import sys
|
||||||
import urllib.parse
|
|
||||||
|
from pyversion import is_python3
|
||||||
|
if is_python3():
|
||||||
|
import urllib.parse
|
||||||
|
else:
|
||||||
|
import imp
|
||||||
|
import urlparse
|
||||||
|
urllib = imp.new_module('urllib')
|
||||||
|
urllib.parse = urlparse
|
||||||
|
|
||||||
from color import Coloring
|
from color import Coloring
|
||||||
from command import InteractiveCommand, MirrorSafeCommand
|
from command import InteractiveCommand, MirrorSafeCommand
|
||||||
from error import ManifestParseError
|
from error import ManifestParseError
|
||||||
from project import SyncBuffer
|
from project import SyncBuffer
|
||||||
from git_config import GitConfig
|
from git_config import GitConfig
|
||||||
from git_command import git_require, MIN_GIT_VERSION_SOFT, MIN_GIT_VERSION_HARD
|
from git_command import git_require, MIN_GIT_VERSION
|
||||||
import git_superproject
|
|
||||||
import platform_utils
|
import platform_utils
|
||||||
from wrapper import Wrapper
|
|
||||||
|
|
||||||
|
|
||||||
class Init(InteractiveCommand, MirrorSafeCommand):
|
class Init(InteractiveCommand, MirrorSafeCommand):
|
||||||
common = True
|
common = True
|
||||||
helpSummary = "Initialize a repo client checkout in the current directory"
|
helpSummary = "Initialize repo in the current directory"
|
||||||
helpUsage = """
|
helpUsage = """
|
||||||
%prog [options] [manifest url]
|
%prog [options]
|
||||||
"""
|
"""
|
||||||
helpDescription = """
|
helpDescription = """
|
||||||
The '%prog' command is run once to install and initialize repo.
|
The '%prog' command is run once to install and initialize repo.
|
||||||
@ -42,13 +49,8 @@ The latest repo source code and manifest collection is downloaded
|
|||||||
from the server and is installed in the .repo/ directory in the
|
from the server and is installed in the .repo/ directory in the
|
||||||
current working directory.
|
current working directory.
|
||||||
|
|
||||||
When creating a new checkout, the manifest URL is the only required setting.
|
|
||||||
It may be specified using the --manifest-url option, or as the first optional
|
|
||||||
argument.
|
|
||||||
|
|
||||||
The optional -b argument can be used to select the manifest branch
|
The optional -b argument can be used to select the manifest branch
|
||||||
to checkout and use. If no branch is specified, the remote's default
|
to checkout and use. If no branch is specified, master is assumed.
|
||||||
branch is used. This is equivalent to using -b HEAD.
|
|
||||||
|
|
||||||
The optional -m argument can be used to specify an alternate manifest
|
The optional -m argument can be used to specify an alternate manifest
|
||||||
to be used. If no manifest is specified, the manifest default.xml
|
to be used. If no manifest is specified, the manifest default.xml
|
||||||
@ -79,41 +81,109 @@ manifest, a subsequent `repo sync` (or `repo sync -d`) is necessary
|
|||||||
to update the working directory files.
|
to update the working directory files.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
def _CommonOptions(self, p):
|
|
||||||
"""Disable due to re-use of Wrapper()."""
|
|
||||||
|
|
||||||
def _Options(self, p, gitc_init=False):
|
def _Options(self, p, gitc_init=False):
|
||||||
Wrapper().InitParser(p, gitc_init=gitc_init)
|
# Logging
|
||||||
|
g = p.add_option_group('Logging options')
|
||||||
|
g.add_option('-q', '--quiet',
|
||||||
|
dest="quiet", action="store_true", default=False,
|
||||||
|
help="be quiet")
|
||||||
|
|
||||||
|
# Manifest
|
||||||
|
g = p.add_option_group('Manifest options')
|
||||||
|
g.add_option('-u', '--manifest-url',
|
||||||
|
dest='manifest_url',
|
||||||
|
help='manifest repository location', metavar='URL')
|
||||||
|
g.add_option('-b', '--manifest-branch',
|
||||||
|
dest='manifest_branch',
|
||||||
|
help='manifest branch or revision', metavar='REVISION')
|
||||||
|
cbr_opts = ['--current-branch']
|
||||||
|
# The gitc-init subcommand allocates -c itself, but a lot of init users
|
||||||
|
# want -c, so try to satisfy both as best we can.
|
||||||
|
if not gitc_init:
|
||||||
|
cbr_opts += ['-c']
|
||||||
|
g.add_option(*cbr_opts,
|
||||||
|
dest='current_branch_only', action='store_true',
|
||||||
|
help='fetch only current manifest branch from server')
|
||||||
|
g.add_option('-m', '--manifest-name',
|
||||||
|
dest='manifest_name', default='default.xml',
|
||||||
|
help='initial manifest file', metavar='NAME.xml')
|
||||||
|
g.add_option('--mirror',
|
||||||
|
dest='mirror', action='store_true',
|
||||||
|
help='create a replica of the remote repositories '
|
||||||
|
'rather than a client working directory')
|
||||||
|
g.add_option('--reference',
|
||||||
|
dest='reference',
|
||||||
|
help='location of mirror directory', metavar='DIR')
|
||||||
|
g.add_option('--dissociate',
|
||||||
|
dest='dissociate', action='store_true',
|
||||||
|
help='dissociate from reference mirrors after clone')
|
||||||
|
g.add_option('--depth', type='int', default=None,
|
||||||
|
dest='depth',
|
||||||
|
help='create a shallow clone with given depth; see git clone')
|
||||||
|
g.add_option('--partial-clone', action='store_true',
|
||||||
|
dest='partial_clone',
|
||||||
|
help='perform partial clone (https://git-scm.com/'
|
||||||
|
'docs/gitrepository-layout#_code_partialclone_code)')
|
||||||
|
g.add_option('--clone-filter', action='store', default='blob:none',
|
||||||
|
dest='clone_filter',
|
||||||
|
help='filter for use with --partial-clone [default: %default]')
|
||||||
|
g.add_option('--archive',
|
||||||
|
dest='archive', action='store_true',
|
||||||
|
help='checkout an archive instead of a git repository for '
|
||||||
|
'each project. See git archive.')
|
||||||
|
g.add_option('--submodules',
|
||||||
|
dest='submodules', action='store_true',
|
||||||
|
help='sync any submodules associated with the manifest repo')
|
||||||
|
g.add_option('-g', '--groups',
|
||||||
|
dest='groups', default='default',
|
||||||
|
help='restrict manifest projects to ones with specified '
|
||||||
|
'group(s) [default|all|G1,G2,G3|G4,-G5,-G6]',
|
||||||
|
metavar='GROUP')
|
||||||
|
g.add_option('-p', '--platform',
|
||||||
|
dest='platform', default='auto',
|
||||||
|
help='restrict manifest projects to ones with a specified '
|
||||||
|
'platform group [auto|all|none|linux|darwin|...]',
|
||||||
|
metavar='PLATFORM')
|
||||||
|
g.add_option('--no-clone-bundle',
|
||||||
|
dest='no_clone_bundle', action='store_true',
|
||||||
|
help='disable use of /clone.bundle on HTTP/HTTPS')
|
||||||
|
g.add_option('--no-tags',
|
||||||
|
dest='no_tags', action='store_true',
|
||||||
|
help="don't fetch tags in the manifest")
|
||||||
|
|
||||||
|
# Tool
|
||||||
|
g = p.add_option_group('repo Version options')
|
||||||
|
g.add_option('--repo-url',
|
||||||
|
dest='repo_url',
|
||||||
|
help='repo repository location', metavar='URL')
|
||||||
|
g.add_option('--repo-branch',
|
||||||
|
dest='repo_branch',
|
||||||
|
help='repo branch or revision', metavar='REVISION')
|
||||||
|
g.add_option('--no-repo-verify',
|
||||||
|
dest='no_repo_verify', action='store_true',
|
||||||
|
help='do not verify repo source code')
|
||||||
|
|
||||||
|
# Other
|
||||||
|
g = p.add_option_group('Other options')
|
||||||
|
g.add_option('--config-name',
|
||||||
|
dest='config_name', action="store_true", default=False,
|
||||||
|
help='Always prompt for name/e-mail')
|
||||||
|
|
||||||
def _RegisteredEnvironmentOptions(self):
|
def _RegisteredEnvironmentOptions(self):
|
||||||
return {'REPO_MANIFEST_URL': 'manifest_url',
|
return {'REPO_MANIFEST_URL': 'manifest_url',
|
||||||
'REPO_MIRROR_LOCATION': 'reference'}
|
'REPO_MIRROR_LOCATION': 'reference'}
|
||||||
|
|
||||||
def _CloneSuperproject(self, opt):
|
|
||||||
"""Clone the superproject based on the superproject's url and branch.
|
|
||||||
|
|
||||||
Args:
|
|
||||||
opt: Program options returned from optparse. See _Options().
|
|
||||||
"""
|
|
||||||
superproject = git_superproject.Superproject(self.manifest,
|
|
||||||
self.repodir,
|
|
||||||
quiet=opt.quiet)
|
|
||||||
if not superproject.Sync():
|
|
||||||
print('error: git update of superproject failed', file=sys.stderr)
|
|
||||||
sys.exit(1)
|
|
||||||
|
|
||||||
def _SyncManifest(self, opt):
|
def _SyncManifest(self, opt):
|
||||||
m = self.manifest.manifestProject
|
m = self.manifest.manifestProject
|
||||||
is_new = not m.Exists
|
is_new = not m.Exists
|
||||||
|
|
||||||
if is_new:
|
if is_new:
|
||||||
if not opt.manifest_url:
|
if not opt.manifest_url:
|
||||||
print('fatal: manifest url is required.', file=sys.stderr)
|
print('fatal: manifest url (-u) is required.', file=sys.stderr)
|
||||||
sys.exit(1)
|
sys.exit(1)
|
||||||
|
|
||||||
if not opt.quiet:
|
if not opt.quiet:
|
||||||
print('Downloading manifest from %s' %
|
print('Get %s' % GitConfig.ForUser().UrlInsteadOf(opt.manifest_url),
|
||||||
(GitConfig.ForUser().UrlInsteadOf(opt.manifest_url),),
|
|
||||||
file=sys.stderr)
|
file=sys.stderr)
|
||||||
|
|
||||||
# The manifest project object doesn't keep track of the path on the
|
# The manifest project object doesn't keep track of the path on the
|
||||||
@ -130,32 +200,24 @@ to update the working directory files.
|
|||||||
|
|
||||||
m._InitGitDir(mirror_git=mirrored_manifest_git)
|
m._InitGitDir(mirror_git=mirrored_manifest_git)
|
||||||
|
|
||||||
|
if opt.manifest_branch:
|
||||||
|
m.revisionExpr = opt.manifest_branch
|
||||||
|
else:
|
||||||
|
m.revisionExpr = 'refs/heads/master'
|
||||||
|
else:
|
||||||
|
if opt.manifest_branch:
|
||||||
|
m.revisionExpr = opt.manifest_branch
|
||||||
|
else:
|
||||||
|
m.PreSync()
|
||||||
|
|
||||||
self._ConfigureDepth(opt)
|
self._ConfigureDepth(opt)
|
||||||
|
|
||||||
# Set the remote URL before the remote branch as we might need it below.
|
|
||||||
if opt.manifest_url:
|
if opt.manifest_url:
|
||||||
r = m.GetRemote(m.remote.name)
|
r = m.GetRemote(m.remote.name)
|
||||||
r.url = opt.manifest_url
|
r.url = opt.manifest_url
|
||||||
r.ResetFetch()
|
r.ResetFetch()
|
||||||
r.Save()
|
r.Save()
|
||||||
|
|
||||||
if opt.manifest_branch:
|
|
||||||
if opt.manifest_branch == 'HEAD':
|
|
||||||
opt.manifest_branch = m.ResolveRemoteHead()
|
|
||||||
if opt.manifest_branch is None:
|
|
||||||
print('fatal: unable to resolve HEAD', file=sys.stderr)
|
|
||||||
sys.exit(1)
|
|
||||||
m.revisionExpr = opt.manifest_branch
|
|
||||||
else:
|
|
||||||
if is_new:
|
|
||||||
default_branch = m.ResolveRemoteHead()
|
|
||||||
if default_branch is None:
|
|
||||||
# If the remote doesn't have HEAD configured, default to master.
|
|
||||||
default_branch = 'refs/heads/master'
|
|
||||||
m.revisionExpr = default_branch
|
|
||||||
else:
|
|
||||||
m.PreSync()
|
|
||||||
|
|
||||||
groups = re.split(r'[,\s]+', opt.groups)
|
groups = re.split(r'[,\s]+', opt.groups)
|
||||||
all_platforms = ['linux', 'darwin', 'windows']
|
all_platforms = ['linux', 'darwin', 'windows']
|
||||||
platformize = lambda x: 'platform-' + x
|
platformize = lambda x: 'platform-' + x
|
||||||
@ -173,7 +235,7 @@ to update the working directory files.
|
|||||||
|
|
||||||
groups = [x for x in groups if x]
|
groups = [x for x in groups if x]
|
||||||
groupstr = ','.join(groups)
|
groupstr = ','.join(groups)
|
||||||
if opt.platform == 'auto' and groupstr == self.manifest.GetDefaultGroupsStr():
|
if opt.platform == 'auto' and groupstr == 'default,platform-' + platform.system().lower():
|
||||||
groupstr = None
|
groupstr = None
|
||||||
m.config.SetString('manifest.groups', groupstr)
|
m.config.SetString('manifest.groups', groupstr)
|
||||||
|
|
||||||
@ -181,25 +243,11 @@ to update the working directory files.
|
|||||||
m.config.SetString('repo.reference', opt.reference)
|
m.config.SetString('repo.reference', opt.reference)
|
||||||
|
|
||||||
if opt.dissociate:
|
if opt.dissociate:
|
||||||
m.config.SetBoolean('repo.dissociate', opt.dissociate)
|
m.config.SetString('repo.dissociate', 'true')
|
||||||
|
|
||||||
if opt.worktree:
|
|
||||||
if opt.mirror:
|
|
||||||
print('fatal: --mirror and --worktree are incompatible',
|
|
||||||
file=sys.stderr)
|
|
||||||
sys.exit(1)
|
|
||||||
if opt.submodules:
|
|
||||||
print('fatal: --submodules and --worktree are incompatible',
|
|
||||||
file=sys.stderr)
|
|
||||||
sys.exit(1)
|
|
||||||
m.config.SetBoolean('repo.worktree', opt.worktree)
|
|
||||||
if is_new:
|
|
||||||
m.use_git_worktrees = True
|
|
||||||
print('warning: --worktree is experimental!', file=sys.stderr)
|
|
||||||
|
|
||||||
if opt.archive:
|
if opt.archive:
|
||||||
if is_new:
|
if is_new:
|
||||||
m.config.SetBoolean('repo.archive', opt.archive)
|
m.config.SetString('repo.archive', 'true')
|
||||||
else:
|
else:
|
||||||
print('fatal: --archive is only supported when initializing a new '
|
print('fatal: --archive is only supported when initializing a new '
|
||||||
'workspace.', file=sys.stderr)
|
'workspace.', file=sys.stderr)
|
||||||
@ -209,7 +257,7 @@ to update the working directory files.
|
|||||||
|
|
||||||
if opt.mirror:
|
if opt.mirror:
|
||||||
if is_new:
|
if is_new:
|
||||||
m.config.SetBoolean('repo.mirror', opt.mirror)
|
m.config.SetString('repo.mirror', 'true')
|
||||||
else:
|
else:
|
||||||
print('fatal: --mirror is only supported when initializing a new '
|
print('fatal: --mirror is only supported when initializing a new '
|
||||||
'workspace.', file=sys.stderr)
|
'workspace.', file=sys.stderr)
|
||||||
@ -217,39 +265,25 @@ to update the working directory files.
|
|||||||
'in another location.', file=sys.stderr)
|
'in another location.', file=sys.stderr)
|
||||||
sys.exit(1)
|
sys.exit(1)
|
||||||
|
|
||||||
if opt.partial_clone is not None:
|
if opt.partial_clone:
|
||||||
if opt.mirror:
|
if opt.mirror:
|
||||||
print('fatal: --mirror and --partial-clone are mutually exclusive',
|
print('fatal: --mirror and --partial-clone are mutually exclusive',
|
||||||
file=sys.stderr)
|
file=sys.stderr)
|
||||||
sys.exit(1)
|
sys.exit(1)
|
||||||
m.config.SetBoolean('repo.partialclone', opt.partial_clone)
|
m.config.SetString('repo.partialclone', 'true')
|
||||||
if opt.clone_filter:
|
if opt.clone_filter:
|
||||||
m.config.SetString('repo.clonefilter', opt.clone_filter)
|
m.config.SetString('repo.clonefilter', opt.clone_filter)
|
||||||
elif m.config.GetBoolean('repo.partialclone'):
|
|
||||||
opt.clone_filter = m.config.GetString('repo.clonefilter')
|
|
||||||
else:
|
else:
|
||||||
opt.clone_filter = None
|
opt.clone_filter = None
|
||||||
|
|
||||||
if opt.partial_clone_exclude is not None:
|
|
||||||
m.config.SetString('repo.partialcloneexclude', opt.partial_clone_exclude)
|
|
||||||
|
|
||||||
if opt.clone_bundle is None:
|
|
||||||
opt.clone_bundle = False if opt.partial_clone else True
|
|
||||||
else:
|
|
||||||
m.config.SetBoolean('repo.clonebundle', opt.clone_bundle)
|
|
||||||
|
|
||||||
if opt.submodules:
|
if opt.submodules:
|
||||||
m.config.SetBoolean('repo.submodules', opt.submodules)
|
m.config.SetString('repo.submodules', 'true')
|
||||||
|
|
||||||
if opt.use_superproject is not None:
|
if not m.Sync_NetworkHalf(is_new=is_new, quiet=opt.quiet,
|
||||||
m.config.SetBoolean('repo.superproject', opt.use_superproject)
|
clone_bundle=not opt.no_clone_bundle,
|
||||||
|
|
||||||
if not m.Sync_NetworkHalf(is_new=is_new, quiet=opt.quiet, verbose=opt.verbose,
|
|
||||||
clone_bundle=opt.clone_bundle,
|
|
||||||
current_branch_only=opt.current_branch_only,
|
current_branch_only=opt.current_branch_only,
|
||||||
tags=opt.tags, submodules=opt.submodules,
|
no_tags=opt.no_tags, submodules=opt.submodules,
|
||||||
clone_filter=opt.clone_filter,
|
clone_filter=opt.clone_filter):
|
||||||
partial_clone_exclude=self.manifest.PartialCloneExclude):
|
|
||||||
r = m.GetRemote(m.remote.name)
|
r = m.GetRemote(m.remote.name)
|
||||||
print('fatal: cannot obtain manifest %s' % r.url, file=sys.stderr)
|
print('fatal: cannot obtain manifest %s' % r.url, file=sys.stderr)
|
||||||
|
|
||||||
@ -292,8 +326,8 @@ to update the working directory files.
|
|||||||
return value
|
return value
|
||||||
return a
|
return a
|
||||||
|
|
||||||
def _ShouldConfigureUser(self, opt):
|
def _ShouldConfigureUser(self):
|
||||||
gc = self.client.globalConfig
|
gc = self.manifest.globalConfig
|
||||||
mp = self.manifest.manifestProject
|
mp = self.manifest.manifestProject
|
||||||
|
|
||||||
# If we don't have local settings, get from global.
|
# If we don't have local settings, get from global.
|
||||||
@ -304,23 +338,20 @@ to update the working directory files.
|
|||||||
mp.config.SetString('user.name', gc.GetString('user.name'))
|
mp.config.SetString('user.name', gc.GetString('user.name'))
|
||||||
mp.config.SetString('user.email', gc.GetString('user.email'))
|
mp.config.SetString('user.email', gc.GetString('user.email'))
|
||||||
|
|
||||||
if not opt.quiet:
|
|
||||||
print()
|
print()
|
||||||
print('Your identity is: %s <%s>' % (mp.config.GetString('user.name'),
|
print('Your identity is: %s <%s>' % (mp.config.GetString('user.name'),
|
||||||
mp.config.GetString('user.email')))
|
mp.config.GetString('user.email')))
|
||||||
print("If you want to change this, please re-run 'repo init' with --config-name")
|
print('If you want to change this, please re-run \'repo init\' with --config-name')
|
||||||
return False
|
return False
|
||||||
|
|
||||||
def _ConfigureUser(self, opt):
|
def _ConfigureUser(self):
|
||||||
mp = self.manifest.manifestProject
|
mp = self.manifest.manifestProject
|
||||||
|
|
||||||
while True:
|
while True:
|
||||||
if not opt.quiet:
|
|
||||||
print()
|
print()
|
||||||
name = self._Prompt('Your Name', mp.UserName)
|
name = self._Prompt('Your Name', mp.UserName)
|
||||||
email = self._Prompt('Your Email', mp.UserEmail)
|
email = self._Prompt('Your Email', mp.UserEmail)
|
||||||
|
|
||||||
if not opt.quiet:
|
|
||||||
print()
|
print()
|
||||||
print('Your identity is: %s <%s>' % (name, email))
|
print('Your identity is: %s <%s>' % (name, email))
|
||||||
print('is this correct [y/N]? ', end='')
|
print('is this correct [y/N]? ', end='')
|
||||||
@ -342,7 +373,7 @@ to update the working directory files.
|
|||||||
return False
|
return False
|
||||||
|
|
||||||
def _ConfigureColor(self):
|
def _ConfigureColor(self):
|
||||||
gc = self.client.globalConfig
|
gc = self.manifest.globalConfig
|
||||||
if self._HasColorSet(gc):
|
if self._HasColorSet(gc):
|
||||||
return
|
return
|
||||||
|
|
||||||
@ -393,16 +424,15 @@ to update the working directory files.
|
|||||||
# We store the depth in the main manifest project.
|
# We store the depth in the main manifest project.
|
||||||
self.manifest.manifestProject.config.SetString('repo.depth', depth)
|
self.manifest.manifestProject.config.SetString('repo.depth', depth)
|
||||||
|
|
||||||
def _DisplayResult(self, opt):
|
def _DisplayResult(self):
|
||||||
if self.manifest.IsMirror:
|
if self.manifest.IsMirror:
|
||||||
init_type = 'mirror '
|
init_type = 'mirror '
|
||||||
else:
|
else:
|
||||||
init_type = ''
|
init_type = ''
|
||||||
|
|
||||||
if not opt.quiet:
|
|
||||||
print()
|
print()
|
||||||
print('repo %shas been initialized in %s' %
|
print('repo %shas been initialized in %s'
|
||||||
(init_type, self.manifest.topdir))
|
% (init_type, self.manifest.topdir))
|
||||||
|
|
||||||
current_dir = os.getcwd()
|
current_dir = os.getcwd()
|
||||||
if current_dir != self.manifest.topdir:
|
if current_dir != self.manifest.topdir:
|
||||||
@ -420,56 +450,15 @@ to update the working directory files.
|
|||||||
if opt.archive and opt.mirror:
|
if opt.archive and opt.mirror:
|
||||||
self.OptionParser.error('--mirror and --archive cannot be used together.')
|
self.OptionParser.error('--mirror and --archive cannot be used together.')
|
||||||
|
|
||||||
if args:
|
|
||||||
if opt.manifest_url:
|
|
||||||
self.OptionParser.error(
|
|
||||||
'--manifest-url option and URL argument both specified: only use '
|
|
||||||
'one to select the manifest URL.')
|
|
||||||
|
|
||||||
opt.manifest_url = args.pop(0)
|
|
||||||
|
|
||||||
if args:
|
|
||||||
self.OptionParser.error('too many arguments to init')
|
|
||||||
|
|
||||||
def Execute(self, opt, args):
|
def Execute(self, opt, args):
|
||||||
git_require(MIN_GIT_VERSION_HARD, fail=True)
|
git_require(MIN_GIT_VERSION, fail=True)
|
||||||
if not git_require(MIN_GIT_VERSION_SOFT):
|
|
||||||
print('repo: warning: git-%s+ will soon be required; please upgrade your '
|
|
||||||
'version of git to maintain support.'
|
|
||||||
% ('.'.join(str(x) for x in MIN_GIT_VERSION_SOFT),),
|
|
||||||
file=sys.stderr)
|
|
||||||
|
|
||||||
rp = self.manifest.repoProject
|
|
||||||
|
|
||||||
# Handle new --repo-url requests.
|
|
||||||
if opt.repo_url:
|
|
||||||
remote = rp.GetRemote('origin')
|
|
||||||
remote.url = opt.repo_url
|
|
||||||
remote.Save()
|
|
||||||
|
|
||||||
# Handle new --repo-rev requests.
|
|
||||||
if opt.repo_rev:
|
|
||||||
wrapper = Wrapper()
|
|
||||||
remote_ref, rev = wrapper.check_repo_rev(
|
|
||||||
rp.gitdir, opt.repo_rev, repo_verify=opt.repo_verify, quiet=opt.quiet)
|
|
||||||
branch = rp.GetBranch('default')
|
|
||||||
branch.merge = remote_ref
|
|
||||||
rp.work_git.reset('--hard', rev)
|
|
||||||
branch.Save()
|
|
||||||
|
|
||||||
if opt.worktree:
|
|
||||||
# Older versions of git supported worktree, but had dangerous gc bugs.
|
|
||||||
git_require((2, 15, 0), fail=True, msg='git gc worktree corruption')
|
|
||||||
|
|
||||||
self._SyncManifest(opt)
|
self._SyncManifest(opt)
|
||||||
self._LinkManifest(opt.manifest_name)
|
self._LinkManifest(opt.manifest_name)
|
||||||
|
|
||||||
if self.manifest.manifestProject.config.GetBoolean('repo.superproject'):
|
|
||||||
self._CloneSuperproject(opt)
|
|
||||||
|
|
||||||
if os.isatty(0) and os.isatty(1) and not self.manifest.IsMirror:
|
if os.isatty(0) and os.isatty(1) and not self.manifest.IsMirror:
|
||||||
if opt.config_name or self._ShouldConfigureUser(opt):
|
if opt.config_name or self._ShouldConfigureUser():
|
||||||
self._ConfigureUser(opt)
|
self._ConfigureUser()
|
||||||
self._ConfigureColor()
|
self._ConfigureColor()
|
||||||
|
|
||||||
self._DisplayResult(opt)
|
self._DisplayResult()
|
||||||
|
@ -1,3 +1,5 @@
|
|||||||
|
# -*- coding:utf-8 -*-
|
||||||
|
#
|
||||||
# Copyright (C) 2011 The Android Open Source Project
|
# Copyright (C) 2011 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
@ -12,46 +14,40 @@
|
|||||||
# See the License for the specific language governing permissions and
|
# See the License for the specific language governing permissions and
|
||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
|
|
||||||
from command import Command, MirrorSafeCommand
|
from __future__ import print_function
|
||||||
|
import sys
|
||||||
|
|
||||||
|
from command import Command, MirrorSafeCommand
|
||||||
|
|
||||||
class List(Command, MirrorSafeCommand):
|
class List(Command, MirrorSafeCommand):
|
||||||
common = True
|
common = True
|
||||||
helpSummary = "List projects and their associated directories"
|
helpSummary = "List projects and their associated directories"
|
||||||
helpUsage = """
|
helpUsage = """
|
||||||
%prog [-f] [<project>...]
|
%prog [-f] [<project>...]
|
||||||
%prog [-f] -r str1 [str2]...
|
%prog [-f] -r str1 [str2]..."
|
||||||
"""
|
"""
|
||||||
helpDescription = """
|
helpDescription = """
|
||||||
List all projects; pass '.' to list the project for the cwd.
|
List all projects; pass '.' to list the project for the cwd.
|
||||||
|
|
||||||
By default, only projects that currently exist in the checkout are shown. If
|
|
||||||
you want to list all projects (using the specified filter settings), use the
|
|
||||||
--all option. If you want to show all projects regardless of the manifest
|
|
||||||
groups, then also pass --groups all.
|
|
||||||
|
|
||||||
This is similar to running: repo forall -c 'echo "$REPO_PATH : $REPO_PROJECT"'.
|
This is similar to running: repo forall -c 'echo "$REPO_PATH : $REPO_PROJECT"'.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
def _Options(self, p):
|
def _Options(self, p):
|
||||||
p.add_option('-r', '--regex',
|
p.add_option('-r', '--regex',
|
||||||
dest='regex', action='store_true',
|
dest='regex', action='store_true',
|
||||||
help='filter the project list based on regex or wildcard matching of strings')
|
help="Filter the project list based on regex or wildcard matching of strings")
|
||||||
p.add_option('-g', '--groups',
|
p.add_option('-g', '--groups',
|
||||||
dest='groups',
|
dest='groups',
|
||||||
help='filter the project list based on the groups the project is in')
|
help="Filter the project list based on the groups the project is in")
|
||||||
p.add_option('-a', '--all',
|
|
||||||
action='store_true',
|
|
||||||
help='show projects regardless of checkout state')
|
|
||||||
p.add_option('-f', '--fullpath',
|
p.add_option('-f', '--fullpath',
|
||||||
dest='fullpath', action='store_true',
|
dest='fullpath', action='store_true',
|
||||||
help='display the full work tree path instead of the relative path')
|
help="Display the full work tree path instead of the relative path")
|
||||||
p.add_option('-n', '--name-only',
|
p.add_option('-n', '--name-only',
|
||||||
dest='name_only', action='store_true',
|
dest='name_only', action='store_true',
|
||||||
help='display only the name of the repository')
|
help="Display only the name of the repository")
|
||||||
p.add_option('-p', '--path-only',
|
p.add_option('-p', '--path-only',
|
||||||
dest='path_only', action='store_true',
|
dest='path_only', action='store_true',
|
||||||
help='display only the path of the repository')
|
help="Display only the path of the repository")
|
||||||
|
|
||||||
def ValidateOptions(self, opt, args):
|
def ValidateOptions(self, opt, args):
|
||||||
if opt.fullpath and opt.name_only:
|
if opt.fullpath and opt.name_only:
|
||||||
@ -69,7 +65,7 @@ This is similar to running: repo forall -c 'echo "$REPO_PATH : $REPO_PROJECT"'.
|
|||||||
args: Positional args. Can be a list of projects to list, or empty.
|
args: Positional args. Can be a list of projects to list, or empty.
|
||||||
"""
|
"""
|
||||||
if not opt.regex:
|
if not opt.regex:
|
||||||
projects = self.GetProjects(args, groups=opt.groups, missing_ok=opt.all)
|
projects = self.GetProjects(args, groups=opt.groups)
|
||||||
else:
|
else:
|
||||||
projects = self.FindProjects(args)
|
projects = self.FindProjects(args)
|
||||||
|
|
||||||
@ -81,12 +77,11 @@ This is similar to running: repo forall -c 'echo "$REPO_PATH : $REPO_PROJECT"'.
|
|||||||
lines = []
|
lines = []
|
||||||
for project in projects:
|
for project in projects:
|
||||||
if opt.name_only and not opt.path_only:
|
if opt.name_only and not opt.path_only:
|
||||||
lines.append("%s" % (project.name))
|
lines.append("%s" % ( project.name))
|
||||||
elif opt.path_only and not opt.name_only:
|
elif opt.path_only and not opt.name_only:
|
||||||
lines.append("%s" % (_getpath(project)))
|
lines.append("%s" % (_getpath(project)))
|
||||||
else:
|
else:
|
||||||
lines.append("%s : %s" % (_getpath(project), project.name))
|
lines.append("%s : %s" % (_getpath(project), project.name))
|
||||||
|
|
||||||
if lines:
|
|
||||||
lines.sort()
|
lines.sort()
|
||||||
print('\n'.join(lines))
|
print('\n'.join(lines))
|
||||||
|
@ -1,3 +1,5 @@
|
|||||||
|
# -*- coding:utf-8 -*-
|
||||||
|
#
|
||||||
# Copyright (C) 2009 The Android Open Source Project
|
# Copyright (C) 2009 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
@ -12,32 +14,25 @@
|
|||||||
# See the License for the specific language governing permissions and
|
# See the License for the specific language governing permissions and
|
||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
|
|
||||||
import json
|
from __future__ import print_function
|
||||||
import os
|
import os
|
||||||
import sys
|
import sys
|
||||||
|
|
||||||
from command import PagedCommand
|
from command import PagedCommand
|
||||||
|
|
||||||
|
|
||||||
class Manifest(PagedCommand):
|
class Manifest(PagedCommand):
|
||||||
common = False
|
common = False
|
||||||
helpSummary = "Manifest inspection utility"
|
helpSummary = "Manifest inspection utility"
|
||||||
helpUsage = """
|
helpUsage = """
|
||||||
%prog [-o {-|NAME.xml}] [-m MANIFEST.xml] [-r]
|
%prog [-o {-|NAME.xml} [-r]]
|
||||||
"""
|
"""
|
||||||
_helpDescription = """
|
_helpDescription = """
|
||||||
|
|
||||||
With the -o option, exports the current manifest for inspection.
|
With the -o option, exports the current manifest for inspection.
|
||||||
The manifest and (if present) local_manifests/ are combined
|
The manifest and (if present) local_manifest.xml are combined
|
||||||
together to produce a single manifest file. This file can be stored
|
together to produce a single manifest file. This file can be stored
|
||||||
in a Git repository for use during future 'repo init' invocations.
|
in a Git repository for use during future 'repo init' invocations.
|
||||||
|
|
||||||
The -r option can be used to generate a manifest file with project
|
|
||||||
revisions set to the current commit hash. These are known as
|
|
||||||
"revision locked manifests", as they don't follow a particular branch.
|
|
||||||
In this case, the 'upstream' attribute is set to the ref we were on
|
|
||||||
when the manifest was generated. The 'dest-branch' attribute is set
|
|
||||||
to indicate the remote ref to push changes to via 'repo upload'.
|
|
||||||
"""
|
"""
|
||||||
|
|
||||||
@property
|
@property
|
||||||
@ -53,58 +48,26 @@ to indicate the remote ref to push changes to via 'repo upload'.
|
|||||||
def _Options(self, p):
|
def _Options(self, p):
|
||||||
p.add_option('-r', '--revision-as-HEAD',
|
p.add_option('-r', '--revision-as-HEAD',
|
||||||
dest='peg_rev', action='store_true',
|
dest='peg_rev', action='store_true',
|
||||||
help='save revisions as current HEAD')
|
help='Save revisions as current HEAD')
|
||||||
p.add_option('-m', '--manifest-name',
|
|
||||||
help='temporary manifest to use for this sync', metavar='NAME.xml')
|
|
||||||
p.add_option('--suppress-upstream-revision', dest='peg_rev_upstream',
|
p.add_option('--suppress-upstream-revision', dest='peg_rev_upstream',
|
||||||
default=True, action='store_false',
|
default=True, action='store_false',
|
||||||
help='if in -r mode, do not write the upstream field '
|
help='If in -r mode, do not write the upstream field. '
|
||||||
'(only of use if the branch names for a sha1 manifest are '
|
'Only of use if the branch names for a sha1 manifest are '
|
||||||
'sensitive)')
|
'sensitive.')
|
||||||
p.add_option('--suppress-dest-branch', dest='peg_rev_dest_branch',
|
|
||||||
default=True, action='store_false',
|
|
||||||
help='if in -r mode, do not write the dest-branch field '
|
|
||||||
'(only of use if the branch names for a sha1 manifest are '
|
|
||||||
'sensitive)')
|
|
||||||
p.add_option('--json', default=False, action='store_true',
|
|
||||||
help='output manifest in JSON format (experimental)')
|
|
||||||
p.add_option('--pretty', default=False, action='store_true',
|
|
||||||
help='format output for humans to read')
|
|
||||||
p.add_option('-o', '--output-file',
|
p.add_option('-o', '--output-file',
|
||||||
dest='output_file',
|
dest='output_file',
|
||||||
default='-',
|
default='-',
|
||||||
help='file to save the manifest to',
|
help='File to save the manifest to',
|
||||||
metavar='-|NAME.xml')
|
metavar='-|NAME.xml')
|
||||||
|
|
||||||
def _Output(self, opt):
|
def _Output(self, opt):
|
||||||
# If alternate manifest is specified, override the manifest file that we're using.
|
|
||||||
if opt.manifest_name:
|
|
||||||
self.manifest.Override(opt.manifest_name, False)
|
|
||||||
|
|
||||||
if opt.output_file == '-':
|
if opt.output_file == '-':
|
||||||
fd = sys.stdout
|
fd = sys.stdout
|
||||||
else:
|
else:
|
||||||
fd = open(opt.output_file, 'w')
|
fd = open(opt.output_file, 'w')
|
||||||
if opt.json:
|
|
||||||
print('warning: --json is experimental!', file=sys.stderr)
|
|
||||||
doc = self.manifest.ToDict(peg_rev=opt.peg_rev,
|
|
||||||
peg_rev_upstream=opt.peg_rev_upstream,
|
|
||||||
peg_rev_dest_branch=opt.peg_rev_dest_branch)
|
|
||||||
|
|
||||||
json_settings = {
|
|
||||||
# JSON style guide says Uunicode characters are fully allowed.
|
|
||||||
'ensure_ascii': False,
|
|
||||||
# We use 2 space indent to match JSON style guide.
|
|
||||||
'indent': 2 if opt.pretty else None,
|
|
||||||
'separators': (',', ': ') if opt.pretty else (',', ':'),
|
|
||||||
'sort_keys': True,
|
|
||||||
}
|
|
||||||
fd.write(json.dumps(doc, **json_settings))
|
|
||||||
else:
|
|
||||||
self.manifest.Save(fd,
|
self.manifest.Save(fd,
|
||||||
peg_rev=opt.peg_rev,
|
peg_rev = opt.peg_rev,
|
||||||
peg_rev_upstream=opt.peg_rev_upstream,
|
peg_rev_upstream = opt.peg_rev_upstream)
|
||||||
peg_rev_dest_branch=opt.peg_rev_dest_branch)
|
|
||||||
fd.close()
|
fd.close()
|
||||||
if opt.output_file != '-':
|
if opt.output_file != '-':
|
||||||
print('Saved manifest to %s' % opt.output_file, file=sys.stderr)
|
print('Saved manifest to %s' % opt.output_file, file=sys.stderr)
|
||||||
|
@ -1,3 +1,5 @@
|
|||||||
|
# -*- coding:utf-8 -*-
|
||||||
|
#
|
||||||
# Copyright (C) 2012 The Android Open Source Project
|
# Copyright (C) 2012 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
@ -12,8 +14,7 @@
|
|||||||
# See the License for the specific language governing permissions and
|
# See the License for the specific language governing permissions and
|
||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
|
|
||||||
import optparse
|
from __future__ import print_function
|
||||||
|
|
||||||
from color import Coloring
|
from color import Coloring
|
||||||
from command import PagedCommand
|
from command import PagedCommand
|
||||||
|
|
||||||
@ -28,22 +29,15 @@ class Overview(PagedCommand):
|
|||||||
The '%prog' command is used to display an overview of the projects branches,
|
The '%prog' command is used to display an overview of the projects branches,
|
||||||
and list any local commits that have not yet been merged into the project.
|
and list any local commits that have not yet been merged into the project.
|
||||||
|
|
||||||
The -c/--current-branch option can be used to restrict the output to only
|
The -b/--current-branch option can be used to restrict the output to only
|
||||||
branches currently checked out in each project. By default, all branches
|
branches currently checked out in each project. By default, all branches
|
||||||
are displayed.
|
are displayed.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
def _Options(self, p):
|
def _Options(self, p):
|
||||||
p.add_option('-c', '--current-branch',
|
p.add_option('-b', '--current-branch',
|
||||||
dest="current_branch", action="store_true",
|
dest="current_branch", action="store_true",
|
||||||
help="consider only checked out branches")
|
help="Consider only checked out branches")
|
||||||
p.add_option('--no-current-branch',
|
|
||||||
dest='current_branch', action='store_false',
|
|
||||||
help='consider all local branches')
|
|
||||||
# Turn this into a warning & remove this someday.
|
|
||||||
p.add_option('-b',
|
|
||||||
dest='current_branch', action='store_true',
|
|
||||||
help=optparse.SUPPRESS_HELP)
|
|
||||||
|
|
||||||
def Execute(self, opt, args):
|
def Execute(self, opt, args):
|
||||||
all_branches = []
|
all_branches = []
|
||||||
|
@ -1,3 +1,5 @@
|
|||||||
|
# -*- coding:utf-8 -*-
|
||||||
|
#
|
||||||
# Copyright (C) 2008 The Android Open Source Project
|
# Copyright (C) 2008 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
@ -12,11 +14,9 @@
|
|||||||
# See the License for the specific language governing permissions and
|
# See the License for the specific language governing permissions and
|
||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
|
|
||||||
import itertools
|
from __future__ import print_function
|
||||||
|
|
||||||
from color import Coloring
|
from color import Coloring
|
||||||
from command import DEFAULT_LOCAL_JOBS, PagedCommand
|
from command import PagedCommand
|
||||||
|
|
||||||
|
|
||||||
class Prune(PagedCommand):
|
class Prune(PagedCommand):
|
||||||
common = True
|
common = True
|
||||||
@ -24,26 +24,11 @@ class Prune(PagedCommand):
|
|||||||
helpUsage = """
|
helpUsage = """
|
||||||
%prog [<project>...]
|
%prog [<project>...]
|
||||||
"""
|
"""
|
||||||
PARALLEL_JOBS = DEFAULT_LOCAL_JOBS
|
|
||||||
|
|
||||||
def _ExecuteOne(self, project):
|
|
||||||
"""Process one project."""
|
|
||||||
return project.PruneHeads()
|
|
||||||
|
|
||||||
def Execute(self, opt, args):
|
def Execute(self, opt, args):
|
||||||
projects = self.GetProjects(args)
|
all_branches = []
|
||||||
|
for project in self.GetProjects(args):
|
||||||
# NB: Should be able to refactor this module to display summary as results
|
all_branches.extend(project.PruneHeads())
|
||||||
# come back from children.
|
|
||||||
def _ProcessResults(_pool, _output, results):
|
|
||||||
return list(itertools.chain.from_iterable(results))
|
|
||||||
|
|
||||||
all_branches = self.ExecuteInParallel(
|
|
||||||
opt.jobs,
|
|
||||||
self._ExecuteOne,
|
|
||||||
projects,
|
|
||||||
callback=_ProcessResults,
|
|
||||||
ordered=True)
|
|
||||||
|
|
||||||
if not all_branches:
|
if not all_branches:
|
||||||
return
|
return
|
||||||
|
@ -1,3 +1,5 @@
|
|||||||
|
# -*- coding:utf-8 -*-
|
||||||
|
#
|
||||||
# Copyright (C) 2010 The Android Open Source Project
|
# Copyright (C) 2010 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
@ -12,6 +14,7 @@
|
|||||||
# See the License for the specific language governing permissions and
|
# See the License for the specific language governing permissions and
|
||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
|
|
||||||
|
from __future__ import print_function
|
||||||
import sys
|
import sys
|
||||||
|
|
||||||
from color import Coloring
|
from color import Coloring
|
||||||
@ -39,34 +42,36 @@ branch but need to incorporate new upstream changes "underneath" them.
|
|||||||
"""
|
"""
|
||||||
|
|
||||||
def _Options(self, p):
|
def _Options(self, p):
|
||||||
g = p.get_option_group('--quiet')
|
p.add_option('-i', '--interactive',
|
||||||
g.add_option('-i', '--interactive',
|
|
||||||
dest="interactive", action="store_true",
|
dest="interactive", action="store_true",
|
||||||
help="interactive rebase (single project only)")
|
help="interactive rebase (single project only)")
|
||||||
|
|
||||||
p.add_option('--fail-fast',
|
p.add_option('--fail-fast',
|
||||||
dest='fail_fast', action='store_true',
|
dest='fail_fast', action='store_true',
|
||||||
help='stop rebasing after first error is hit')
|
help='Stop rebasing after first error is hit')
|
||||||
p.add_option('-f', '--force-rebase',
|
p.add_option('-f', '--force-rebase',
|
||||||
dest='force_rebase', action='store_true',
|
dest='force_rebase', action='store_true',
|
||||||
help='pass --force-rebase to git rebase')
|
help='Pass --force-rebase to git rebase')
|
||||||
p.add_option('--no-ff',
|
p.add_option('--no-ff',
|
||||||
dest='ff', default=True, action='store_false',
|
dest='no_ff', action='store_true',
|
||||||
help='pass --no-ff to git rebase')
|
help='Pass --no-ff to git rebase')
|
||||||
|
p.add_option('-q', '--quiet',
|
||||||
|
dest='quiet', action='store_true',
|
||||||
|
help='Pass --quiet to git rebase')
|
||||||
p.add_option('--autosquash',
|
p.add_option('--autosquash',
|
||||||
dest='autosquash', action='store_true',
|
dest='autosquash', action='store_true',
|
||||||
help='pass --autosquash to git rebase')
|
help='Pass --autosquash to git rebase')
|
||||||
p.add_option('--whitespace',
|
p.add_option('--whitespace',
|
||||||
dest='whitespace', action='store', metavar='WS',
|
dest='whitespace', action='store', metavar='WS',
|
||||||
help='pass --whitespace to git rebase')
|
help='Pass --whitespace to git rebase')
|
||||||
p.add_option('--auto-stash',
|
p.add_option('--auto-stash',
|
||||||
dest='auto_stash', action='store_true',
|
dest='auto_stash', action='store_true',
|
||||||
help='stash local modifications before starting')
|
help='Stash local modifications before starting')
|
||||||
p.add_option('-m', '--onto-manifest',
|
p.add_option('-m', '--onto-manifest',
|
||||||
dest='onto_manifest', action='store_true',
|
dest='onto_manifest', action='store_true',
|
||||||
help='rebase onto the manifest version instead of upstream '
|
help='Rebase onto the manifest version instead of upstream '
|
||||||
'HEAD (this helps to make sure the local tree stays '
|
'HEAD. This helps to make sure the local tree stays '
|
||||||
'consistent if you previously synced to a manifest)')
|
'consistent if you previously synced to a manifest.')
|
||||||
|
|
||||||
def Execute(self, opt, args):
|
def Execute(self, opt, args):
|
||||||
all_projects = self.GetProjects(args)
|
all_projects = self.GetProjects(args)
|
||||||
@ -88,7 +93,7 @@ branch but need to incorporate new upstream changes "underneath" them.
|
|||||||
common_args.append('--quiet')
|
common_args.append('--quiet')
|
||||||
if opt.force_rebase:
|
if opt.force_rebase:
|
||||||
common_args.append('--force-rebase')
|
common_args.append('--force-rebase')
|
||||||
if not opt.ff:
|
if opt.no_ff:
|
||||||
common_args.append('--no-ff')
|
common_args.append('--no-ff')
|
||||||
if opt.autosquash:
|
if opt.autosquash:
|
||||||
common_args.append('--autosquash')
|
common_args.append('--autosquash')
|
||||||
|
@ -1,3 +1,5 @@
|
|||||||
|
# -*- coding:utf-8 -*-
|
||||||
|
#
|
||||||
# Copyright (C) 2009 The Android Open Source Project
|
# Copyright (C) 2009 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
@ -12,6 +14,7 @@
|
|||||||
# See the License for the specific language governing permissions and
|
# See the License for the specific language governing permissions and
|
||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
|
|
||||||
|
from __future__ import print_function
|
||||||
from optparse import SUPPRESS_HELP
|
from optparse import SUPPRESS_HELP
|
||||||
import sys
|
import sys
|
||||||
|
|
||||||
@ -19,7 +22,6 @@ from command import Command, MirrorSafeCommand
|
|||||||
from subcmds.sync import _PostRepoUpgrade
|
from subcmds.sync import _PostRepoUpgrade
|
||||||
from subcmds.sync import _PostRepoFetch
|
from subcmds.sync import _PostRepoFetch
|
||||||
|
|
||||||
|
|
||||||
class Selfupdate(Command, MirrorSafeCommand):
|
class Selfupdate(Command, MirrorSafeCommand):
|
||||||
common = False
|
common = False
|
||||||
helpSummary = "Update repo to the latest version"
|
helpSummary = "Update repo to the latest version"
|
||||||
@ -37,7 +39,7 @@ need to be performed by an end-user.
|
|||||||
def _Options(self, p):
|
def _Options(self, p):
|
||||||
g = p.add_option_group('repo Version options')
|
g = p.add_option_group('repo Version options')
|
||||||
g.add_option('--no-repo-verify',
|
g.add_option('--no-repo-verify',
|
||||||
dest='repo_verify', default=True, action='store_false',
|
dest='no_repo_verify', action='store_true',
|
||||||
help='do not verify repo source code')
|
help='do not verify repo source code')
|
||||||
g.add_option('--repo-upgraded',
|
g.add_option('--repo-upgraded',
|
||||||
dest='repo_upgraded', action='store_true',
|
dest='repo_upgraded', action='store_true',
|
||||||
@ -57,5 +59,5 @@ need to be performed by an end-user.
|
|||||||
|
|
||||||
rp.bare_git.gc('--auto')
|
rp.bare_git.gc('--auto')
|
||||||
_PostRepoFetch(rp,
|
_PostRepoFetch(rp,
|
||||||
repo_verify=opt.repo_verify,
|
no_repo_verify = opt.no_repo_verify,
|
||||||
verbose=True)
|
verbose = True)
|
||||||
|
@ -1,3 +1,5 @@
|
|||||||
|
# -*- coding:utf-8 -*-
|
||||||
|
#
|
||||||
# Copyright (C) 2010 The Android Open Source Project
|
# Copyright (C) 2010 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
@ -14,7 +16,6 @@
|
|||||||
|
|
||||||
from subcmds.sync import Sync
|
from subcmds.sync import Sync
|
||||||
|
|
||||||
|
|
||||||
class Smartsync(Sync):
|
class Smartsync(Sync):
|
||||||
common = True
|
common = True
|
||||||
helpSummary = "Update working tree to the latest known good revision"
|
helpSummary = "Update working tree to the latest known good revision"
|
||||||
|
@ -1,3 +1,5 @@
|
|||||||
|
# -*- coding:utf-8 -*-
|
||||||
|
#
|
||||||
# Copyright (C) 2008 The Android Open Source Project
|
# Copyright (C) 2008 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
@ -12,13 +14,13 @@
|
|||||||
# See the License for the specific language governing permissions and
|
# See the License for the specific language governing permissions and
|
||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
|
|
||||||
|
from __future__ import print_function
|
||||||
import sys
|
import sys
|
||||||
|
|
||||||
from color import Coloring
|
from color import Coloring
|
||||||
from command import InteractiveCommand
|
from command import InteractiveCommand
|
||||||
from git_command import GitCommand
|
from git_command import GitCommand
|
||||||
|
|
||||||
|
|
||||||
class _ProjectList(Coloring):
|
class _ProjectList(Coloring):
|
||||||
def __init__(self, gc):
|
def __init__(self, gc):
|
||||||
Coloring.__init__(self, gc, 'interactive')
|
Coloring.__init__(self, gc, 'interactive')
|
||||||
@ -26,7 +28,6 @@ class _ProjectList(Coloring):
|
|||||||
self.header = self.printer('header', attr='bold')
|
self.header = self.printer('header', attr='bold')
|
||||||
self.help = self.printer('help', fg='red', attr='bold')
|
self.help = self.printer('help', fg='red', attr='bold')
|
||||||
|
|
||||||
|
|
||||||
class Stage(InteractiveCommand):
|
class Stage(InteractiveCommand):
|
||||||
common = True
|
common = True
|
||||||
helpSummary = "Stage file(s) for commit"
|
helpSummary = "Stage file(s) for commit"
|
||||||
@ -38,8 +39,7 @@ The '%prog' command stages files to prepare the next commit.
|
|||||||
"""
|
"""
|
||||||
|
|
||||||
def _Options(self, p):
|
def _Options(self, p):
|
||||||
g = p.get_option_group('--quiet')
|
p.add_option('-i', '--interactive',
|
||||||
g.add_option('-i', '--interactive',
|
|
||||||
dest='interactive', action='store_true',
|
dest='interactive', action='store_true',
|
||||||
help='use interactive staging')
|
help='use interactive staging')
|
||||||
|
|
||||||
@ -105,7 +105,6 @@ The '%prog' command stages files to prepare the next commit.
|
|||||||
continue
|
continue
|
||||||
print('Bye.')
|
print('Bye.')
|
||||||
|
|
||||||
|
|
||||||
def _AddI(project):
|
def _AddI(project):
|
||||||
p = GitCommand(project, ['add', '--interactive'], bare=False)
|
p = GitCommand(project, ['add', '--interactive'], bare=False)
|
||||||
p.Wait()
|
p.Wait()
|
||||||
|
@ -1,3 +1,5 @@
|
|||||||
|
# -*- coding:utf-8 -*-
|
||||||
|
#
|
||||||
# Copyright (C) 2008 The Android Open Source Project
|
# Copyright (C) 2008 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
@ -12,18 +14,17 @@
|
|||||||
# See the License for the specific language governing permissions and
|
# See the License for the specific language governing permissions and
|
||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
|
|
||||||
import functools
|
from __future__ import print_function
|
||||||
import os
|
import os
|
||||||
import sys
|
import sys
|
||||||
|
|
||||||
from command import Command, DEFAULT_LOCAL_JOBS
|
from command import Command
|
||||||
from git_config import IsImmutable
|
from git_config import IsImmutable
|
||||||
from git_command import git
|
from git_command import git
|
||||||
import gitc_utils
|
import gitc_utils
|
||||||
from progress import Progress
|
from progress import Progress
|
||||||
from project import SyncBuffer
|
from project import SyncBuffer
|
||||||
|
|
||||||
|
|
||||||
class Start(Command):
|
class Start(Command):
|
||||||
common = True
|
common = True
|
||||||
helpSummary = "Start a new branch for development"
|
helpSummary = "Start a new branch for development"
|
||||||
@ -34,7 +35,6 @@ class Start(Command):
|
|||||||
'%prog' begins a new branch of development, starting from the
|
'%prog' begins a new branch of development, starting from the
|
||||||
revision specified in the manifest.
|
revision specified in the manifest.
|
||||||
"""
|
"""
|
||||||
PARALLEL_JOBS = DEFAULT_LOCAL_JOBS
|
|
||||||
|
|
||||||
def _Options(self, p):
|
def _Options(self, p):
|
||||||
p.add_option('--all',
|
p.add_option('--all',
|
||||||
@ -42,8 +42,7 @@ revision specified in the manifest.
|
|||||||
help='begin branch in all projects')
|
help='begin branch in all projects')
|
||||||
p.add_option('-r', '--rev', '--revision', dest='revision',
|
p.add_option('-r', '--rev', '--revision', dest='revision',
|
||||||
help='point branch at this revision instead of upstream')
|
help='point branch at this revision instead of upstream')
|
||||||
p.add_option('--head', '--HEAD',
|
p.add_option('--head', dest='revision', action='store_const', const='HEAD',
|
||||||
dest='revision', action='store_const', const='HEAD',
|
|
||||||
help='abbreviation for --rev HEAD')
|
help='abbreviation for --rev HEAD')
|
||||||
|
|
||||||
def ValidateOptions(self, opt, args):
|
def ValidateOptions(self, opt, args):
|
||||||
@ -54,26 +53,6 @@ revision specified in the manifest.
|
|||||||
if not git.check_ref_format('heads/%s' % nb):
|
if not git.check_ref_format('heads/%s' % nb):
|
||||||
self.OptionParser.error("'%s' is not a valid name" % nb)
|
self.OptionParser.error("'%s' is not a valid name" % nb)
|
||||||
|
|
||||||
def _ExecuteOne(self, revision, nb, project):
|
|
||||||
"""Start one project."""
|
|
||||||
# If the current revision is immutable, such as a SHA1, a tag or
|
|
||||||
# a change, then we can't push back to it. Substitute with
|
|
||||||
# dest_branch, if defined; or with manifest default revision instead.
|
|
||||||
branch_merge = ''
|
|
||||||
if IsImmutable(project.revisionExpr):
|
|
||||||
if project.dest_branch:
|
|
||||||
branch_merge = project.dest_branch
|
|
||||||
else:
|
|
||||||
branch_merge = self.manifest.default.revisionExpr
|
|
||||||
|
|
||||||
try:
|
|
||||||
ret = project.StartBranch(
|
|
||||||
nb, branch_merge=branch_merge, revision=revision)
|
|
||||||
except Exception as e:
|
|
||||||
print('error: unable to checkout %s: %s' % (project.name, e), file=sys.stderr)
|
|
||||||
ret = False
|
|
||||||
return (ret, project)
|
|
||||||
|
|
||||||
def Execute(self, opt, args):
|
def Execute(self, opt, args):
|
||||||
nb = args[0]
|
nb = args[0]
|
||||||
err = []
|
err = []
|
||||||
@ -81,7 +60,7 @@ revision specified in the manifest.
|
|||||||
if not opt.all:
|
if not opt.all:
|
||||||
projects = args[1:]
|
projects = args[1:]
|
||||||
if len(projects) < 1:
|
if len(projects) < 1:
|
||||||
projects = ['.'] # start it in the local project by default
|
projects = ['.',] # start it in the local project by default
|
||||||
|
|
||||||
all_projects = self.GetProjects(projects,
|
all_projects = self.GetProjects(projects,
|
||||||
missing_ok=bool(self.gitc_manifest))
|
missing_ok=bool(self.gitc_manifest))
|
||||||
@ -105,8 +84,11 @@ revision specified in the manifest.
|
|||||||
if not os.path.exists(os.getcwd()):
|
if not os.path.exists(os.getcwd()):
|
||||||
os.chdir(self.manifest.topdir)
|
os.chdir(self.manifest.topdir)
|
||||||
|
|
||||||
pm = Progress('Syncing %s' % nb, len(all_projects), quiet=opt.quiet)
|
pm = Progress('Starting %s' % nb, len(all_projects))
|
||||||
for project in all_projects:
|
for project in all_projects:
|
||||||
|
pm.update()
|
||||||
|
|
||||||
|
if self.gitc_manifest:
|
||||||
gitc_project = self.gitc_manifest.paths[project.relpath]
|
gitc_project = self.gitc_manifest.paths[project.relpath]
|
||||||
# Sync projects that have not been opened.
|
# Sync projects that have not been opened.
|
||||||
if not gitc_project.already_synced:
|
if not gitc_project.already_synced:
|
||||||
@ -119,21 +101,21 @@ revision specified in the manifest.
|
|||||||
sync_buf = SyncBuffer(self.manifest.manifestProject.config)
|
sync_buf = SyncBuffer(self.manifest.manifestProject.config)
|
||||||
project.Sync_LocalHalf(sync_buf)
|
project.Sync_LocalHalf(sync_buf)
|
||||||
project.revisionId = gitc_project.old_revision
|
project.revisionId = gitc_project.old_revision
|
||||||
pm.update()
|
|
||||||
pm.end()
|
|
||||||
|
|
||||||
def _ProcessResults(_pool, pm, results):
|
# If the current revision is immutable, such as a SHA1, a tag or
|
||||||
for (result, project) in results:
|
# a change, then we can't push back to it. Substitute with
|
||||||
if not result:
|
# dest_branch, if defined; or with manifest default revision instead.
|
||||||
|
branch_merge = ''
|
||||||
|
if IsImmutable(project.revisionExpr):
|
||||||
|
if project.dest_branch:
|
||||||
|
branch_merge = project.dest_branch
|
||||||
|
else:
|
||||||
|
branch_merge = self.manifest.default.revisionExpr
|
||||||
|
|
||||||
|
if not project.StartBranch(
|
||||||
|
nb, branch_merge=branch_merge, revision=opt.revision):
|
||||||
err.append(project)
|
err.append(project)
|
||||||
pm.update()
|
pm.end()
|
||||||
|
|
||||||
self.ExecuteInParallel(
|
|
||||||
opt.jobs,
|
|
||||||
functools.partial(self._ExecuteOne, opt.revision, nb),
|
|
||||||
all_projects,
|
|
||||||
callback=_ProcessResults,
|
|
||||||
output=Progress('Starting %s' % (nb,), len(all_projects), quiet=opt.quiet))
|
|
||||||
|
|
||||||
if err:
|
if err:
|
||||||
for p in err:
|
for p in err:
|
||||||
|
@ -1,3 +1,5 @@
|
|||||||
|
# -*- coding:utf-8 -*-
|
||||||
|
#
|
||||||
# Copyright (C) 2008 The Android Open Source Project
|
# Copyright (C) 2008 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
@ -12,17 +14,23 @@
|
|||||||
# See the License for the specific language governing permissions and
|
# See the License for the specific language governing permissions and
|
||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
|
|
||||||
import functools
|
from __future__ import print_function
|
||||||
import glob
|
|
||||||
import io
|
|
||||||
import os
|
|
||||||
|
|
||||||
from command import DEFAULT_LOCAL_JOBS, PagedCommand
|
from command import PagedCommand
|
||||||
|
|
||||||
|
try:
|
||||||
|
import threading as _threading
|
||||||
|
except ImportError:
|
||||||
|
import dummy_threading as _threading
|
||||||
|
|
||||||
|
import glob
|
||||||
|
|
||||||
|
import itertools
|
||||||
|
import os
|
||||||
|
|
||||||
from color import Coloring
|
from color import Coloring
|
||||||
import platform_utils
|
import platform_utils
|
||||||
|
|
||||||
|
|
||||||
class Status(PagedCommand):
|
class Status(PagedCommand):
|
||||||
common = True
|
common = True
|
||||||
helpSummary = "Show the working tree status"
|
helpSummary = "Show the working tree status"
|
||||||
@ -76,29 +84,36 @@ the following meanings:
|
|||||||
d: deleted ( in index, not in work tree )
|
d: deleted ( in index, not in work tree )
|
||||||
|
|
||||||
"""
|
"""
|
||||||
PARALLEL_JOBS = DEFAULT_LOCAL_JOBS
|
|
||||||
|
|
||||||
def _Options(self, p):
|
def _Options(self, p):
|
||||||
|
p.add_option('-j', '--jobs',
|
||||||
|
dest='jobs', action='store', type='int', default=2,
|
||||||
|
help="number of projects to check simultaneously")
|
||||||
p.add_option('-o', '--orphans',
|
p.add_option('-o', '--orphans',
|
||||||
dest='orphans', action='store_true',
|
dest='orphans', action='store_true',
|
||||||
help="include objects in working directory outside of repo projects")
|
help="include objects in working directory outside of repo projects")
|
||||||
|
p.add_option('-q', '--quiet', action='store_true',
|
||||||
|
help="only print the name of modified projects")
|
||||||
|
|
||||||
def _StatusHelper(self, quiet, project):
|
def _StatusHelper(self, project, clean_counter, sem, quiet):
|
||||||
"""Obtains the status for a specific project.
|
"""Obtains the status for a specific project.
|
||||||
|
|
||||||
Obtains the status for a project, redirecting the output to
|
Obtains the status for a project, redirecting the output to
|
||||||
the specified object.
|
the specified object. It will release the semaphore
|
||||||
|
when done.
|
||||||
|
|
||||||
Args:
|
Args:
|
||||||
quiet: Where to output the status.
|
|
||||||
project: Project to get status of.
|
project: Project to get status of.
|
||||||
|
clean_counter: Counter for clean projects.
|
||||||
Returns:
|
sem: Semaphore, will call release() when complete.
|
||||||
The status of the project.
|
output: Where to output the status.
|
||||||
"""
|
"""
|
||||||
buf = io.StringIO()
|
try:
|
||||||
ret = project.PrintWorkTreeStatus(quiet=quiet, output_redir=buf)
|
state = project.PrintWorkTreeStatus(quiet=quiet)
|
||||||
return (ret, buf.getvalue())
|
if state == 'CLEAN':
|
||||||
|
next(clean_counter)
|
||||||
|
finally:
|
||||||
|
sem.release()
|
||||||
|
|
||||||
def _FindOrphans(self, dirs, proj_dirs, proj_dirs_parents, outstring):
|
def _FindOrphans(self, dirs, proj_dirs, proj_dirs_parents, outstring):
|
||||||
"""find 'dirs' that are present in 'proj_dirs_parents' but not in 'proj_dirs'"""
|
"""find 'dirs' that are present in 'proj_dirs_parents' but not in 'proj_dirs'"""
|
||||||
@ -118,24 +133,27 @@ the following meanings:
|
|||||||
|
|
||||||
def Execute(self, opt, args):
|
def Execute(self, opt, args):
|
||||||
all_projects = self.GetProjects(args)
|
all_projects = self.GetProjects(args)
|
||||||
|
counter = itertools.count()
|
||||||
|
|
||||||
def _ProcessResults(_pool, _output, results):
|
if opt.jobs == 1:
|
||||||
ret = 0
|
for project in all_projects:
|
||||||
for (state, output) in results:
|
state = project.PrintWorkTreeStatus(quiet=opt.quiet)
|
||||||
if output:
|
|
||||||
print(output, end='')
|
|
||||||
if state == 'CLEAN':
|
if state == 'CLEAN':
|
||||||
ret += 1
|
next(counter)
|
||||||
return ret
|
else:
|
||||||
|
sem = _threading.Semaphore(opt.jobs)
|
||||||
|
threads = []
|
||||||
|
for project in all_projects:
|
||||||
|
sem.acquire()
|
||||||
|
|
||||||
counter = self.ExecuteInParallel(
|
t = _threading.Thread(target=self._StatusHelper,
|
||||||
opt.jobs,
|
args=(project, counter, sem, opt.quiet))
|
||||||
functools.partial(self._StatusHelper, opt.quiet),
|
threads.append(t)
|
||||||
all_projects,
|
t.daemon = True
|
||||||
callback=_ProcessResults,
|
t.start()
|
||||||
ordered=True)
|
for t in threads:
|
||||||
|
t.join()
|
||||||
if not opt.quiet and len(all_projects) == counter:
|
if not opt.quiet and len(all_projects) == next(counter):
|
||||||
print('nothing to commit (working directory clean)')
|
print('nothing to commit (working directory clean)')
|
||||||
|
|
||||||
if opt.orphans:
|
if opt.orphans:
|
||||||
@ -152,8 +170,8 @@ the following meanings:
|
|||||||
class StatusColoring(Coloring):
|
class StatusColoring(Coloring):
|
||||||
def __init__(self, config):
|
def __init__(self, config):
|
||||||
Coloring.__init__(self, config, 'status')
|
Coloring.__init__(self, config, 'status')
|
||||||
self.project = self.printer('header', attr='bold')
|
self.project = self.printer('header', attr = 'bold')
|
||||||
self.untracked = self.printer('untracked', fg='red')
|
self.untracked = self.printer('untracked', fg = 'red')
|
||||||
|
|
||||||
orig_path = os.getcwd()
|
orig_path = os.getcwd()
|
||||||
try:
|
try:
|
||||||
@ -165,7 +183,7 @@ the following meanings:
|
|||||||
proj_dirs, proj_dirs_parents, outstring)
|
proj_dirs, proj_dirs_parents, outstring)
|
||||||
|
|
||||||
if outstring:
|
if outstring:
|
||||||
output = StatusColoring(self.client.globalConfig)
|
output = StatusColoring(self.manifest.globalConfig)
|
||||||
output.project('Objects not within a project (orphans)')
|
output.project('Objects not within a project (orphans)')
|
||||||
output.nl()
|
output.nl()
|
||||||
for entry in outstring:
|
for entry in outstring:
|
||||||
|
961
subcmds/sync.py
961
subcmds/sync.py
File diff suppressed because it is too large
Load Diff
@ -1,3 +1,5 @@
|
|||||||
|
# -*- coding:utf-8 -*-
|
||||||
|
#
|
||||||
# Copyright (C) 2008 The Android Open Source Project
|
# Copyright (C) 2008 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
@ -12,23 +14,25 @@
|
|||||||
# See the License for the specific language governing permissions and
|
# See the License for the specific language governing permissions and
|
||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
|
|
||||||
|
from __future__ import print_function
|
||||||
import copy
|
import copy
|
||||||
import functools
|
|
||||||
import optparse
|
|
||||||
import re
|
import re
|
||||||
import sys
|
import sys
|
||||||
|
|
||||||
from command import DEFAULT_LOCAL_JOBS, InteractiveCommand
|
from command import InteractiveCommand
|
||||||
from editor import Editor
|
from editor import Editor
|
||||||
from error import UploadError
|
from error import HookError, UploadError
|
||||||
from git_command import GitCommand
|
from git_command import GitCommand
|
||||||
from git_refs import R_HEADS
|
from project import RepoHook
|
||||||
from hooks import RepoHook
|
|
||||||
|
|
||||||
|
from pyversion import is_python3
|
||||||
|
if not is_python3():
|
||||||
|
input = raw_input
|
||||||
|
else:
|
||||||
|
unicode = str
|
||||||
|
|
||||||
UNUSUAL_COMMIT_THRESHOLD = 5
|
UNUSUAL_COMMIT_THRESHOLD = 5
|
||||||
|
|
||||||
|
|
||||||
def _ConfirmManyUploads(multiple_branches=False):
|
def _ConfirmManyUploads(multiple_branches=False):
|
||||||
if multiple_branches:
|
if multiple_branches:
|
||||||
print('ATTENTION: One or more branches has an unusually high number '
|
print('ATTENTION: One or more branches has an unusually high number '
|
||||||
@ -40,20 +44,17 @@ def _ConfirmManyUploads(multiple_branches=False):
|
|||||||
answer = input("If you are sure you intend to do this, type 'yes': ").strip()
|
answer = input("If you are sure you intend to do this, type 'yes': ").strip()
|
||||||
return answer == "yes"
|
return answer == "yes"
|
||||||
|
|
||||||
|
|
||||||
def _die(fmt, *args):
|
def _die(fmt, *args):
|
||||||
msg = fmt % args
|
msg = fmt % args
|
||||||
print('error: %s' % msg, file=sys.stderr)
|
print('error: %s' % msg, file=sys.stderr)
|
||||||
sys.exit(1)
|
sys.exit(1)
|
||||||
|
|
||||||
|
|
||||||
def _SplitEmails(values):
|
def _SplitEmails(values):
|
||||||
result = []
|
result = []
|
||||||
for value in values:
|
for value in values:
|
||||||
result.extend([s.strip() for s in value.split(',')])
|
result.extend([s.strip() for s in value.split(',')])
|
||||||
return result
|
return result
|
||||||
|
|
||||||
|
|
||||||
class Upload(InteractiveCommand):
|
class Upload(InteractiveCommand):
|
||||||
common = True
|
common = True
|
||||||
helpSummary = "Upload changes for code review"
|
helpSummary = "Upload changes for code review"
|
||||||
@ -125,89 +126,74 @@ is set to "true" then repo will assume you always want the equivalent
|
|||||||
of the -t option to the repo command. If unset or set to "false" then
|
of the -t option to the repo command. If unset or set to "false" then
|
||||||
repo will make use of only the command line option.
|
repo will make use of only the command line option.
|
||||||
|
|
||||||
review.URL.uploadhashtags:
|
|
||||||
|
|
||||||
To add hashtags whenever uploading a commit, you can set a per-project
|
|
||||||
or global Git option to do so. The value of review.URL.uploadhashtags
|
|
||||||
will be used as comma delimited hashtags like the --hashtag option.
|
|
||||||
|
|
||||||
review.URL.uploadlabels:
|
|
||||||
|
|
||||||
To add labels whenever uploading a commit, you can set a per-project
|
|
||||||
or global Git option to do so. The value of review.URL.uploadlabels
|
|
||||||
will be used as comma delimited labels like the --label option.
|
|
||||||
|
|
||||||
review.URL.uploadnotify:
|
|
||||||
|
|
||||||
Control e-mail notifications when uploading.
|
|
||||||
https://gerrit-review.googlesource.com/Documentation/user-upload.html#notify
|
|
||||||
|
|
||||||
# References
|
# References
|
||||||
|
|
||||||
Gerrit Code Review: https://www.gerritcodereview.com/
|
Gerrit Code Review: https://www.gerritcodereview.com/
|
||||||
|
|
||||||
"""
|
"""
|
||||||
PARALLEL_JOBS = DEFAULT_LOCAL_JOBS
|
|
||||||
|
|
||||||
def _Options(self, p):
|
def _Options(self, p):
|
||||||
p.add_option('-t',
|
p.add_option('-t',
|
||||||
dest='auto_topic', action='store_true',
|
dest='auto_topic', action='store_true',
|
||||||
help='send local branch name to Gerrit Code Review')
|
help='Send local branch name to Gerrit Code Review')
|
||||||
p.add_option('--hashtag', '--ht',
|
|
||||||
dest='hashtags', action='append', default=[],
|
|
||||||
help='add hashtags (comma delimited) to the review')
|
|
||||||
p.add_option('--hashtag-branch', '--htb',
|
|
||||||
action='store_true',
|
|
||||||
help='add local branch name as a hashtag')
|
|
||||||
p.add_option('-l', '--label',
|
|
||||||
dest='labels', action='append', default=[],
|
|
||||||
help='add a label when uploading')
|
|
||||||
p.add_option('--re', '--reviewers',
|
p.add_option('--re', '--reviewers',
|
||||||
type='string', action='append', dest='reviewers',
|
type='string', action='append', dest='reviewers',
|
||||||
help='request reviews from these people')
|
help='Request reviews from these people.')
|
||||||
p.add_option('--cc',
|
p.add_option('--cc',
|
||||||
type='string', action='append', dest='cc',
|
type='string', action='append', dest='cc',
|
||||||
help='also send email to these email addresses')
|
help='Also send email to these email addresses.')
|
||||||
p.add_option('--br', '--branch',
|
p.add_option('--br',
|
||||||
type='string', action='store', dest='branch',
|
type='string', action='store', dest='branch',
|
||||||
help='(local) branch to upload')
|
help='Branch to upload.')
|
||||||
p.add_option('-c', '--current-branch',
|
p.add_option('--cbr', '--current-branch',
|
||||||
dest='current_branch', action='store_true',
|
dest='current_branch', action='store_true',
|
||||||
help='upload current git branch')
|
help='Upload current git branch.')
|
||||||
p.add_option('--no-current-branch',
|
p.add_option('-d', '--draft',
|
||||||
dest='current_branch', action='store_false',
|
action='store_true', dest='draft', default=False,
|
||||||
help='upload all git branches')
|
help='If specified, upload as a draft.')
|
||||||
# Turn this into a warning & remove this someday.
|
|
||||||
p.add_option('--cbr',
|
|
||||||
dest='current_branch', action='store_true',
|
|
||||||
help=optparse.SUPPRESS_HELP)
|
|
||||||
p.add_option('--ne', '--no-emails',
|
p.add_option('--ne', '--no-emails',
|
||||||
action='store_false', dest='notify', default=True,
|
action='store_false', dest='notify', default=True,
|
||||||
help='do not send e-mails on upload')
|
help='If specified, do not send emails on upload.')
|
||||||
p.add_option('-p', '--private',
|
p.add_option('-p', '--private',
|
||||||
action='store_true', dest='private', default=False,
|
action='store_true', dest='private', default=False,
|
||||||
help='upload as a private change (deprecated; use --wip)')
|
help='If specified, upload as a private change.')
|
||||||
p.add_option('-w', '--wip',
|
p.add_option('-w', '--wip',
|
||||||
action='store_true', dest='wip', default=False,
|
action='store_true', dest='wip', default=False,
|
||||||
help='upload as a work-in-progress change')
|
help='If specified, upload as a work-in-progress change.')
|
||||||
p.add_option('-o', '--push-option',
|
p.add_option('-o', '--push-option',
|
||||||
type='string', action='append', dest='push_options',
|
type='string', action='append', dest='push_options',
|
||||||
default=[],
|
default=[],
|
||||||
help='additional push options to transmit')
|
help='Additional push options to transmit')
|
||||||
p.add_option('-D', '--destination', '--dest',
|
p.add_option('-D', '--destination', '--dest',
|
||||||
type='string', action='store', dest='dest_branch',
|
type='string', action='store', dest='dest_branch',
|
||||||
metavar='BRANCH',
|
metavar='BRANCH',
|
||||||
help='submit for review on this target branch')
|
help='Submit for review on this target branch.')
|
||||||
p.add_option('-n', '--dry-run',
|
|
||||||
dest='dryrun', default=False, action='store_true',
|
# Options relating to upload hook. Note that verify and no-verify are NOT
|
||||||
help='do everything except actually upload the CL')
|
# opposites of each other, which is why they store to different locations.
|
||||||
p.add_option('-y', '--yes',
|
# We are using them to match 'git commit' syntax.
|
||||||
default=False, action='store_true',
|
#
|
||||||
help='answer yes to all safe prompts')
|
# Combinations:
|
||||||
|
# - no-verify=False, verify=False (DEFAULT):
|
||||||
|
# If stdout is a tty, can prompt about running upload hooks if needed.
|
||||||
|
# If user denies running hooks, the upload is cancelled. If stdout is
|
||||||
|
# not a tty and we would need to prompt about upload hooks, upload is
|
||||||
|
# cancelled.
|
||||||
|
# - no-verify=False, verify=True:
|
||||||
|
# Always run upload hooks with no prompt.
|
||||||
|
# - no-verify=True, verify=False:
|
||||||
|
# Never run upload hooks, but upload anyway (AKA bypass hooks).
|
||||||
|
# - no-verify=True, verify=True:
|
||||||
|
# Invalid
|
||||||
p.add_option('--no-cert-checks',
|
p.add_option('--no-cert-checks',
|
||||||
dest='validate_certs', action='store_false', default=True,
|
dest='validate_certs', action='store_false', default=True,
|
||||||
help='disable verifying ssl certs (unsafe)')
|
help='Disable verifying ssl certs (unsafe).')
|
||||||
RepoHook.AddOptionGroup(p, 'pre-upload')
|
p.add_option('--no-verify',
|
||||||
|
dest='bypass_hooks', action='store_true',
|
||||||
|
help='Do not run the upload hook.')
|
||||||
|
p.add_option('--verify',
|
||||||
|
dest='allow_all_hooks', action='store_true',
|
||||||
|
help='Run the upload hook without prompting.')
|
||||||
|
|
||||||
def _SingleBranch(self, opt, branch, people):
|
def _SingleBranch(self, opt, branch, people):
|
||||||
project = branch.project
|
project = branch.project
|
||||||
@ -226,7 +212,7 @@ Gerrit Code Review: https://www.gerritcodereview.com/
|
|||||||
|
|
||||||
destination = opt.dest_branch or project.dest_branch or project.revisionExpr
|
destination = opt.dest_branch or project.dest_branch or project.revisionExpr
|
||||||
print('Upload project %s/ to remote branch %s%s:' %
|
print('Upload project %s/ to remote branch %s%s:' %
|
||||||
(project.relpath, destination, ' (private)' if opt.private else ''))
|
(project.relpath, destination, ' (draft)' if opt.draft else ''))
|
||||||
print(' branch %s (%2d commit%s, %s):' % (
|
print(' branch %s (%2d commit%s, %s):' % (
|
||||||
name,
|
name,
|
||||||
len(commit_list),
|
len(commit_list),
|
||||||
@ -238,10 +224,6 @@ Gerrit Code Review: https://www.gerritcodereview.com/
|
|||||||
print('to %s (y/N)? ' % remote.review, end='')
|
print('to %s (y/N)? ' % remote.review, end='')
|
||||||
# TODO: When we require Python 3, use flush=True w/print above.
|
# TODO: When we require Python 3, use flush=True w/print above.
|
||||||
sys.stdout.flush()
|
sys.stdout.flush()
|
||||||
if opt.yes:
|
|
||||||
print('<--yes>')
|
|
||||||
answer = True
|
|
||||||
else:
|
|
||||||
answer = sys.stdin.readline().strip().lower()
|
answer = sys.stdin.readline().strip().lower()
|
||||||
answer = answer in ('y', 'yes', '1', 'true', 't')
|
answer = answer in ('y', 'yes', '1', 'true', 't')
|
||||||
|
|
||||||
@ -340,12 +322,12 @@ Gerrit Code Review: https://www.gerritcodereview.com/
|
|||||||
|
|
||||||
key = 'review.%s.autoreviewer' % project.GetBranch(name).remote.review
|
key = 'review.%s.autoreviewer' % project.GetBranch(name).remote.review
|
||||||
raw_list = project.config.GetString(key)
|
raw_list = project.config.GetString(key)
|
||||||
if raw_list is not None:
|
if not raw_list is None:
|
||||||
people[0].extend([entry.strip() for entry in raw_list.split(',')])
|
people[0].extend([entry.strip() for entry in raw_list.split(',')])
|
||||||
|
|
||||||
key = 'review.%s.autocopy' % project.GetBranch(name).remote.review
|
key = 'review.%s.autocopy' % project.GetBranch(name).remote.review
|
||||||
raw_list = project.config.GetString(key)
|
raw_list = project.config.GetString(key)
|
||||||
if raw_list is not None and len(people[0]) > 0:
|
if not raw_list is None and len(people[0]) > 0:
|
||||||
people[1].extend([entry.strip() for entry in raw_list.split(',')])
|
people[1].extend([entry.strip() for entry in raw_list.split(',')])
|
||||||
|
|
||||||
def _FindGerritChange(self, branch):
|
def _FindGerritChange(self, branch):
|
||||||
@ -382,10 +364,6 @@ Gerrit Code Review: https://www.gerritcodereview.com/
|
|||||||
print('Continue uploading? (y/N) ', end='')
|
print('Continue uploading? (y/N) ', end='')
|
||||||
# TODO: When we require Python 3, use flush=True w/print above.
|
# TODO: When we require Python 3, use flush=True w/print above.
|
||||||
sys.stdout.flush()
|
sys.stdout.flush()
|
||||||
if opt.yes:
|
|
||||||
print('<--yes>')
|
|
||||||
a = 'yes'
|
|
||||||
else:
|
|
||||||
a = sys.stdin.readline().strip().lower()
|
a = sys.stdin.readline().strip().lower()
|
||||||
if a not in ('y', 'yes', 't', 'true', 'on'):
|
if a not in ('y', 'yes', 't', 'true', 'on'):
|
||||||
print("skipping upload", file=sys.stderr)
|
print("skipping upload", file=sys.stderr)
|
||||||
@ -398,51 +376,12 @@ Gerrit Code Review: https://www.gerritcodereview.com/
|
|||||||
key = 'review.%s.uploadtopic' % branch.project.remote.review
|
key = 'review.%s.uploadtopic' % branch.project.remote.review
|
||||||
opt.auto_topic = branch.project.config.GetBoolean(key)
|
opt.auto_topic = branch.project.config.GetBoolean(key)
|
||||||
|
|
||||||
def _ExpandCommaList(value):
|
|
||||||
"""Split |value| up into comma delimited entries."""
|
|
||||||
if not value:
|
|
||||||
return
|
|
||||||
for ret in value.split(','):
|
|
||||||
ret = ret.strip()
|
|
||||||
if ret:
|
|
||||||
yield ret
|
|
||||||
|
|
||||||
# Check if hashtags should be included.
|
|
||||||
key = 'review.%s.uploadhashtags' % branch.project.remote.review
|
|
||||||
hashtags = set(_ExpandCommaList(branch.project.config.GetString(key)))
|
|
||||||
for tag in opt.hashtags:
|
|
||||||
hashtags.update(_ExpandCommaList(tag))
|
|
||||||
if opt.hashtag_branch:
|
|
||||||
hashtags.add(branch.name)
|
|
||||||
|
|
||||||
# Check if labels should be included.
|
|
||||||
key = 'review.%s.uploadlabels' % branch.project.remote.review
|
|
||||||
labels = set(_ExpandCommaList(branch.project.config.GetString(key)))
|
|
||||||
for label in opt.labels:
|
|
||||||
labels.update(_ExpandCommaList(label))
|
|
||||||
# Basic sanity check on label syntax.
|
|
||||||
for label in labels:
|
|
||||||
if not re.match(r'^.+[+-][0-9]+$', label):
|
|
||||||
print('repo: error: invalid label syntax "%s": labels use forms '
|
|
||||||
'like CodeReview+1 or Verified-1' % (label,), file=sys.stderr)
|
|
||||||
sys.exit(1)
|
|
||||||
|
|
||||||
# Handle e-mail notifications.
|
|
||||||
if opt.notify is False:
|
|
||||||
notify = 'NONE'
|
|
||||||
else:
|
|
||||||
key = 'review.%s.uploadnotify' % branch.project.remote.review
|
|
||||||
notify = branch.project.config.GetString(key)
|
|
||||||
|
|
||||||
destination = opt.dest_branch or branch.project.dest_branch
|
destination = opt.dest_branch or branch.project.dest_branch
|
||||||
|
|
||||||
# Make sure our local branch is not setup to track a different remote branch
|
# Make sure our local branch is not setup to track a different remote branch
|
||||||
merge_branch = self._GetMergeBranch(branch.project)
|
merge_branch = self._GetMergeBranch(branch.project)
|
||||||
if destination:
|
if destination:
|
||||||
full_dest = destination
|
full_dest = 'refs/heads/%s' % destination
|
||||||
if not full_dest.startswith(R_HEADS):
|
|
||||||
full_dest = R_HEADS + full_dest
|
|
||||||
|
|
||||||
if not opt.dest_branch and merge_branch and merge_branch != full_dest:
|
if not opt.dest_branch and merge_branch and merge_branch != full_dest:
|
||||||
print('merge branch %s does not match destination branch %s'
|
print('merge branch %s does not match destination branch %s'
|
||||||
% (merge_branch, full_dest))
|
% (merge_branch, full_dest))
|
||||||
@ -453,12 +392,10 @@ Gerrit Code Review: https://www.gerritcodereview.com/
|
|||||||
continue
|
continue
|
||||||
|
|
||||||
branch.UploadForReview(people,
|
branch.UploadForReview(people,
|
||||||
dryrun=opt.dryrun,
|
|
||||||
auto_topic=opt.auto_topic,
|
auto_topic=opt.auto_topic,
|
||||||
hashtags=hashtags,
|
draft=opt.draft,
|
||||||
labels=labels,
|
|
||||||
private=opt.private,
|
private=opt.private,
|
||||||
notify=notify,
|
notify=None if opt.notify else 'NONE',
|
||||||
wip=opt.wip,
|
wip=opt.wip,
|
||||||
dest_branch=destination,
|
dest_branch=destination,
|
||||||
validate_certs=opt.validate_certs,
|
validate_certs=opt.validate_certs,
|
||||||
@ -481,8 +418,8 @@ Gerrit Code Review: https://www.gerritcodereview.com/
|
|||||||
else:
|
else:
|
||||||
fmt = '\n (%s)'
|
fmt = '\n (%s)'
|
||||||
print(('[FAILED] %-15s %-15s' + fmt) % (
|
print(('[FAILED] %-15s %-15s' + fmt) % (
|
||||||
branch.project.relpath + '/',
|
branch.project.relpath + '/', \
|
||||||
branch.name,
|
branch.name, \
|
||||||
str(branch.error)),
|
str(branch.error)),
|
||||||
file=sys.stderr)
|
file=sys.stderr)
|
||||||
print()
|
print()
|
||||||
@ -500,72 +437,68 @@ Gerrit Code Review: https://www.gerritcodereview.com/
|
|||||||
def _GetMergeBranch(self, project):
|
def _GetMergeBranch(self, project):
|
||||||
p = GitCommand(project,
|
p = GitCommand(project,
|
||||||
['rev-parse', '--abbrev-ref', 'HEAD'],
|
['rev-parse', '--abbrev-ref', 'HEAD'],
|
||||||
capture_stdout=True,
|
capture_stdout = True,
|
||||||
capture_stderr=True)
|
capture_stderr = True)
|
||||||
p.Wait()
|
p.Wait()
|
||||||
local_branch = p.stdout.strip()
|
local_branch = p.stdout.strip()
|
||||||
p = GitCommand(project,
|
p = GitCommand(project,
|
||||||
['config', '--get', 'branch.%s.merge' % local_branch],
|
['config', '--get', 'branch.%s.merge' % local_branch],
|
||||||
capture_stdout=True,
|
capture_stdout = True,
|
||||||
capture_stderr=True)
|
capture_stderr = True)
|
||||||
p.Wait()
|
p.Wait()
|
||||||
merge_branch = p.stdout.strip()
|
merge_branch = p.stdout.strip()
|
||||||
return merge_branch
|
return merge_branch
|
||||||
|
|
||||||
@staticmethod
|
def Execute(self, opt, args):
|
||||||
def _GatherOne(opt, project):
|
project_list = self.GetProjects(args)
|
||||||
"""Figure out the upload status for |project|."""
|
pending = []
|
||||||
|
reviewers = []
|
||||||
|
cc = []
|
||||||
|
branch = None
|
||||||
|
|
||||||
|
if opt.branch:
|
||||||
|
branch = opt.branch
|
||||||
|
|
||||||
|
for project in project_list:
|
||||||
if opt.current_branch:
|
if opt.current_branch:
|
||||||
cbr = project.CurrentBranch
|
cbr = project.CurrentBranch
|
||||||
up_branch = project.GetUploadableBranch(cbr)
|
up_branch = project.GetUploadableBranch(cbr)
|
||||||
avail = [up_branch] if up_branch else None
|
if up_branch:
|
||||||
|
avail = [up_branch]
|
||||||
else:
|
else:
|
||||||
avail = project.GetUploadableBranches(opt.branch)
|
avail = None
|
||||||
return (project, avail)
|
print('ERROR: Current branch (%s) not uploadable. '
|
||||||
|
'You may be able to type '
|
||||||
def Execute(self, opt, args):
|
'"git branch --set-upstream-to m/master" to fix '
|
||||||
projects = self.GetProjects(args)
|
'your branch.' % str(cbr),
|
||||||
|
|
||||||
def _ProcessResults(_pool, _out, results):
|
|
||||||
pending = []
|
|
||||||
for result in results:
|
|
||||||
project, avail = result
|
|
||||||
if avail is None:
|
|
||||||
print('repo: error: %s: Unable to upload branch "%s". '
|
|
||||||
'You might be able to fix the branch by running:\n'
|
|
||||||
' git branch --set-upstream-to m/%s' %
|
|
||||||
(project.relpath, project.CurrentBranch, self.manifest.branch),
|
|
||||||
file=sys.stderr)
|
file=sys.stderr)
|
||||||
elif avail:
|
else:
|
||||||
pending.append(result)
|
avail = project.GetUploadableBranches(branch)
|
||||||
return pending
|
if avail:
|
||||||
|
pending.append((project, avail))
|
||||||
pending = self.ExecuteInParallel(
|
|
||||||
opt.jobs,
|
|
||||||
functools.partial(self._GatherOne, opt),
|
|
||||||
projects,
|
|
||||||
callback=_ProcessResults)
|
|
||||||
|
|
||||||
if not pending:
|
if not pending:
|
||||||
if opt.branch is None:
|
print("no branches ready for upload", file=sys.stderr)
|
||||||
print('repo: error: no branches ready for upload', file=sys.stderr)
|
return
|
||||||
else:
|
|
||||||
print('repo: error: no branches named "%s" ready for upload' %
|
|
||||||
(opt.branch,), file=sys.stderr)
|
|
||||||
return 1
|
|
||||||
|
|
||||||
|
if not opt.bypass_hooks:
|
||||||
|
hook = RepoHook('pre-upload', self.manifest.repo_hooks_project,
|
||||||
|
self.manifest.topdir,
|
||||||
|
self.manifest.manifestProject.GetRemote('origin').url,
|
||||||
|
abort_if_user_denies=True)
|
||||||
pending_proj_names = [project.name for (project, available) in pending]
|
pending_proj_names = [project.name for (project, available) in pending]
|
||||||
pending_worktrees = [project.worktree for (project, available) in pending]
|
pending_worktrees = [project.worktree for (project, available) in pending]
|
||||||
hook = RepoHook.FromSubcmd(
|
try:
|
||||||
hook_type='pre-upload', manifest=self.manifest,
|
hook.Run(opt.allow_all_hooks, project_list=pending_proj_names,
|
||||||
opt=opt, abort_if_user_denies=True)
|
worktree_list=pending_worktrees)
|
||||||
if not hook.Run(
|
except HookError as e:
|
||||||
project_list=pending_proj_names,
|
print("ERROR: %s" % str(e), file=sys.stderr)
|
||||||
worktree_list=pending_worktrees):
|
return
|
||||||
return 1
|
|
||||||
|
|
||||||
reviewers = _SplitEmails(opt.reviewers) if opt.reviewers else []
|
if opt.reviewers:
|
||||||
cc = _SplitEmails(opt.cc) if opt.cc else []
|
reviewers = _SplitEmails(opt.reviewers)
|
||||||
|
if opt.cc:
|
||||||
|
cc = _SplitEmails(opt.cc)
|
||||||
people = (reviewers, cc)
|
people = (reviewers, cc)
|
||||||
|
|
||||||
if len(pending) == 1 and len(pending[0][1]) == 1:
|
if len(pending) == 1 and len(pending[0][1]) == 1:
|
||||||
|
@ -1,3 +1,5 @@
|
|||||||
|
# -*- coding:utf-8 -*-
|
||||||
|
#
|
||||||
# Copyright (C) 2009 The Android Open Source Project
|
# Copyright (C) 2009 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
@ -12,14 +14,11 @@
|
|||||||
# See the License for the specific language governing permissions and
|
# See the License for the specific language governing permissions and
|
||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
|
|
||||||
import platform
|
from __future__ import print_function
|
||||||
import sys
|
import sys
|
||||||
|
|
||||||
from command import Command, MirrorSafeCommand
|
from command import Command, MirrorSafeCommand
|
||||||
from git_command import git, RepoSourceVersion, user_agent
|
from git_command import git, RepoSourceVersion, user_agent
|
||||||
from git_refs import HEAD
|
from git_refs import HEAD
|
||||||
from wrapper import Wrapper
|
|
||||||
|
|
||||||
|
|
||||||
class Version(Command, MirrorSafeCommand):
|
class Version(Command, MirrorSafeCommand):
|
||||||
wrapper_version = None
|
wrapper_version = None
|
||||||
@ -34,19 +33,16 @@ class Version(Command, MirrorSafeCommand):
|
|||||||
def Execute(self, opt, args):
|
def Execute(self, opt, args):
|
||||||
rp = self.manifest.repoProject
|
rp = self.manifest.repoProject
|
||||||
rem = rp.GetRemote(rp.remote.name)
|
rem = rp.GetRemote(rp.remote.name)
|
||||||
branch = rp.GetBranch('default')
|
|
||||||
|
|
||||||
# These might not be the same. Report them both.
|
# These might not be the same. Report them both.
|
||||||
src_ver = RepoSourceVersion()
|
src_ver = RepoSourceVersion()
|
||||||
rp_ver = rp.bare_git.describe(HEAD)
|
rp_ver = rp.bare_git.describe(HEAD)
|
||||||
print('repo version %s' % rp_ver)
|
print('repo version %s' % rp_ver)
|
||||||
print(' (from %s)' % rem.url)
|
print(' (from %s)' % rem.url)
|
||||||
print(' (tracking %s)' % branch.merge)
|
|
||||||
print(' (%s)' % rp.bare_git.log('-1', '--format=%cD', HEAD))
|
|
||||||
|
|
||||||
if self.wrapper_path is not None:
|
if Version.wrapper_path is not None:
|
||||||
print('repo launcher version %s' % self.wrapper_version)
|
print('repo launcher version %s' % Version.wrapper_version)
|
||||||
print(' (from %s)' % self.wrapper_path)
|
print(' (from %s)' % Version.wrapper_path)
|
||||||
|
|
||||||
if src_ver != rp_ver:
|
if src_ver != rp_ver:
|
||||||
print(' (currently at %s)' % src_ver)
|
print(' (currently at %s)' % src_ver)
|
||||||
@ -55,12 +51,3 @@ class Version(Command, MirrorSafeCommand):
|
|||||||
print('git %s' % git.version_tuple().full)
|
print('git %s' % git.version_tuple().full)
|
||||||
print('git User-Agent %s' % user_agent.git)
|
print('git User-Agent %s' % user_agent.git)
|
||||||
print('Python %s' % sys.version)
|
print('Python %s' % sys.version)
|
||||||
uname = platform.uname()
|
|
||||||
if sys.version_info.major < 3:
|
|
||||||
# Python 3 returns a named tuple, but Python 2 is simpler.
|
|
||||||
print(uname)
|
|
||||||
else:
|
|
||||||
print('OS %s %s (%s)' % (uname.system, uname.release, uname.version))
|
|
||||||
print('CPU %s (%s)' %
|
|
||||||
(uname.machine, uname.processor if uname.processor else 'unknown'))
|
|
||||||
print('Bug reports:', Wrapper().BUG_URL)
|
|
||||||
|
10
tests/fixtures/test.gitconfig
vendored
10
tests/fixtures/test.gitconfig
vendored
@ -1,13 +1,3 @@
|
|||||||
[section]
|
[section]
|
||||||
empty
|
empty
|
||||||
nonempty = true
|
nonempty = true
|
||||||
boolinvalid = oops
|
|
||||||
booltrue = true
|
|
||||||
boolfalse = false
|
|
||||||
intinvalid = oops
|
|
||||||
inthex = 0x10
|
|
||||||
inthexk = 0x10k
|
|
||||||
int = 10
|
|
||||||
intk = 10k
|
|
||||||
intm = 10m
|
|
||||||
intg = 10g
|
|
||||||
|
@ -1,3 +1,5 @@
|
|||||||
|
# -*- coding:utf-8 -*-
|
||||||
|
#
|
||||||
# Copyright (C) 2019 The Android Open Source Project
|
# Copyright (C) 2019 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
@ -14,6 +16,8 @@
|
|||||||
|
|
||||||
"""Unittests for the editor.py module."""
|
"""Unittests for the editor.py module."""
|
||||||
|
|
||||||
|
from __future__ import print_function
|
||||||
|
|
||||||
import unittest
|
import unittest
|
||||||
|
|
||||||
from editor import Editor
|
from editor import Editor
|
||||||
|
@ -1,53 +0,0 @@
|
|||||||
# Copyright 2021 The Android Open Source Project
|
|
||||||
#
|
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
|
||||||
# you may not use this file except in compliance with the License.
|
|
||||||
# You may obtain a copy of the License at
|
|
||||||
#
|
|
||||||
# http://www.apache.org/licenses/LICENSE-2.0
|
|
||||||
#
|
|
||||||
# Unless required by applicable law or agreed to in writing, software
|
|
||||||
# distributed under the License is distributed on an "AS IS" BASIS,
|
|
||||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
|
||||||
# See the License for the specific language governing permissions and
|
|
||||||
# limitations under the License.
|
|
||||||
|
|
||||||
"""Unittests for the error.py module."""
|
|
||||||
|
|
||||||
import inspect
|
|
||||||
import pickle
|
|
||||||
import unittest
|
|
||||||
|
|
||||||
import error
|
|
||||||
|
|
||||||
|
|
||||||
class PickleTests(unittest.TestCase):
|
|
||||||
"""Make sure all our custom exceptions can be pickled."""
|
|
||||||
|
|
||||||
def getExceptions(self):
|
|
||||||
"""Return all our custom exceptions."""
|
|
||||||
for name in dir(error):
|
|
||||||
cls = getattr(error, name)
|
|
||||||
if isinstance(cls, type) and issubclass(cls, Exception):
|
|
||||||
yield cls
|
|
||||||
|
|
||||||
def testExceptionLookup(self):
|
|
||||||
"""Make sure our introspection logic works."""
|
|
||||||
classes = list(self.getExceptions())
|
|
||||||
self.assertIn(error.HookError, classes)
|
|
||||||
# Don't assert the exact number to avoid being a change-detector test.
|
|
||||||
self.assertGreater(len(classes), 10)
|
|
||||||
|
|
||||||
def testPickle(self):
|
|
||||||
"""Try to pickle all the exceptions."""
|
|
||||||
for cls in self.getExceptions():
|
|
||||||
args = inspect.getfullargspec(cls.__init__).args[1:]
|
|
||||||
obj = cls(*args)
|
|
||||||
p = pickle.dumps(obj)
|
|
||||||
try:
|
|
||||||
newobj = pickle.loads(p)
|
|
||||||
except Exception as e: # pylint: disable=broad-except
|
|
||||||
self.fail('Class %s is unable to be pickled: %s\n'
|
|
||||||
'Incomplete super().__init__(...) call?' % (cls, e))
|
|
||||||
self.assertIsInstance(newobj, cls)
|
|
||||||
self.assertEqual(str(obj), str(newobj))
|
|
@ -1,3 +1,5 @@
|
|||||||
|
# -*- coding:utf-8 -*-
|
||||||
|
#
|
||||||
# Copyright 2019 The Android Open Source Project
|
# Copyright 2019 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
@ -14,16 +16,12 @@
|
|||||||
|
|
||||||
"""Unittests for the git_command.py module."""
|
"""Unittests for the git_command.py module."""
|
||||||
|
|
||||||
|
from __future__ import print_function
|
||||||
|
|
||||||
import re
|
import re
|
||||||
import unittest
|
import unittest
|
||||||
|
|
||||||
try:
|
|
||||||
from unittest import mock
|
|
||||||
except ImportError:
|
|
||||||
import mock
|
|
||||||
|
|
||||||
import git_command
|
import git_command
|
||||||
import wrapper
|
|
||||||
|
|
||||||
|
|
||||||
class GitCallUnitTest(unittest.TestCase):
|
class GitCallUnitTest(unittest.TestCase):
|
||||||
@ -37,7 +35,7 @@ class GitCallUnitTest(unittest.TestCase):
|
|||||||
# We don't dive too deep into the values here to avoid having to update
|
# We don't dive too deep into the values here to avoid having to update
|
||||||
# whenever git versions change. We do check relative to this min version
|
# whenever git versions change. We do check relative to this min version
|
||||||
# as this is what `repo` itself requires via MIN_GIT_VERSION.
|
# as this is what `repo` itself requires via MIN_GIT_VERSION.
|
||||||
MIN_GIT_VERSION = (2, 10, 2)
|
MIN_GIT_VERSION = (1, 7, 2)
|
||||||
self.assertTrue(isinstance(ver.major, int))
|
self.assertTrue(isinstance(ver.major, int))
|
||||||
self.assertTrue(isinstance(ver.minor, int))
|
self.assertTrue(isinstance(ver.minor, int))
|
||||||
self.assertTrue(isinstance(ver.micro, int))
|
self.assertTrue(isinstance(ver.micro, int))
|
||||||
@ -78,45 +76,3 @@ class UserAgentUnitTest(unittest.TestCase):
|
|||||||
# the general form.
|
# the general form.
|
||||||
m = re.match(r'^git/[^ ]+ ([^ ]+) git-repo/[^ ]+', ua)
|
m = re.match(r'^git/[^ ]+ ([^ ]+) git-repo/[^ ]+', ua)
|
||||||
self.assertIsNotNone(m)
|
self.assertIsNotNone(m)
|
||||||
|
|
||||||
|
|
||||||
class GitRequireTests(unittest.TestCase):
|
|
||||||
"""Test the git_require helper."""
|
|
||||||
|
|
||||||
def setUp(self):
|
|
||||||
ver = wrapper.GitVersion(1, 2, 3, 4)
|
|
||||||
mock.patch.object(git_command.git, 'version_tuple', return_value=ver).start()
|
|
||||||
|
|
||||||
def tearDown(self):
|
|
||||||
mock.patch.stopall()
|
|
||||||
|
|
||||||
def test_older_nonfatal(self):
|
|
||||||
"""Test non-fatal require calls with old versions."""
|
|
||||||
self.assertFalse(git_command.git_require((2,)))
|
|
||||||
self.assertFalse(git_command.git_require((1, 3)))
|
|
||||||
self.assertFalse(git_command.git_require((1, 2, 4)))
|
|
||||||
self.assertFalse(git_command.git_require((1, 2, 3, 5)))
|
|
||||||
|
|
||||||
def test_newer_nonfatal(self):
|
|
||||||
"""Test non-fatal require calls with newer versions."""
|
|
||||||
self.assertTrue(git_command.git_require((0,)))
|
|
||||||
self.assertTrue(git_command.git_require((1, 0)))
|
|
||||||
self.assertTrue(git_command.git_require((1, 2, 0)))
|
|
||||||
self.assertTrue(git_command.git_require((1, 2, 3, 0)))
|
|
||||||
|
|
||||||
def test_equal_nonfatal(self):
|
|
||||||
"""Test require calls with equal values."""
|
|
||||||
self.assertTrue(git_command.git_require((1, 2, 3, 4), fail=False))
|
|
||||||
self.assertTrue(git_command.git_require((1, 2, 3, 4), fail=True))
|
|
||||||
|
|
||||||
def test_older_fatal(self):
|
|
||||||
"""Test fatal require calls with old versions."""
|
|
||||||
with self.assertRaises(SystemExit) as e:
|
|
||||||
git_command.git_require((2,), fail=True)
|
|
||||||
self.assertNotEqual(0, e.code)
|
|
||||||
|
|
||||||
def test_older_fatal_msg(self):
|
|
||||||
"""Test fatal require calls with old versions and message."""
|
|
||||||
with self.assertRaises(SystemExit) as e:
|
|
||||||
git_command.git_require((2,), fail=True, msg='so sad')
|
|
||||||
self.assertNotEqual(0, e.code)
|
|
||||||
|
@ -1,3 +1,5 @@
|
|||||||
|
# -*- coding:utf-8 -*-
|
||||||
|
#
|
||||||
# Copyright (C) 2009 The Android Open Source Project
|
# Copyright (C) 2009 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
@ -14,22 +16,21 @@
|
|||||||
|
|
||||||
"""Unittests for the git_config.py module."""
|
"""Unittests for the git_config.py module."""
|
||||||
|
|
||||||
|
from __future__ import print_function
|
||||||
|
|
||||||
import os
|
import os
|
||||||
import tempfile
|
|
||||||
import unittest
|
import unittest
|
||||||
|
|
||||||
import git_config
|
import git_config
|
||||||
|
|
||||||
|
|
||||||
def fixture(*paths):
|
def fixture(*paths):
|
||||||
"""Return a path relative to test/fixtures.
|
"""Return a path relative to test/fixtures.
|
||||||
"""
|
"""
|
||||||
return os.path.join(os.path.dirname(__file__), 'fixtures', *paths)
|
return os.path.join(os.path.dirname(__file__), 'fixtures', *paths)
|
||||||
|
|
||||||
|
class GitConfigUnitTest(unittest.TestCase):
|
||||||
class GitConfigReadOnlyTests(unittest.TestCase):
|
"""Tests the GitConfig class.
|
||||||
"""Read-only tests of the GitConfig class."""
|
"""
|
||||||
|
|
||||||
def setUp(self):
|
def setUp(self):
|
||||||
"""Create a GitConfig object using the test.gitconfig fixture.
|
"""Create a GitConfig object using the test.gitconfig fixture.
|
||||||
"""
|
"""
|
||||||
@ -67,107 +68,5 @@ class GitConfigReadOnlyTests(unittest.TestCase):
|
|||||||
val = config.GetString('empty')
|
val = config.GetString('empty')
|
||||||
self.assertEqual(val, None)
|
self.assertEqual(val, None)
|
||||||
|
|
||||||
def test_GetBoolean_undefined(self):
|
|
||||||
"""Test GetBoolean on key that doesn't exist."""
|
|
||||||
self.assertIsNone(self.config.GetBoolean('section.missing'))
|
|
||||||
|
|
||||||
def test_GetBoolean_invalid(self):
|
|
||||||
"""Test GetBoolean on invalid boolean value."""
|
|
||||||
self.assertIsNone(self.config.GetBoolean('section.boolinvalid'))
|
|
||||||
|
|
||||||
def test_GetBoolean_true(self):
|
|
||||||
"""Test GetBoolean on valid true boolean."""
|
|
||||||
self.assertTrue(self.config.GetBoolean('section.booltrue'))
|
|
||||||
|
|
||||||
def test_GetBoolean_false(self):
|
|
||||||
"""Test GetBoolean on valid false boolean."""
|
|
||||||
self.assertFalse(self.config.GetBoolean('section.boolfalse'))
|
|
||||||
|
|
||||||
def test_GetInt_undefined(self):
|
|
||||||
"""Test GetInt on key that doesn't exist."""
|
|
||||||
self.assertIsNone(self.config.GetInt('section.missing'))
|
|
||||||
|
|
||||||
def test_GetInt_invalid(self):
|
|
||||||
"""Test GetInt on invalid integer value."""
|
|
||||||
self.assertIsNone(self.config.GetBoolean('section.intinvalid'))
|
|
||||||
|
|
||||||
def test_GetInt_valid(self):
|
|
||||||
"""Test GetInt on valid integers."""
|
|
||||||
TESTS = (
|
|
||||||
('inthex', 16),
|
|
||||||
('inthexk', 16384),
|
|
||||||
('int', 10),
|
|
||||||
('intk', 10240),
|
|
||||||
('intm', 10485760),
|
|
||||||
('intg', 10737418240),
|
|
||||||
)
|
|
||||||
for key, value in TESTS:
|
|
||||||
self.assertEqual(value, self.config.GetInt('section.%s' % (key,)))
|
|
||||||
|
|
||||||
|
|
||||||
class GitConfigReadWriteTests(unittest.TestCase):
|
|
||||||
"""Read/write tests of the GitConfig class."""
|
|
||||||
|
|
||||||
def setUp(self):
|
|
||||||
self.tmpfile = tempfile.NamedTemporaryFile()
|
|
||||||
self.config = self.get_config()
|
|
||||||
|
|
||||||
def get_config(self):
|
|
||||||
"""Get a new GitConfig instance."""
|
|
||||||
return git_config.GitConfig(self.tmpfile.name)
|
|
||||||
|
|
||||||
def test_SetString(self):
|
|
||||||
"""Test SetString behavior."""
|
|
||||||
# Set a value.
|
|
||||||
self.assertIsNone(self.config.GetString('foo.bar'))
|
|
||||||
self.config.SetString('foo.bar', 'val')
|
|
||||||
self.assertEqual('val', self.config.GetString('foo.bar'))
|
|
||||||
|
|
||||||
# Make sure the value was actually written out.
|
|
||||||
config = self.get_config()
|
|
||||||
self.assertEqual('val', config.GetString('foo.bar'))
|
|
||||||
|
|
||||||
# Update the value.
|
|
||||||
self.config.SetString('foo.bar', 'valll')
|
|
||||||
self.assertEqual('valll', self.config.GetString('foo.bar'))
|
|
||||||
config = self.get_config()
|
|
||||||
self.assertEqual('valll', config.GetString('foo.bar'))
|
|
||||||
|
|
||||||
# Delete the value.
|
|
||||||
self.config.SetString('foo.bar', None)
|
|
||||||
self.assertIsNone(self.config.GetString('foo.bar'))
|
|
||||||
config = self.get_config()
|
|
||||||
self.assertIsNone(config.GetString('foo.bar'))
|
|
||||||
|
|
||||||
def test_SetBoolean(self):
|
|
||||||
"""Test SetBoolean behavior."""
|
|
||||||
# Set a true value.
|
|
||||||
self.assertIsNone(self.config.GetBoolean('foo.bar'))
|
|
||||||
for val in (True, 1):
|
|
||||||
self.config.SetBoolean('foo.bar', val)
|
|
||||||
self.assertTrue(self.config.GetBoolean('foo.bar'))
|
|
||||||
|
|
||||||
# Make sure the value was actually written out.
|
|
||||||
config = self.get_config()
|
|
||||||
self.assertTrue(config.GetBoolean('foo.bar'))
|
|
||||||
self.assertEqual('true', config.GetString('foo.bar'))
|
|
||||||
|
|
||||||
# Set a false value.
|
|
||||||
for val in (False, 0):
|
|
||||||
self.config.SetBoolean('foo.bar', val)
|
|
||||||
self.assertFalse(self.config.GetBoolean('foo.bar'))
|
|
||||||
|
|
||||||
# Make sure the value was actually written out.
|
|
||||||
config = self.get_config()
|
|
||||||
self.assertFalse(config.GetBoolean('foo.bar'))
|
|
||||||
self.assertEqual('false', config.GetString('foo.bar'))
|
|
||||||
|
|
||||||
# Delete the value.
|
|
||||||
self.config.SetBoolean('foo.bar', None)
|
|
||||||
self.assertIsNone(self.config.GetBoolean('foo.bar'))
|
|
||||||
config = self.get_config()
|
|
||||||
self.assertIsNone(config.GetBoolean('foo.bar'))
|
|
||||||
|
|
||||||
|
|
||||||
if __name__ == '__main__':
|
if __name__ == '__main__':
|
||||||
unittest.main()
|
unittest.main()
|
||||||
|
@ -1,226 +0,0 @@
|
|||||||
# Copyright (C) 2021 The Android Open Source Project
|
|
||||||
#
|
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
|
||||||
# you may not use this file except in compliance with the License.
|
|
||||||
# You may obtain a copy of the License at
|
|
||||||
#
|
|
||||||
# http://www.apache.org/licenses/LICENSE-2.0
|
|
||||||
#
|
|
||||||
# Unless required by applicable law or agreed to in writing, software
|
|
||||||
# distributed under the License is distributed on an "AS IS" BASIS,
|
|
||||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
|
||||||
# See the License for the specific language governing permissions and
|
|
||||||
# limitations under the License.
|
|
||||||
|
|
||||||
"""Unittests for the git_superproject.py module."""
|
|
||||||
|
|
||||||
import os
|
|
||||||
import platform
|
|
||||||
import tempfile
|
|
||||||
import unittest
|
|
||||||
from unittest import mock
|
|
||||||
|
|
||||||
import git_superproject
|
|
||||||
import manifest_xml
|
|
||||||
import platform_utils
|
|
||||||
|
|
||||||
|
|
||||||
class SuperprojectTestCase(unittest.TestCase):
|
|
||||||
"""TestCase for the Superproject module."""
|
|
||||||
|
|
||||||
def setUp(self):
|
|
||||||
"""Set up superproject every time."""
|
|
||||||
self.tempdir = tempfile.mkdtemp(prefix='repo_tests')
|
|
||||||
self.repodir = os.path.join(self.tempdir, '.repo')
|
|
||||||
self.manifest_file = os.path.join(
|
|
||||||
self.repodir, manifest_xml.MANIFEST_FILE_NAME)
|
|
||||||
os.mkdir(self.repodir)
|
|
||||||
self.platform = platform.system().lower()
|
|
||||||
|
|
||||||
# The manifest parsing really wants a git repo currently.
|
|
||||||
gitdir = os.path.join(self.repodir, 'manifests.git')
|
|
||||||
os.mkdir(gitdir)
|
|
||||||
with open(os.path.join(gitdir, 'config'), 'w') as fp:
|
|
||||||
fp.write("""[remote "origin"]
|
|
||||||
url = https://localhost:0/manifest
|
|
||||||
""")
|
|
||||||
|
|
||||||
manifest = self.getXmlManifest("""
|
|
||||||
<manifest>
|
|
||||||
<remote name="default-remote" fetch="http://localhost" />
|
|
||||||
<default remote="default-remote" revision="refs/heads/main" />
|
|
||||||
<superproject name="superproject"/>
|
|
||||||
<project path="art" name="platform/art" groups="notdefault,platform-""" + self.platform + """
|
|
||||||
" /></manifest>
|
|
||||||
""")
|
|
||||||
self._superproject = git_superproject.Superproject(manifest, self.repodir)
|
|
||||||
|
|
||||||
def tearDown(self):
|
|
||||||
"""Tear down superproject every time."""
|
|
||||||
platform_utils.rmtree(self.tempdir)
|
|
||||||
|
|
||||||
def getXmlManifest(self, data):
|
|
||||||
"""Helper to initialize a manifest for testing."""
|
|
||||||
with open(self.manifest_file, 'w') as fp:
|
|
||||||
fp.write(data)
|
|
||||||
return manifest_xml.XmlManifest(self.repodir, self.manifest_file)
|
|
||||||
|
|
||||||
def test_superproject_get_superproject_no_superproject(self):
|
|
||||||
"""Test with no url."""
|
|
||||||
manifest = self.getXmlManifest("""
|
|
||||||
<manifest>
|
|
||||||
</manifest>
|
|
||||||
""")
|
|
||||||
superproject = git_superproject.Superproject(manifest, self.repodir)
|
|
||||||
self.assertFalse(superproject.Sync())
|
|
||||||
|
|
||||||
def test_superproject_get_superproject_invalid_url(self):
|
|
||||||
"""Test with an invalid url."""
|
|
||||||
manifest = self.getXmlManifest("""
|
|
||||||
<manifest>
|
|
||||||
<remote name="test-remote" fetch="localhost" />
|
|
||||||
<default remote="test-remote" revision="refs/heads/main" />
|
|
||||||
<superproject name="superproject"/>
|
|
||||||
</manifest>
|
|
||||||
""")
|
|
||||||
superproject = git_superproject.Superproject(manifest, self.repodir)
|
|
||||||
self.assertFalse(superproject.Sync())
|
|
||||||
|
|
||||||
def test_superproject_get_superproject_invalid_branch(self):
|
|
||||||
"""Test with an invalid branch."""
|
|
||||||
manifest = self.getXmlManifest("""
|
|
||||||
<manifest>
|
|
||||||
<remote name="test-remote" fetch="localhost" />
|
|
||||||
<default remote="test-remote" revision="refs/heads/main" />
|
|
||||||
<superproject name="superproject"/>
|
|
||||||
</manifest>
|
|
||||||
""")
|
|
||||||
superproject = git_superproject.Superproject(manifest, self.repodir)
|
|
||||||
with mock.patch.object(self._superproject, '_GetBranch', return_value='junk'):
|
|
||||||
self.assertFalse(superproject.Sync())
|
|
||||||
|
|
||||||
def test_superproject_get_superproject_mock_init(self):
|
|
||||||
"""Test with _Init failing."""
|
|
||||||
with mock.patch.object(self._superproject, '_Init', return_value=False):
|
|
||||||
self.assertFalse(self._superproject.Sync())
|
|
||||||
|
|
||||||
def test_superproject_get_superproject_mock_fetch(self):
|
|
||||||
"""Test with _Fetch failing."""
|
|
||||||
with mock.patch.object(self._superproject, '_Init', return_value=True):
|
|
||||||
os.mkdir(self._superproject._superproject_path)
|
|
||||||
with mock.patch.object(self._superproject, '_Fetch', return_value=False):
|
|
||||||
self.assertFalse(self._superproject.Sync())
|
|
||||||
|
|
||||||
def test_superproject_get_all_project_commit_ids_mock_ls_tree(self):
|
|
||||||
"""Test with LsTree being a mock."""
|
|
||||||
data = ('120000 blob 158258bdf146f159218e2b90f8b699c4d85b5804\tAndroid.bp\x00'
|
|
||||||
'160000 commit 2c2724cb36cd5a9cec6c852c681efc3b7c6b86ea\tart\x00'
|
|
||||||
'160000 commit e9d25da64d8d365dbba7c8ee00fe8c4473fe9a06\tbootable/recovery\x00'
|
|
||||||
'120000 blob acc2cbdf438f9d2141f0ae424cec1d8fc4b5d97f\tbootstrap.bash\x00'
|
|
||||||
'160000 commit ade9b7a0d874e25fff4bf2552488825c6f111928\tbuild/bazel\x00')
|
|
||||||
with mock.patch.object(self._superproject, '_Init', return_value=True):
|
|
||||||
with mock.patch.object(self._superproject, '_Fetch', return_value=True):
|
|
||||||
with mock.patch.object(self._superproject, '_LsTree', return_value=data):
|
|
||||||
commit_ids = self._superproject._GetAllProjectsCommitIds()
|
|
||||||
self.assertEqual(commit_ids, {
|
|
||||||
'art': '2c2724cb36cd5a9cec6c852c681efc3b7c6b86ea',
|
|
||||||
'bootable/recovery': 'e9d25da64d8d365dbba7c8ee00fe8c4473fe9a06',
|
|
||||||
'build/bazel': 'ade9b7a0d874e25fff4bf2552488825c6f111928'
|
|
||||||
})
|
|
||||||
|
|
||||||
def test_superproject_write_manifest_file(self):
|
|
||||||
"""Test with writing manifest to a file after setting revisionId."""
|
|
||||||
self.assertEqual(len(self._superproject._manifest.projects), 1)
|
|
||||||
project = self._superproject._manifest.projects[0]
|
|
||||||
project.SetRevisionId('ABCDEF')
|
|
||||||
# Create temporary directory so that it can write the file.
|
|
||||||
os.mkdir(self._superproject._superproject_path)
|
|
||||||
manifest_path = self._superproject._WriteManfiestFile()
|
|
||||||
self.assertIsNotNone(manifest_path)
|
|
||||||
with open(manifest_path, 'r') as fp:
|
|
||||||
manifest_xml = fp.read()
|
|
||||||
self.assertEqual(
|
|
||||||
manifest_xml,
|
|
||||||
'<?xml version="1.0" ?><manifest>'
|
|
||||||
'<remote name="default-remote" fetch="http://localhost"/>'
|
|
||||||
'<default remote="default-remote" revision="refs/heads/main"/>'
|
|
||||||
'<project name="platform/art" path="art" revision="ABCDEF" '
|
|
||||||
'groups="notdefault,platform-' + self.platform + '"/>'
|
|
||||||
'<superproject name="superproject"/>'
|
|
||||||
'</manifest>')
|
|
||||||
|
|
||||||
def test_superproject_update_project_revision_id(self):
|
|
||||||
"""Test with LsTree being a mock."""
|
|
||||||
self.assertEqual(len(self._superproject._manifest.projects), 1)
|
|
||||||
projects = self._superproject._manifest.projects
|
|
||||||
data = ('160000 commit 2c2724cb36cd5a9cec6c852c681efc3b7c6b86ea\tart\x00'
|
|
||||||
'160000 commit e9d25da64d8d365dbba7c8ee00fe8c4473fe9a06\tbootable/recovery\x00')
|
|
||||||
with mock.patch.object(self._superproject, '_Init', return_value=True):
|
|
||||||
with mock.patch.object(self._superproject, '_Fetch', return_value=True):
|
|
||||||
with mock.patch.object(self._superproject,
|
|
||||||
'_LsTree',
|
|
||||||
return_value=data):
|
|
||||||
# Create temporary directory so that it can write the file.
|
|
||||||
os.mkdir(self._superproject._superproject_path)
|
|
||||||
manifest_path = self._superproject.UpdateProjectsRevisionId(projects)
|
|
||||||
self.assertIsNotNone(manifest_path)
|
|
||||||
with open(manifest_path, 'r') as fp:
|
|
||||||
manifest_xml = fp.read()
|
|
||||||
self.assertEqual(
|
|
||||||
manifest_xml,
|
|
||||||
'<?xml version="1.0" ?><manifest>'
|
|
||||||
'<remote name="default-remote" fetch="http://localhost"/>'
|
|
||||||
'<default remote="default-remote" revision="refs/heads/main"/>'
|
|
||||||
'<project name="platform/art" path="art" '
|
|
||||||
'revision="2c2724cb36cd5a9cec6c852c681efc3b7c6b86ea" '
|
|
||||||
'groups="notdefault,platform-' + self.platform + '"/>'
|
|
||||||
'<superproject name="superproject"/>'
|
|
||||||
'</manifest>')
|
|
||||||
|
|
||||||
def test_superproject_update_project_revision_id_with_different_remotes(self):
|
|
||||||
"""Test update of commit ids of a manifest with mutiple remotes."""
|
|
||||||
manifest = self.getXmlManifest("""
|
|
||||||
<manifest>
|
|
||||||
<remote name="default-remote" fetch="http://localhost" />
|
|
||||||
<remote name="goog" fetch="http://localhost2" />
|
|
||||||
<default remote="default-remote" revision="refs/heads/main" />
|
|
||||||
<superproject name="superproject"/>
|
|
||||||
<project path="vendor/x" name="platform/vendor/x" remote="goog" groups="vendor"
|
|
||||||
revision="master-with-vendor" clone-depth="1" />
|
|
||||||
<project path="art" name="platform/art" groups="notdefault,platform-""" + self.platform + """
|
|
||||||
" /></manifest>
|
|
||||||
""")
|
|
||||||
self.maxDiff = None
|
|
||||||
self._superproject = git_superproject.Superproject(manifest, self.repodir)
|
|
||||||
self.assertEqual(len(self._superproject._manifest.projects), 2)
|
|
||||||
projects = self._superproject._manifest.projects
|
|
||||||
data = ('160000 commit 2c2724cb36cd5a9cec6c852c681efc3b7c6b86ea\tart\x00'
|
|
||||||
'160000 commit e9d25da64d8d365dbba7c8ee00fe8c4473fe9a06\tbootable/recovery\x00')
|
|
||||||
with mock.patch.object(self._superproject, '_Init', return_value=True):
|
|
||||||
with mock.patch.object(self._superproject, '_Fetch', return_value=True):
|
|
||||||
with mock.patch.object(self._superproject,
|
|
||||||
'_LsTree',
|
|
||||||
return_value=data):
|
|
||||||
# Create temporary directory so that it can write the file.
|
|
||||||
os.mkdir(self._superproject._superproject_path)
|
|
||||||
manifest_path = self._superproject.UpdateProjectsRevisionId(projects)
|
|
||||||
self.assertIsNotNone(manifest_path)
|
|
||||||
with open(manifest_path, 'r') as fp:
|
|
||||||
manifest_xml = fp.read()
|
|
||||||
self.assertEqual(
|
|
||||||
manifest_xml,
|
|
||||||
'<?xml version="1.0" ?><manifest>'
|
|
||||||
'<remote name="default-remote" fetch="http://localhost"/>'
|
|
||||||
'<remote name="goog" fetch="http://localhost2"/>'
|
|
||||||
'<default remote="default-remote" revision="refs/heads/main"/>'
|
|
||||||
'<project name="platform/art" path="art" '
|
|
||||||
'revision="2c2724cb36cd5a9cec6c852c681efc3b7c6b86ea" '
|
|
||||||
'groups="notdefault,platform-' + self.platform + '"/>'
|
|
||||||
'<project name="platform/vendor/x" path="vendor/x" remote="goog" '
|
|
||||||
'revision="master-with-vendor" groups="vendor" clone-depth="1"/>'
|
|
||||||
'<superproject name="superproject"/>'
|
|
||||||
'</manifest>')
|
|
||||||
|
|
||||||
|
|
||||||
if __name__ == '__main__':
|
|
||||||
unittest.main()
|
|
@ -1,261 +0,0 @@
|
|||||||
# Copyright (C) 2020 The Android Open Source Project
|
|
||||||
#
|
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
|
||||||
# you may not use this file except in compliance with the License.
|
|
||||||
# You may obtain a copy of the License at
|
|
||||||
#
|
|
||||||
# http://www.apache.org/licenses/LICENSE-2.0
|
|
||||||
#
|
|
||||||
# Unless required by applicable law or agreed to in writing, software
|
|
||||||
# distributed under the License is distributed on an "AS IS" BASIS,
|
|
||||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
|
||||||
# See the License for the specific language governing permissions and
|
|
||||||
# limitations under the License.
|
|
||||||
|
|
||||||
"""Unittests for the git_trace2_event_log.py module."""
|
|
||||||
|
|
||||||
import json
|
|
||||||
import os
|
|
||||||
import tempfile
|
|
||||||
import unittest
|
|
||||||
from unittest import mock
|
|
||||||
|
|
||||||
import git_trace2_event_log
|
|
||||||
|
|
||||||
|
|
||||||
class EventLogTestCase(unittest.TestCase):
|
|
||||||
"""TestCase for the EventLog module."""
|
|
||||||
|
|
||||||
PARENT_SID_KEY = 'GIT_TRACE2_PARENT_SID'
|
|
||||||
PARENT_SID_VALUE = 'parent_sid'
|
|
||||||
SELF_SID_REGEX = r'repo-\d+T\d+Z-.*'
|
|
||||||
FULL_SID_REGEX = r'^%s/%s' % (PARENT_SID_VALUE, SELF_SID_REGEX)
|
|
||||||
|
|
||||||
def setUp(self):
|
|
||||||
"""Load the event_log module every time."""
|
|
||||||
self._event_log_module = None
|
|
||||||
# By default we initialize with the expected case where
|
|
||||||
# repo launches us (so GIT_TRACE2_PARENT_SID is set).
|
|
||||||
env = {
|
|
||||||
self.PARENT_SID_KEY: self.PARENT_SID_VALUE,
|
|
||||||
}
|
|
||||||
self._event_log_module = git_trace2_event_log.EventLog(env=env)
|
|
||||||
self._log_data = None
|
|
||||||
|
|
||||||
def verifyCommonKeys(self, log_entry, expected_event_name, full_sid=True):
|
|
||||||
"""Helper function to verify common event log keys."""
|
|
||||||
self.assertIn('event', log_entry)
|
|
||||||
self.assertIn('sid', log_entry)
|
|
||||||
self.assertIn('thread', log_entry)
|
|
||||||
self.assertIn('time', log_entry)
|
|
||||||
|
|
||||||
# Do basic data format validation.
|
|
||||||
self.assertEqual(expected_event_name, log_entry['event'])
|
|
||||||
if full_sid:
|
|
||||||
self.assertRegex(log_entry['sid'], self.FULL_SID_REGEX)
|
|
||||||
else:
|
|
||||||
self.assertRegex(log_entry['sid'], self.SELF_SID_REGEX)
|
|
||||||
self.assertRegex(log_entry['time'], r'^\d+-\d+-\d+T\d+:\d+:\d+\.\d+Z$')
|
|
||||||
|
|
||||||
def readLog(self, log_path):
|
|
||||||
"""Helper function to read log data into a list."""
|
|
||||||
log_data = []
|
|
||||||
with open(log_path, mode='rb') as f:
|
|
||||||
for line in f:
|
|
||||||
log_data.append(json.loads(line))
|
|
||||||
return log_data
|
|
||||||
|
|
||||||
def test_initial_state_with_parent_sid(self):
|
|
||||||
"""Test initial state when 'GIT_TRACE2_PARENT_SID' is set by parent."""
|
|
||||||
self.assertRegex(self._event_log_module.full_sid, self.FULL_SID_REGEX)
|
|
||||||
|
|
||||||
def test_initial_state_no_parent_sid(self):
|
|
||||||
"""Test initial state when 'GIT_TRACE2_PARENT_SID' is not set."""
|
|
||||||
# Setup an empty environment dict (no parent sid).
|
|
||||||
self._event_log_module = git_trace2_event_log.EventLog(env={})
|
|
||||||
self.assertRegex(self._event_log_module.full_sid, self.SELF_SID_REGEX)
|
|
||||||
|
|
||||||
def test_version_event(self):
|
|
||||||
"""Test 'version' event data is valid.
|
|
||||||
|
|
||||||
Verify that the 'version' event is written even when no other
|
|
||||||
events are addded.
|
|
||||||
|
|
||||||
Expected event log:
|
|
||||||
<version event>
|
|
||||||
"""
|
|
||||||
with tempfile.TemporaryDirectory(prefix='event_log_tests') as tempdir:
|
|
||||||
log_path = self._event_log_module.Write(path=tempdir)
|
|
||||||
self._log_data = self.readLog(log_path)
|
|
||||||
|
|
||||||
# A log with no added events should only have the version entry.
|
|
||||||
self.assertEqual(len(self._log_data), 1)
|
|
||||||
version_event = self._log_data[0]
|
|
||||||
self.verifyCommonKeys(version_event, expected_event_name='version')
|
|
||||||
# Check for 'version' event specific fields.
|
|
||||||
self.assertIn('evt', version_event)
|
|
||||||
self.assertIn('exe', version_event)
|
|
||||||
# Verify "evt" version field is a string.
|
|
||||||
self.assertIsInstance(version_event['evt'], str)
|
|
||||||
|
|
||||||
def test_start_event(self):
|
|
||||||
"""Test and validate 'start' event data is valid.
|
|
||||||
|
|
||||||
Expected event log:
|
|
||||||
<version event>
|
|
||||||
<start event>
|
|
||||||
"""
|
|
||||||
self._event_log_module.StartEvent()
|
|
||||||
with tempfile.TemporaryDirectory(prefix='event_log_tests') as tempdir:
|
|
||||||
log_path = self._event_log_module.Write(path=tempdir)
|
|
||||||
self._log_data = self.readLog(log_path)
|
|
||||||
|
|
||||||
self.assertEqual(len(self._log_data), 2)
|
|
||||||
start_event = self._log_data[1]
|
|
||||||
self.verifyCommonKeys(self._log_data[0], expected_event_name='version')
|
|
||||||
self.verifyCommonKeys(start_event, expected_event_name='start')
|
|
||||||
# Check for 'start' event specific fields.
|
|
||||||
self.assertIn('argv', start_event)
|
|
||||||
self.assertTrue(isinstance(start_event['argv'], list))
|
|
||||||
|
|
||||||
def test_exit_event_result_none(self):
|
|
||||||
"""Test 'exit' event data is valid when result is None.
|
|
||||||
|
|
||||||
We expect None result to be converted to 0 in the exit event data.
|
|
||||||
|
|
||||||
Expected event log:
|
|
||||||
<version event>
|
|
||||||
<exit event>
|
|
||||||
"""
|
|
||||||
self._event_log_module.ExitEvent(None)
|
|
||||||
with tempfile.TemporaryDirectory(prefix='event_log_tests') as tempdir:
|
|
||||||
log_path = self._event_log_module.Write(path=tempdir)
|
|
||||||
self._log_data = self.readLog(log_path)
|
|
||||||
|
|
||||||
self.assertEqual(len(self._log_data), 2)
|
|
||||||
exit_event = self._log_data[1]
|
|
||||||
self.verifyCommonKeys(self._log_data[0], expected_event_name='version')
|
|
||||||
self.verifyCommonKeys(exit_event, expected_event_name='exit')
|
|
||||||
# Check for 'exit' event specific fields.
|
|
||||||
self.assertIn('code', exit_event)
|
|
||||||
# 'None' result should convert to 0 (successful) return code.
|
|
||||||
self.assertEqual(exit_event['code'], 0)
|
|
||||||
|
|
||||||
def test_exit_event_result_integer(self):
|
|
||||||
"""Test 'exit' event data is valid when result is an integer.
|
|
||||||
|
|
||||||
Expected event log:
|
|
||||||
<version event>
|
|
||||||
<exit event>
|
|
||||||
"""
|
|
||||||
self._event_log_module.ExitEvent(2)
|
|
||||||
with tempfile.TemporaryDirectory(prefix='event_log_tests') as tempdir:
|
|
||||||
log_path = self._event_log_module.Write(path=tempdir)
|
|
||||||
self._log_data = self.readLog(log_path)
|
|
||||||
|
|
||||||
self.assertEqual(len(self._log_data), 2)
|
|
||||||
exit_event = self._log_data[1]
|
|
||||||
self.verifyCommonKeys(self._log_data[0], expected_event_name='version')
|
|
||||||
self.verifyCommonKeys(exit_event, expected_event_name='exit')
|
|
||||||
# Check for 'exit' event specific fields.
|
|
||||||
self.assertIn('code', exit_event)
|
|
||||||
self.assertEqual(exit_event['code'], 2)
|
|
||||||
|
|
||||||
def test_command_event(self):
|
|
||||||
"""Test and validate 'command' event data is valid.
|
|
||||||
|
|
||||||
Expected event log:
|
|
||||||
<version event>
|
|
||||||
<command event>
|
|
||||||
"""
|
|
||||||
name = 'repo'
|
|
||||||
subcommands = ['init' 'this']
|
|
||||||
self._event_log_module.CommandEvent(name='repo', subcommands=subcommands)
|
|
||||||
with tempfile.TemporaryDirectory(prefix='event_log_tests') as tempdir:
|
|
||||||
log_path = self._event_log_module.Write(path=tempdir)
|
|
||||||
self._log_data = self.readLog(log_path)
|
|
||||||
|
|
||||||
self.assertEqual(len(self._log_data), 2)
|
|
||||||
command_event = self._log_data[1]
|
|
||||||
self.verifyCommonKeys(self._log_data[0], expected_event_name='version')
|
|
||||||
self.verifyCommonKeys(command_event, expected_event_name='command')
|
|
||||||
# Check for 'command' event specific fields.
|
|
||||||
self.assertIn('name', command_event)
|
|
||||||
self.assertIn('subcommands', command_event)
|
|
||||||
self.assertEqual(command_event['name'], name)
|
|
||||||
self.assertEqual(command_event['subcommands'], subcommands)
|
|
||||||
|
|
||||||
def test_def_params_event_repo_config(self):
|
|
||||||
"""Test 'def_params' event data outputs only repo config keys.
|
|
||||||
|
|
||||||
Expected event log:
|
|
||||||
<version event>
|
|
||||||
<def_param event>
|
|
||||||
<def_param event>
|
|
||||||
"""
|
|
||||||
config = {
|
|
||||||
'git.foo': 'bar',
|
|
||||||
'repo.partialclone': 'true',
|
|
||||||
'repo.partialclonefilter': 'blob:none',
|
|
||||||
}
|
|
||||||
self._event_log_module.DefParamRepoEvents(config)
|
|
||||||
|
|
||||||
with tempfile.TemporaryDirectory(prefix='event_log_tests') as tempdir:
|
|
||||||
log_path = self._event_log_module.Write(path=tempdir)
|
|
||||||
self._log_data = self.readLog(log_path)
|
|
||||||
|
|
||||||
self.assertEqual(len(self._log_data), 3)
|
|
||||||
def_param_events = self._log_data[1:]
|
|
||||||
self.verifyCommonKeys(self._log_data[0], expected_event_name='version')
|
|
||||||
|
|
||||||
for event in def_param_events:
|
|
||||||
self.verifyCommonKeys(event, expected_event_name='def_param')
|
|
||||||
# Check for 'def_param' event specific fields.
|
|
||||||
self.assertIn('param', event)
|
|
||||||
self.assertIn('value', event)
|
|
||||||
self.assertTrue(event['param'].startswith('repo.'))
|
|
||||||
|
|
||||||
def test_def_params_event_no_repo_config(self):
|
|
||||||
"""Test 'def_params' event data won't output non-repo config keys.
|
|
||||||
|
|
||||||
Expected event log:
|
|
||||||
<version event>
|
|
||||||
"""
|
|
||||||
config = {
|
|
||||||
'git.foo': 'bar',
|
|
||||||
'git.core.foo2': 'baz',
|
|
||||||
}
|
|
||||||
self._event_log_module.DefParamRepoEvents(config)
|
|
||||||
|
|
||||||
with tempfile.TemporaryDirectory(prefix='event_log_tests') as tempdir:
|
|
||||||
log_path = self._event_log_module.Write(path=tempdir)
|
|
||||||
self._log_data = self.readLog(log_path)
|
|
||||||
|
|
||||||
self.assertEqual(len(self._log_data), 1)
|
|
||||||
self.verifyCommonKeys(self._log_data[0], expected_event_name='version')
|
|
||||||
|
|
||||||
def test_write_with_filename(self):
|
|
||||||
"""Test Write() with a path to a file exits with None."""
|
|
||||||
self.assertIsNone(self._event_log_module.Write(path='path/to/file'))
|
|
||||||
|
|
||||||
def test_write_with_git_config(self):
|
|
||||||
"""Test Write() uses the git config path when 'git config' call succeeds."""
|
|
||||||
with tempfile.TemporaryDirectory(prefix='event_log_tests') as tempdir:
|
|
||||||
with mock.patch.object(self._event_log_module,
|
|
||||||
'_GetEventTargetPath', return_value=tempdir):
|
|
||||||
self.assertEqual(os.path.dirname(self._event_log_module.Write()), tempdir)
|
|
||||||
|
|
||||||
def test_write_no_git_config(self):
|
|
||||||
"""Test Write() with no git config variable present exits with None."""
|
|
||||||
with mock.patch.object(self._event_log_module,
|
|
||||||
'_GetEventTargetPath', return_value=None):
|
|
||||||
self.assertIsNone(self._event_log_module.Write())
|
|
||||||
|
|
||||||
def test_write_non_string(self):
|
|
||||||
"""Test Write() with non-string type for |path| throws TypeError."""
|
|
||||||
with self.assertRaises(TypeError):
|
|
||||||
self._event_log_module.Write(path=1234)
|
|
||||||
|
|
||||||
|
|
||||||
if __name__ == '__main__':
|
|
||||||
unittest.main()
|
|
@ -1,55 +0,0 @@
|
|||||||
# Copyright (C) 2019 The Android Open Source Project
|
|
||||||
#
|
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
|
||||||
# you may not use this file except in compliance with the License.
|
|
||||||
# You may obtain a copy of the License at
|
|
||||||
#
|
|
||||||
# http://www.apache.org/licenses/LICENSE-2.0
|
|
||||||
#
|
|
||||||
# Unless required by applicable law or agreed to in writing, software
|
|
||||||
# distributed under the License is distributed on an "AS IS" BASIS,
|
|
||||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
|
||||||
# See the License for the specific language governing permissions and
|
|
||||||
# limitations under the License.
|
|
||||||
|
|
||||||
"""Unittests for the hooks.py module."""
|
|
||||||
|
|
||||||
import hooks
|
|
||||||
import unittest
|
|
||||||
|
|
||||||
class RepoHookShebang(unittest.TestCase):
|
|
||||||
"""Check shebang parsing in RepoHook."""
|
|
||||||
|
|
||||||
def test_no_shebang(self):
|
|
||||||
"""Lines w/out shebangs should be rejected."""
|
|
||||||
DATA = (
|
|
||||||
'',
|
|
||||||
'#\n# foo\n',
|
|
||||||
'# Bad shebang in script\n#!/foo\n'
|
|
||||||
)
|
|
||||||
for data in DATA:
|
|
||||||
self.assertIsNone(hooks.RepoHook._ExtractInterpFromShebang(data))
|
|
||||||
|
|
||||||
def test_direct_interp(self):
|
|
||||||
"""Lines whose shebang points directly to the interpreter."""
|
|
||||||
DATA = (
|
|
||||||
('#!/foo', '/foo'),
|
|
||||||
('#! /foo', '/foo'),
|
|
||||||
('#!/bin/foo ', '/bin/foo'),
|
|
||||||
('#! /usr/foo ', '/usr/foo'),
|
|
||||||
('#! /usr/foo -args', '/usr/foo'),
|
|
||||||
)
|
|
||||||
for shebang, interp in DATA:
|
|
||||||
self.assertEqual(hooks.RepoHook._ExtractInterpFromShebang(shebang),
|
|
||||||
interp)
|
|
||||||
|
|
||||||
def test_env_interp(self):
|
|
||||||
"""Lines whose shebang launches through `env`."""
|
|
||||||
DATA = (
|
|
||||||
('#!/usr/bin/env foo', 'foo'),
|
|
||||||
('#!/bin/env foo', 'foo'),
|
|
||||||
('#! /bin/env /bin/foo ', '/bin/foo'),
|
|
||||||
)
|
|
||||||
for shebang, interp in DATA:
|
|
||||||
self.assertEqual(hooks.RepoHook._ExtractInterpFromShebang(shebang),
|
|
||||||
interp)
|
|
@ -1,584 +0,0 @@
|
|||||||
# Copyright (C) 2019 The Android Open Source Project
|
|
||||||
#
|
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
|
||||||
# you may not use this file except in compliance with the License.
|
|
||||||
# You may obtain a copy of the License at
|
|
||||||
#
|
|
||||||
# http://www.apache.org/licenses/LICENSE-2.0
|
|
||||||
#
|
|
||||||
# Unless required by applicable law or agreed to in writing, software
|
|
||||||
# distributed under the License is distributed on an "AS IS" BASIS,
|
|
||||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
|
||||||
# See the License for the specific language governing permissions and
|
|
||||||
# limitations under the License.
|
|
||||||
|
|
||||||
"""Unittests for the manifest_xml.py module."""
|
|
||||||
|
|
||||||
import os
|
|
||||||
import platform
|
|
||||||
import shutil
|
|
||||||
import tempfile
|
|
||||||
import unittest
|
|
||||||
import xml.dom.minidom
|
|
||||||
|
|
||||||
import error
|
|
||||||
import manifest_xml
|
|
||||||
|
|
||||||
|
|
||||||
# Invalid paths that we don't want in the filesystem.
|
|
||||||
INVALID_FS_PATHS = (
|
|
||||||
'',
|
|
||||||
'.',
|
|
||||||
'..',
|
|
||||||
'../',
|
|
||||||
'./',
|
|
||||||
'.//',
|
|
||||||
'foo/',
|
|
||||||
'./foo',
|
|
||||||
'../foo',
|
|
||||||
'foo/./bar',
|
|
||||||
'foo/../../bar',
|
|
||||||
'/foo',
|
|
||||||
'./../foo',
|
|
||||||
'.git/foo',
|
|
||||||
# Check case folding.
|
|
||||||
'.GIT/foo',
|
|
||||||
'blah/.git/foo',
|
|
||||||
'.repo/foo',
|
|
||||||
'.repoconfig',
|
|
||||||
# Block ~ due to 8.3 filenames on Windows filesystems.
|
|
||||||
'~',
|
|
||||||
'foo~',
|
|
||||||
'blah/foo~',
|
|
||||||
# Block Unicode characters that get normalized out by filesystems.
|
|
||||||
u'foo\u200Cbar',
|
|
||||||
# Block newlines.
|
|
||||||
'f\n/bar',
|
|
||||||
'f\r/bar',
|
|
||||||
)
|
|
||||||
|
|
||||||
# Make sure platforms that use path separators (e.g. Windows) are also
|
|
||||||
# rejected properly.
|
|
||||||
if os.path.sep != '/':
|
|
||||||
INVALID_FS_PATHS += tuple(x.replace('/', os.path.sep) for x in INVALID_FS_PATHS)
|
|
||||||
|
|
||||||
|
|
||||||
class ManifestParseTestCase(unittest.TestCase):
|
|
||||||
"""TestCase for parsing manifests."""
|
|
||||||
|
|
||||||
def setUp(self):
|
|
||||||
self.tempdir = tempfile.mkdtemp(prefix='repo_tests')
|
|
||||||
self.repodir = os.path.join(self.tempdir, '.repo')
|
|
||||||
self.manifest_dir = os.path.join(self.repodir, 'manifests')
|
|
||||||
self.manifest_file = os.path.join(
|
|
||||||
self.repodir, manifest_xml.MANIFEST_FILE_NAME)
|
|
||||||
self.local_manifest_dir = os.path.join(
|
|
||||||
self.repodir, manifest_xml.LOCAL_MANIFESTS_DIR_NAME)
|
|
||||||
os.mkdir(self.repodir)
|
|
||||||
os.mkdir(self.manifest_dir)
|
|
||||||
|
|
||||||
# The manifest parsing really wants a git repo currently.
|
|
||||||
gitdir = os.path.join(self.repodir, 'manifests.git')
|
|
||||||
os.mkdir(gitdir)
|
|
||||||
with open(os.path.join(gitdir, 'config'), 'w') as fp:
|
|
||||||
fp.write("""[remote "origin"]
|
|
||||||
url = https://localhost:0/manifest
|
|
||||||
""")
|
|
||||||
|
|
||||||
def tearDown(self):
|
|
||||||
shutil.rmtree(self.tempdir, ignore_errors=True)
|
|
||||||
|
|
||||||
def getXmlManifest(self, data):
|
|
||||||
"""Helper to initialize a manifest for testing."""
|
|
||||||
with open(self.manifest_file, 'w') as fp:
|
|
||||||
fp.write(data)
|
|
||||||
return manifest_xml.XmlManifest(self.repodir, self.manifest_file)
|
|
||||||
|
|
||||||
@staticmethod
|
|
||||||
def encodeXmlAttr(attr):
|
|
||||||
"""Encode |attr| using XML escape rules."""
|
|
||||||
return attr.replace('\r', '
').replace('\n', '
')
|
|
||||||
|
|
||||||
|
|
||||||
class ManifestValidateFilePaths(unittest.TestCase):
|
|
||||||
"""Check _ValidateFilePaths helper.
|
|
||||||
|
|
||||||
This doesn't access a real filesystem.
|
|
||||||
"""
|
|
||||||
|
|
||||||
def check_both(self, *args):
|
|
||||||
manifest_xml.XmlManifest._ValidateFilePaths('copyfile', *args)
|
|
||||||
manifest_xml.XmlManifest._ValidateFilePaths('linkfile', *args)
|
|
||||||
|
|
||||||
def test_normal_path(self):
|
|
||||||
"""Make sure good paths are accepted."""
|
|
||||||
self.check_both('foo', 'bar')
|
|
||||||
self.check_both('foo/bar', 'bar')
|
|
||||||
self.check_both('foo', 'bar/bar')
|
|
||||||
self.check_both('foo/bar', 'bar/bar')
|
|
||||||
|
|
||||||
def test_symlink_targets(self):
|
|
||||||
"""Some extra checks for symlinks."""
|
|
||||||
def check(*args):
|
|
||||||
manifest_xml.XmlManifest._ValidateFilePaths('linkfile', *args)
|
|
||||||
|
|
||||||
# We allow symlinks to end in a slash since we allow them to point to dirs
|
|
||||||
# in general. Technically the slash isn't necessary.
|
|
||||||
check('foo/', 'bar')
|
|
||||||
# We allow a single '.' to get a reference to the project itself.
|
|
||||||
check('.', 'bar')
|
|
||||||
|
|
||||||
def test_bad_paths(self):
|
|
||||||
"""Make sure bad paths (src & dest) are rejected."""
|
|
||||||
for path in INVALID_FS_PATHS:
|
|
||||||
self.assertRaises(
|
|
||||||
error.ManifestInvalidPathError, self.check_both, path, 'a')
|
|
||||||
self.assertRaises(
|
|
||||||
error.ManifestInvalidPathError, self.check_both, 'a', path)
|
|
||||||
|
|
||||||
|
|
||||||
class ValueTests(unittest.TestCase):
|
|
||||||
"""Check utility parsing code."""
|
|
||||||
|
|
||||||
def _get_node(self, text):
|
|
||||||
return xml.dom.minidom.parseString(text).firstChild
|
|
||||||
|
|
||||||
def test_bool_default(self):
|
|
||||||
"""Check XmlBool default handling."""
|
|
||||||
node = self._get_node('<node/>')
|
|
||||||
self.assertIsNone(manifest_xml.XmlBool(node, 'a'))
|
|
||||||
self.assertIsNone(manifest_xml.XmlBool(node, 'a', None))
|
|
||||||
self.assertEqual(123, manifest_xml.XmlBool(node, 'a', 123))
|
|
||||||
|
|
||||||
node = self._get_node('<node a=""/>')
|
|
||||||
self.assertIsNone(manifest_xml.XmlBool(node, 'a'))
|
|
||||||
|
|
||||||
def test_bool_invalid(self):
|
|
||||||
"""Check XmlBool invalid handling."""
|
|
||||||
node = self._get_node('<node a="moo"/>')
|
|
||||||
self.assertEqual(123, manifest_xml.XmlBool(node, 'a', 123))
|
|
||||||
|
|
||||||
def test_bool_true(self):
|
|
||||||
"""Check XmlBool true values."""
|
|
||||||
for value in ('yes', 'true', '1'):
|
|
||||||
node = self._get_node('<node a="%s"/>' % (value,))
|
|
||||||
self.assertTrue(manifest_xml.XmlBool(node, 'a'))
|
|
||||||
|
|
||||||
def test_bool_false(self):
|
|
||||||
"""Check XmlBool false values."""
|
|
||||||
for value in ('no', 'false', '0'):
|
|
||||||
node = self._get_node('<node a="%s"/>' % (value,))
|
|
||||||
self.assertFalse(manifest_xml.XmlBool(node, 'a'))
|
|
||||||
|
|
||||||
def test_int_default(self):
|
|
||||||
"""Check XmlInt default handling."""
|
|
||||||
node = self._get_node('<node/>')
|
|
||||||
self.assertIsNone(manifest_xml.XmlInt(node, 'a'))
|
|
||||||
self.assertIsNone(manifest_xml.XmlInt(node, 'a', None))
|
|
||||||
self.assertEqual(123, manifest_xml.XmlInt(node, 'a', 123))
|
|
||||||
|
|
||||||
node = self._get_node('<node a=""/>')
|
|
||||||
self.assertIsNone(manifest_xml.XmlInt(node, 'a'))
|
|
||||||
|
|
||||||
def test_int_good(self):
|
|
||||||
"""Check XmlInt numeric handling."""
|
|
||||||
for value in (-1, 0, 1, 50000):
|
|
||||||
node = self._get_node('<node a="%s"/>' % (value,))
|
|
||||||
self.assertEqual(value, manifest_xml.XmlInt(node, 'a'))
|
|
||||||
|
|
||||||
def test_int_invalid(self):
|
|
||||||
"""Check XmlInt invalid handling."""
|
|
||||||
with self.assertRaises(error.ManifestParseError):
|
|
||||||
node = self._get_node('<node a="xx"/>')
|
|
||||||
manifest_xml.XmlInt(node, 'a')
|
|
||||||
|
|
||||||
|
|
||||||
class XmlManifestTests(ManifestParseTestCase):
|
|
||||||
"""Check manifest processing."""
|
|
||||||
|
|
||||||
def test_empty(self):
|
|
||||||
"""Parse an 'empty' manifest file."""
|
|
||||||
manifest = self.getXmlManifest(
|
|
||||||
'<?xml version="1.0" encoding="UTF-8"?>'
|
|
||||||
'<manifest></manifest>')
|
|
||||||
self.assertEqual(manifest.remotes, {})
|
|
||||||
self.assertEqual(manifest.projects, [])
|
|
||||||
|
|
||||||
def test_link(self):
|
|
||||||
"""Verify Link handling with new names."""
|
|
||||||
manifest = manifest_xml.XmlManifest(self.repodir, self.manifest_file)
|
|
||||||
with open(os.path.join(self.manifest_dir, 'foo.xml'), 'w') as fp:
|
|
||||||
fp.write('<manifest></manifest>')
|
|
||||||
manifest.Link('foo.xml')
|
|
||||||
with open(self.manifest_file) as fp:
|
|
||||||
self.assertIn('<include name="foo.xml" />', fp.read())
|
|
||||||
|
|
||||||
def test_toxml_empty(self):
|
|
||||||
"""Verify the ToXml() helper."""
|
|
||||||
manifest = self.getXmlManifest(
|
|
||||||
'<?xml version="1.0" encoding="UTF-8"?>'
|
|
||||||
'<manifest></manifest>')
|
|
||||||
self.assertEqual(manifest.ToXml().toxml(), '<?xml version="1.0" ?><manifest/>')
|
|
||||||
|
|
||||||
def test_todict_empty(self):
|
|
||||||
"""Verify the ToDict() helper."""
|
|
||||||
manifest = self.getXmlManifest(
|
|
||||||
'<?xml version="1.0" encoding="UTF-8"?>'
|
|
||||||
'<manifest></manifest>')
|
|
||||||
self.assertEqual(manifest.ToDict(), {})
|
|
||||||
|
|
||||||
def test_repo_hooks(self):
|
|
||||||
"""Check repo-hooks settings."""
|
|
||||||
manifest = self.getXmlManifest("""
|
|
||||||
<manifest>
|
|
||||||
<remote name="test-remote" fetch="http://localhost" />
|
|
||||||
<default remote="test-remote" revision="refs/heads/main" />
|
|
||||||
<project name="repohooks" path="src/repohooks"/>
|
|
||||||
<repo-hooks in-project="repohooks" enabled-list="a, b"/>
|
|
||||||
</manifest>
|
|
||||||
""")
|
|
||||||
self.assertEqual(manifest.repo_hooks_project.name, 'repohooks')
|
|
||||||
self.assertEqual(manifest.repo_hooks_project.enabled_repo_hooks, ['a', 'b'])
|
|
||||||
|
|
||||||
def test_unknown_tags(self):
|
|
||||||
"""Check superproject settings."""
|
|
||||||
manifest = self.getXmlManifest("""
|
|
||||||
<manifest>
|
|
||||||
<remote name="test-remote" fetch="http://localhost" />
|
|
||||||
<default remote="test-remote" revision="refs/heads/main" />
|
|
||||||
<superproject name="superproject"/>
|
|
||||||
<iankaz value="unknown (possible) future tags are ignored"/>
|
|
||||||
<x-custom-tag>X tags are always ignored</x-custom-tag>
|
|
||||||
</manifest>
|
|
||||||
""")
|
|
||||||
self.assertEqual(manifest.superproject['name'], 'superproject')
|
|
||||||
self.assertEqual(manifest.superproject['remote'].name, 'test-remote')
|
|
||||||
self.assertEqual(
|
|
||||||
manifest.ToXml().toxml(),
|
|
||||||
'<?xml version="1.0" ?><manifest>'
|
|
||||||
'<remote name="test-remote" fetch="http://localhost"/>'
|
|
||||||
'<default remote="test-remote" revision="refs/heads/main"/>'
|
|
||||||
'<superproject name="superproject"/>'
|
|
||||||
'</manifest>')
|
|
||||||
|
|
||||||
|
|
||||||
class IncludeElementTests(ManifestParseTestCase):
|
|
||||||
"""Tests for <include>."""
|
|
||||||
|
|
||||||
def test_group_levels(self):
|
|
||||||
root_m = os.path.join(self.manifest_dir, 'root.xml')
|
|
||||||
with open(root_m, 'w') as fp:
|
|
||||||
fp.write("""
|
|
||||||
<manifest>
|
|
||||||
<remote name="test-remote" fetch="http://localhost" />
|
|
||||||
<default remote="test-remote" revision="refs/heads/main" />
|
|
||||||
<include name="level1.xml" groups="level1-group" />
|
|
||||||
<project name="root-name1" path="root-path1" />
|
|
||||||
<project name="root-name2" path="root-path2" groups="r2g1,r2g2" />
|
|
||||||
</manifest>
|
|
||||||
""")
|
|
||||||
with open(os.path.join(self.manifest_dir, 'level1.xml'), 'w') as fp:
|
|
||||||
fp.write("""
|
|
||||||
<manifest>
|
|
||||||
<include name="level2.xml" groups="level2-group" />
|
|
||||||
<project name="level1-name1" path="level1-path1" />
|
|
||||||
</manifest>
|
|
||||||
""")
|
|
||||||
with open(os.path.join(self.manifest_dir, 'level2.xml'), 'w') as fp:
|
|
||||||
fp.write("""
|
|
||||||
<manifest>
|
|
||||||
<project name="level2-name1" path="level2-path1" groups="l2g1,l2g2" />
|
|
||||||
</manifest>
|
|
||||||
""")
|
|
||||||
include_m = manifest_xml.XmlManifest(self.repodir, root_m)
|
|
||||||
for proj in include_m.projects:
|
|
||||||
if proj.name == 'root-name1':
|
|
||||||
# Check include group not set on root level proj.
|
|
||||||
self.assertNotIn('level1-group', proj.groups)
|
|
||||||
if proj.name == 'root-name2':
|
|
||||||
# Check root proj group not removed.
|
|
||||||
self.assertIn('r2g1', proj.groups)
|
|
||||||
if proj.name == 'level1-name1':
|
|
||||||
# Check level1 proj has inherited group level 1.
|
|
||||||
self.assertIn('level1-group', proj.groups)
|
|
||||||
if proj.name == 'level2-name1':
|
|
||||||
# Check level2 proj has inherited group levels 1 and 2.
|
|
||||||
self.assertIn('level1-group', proj.groups)
|
|
||||||
self.assertIn('level2-group', proj.groups)
|
|
||||||
# Check level2 proj group not removed.
|
|
||||||
self.assertIn('l2g1', proj.groups)
|
|
||||||
|
|
||||||
def test_allow_bad_name_from_user(self):
|
|
||||||
"""Check handling of bad name attribute from the user's input."""
|
|
||||||
def parse(name):
|
|
||||||
name = self.encodeXmlAttr(name)
|
|
||||||
manifest = self.getXmlManifest(f"""
|
|
||||||
<manifest>
|
|
||||||
<remote name="default-remote" fetch="http://localhost" />
|
|
||||||
<default remote="default-remote" revision="refs/heads/main" />
|
|
||||||
<include name="{name}" />
|
|
||||||
</manifest>
|
|
||||||
""")
|
|
||||||
# Force the manifest to be parsed.
|
|
||||||
manifest.ToXml()
|
|
||||||
|
|
||||||
# Setup target of the include.
|
|
||||||
target = os.path.join(self.tempdir, 'target.xml')
|
|
||||||
with open(target, 'w') as fp:
|
|
||||||
fp.write('<manifest></manifest>')
|
|
||||||
|
|
||||||
# Include with absolute path.
|
|
||||||
parse(os.path.abspath(target))
|
|
||||||
|
|
||||||
# Include with relative path.
|
|
||||||
parse(os.path.relpath(target, self.manifest_dir))
|
|
||||||
|
|
||||||
def test_bad_name_checks(self):
|
|
||||||
"""Check handling of bad name attribute."""
|
|
||||||
def parse(name):
|
|
||||||
name = self.encodeXmlAttr(name)
|
|
||||||
# Setup target of the include.
|
|
||||||
with open(os.path.join(self.manifest_dir, 'target.xml'), 'w') as fp:
|
|
||||||
fp.write(f'<manifest><include name="{name}"/></manifest>')
|
|
||||||
|
|
||||||
manifest = self.getXmlManifest("""
|
|
||||||
<manifest>
|
|
||||||
<remote name="default-remote" fetch="http://localhost" />
|
|
||||||
<default remote="default-remote" revision="refs/heads/main" />
|
|
||||||
<include name="target.xml" />
|
|
||||||
</manifest>
|
|
||||||
""")
|
|
||||||
# Force the manifest to be parsed.
|
|
||||||
manifest.ToXml()
|
|
||||||
|
|
||||||
# Handle empty name explicitly because a different codepath rejects it.
|
|
||||||
with self.assertRaises(error.ManifestParseError):
|
|
||||||
parse('')
|
|
||||||
|
|
||||||
for path in INVALID_FS_PATHS:
|
|
||||||
if not path:
|
|
||||||
continue
|
|
||||||
|
|
||||||
with self.assertRaises(error.ManifestInvalidPathError):
|
|
||||||
parse(path)
|
|
||||||
|
|
||||||
|
|
||||||
class ProjectElementTests(ManifestParseTestCase):
|
|
||||||
"""Tests for <project>."""
|
|
||||||
|
|
||||||
def test_group(self):
|
|
||||||
"""Check project group settings."""
|
|
||||||
manifest = self.getXmlManifest("""
|
|
||||||
<manifest>
|
|
||||||
<remote name="test-remote" fetch="http://localhost" />
|
|
||||||
<default remote="test-remote" revision="refs/heads/main" />
|
|
||||||
<project name="test-name" path="test-path"/>
|
|
||||||
<project name="extras" path="path" groups="g1,g2,g1"/>
|
|
||||||
</manifest>
|
|
||||||
""")
|
|
||||||
self.assertEqual(len(manifest.projects), 2)
|
|
||||||
# Ordering isn't guaranteed.
|
|
||||||
result = {
|
|
||||||
manifest.projects[0].name: manifest.projects[0].groups,
|
|
||||||
manifest.projects[1].name: manifest.projects[1].groups,
|
|
||||||
}
|
|
||||||
project = manifest.projects[0]
|
|
||||||
self.assertCountEqual(
|
|
||||||
result['test-name'],
|
|
||||||
['name:test-name', 'all', 'path:test-path'])
|
|
||||||
self.assertCountEqual(
|
|
||||||
result['extras'],
|
|
||||||
['g1', 'g2', 'g1', 'name:extras', 'all', 'path:path'])
|
|
||||||
groupstr = 'default,platform-' + platform.system().lower()
|
|
||||||
self.assertEqual(groupstr, manifest.GetGroupsStr())
|
|
||||||
groupstr = 'g1,g2,g1'
|
|
||||||
manifest.manifestProject.config.SetString('manifest.groups', groupstr)
|
|
||||||
self.assertEqual(groupstr, manifest.GetGroupsStr())
|
|
||||||
|
|
||||||
def test_set_revision_id(self):
|
|
||||||
"""Check setting of project's revisionId."""
|
|
||||||
manifest = self.getXmlManifest("""
|
|
||||||
<manifest>
|
|
||||||
<remote name="default-remote" fetch="http://localhost" />
|
|
||||||
<default remote="default-remote" revision="refs/heads/main" />
|
|
||||||
<project name="test-name"/>
|
|
||||||
</manifest>
|
|
||||||
""")
|
|
||||||
self.assertEqual(len(manifest.projects), 1)
|
|
||||||
project = manifest.projects[0]
|
|
||||||
project.SetRevisionId('ABCDEF')
|
|
||||||
self.assertEqual(
|
|
||||||
manifest.ToXml().toxml(),
|
|
||||||
'<?xml version="1.0" ?><manifest>'
|
|
||||||
'<remote name="default-remote" fetch="http://localhost"/>'
|
|
||||||
'<default remote="default-remote" revision="refs/heads/main"/>'
|
|
||||||
'<project name="test-name" revision="ABCDEF"/>'
|
|
||||||
'</manifest>')
|
|
||||||
|
|
||||||
def test_trailing_slash(self):
|
|
||||||
"""Check handling of trailing slashes in attributes."""
|
|
||||||
def parse(name, path):
|
|
||||||
name = self.encodeXmlAttr(name)
|
|
||||||
path = self.encodeXmlAttr(path)
|
|
||||||
return self.getXmlManifest(f"""
|
|
||||||
<manifest>
|
|
||||||
<remote name="default-remote" fetch="http://localhost" />
|
|
||||||
<default remote="default-remote" revision="refs/heads/main" />
|
|
||||||
<project name="{name}" path="{path}" />
|
|
||||||
</manifest>
|
|
||||||
""")
|
|
||||||
|
|
||||||
manifest = parse('a/path/', 'foo')
|
|
||||||
self.assertEqual(manifest.projects[0].gitdir,
|
|
||||||
os.path.join(self.tempdir, '.repo/projects/foo.git'))
|
|
||||||
self.assertEqual(manifest.projects[0].objdir,
|
|
||||||
os.path.join(self.tempdir, '.repo/project-objects/a/path.git'))
|
|
||||||
|
|
||||||
manifest = parse('a/path', 'foo/')
|
|
||||||
self.assertEqual(manifest.projects[0].gitdir,
|
|
||||||
os.path.join(self.tempdir, '.repo/projects/foo.git'))
|
|
||||||
self.assertEqual(manifest.projects[0].objdir,
|
|
||||||
os.path.join(self.tempdir, '.repo/project-objects/a/path.git'))
|
|
||||||
|
|
||||||
manifest = parse('a/path', 'foo//////')
|
|
||||||
self.assertEqual(manifest.projects[0].gitdir,
|
|
||||||
os.path.join(self.tempdir, '.repo/projects/foo.git'))
|
|
||||||
self.assertEqual(manifest.projects[0].objdir,
|
|
||||||
os.path.join(self.tempdir, '.repo/project-objects/a/path.git'))
|
|
||||||
|
|
||||||
def test_toplevel_path(self):
|
|
||||||
"""Check handling of path=. specially."""
|
|
||||||
def parse(name, path):
|
|
||||||
name = self.encodeXmlAttr(name)
|
|
||||||
path = self.encodeXmlAttr(path)
|
|
||||||
return self.getXmlManifest(f"""
|
|
||||||
<manifest>
|
|
||||||
<remote name="default-remote" fetch="http://localhost" />
|
|
||||||
<default remote="default-remote" revision="refs/heads/main" />
|
|
||||||
<project name="{name}" path="{path}" />
|
|
||||||
</manifest>
|
|
||||||
""")
|
|
||||||
|
|
||||||
for path in ('.', './', './/', './//'):
|
|
||||||
manifest = parse('server/path', path)
|
|
||||||
self.assertEqual(manifest.projects[0].gitdir,
|
|
||||||
os.path.join(self.tempdir, '.repo/projects/..git'))
|
|
||||||
|
|
||||||
def test_bad_path_name_checks(self):
|
|
||||||
"""Check handling of bad path & name attributes."""
|
|
||||||
def parse(name, path):
|
|
||||||
name = self.encodeXmlAttr(name)
|
|
||||||
path = self.encodeXmlAttr(path)
|
|
||||||
manifest = self.getXmlManifest(f"""
|
|
||||||
<manifest>
|
|
||||||
<remote name="default-remote" fetch="http://localhost" />
|
|
||||||
<default remote="default-remote" revision="refs/heads/main" />
|
|
||||||
<project name="{name}" path="{path}" />
|
|
||||||
</manifest>
|
|
||||||
""")
|
|
||||||
# Force the manifest to be parsed.
|
|
||||||
manifest.ToXml()
|
|
||||||
|
|
||||||
# Verify the parser is valid by default to avoid buggy tests below.
|
|
||||||
parse('ok', 'ok')
|
|
||||||
|
|
||||||
# Handle empty name explicitly because a different codepath rejects it.
|
|
||||||
# Empty path is OK because it defaults to the name field.
|
|
||||||
with self.assertRaises(error.ManifestParseError):
|
|
||||||
parse('', 'ok')
|
|
||||||
|
|
||||||
for path in INVALID_FS_PATHS:
|
|
||||||
if not path or path.endswith('/'):
|
|
||||||
continue
|
|
||||||
|
|
||||||
with self.assertRaises(error.ManifestInvalidPathError):
|
|
||||||
parse(path, 'ok')
|
|
||||||
|
|
||||||
# We have a dedicated test for path=".".
|
|
||||||
if path not in {'.'}:
|
|
||||||
with self.assertRaises(error.ManifestInvalidPathError):
|
|
||||||
parse('ok', path)
|
|
||||||
|
|
||||||
|
|
||||||
class SuperProjectElementTests(ManifestParseTestCase):
|
|
||||||
"""Tests for <superproject>."""
|
|
||||||
|
|
||||||
def test_superproject(self):
|
|
||||||
"""Check superproject settings."""
|
|
||||||
manifest = self.getXmlManifest("""
|
|
||||||
<manifest>
|
|
||||||
<remote name="test-remote" fetch="http://localhost" />
|
|
||||||
<default remote="test-remote" revision="refs/heads/main" />
|
|
||||||
<superproject name="superproject"/>
|
|
||||||
</manifest>
|
|
||||||
""")
|
|
||||||
self.assertEqual(manifest.superproject['name'], 'superproject')
|
|
||||||
self.assertEqual(manifest.superproject['remote'].name, 'test-remote')
|
|
||||||
self.assertEqual(manifest.superproject['remote'].url, 'http://localhost/superproject')
|
|
||||||
self.assertEqual(
|
|
||||||
manifest.ToXml().toxml(),
|
|
||||||
'<?xml version="1.0" ?><manifest>'
|
|
||||||
'<remote name="test-remote" fetch="http://localhost"/>'
|
|
||||||
'<default remote="test-remote" revision="refs/heads/main"/>'
|
|
||||||
'<superproject name="superproject"/>'
|
|
||||||
'</manifest>')
|
|
||||||
|
|
||||||
def test_remote(self):
|
|
||||||
"""Check superproject settings with a remote."""
|
|
||||||
manifest = self.getXmlManifest("""
|
|
||||||
<manifest>
|
|
||||||
<remote name="default-remote" fetch="http://localhost" />
|
|
||||||
<remote name="superproject-remote" fetch="http://localhost" />
|
|
||||||
<default remote="default-remote" revision="refs/heads/main" />
|
|
||||||
<superproject name="platform/superproject" remote="superproject-remote"/>
|
|
||||||
</manifest>
|
|
||||||
""")
|
|
||||||
self.assertEqual(manifest.superproject['name'], 'platform/superproject')
|
|
||||||
self.assertEqual(manifest.superproject['remote'].name, 'superproject-remote')
|
|
||||||
self.assertEqual(manifest.superproject['remote'].url, 'http://localhost/platform/superproject')
|
|
||||||
self.assertEqual(
|
|
||||||
manifest.ToXml().toxml(),
|
|
||||||
'<?xml version="1.0" ?><manifest>'
|
|
||||||
'<remote name="default-remote" fetch="http://localhost"/>'
|
|
||||||
'<remote name="superproject-remote" fetch="http://localhost"/>'
|
|
||||||
'<default remote="default-remote" revision="refs/heads/main"/>'
|
|
||||||
'<superproject name="platform/superproject" remote="superproject-remote"/>'
|
|
||||||
'</manifest>')
|
|
||||||
|
|
||||||
def test_defalut_remote(self):
|
|
||||||
"""Check superproject settings with a default remote."""
|
|
||||||
manifest = self.getXmlManifest("""
|
|
||||||
<manifest>
|
|
||||||
<remote name="default-remote" fetch="http://localhost" />
|
|
||||||
<default remote="default-remote" revision="refs/heads/main" />
|
|
||||||
<superproject name="superproject" remote="default-remote"/>
|
|
||||||
</manifest>
|
|
||||||
""")
|
|
||||||
self.assertEqual(manifest.superproject['name'], 'superproject')
|
|
||||||
self.assertEqual(manifest.superproject['remote'].name, 'default-remote')
|
|
||||||
self.assertEqual(
|
|
||||||
manifest.ToXml().toxml(),
|
|
||||||
'<?xml version="1.0" ?><manifest>'
|
|
||||||
'<remote name="default-remote" fetch="http://localhost"/>'
|
|
||||||
'<default remote="default-remote" revision="refs/heads/main"/>'
|
|
||||||
'<superproject name="superproject"/>'
|
|
||||||
'</manifest>')
|
|
||||||
|
|
||||||
|
|
||||||
class ContactinfoElementTests(ManifestParseTestCase):
|
|
||||||
"""Tests for <contactinfo>."""
|
|
||||||
|
|
||||||
def test_contactinfo(self):
|
|
||||||
"""Check contactinfo settings."""
|
|
||||||
bugurl = 'http://localhost/contactinfo'
|
|
||||||
manifest = self.getXmlManifest(f"""
|
|
||||||
<manifest>
|
|
||||||
<contactinfo bugurl="{bugurl}"/>
|
|
||||||
</manifest>
|
|
||||||
""")
|
|
||||||
self.assertEqual(manifest.contactinfo['bugurl'], bugurl)
|
|
||||||
self.assertEqual(
|
|
||||||
manifest.ToXml().toxml(),
|
|
||||||
'<?xml version="1.0" ?><manifest>'
|
|
||||||
f'<contactinfo bugurl="{bugurl}"/>'
|
|
||||||
'</manifest>')
|
|
@ -1,3 +1,5 @@
|
|||||||
|
# -*- coding:utf-8 -*-
|
||||||
|
#
|
||||||
# Copyright (C) 2019 The Android Open Source Project
|
# Copyright (C) 2019 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
@ -14,6 +16,8 @@
|
|||||||
|
|
||||||
"""Unittests for the project.py module."""
|
"""Unittests for the project.py module."""
|
||||||
|
|
||||||
|
from __future__ import print_function
|
||||||
|
|
||||||
import contextlib
|
import contextlib
|
||||||
import os
|
import os
|
||||||
import shutil
|
import shutil
|
||||||
@ -21,10 +25,7 @@ import subprocess
|
|||||||
import tempfile
|
import tempfile
|
||||||
import unittest
|
import unittest
|
||||||
|
|
||||||
import error
|
|
||||||
import git_command
|
|
||||||
import git_config
|
import git_config
|
||||||
import platform_utils
|
|
||||||
import project
|
import project
|
||||||
|
|
||||||
|
|
||||||
@ -35,22 +36,49 @@ def TempGitTree():
|
|||||||
# Python 2 support entirely.
|
# Python 2 support entirely.
|
||||||
try:
|
try:
|
||||||
tempdir = tempfile.mkdtemp(prefix='repo-tests')
|
tempdir = tempfile.mkdtemp(prefix='repo-tests')
|
||||||
|
subprocess.check_call(['git', 'init'], cwd=tempdir)
|
||||||
# Tests need to assume, that main is default branch at init,
|
|
||||||
# which is not supported in config until 2.28.
|
|
||||||
cmd = ['git', 'init']
|
|
||||||
if git_command.git_require((2, 28, 0)):
|
|
||||||
cmd += ['--initial-branch=main']
|
|
||||||
else:
|
|
||||||
# Use template dir for init.
|
|
||||||
templatedir = tempfile.mkdtemp(prefix='.test-template')
|
|
||||||
with open(os.path.join(templatedir, 'HEAD'), 'w') as fp:
|
|
||||||
fp.write('ref: refs/heads/main\n')
|
|
||||||
cmd += ['--template', templatedir]
|
|
||||||
subprocess.check_call(cmd, cwd=tempdir)
|
|
||||||
yield tempdir
|
yield tempdir
|
||||||
finally:
|
finally:
|
||||||
platform_utils.rmtree(tempdir)
|
shutil.rmtree(tempdir)
|
||||||
|
|
||||||
|
|
||||||
|
class RepoHookShebang(unittest.TestCase):
|
||||||
|
"""Check shebang parsing in RepoHook."""
|
||||||
|
|
||||||
|
def test_no_shebang(self):
|
||||||
|
"""Lines w/out shebangs should be rejected."""
|
||||||
|
DATA = (
|
||||||
|
'',
|
||||||
|
'# -*- coding:utf-8 -*-\n',
|
||||||
|
'#\n# foo\n',
|
||||||
|
'# Bad shebang in script\n#!/foo\n'
|
||||||
|
)
|
||||||
|
for data in DATA:
|
||||||
|
self.assertIsNone(project.RepoHook._ExtractInterpFromShebang(data))
|
||||||
|
|
||||||
|
def test_direct_interp(self):
|
||||||
|
"""Lines whose shebang points directly to the interpreter."""
|
||||||
|
DATA = (
|
||||||
|
('#!/foo', '/foo'),
|
||||||
|
('#! /foo', '/foo'),
|
||||||
|
('#!/bin/foo ', '/bin/foo'),
|
||||||
|
('#! /usr/foo ', '/usr/foo'),
|
||||||
|
('#! /usr/foo -args', '/usr/foo'),
|
||||||
|
)
|
||||||
|
for shebang, interp in DATA:
|
||||||
|
self.assertEqual(project.RepoHook._ExtractInterpFromShebang(shebang),
|
||||||
|
interp)
|
||||||
|
|
||||||
|
def test_env_interp(self):
|
||||||
|
"""Lines whose shebang launches through `env`."""
|
||||||
|
DATA = (
|
||||||
|
('#!/usr/bin/env foo', 'foo'),
|
||||||
|
('#!/bin/env foo', 'foo'),
|
||||||
|
('#! /bin/env /bin/foo ', '/bin/foo'),
|
||||||
|
)
|
||||||
|
for shebang, interp in DATA:
|
||||||
|
self.assertEqual(project.RepoHook._ExtractInterpFromShebang(shebang),
|
||||||
|
interp)
|
||||||
|
|
||||||
|
|
||||||
class FakeProject(object):
|
class FakeProject(object):
|
||||||
@ -86,7 +114,7 @@ class ReviewableBranchTests(unittest.TestCase):
|
|||||||
|
|
||||||
# Start off with the normal details.
|
# Start off with the normal details.
|
||||||
rb = project.ReviewableBranch(
|
rb = project.ReviewableBranch(
|
||||||
fakeproj, fakeproj.config.GetBranch('work'), 'main')
|
fakeproj, fakeproj.config.GetBranch('work'), 'master')
|
||||||
self.assertEqual('work', rb.name)
|
self.assertEqual('work', rb.name)
|
||||||
self.assertEqual(1, len(rb.commits))
|
self.assertEqual(1, len(rb.commits))
|
||||||
self.assertIn('Del file', rb.commits[0])
|
self.assertIn('Del file', rb.commits[0])
|
||||||
@ -99,239 +127,10 @@ class ReviewableBranchTests(unittest.TestCase):
|
|||||||
self.assertTrue(rb.date)
|
self.assertTrue(rb.date)
|
||||||
|
|
||||||
# Now delete the tracking branch!
|
# Now delete the tracking branch!
|
||||||
fakeproj.work_git.branch('-D', 'main')
|
fakeproj.work_git.branch('-D', 'master')
|
||||||
rb = project.ReviewableBranch(
|
rb = project.ReviewableBranch(
|
||||||
fakeproj, fakeproj.config.GetBranch('work'), 'main')
|
fakeproj, fakeproj.config.GetBranch('work'), 'master')
|
||||||
self.assertEqual(0, len(rb.commits))
|
self.assertEqual(0, len(rb.commits))
|
||||||
self.assertFalse(rb.base_exists)
|
self.assertFalse(rb.base_exists)
|
||||||
# Hard to assert anything useful about this.
|
# Hard to assert anything useful about this.
|
||||||
self.assertTrue(rb.date)
|
self.assertTrue(rb.date)
|
||||||
|
|
||||||
|
|
||||||
class CopyLinkTestCase(unittest.TestCase):
|
|
||||||
"""TestCase for stub repo client checkouts.
|
|
||||||
|
|
||||||
It'll have a layout like:
|
|
||||||
tempdir/ # self.tempdir
|
|
||||||
checkout/ # self.topdir
|
|
||||||
git-project/ # self.worktree
|
|
||||||
|
|
||||||
Attributes:
|
|
||||||
tempdir: A dedicated temporary directory.
|
|
||||||
worktree: The top of the repo client checkout.
|
|
||||||
topdir: The top of a project checkout.
|
|
||||||
"""
|
|
||||||
|
|
||||||
def setUp(self):
|
|
||||||
self.tempdir = tempfile.mkdtemp(prefix='repo_tests')
|
|
||||||
self.topdir = os.path.join(self.tempdir, 'checkout')
|
|
||||||
self.worktree = os.path.join(self.topdir, 'git-project')
|
|
||||||
os.makedirs(self.topdir)
|
|
||||||
os.makedirs(self.worktree)
|
|
||||||
|
|
||||||
def tearDown(self):
|
|
||||||
shutil.rmtree(self.tempdir, ignore_errors=True)
|
|
||||||
|
|
||||||
@staticmethod
|
|
||||||
def touch(path):
|
|
||||||
with open(path, 'w'):
|
|
||||||
pass
|
|
||||||
|
|
||||||
def assertExists(self, path, msg=None):
|
|
||||||
"""Make sure |path| exists."""
|
|
||||||
if os.path.exists(path):
|
|
||||||
return
|
|
||||||
|
|
||||||
if msg is None:
|
|
||||||
msg = ['path is missing: %s' % path]
|
|
||||||
while path != '/':
|
|
||||||
path = os.path.dirname(path)
|
|
||||||
if not path:
|
|
||||||
# If we're given something like "foo", abort once we get to "".
|
|
||||||
break
|
|
||||||
result = os.path.exists(path)
|
|
||||||
msg.append('\tos.path.exists(%s): %s' % (path, result))
|
|
||||||
if result:
|
|
||||||
msg.append('\tcontents: %r' % os.listdir(path))
|
|
||||||
break
|
|
||||||
msg = '\n'.join(msg)
|
|
||||||
|
|
||||||
raise self.failureException(msg)
|
|
||||||
|
|
||||||
|
|
||||||
class CopyFile(CopyLinkTestCase):
|
|
||||||
"""Check _CopyFile handling."""
|
|
||||||
|
|
||||||
def CopyFile(self, src, dest):
|
|
||||||
return project._CopyFile(self.worktree, src, self.topdir, dest)
|
|
||||||
|
|
||||||
def test_basic(self):
|
|
||||||
"""Basic test of copying a file from a project to the toplevel."""
|
|
||||||
src = os.path.join(self.worktree, 'foo.txt')
|
|
||||||
self.touch(src)
|
|
||||||
cf = self.CopyFile('foo.txt', 'foo')
|
|
||||||
cf._Copy()
|
|
||||||
self.assertExists(os.path.join(self.topdir, 'foo'))
|
|
||||||
|
|
||||||
def test_src_subdir(self):
|
|
||||||
"""Copy a file from a subdir of a project."""
|
|
||||||
src = os.path.join(self.worktree, 'bar', 'foo.txt')
|
|
||||||
os.makedirs(os.path.dirname(src))
|
|
||||||
self.touch(src)
|
|
||||||
cf = self.CopyFile('bar/foo.txt', 'new.txt')
|
|
||||||
cf._Copy()
|
|
||||||
self.assertExists(os.path.join(self.topdir, 'new.txt'))
|
|
||||||
|
|
||||||
def test_dest_subdir(self):
|
|
||||||
"""Copy a file to a subdir of a checkout."""
|
|
||||||
src = os.path.join(self.worktree, 'foo.txt')
|
|
||||||
self.touch(src)
|
|
||||||
cf = self.CopyFile('foo.txt', 'sub/dir/new.txt')
|
|
||||||
self.assertFalse(os.path.exists(os.path.join(self.topdir, 'sub')))
|
|
||||||
cf._Copy()
|
|
||||||
self.assertExists(os.path.join(self.topdir, 'sub', 'dir', 'new.txt'))
|
|
||||||
|
|
||||||
def test_update(self):
|
|
||||||
"""Make sure changed files get copied again."""
|
|
||||||
src = os.path.join(self.worktree, 'foo.txt')
|
|
||||||
dest = os.path.join(self.topdir, 'bar')
|
|
||||||
with open(src, 'w') as f:
|
|
||||||
f.write('1st')
|
|
||||||
cf = self.CopyFile('foo.txt', 'bar')
|
|
||||||
cf._Copy()
|
|
||||||
self.assertExists(dest)
|
|
||||||
with open(dest) as f:
|
|
||||||
self.assertEqual(f.read(), '1st')
|
|
||||||
|
|
||||||
with open(src, 'w') as f:
|
|
||||||
f.write('2nd!')
|
|
||||||
cf._Copy()
|
|
||||||
with open(dest) as f:
|
|
||||||
self.assertEqual(f.read(), '2nd!')
|
|
||||||
|
|
||||||
def test_src_block_symlink(self):
|
|
||||||
"""Do not allow reading from a symlinked path."""
|
|
||||||
src = os.path.join(self.worktree, 'foo.txt')
|
|
||||||
sym = os.path.join(self.worktree, 'sym')
|
|
||||||
self.touch(src)
|
|
||||||
platform_utils.symlink('foo.txt', sym)
|
|
||||||
self.assertExists(sym)
|
|
||||||
cf = self.CopyFile('sym', 'foo')
|
|
||||||
self.assertRaises(error.ManifestInvalidPathError, cf._Copy)
|
|
||||||
|
|
||||||
def test_src_block_symlink_traversal(self):
|
|
||||||
"""Do not allow reading through a symlink dir."""
|
|
||||||
realfile = os.path.join(self.tempdir, 'file.txt')
|
|
||||||
self.touch(realfile)
|
|
||||||
src = os.path.join(self.worktree, 'bar', 'file.txt')
|
|
||||||
platform_utils.symlink(self.tempdir, os.path.join(self.worktree, 'bar'))
|
|
||||||
self.assertExists(src)
|
|
||||||
cf = self.CopyFile('bar/file.txt', 'foo')
|
|
||||||
self.assertRaises(error.ManifestInvalidPathError, cf._Copy)
|
|
||||||
|
|
||||||
def test_src_block_copy_from_dir(self):
|
|
||||||
"""Do not allow copying from a directory."""
|
|
||||||
src = os.path.join(self.worktree, 'dir')
|
|
||||||
os.makedirs(src)
|
|
||||||
cf = self.CopyFile('dir', 'foo')
|
|
||||||
self.assertRaises(error.ManifestInvalidPathError, cf._Copy)
|
|
||||||
|
|
||||||
def test_dest_block_symlink(self):
|
|
||||||
"""Do not allow writing to a symlink."""
|
|
||||||
src = os.path.join(self.worktree, 'foo.txt')
|
|
||||||
self.touch(src)
|
|
||||||
platform_utils.symlink('dest', os.path.join(self.topdir, 'sym'))
|
|
||||||
cf = self.CopyFile('foo.txt', 'sym')
|
|
||||||
self.assertRaises(error.ManifestInvalidPathError, cf._Copy)
|
|
||||||
|
|
||||||
def test_dest_block_symlink_traversal(self):
|
|
||||||
"""Do not allow writing through a symlink dir."""
|
|
||||||
src = os.path.join(self.worktree, 'foo.txt')
|
|
||||||
self.touch(src)
|
|
||||||
platform_utils.symlink(tempfile.gettempdir(),
|
|
||||||
os.path.join(self.topdir, 'sym'))
|
|
||||||
cf = self.CopyFile('foo.txt', 'sym/foo.txt')
|
|
||||||
self.assertRaises(error.ManifestInvalidPathError, cf._Copy)
|
|
||||||
|
|
||||||
def test_src_block_copy_to_dir(self):
|
|
||||||
"""Do not allow copying to a directory."""
|
|
||||||
src = os.path.join(self.worktree, 'foo.txt')
|
|
||||||
self.touch(src)
|
|
||||||
os.makedirs(os.path.join(self.topdir, 'dir'))
|
|
||||||
cf = self.CopyFile('foo.txt', 'dir')
|
|
||||||
self.assertRaises(error.ManifestInvalidPathError, cf._Copy)
|
|
||||||
|
|
||||||
|
|
||||||
class LinkFile(CopyLinkTestCase):
|
|
||||||
"""Check _LinkFile handling."""
|
|
||||||
|
|
||||||
def LinkFile(self, src, dest):
|
|
||||||
return project._LinkFile(self.worktree, src, self.topdir, dest)
|
|
||||||
|
|
||||||
def test_basic(self):
|
|
||||||
"""Basic test of linking a file from a project into the toplevel."""
|
|
||||||
src = os.path.join(self.worktree, 'foo.txt')
|
|
||||||
self.touch(src)
|
|
||||||
lf = self.LinkFile('foo.txt', 'foo')
|
|
||||||
lf._Link()
|
|
||||||
dest = os.path.join(self.topdir, 'foo')
|
|
||||||
self.assertExists(dest)
|
|
||||||
self.assertTrue(os.path.islink(dest))
|
|
||||||
self.assertEqual(os.path.join('git-project', 'foo.txt'), os.readlink(dest))
|
|
||||||
|
|
||||||
def test_src_subdir(self):
|
|
||||||
"""Link to a file in a subdir of a project."""
|
|
||||||
src = os.path.join(self.worktree, 'bar', 'foo.txt')
|
|
||||||
os.makedirs(os.path.dirname(src))
|
|
||||||
self.touch(src)
|
|
||||||
lf = self.LinkFile('bar/foo.txt', 'foo')
|
|
||||||
lf._Link()
|
|
||||||
self.assertExists(os.path.join(self.topdir, 'foo'))
|
|
||||||
|
|
||||||
def test_src_self(self):
|
|
||||||
"""Link to the project itself."""
|
|
||||||
dest = os.path.join(self.topdir, 'foo', 'bar')
|
|
||||||
lf = self.LinkFile('.', 'foo/bar')
|
|
||||||
lf._Link()
|
|
||||||
self.assertExists(dest)
|
|
||||||
self.assertEqual(os.path.join('..', 'git-project'), os.readlink(dest))
|
|
||||||
|
|
||||||
def test_dest_subdir(self):
|
|
||||||
"""Link a file to a subdir of a checkout."""
|
|
||||||
src = os.path.join(self.worktree, 'foo.txt')
|
|
||||||
self.touch(src)
|
|
||||||
lf = self.LinkFile('foo.txt', 'sub/dir/foo/bar')
|
|
||||||
self.assertFalse(os.path.exists(os.path.join(self.topdir, 'sub')))
|
|
||||||
lf._Link()
|
|
||||||
self.assertExists(os.path.join(self.topdir, 'sub', 'dir', 'foo', 'bar'))
|
|
||||||
|
|
||||||
def test_src_block_relative(self):
|
|
||||||
"""Do not allow relative symlinks."""
|
|
||||||
BAD_SOURCES = (
|
|
||||||
'./',
|
|
||||||
'..',
|
|
||||||
'../',
|
|
||||||
'foo/.',
|
|
||||||
'foo/./bar',
|
|
||||||
'foo/..',
|
|
||||||
'foo/../foo',
|
|
||||||
)
|
|
||||||
for src in BAD_SOURCES:
|
|
||||||
lf = self.LinkFile(src, 'foo')
|
|
||||||
self.assertRaises(error.ManifestInvalidPathError, lf._Link)
|
|
||||||
|
|
||||||
def test_update(self):
|
|
||||||
"""Make sure changed targets get updated."""
|
|
||||||
dest = os.path.join(self.topdir, 'sym')
|
|
||||||
|
|
||||||
src = os.path.join(self.worktree, 'foo.txt')
|
|
||||||
self.touch(src)
|
|
||||||
lf = self.LinkFile('foo.txt', 'sym')
|
|
||||||
lf._Link()
|
|
||||||
self.assertEqual(os.path.join('git-project', 'foo.txt'), os.readlink(dest))
|
|
||||||
|
|
||||||
# Point the symlink somewhere else.
|
|
||||||
os.unlink(dest)
|
|
||||||
platform_utils.symlink(self.tempdir, dest)
|
|
||||||
lf._Link()
|
|
||||||
self.assertEqual(os.path.join('git-project', 'foo.txt'), os.readlink(dest))
|
|
||||||
|
@ -1,74 +0,0 @@
|
|||||||
# Copyright 2019 The Android Open Source Project
|
|
||||||
#
|
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
|
||||||
# you may not use this file except in compliance with the License.
|
|
||||||
# You may obtain a copy of the License at
|
|
||||||
#
|
|
||||||
# http://www.apache.org/licenses/LICENSE-2.0
|
|
||||||
#
|
|
||||||
# Unless required by applicable law or agreed to in writing, software
|
|
||||||
# distributed under the License is distributed on an "AS IS" BASIS,
|
|
||||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
|
||||||
# See the License for the specific language governing permissions and
|
|
||||||
# limitations under the License.
|
|
||||||
|
|
||||||
"""Unittests for the ssh.py module."""
|
|
||||||
|
|
||||||
import multiprocessing
|
|
||||||
import subprocess
|
|
||||||
import unittest
|
|
||||||
from unittest import mock
|
|
||||||
|
|
||||||
import ssh
|
|
||||||
|
|
||||||
|
|
||||||
class SshTests(unittest.TestCase):
|
|
||||||
"""Tests the ssh functions."""
|
|
||||||
|
|
||||||
def test_parse_ssh_version(self):
|
|
||||||
"""Check _parse_ssh_version() handling."""
|
|
||||||
ver = ssh._parse_ssh_version('Unknown\n')
|
|
||||||
self.assertEqual(ver, ())
|
|
||||||
ver = ssh._parse_ssh_version('OpenSSH_1.0\n')
|
|
||||||
self.assertEqual(ver, (1, 0))
|
|
||||||
ver = ssh._parse_ssh_version('OpenSSH_6.6.1p1 Ubuntu-2ubuntu2.13, OpenSSL 1.0.1f 6 Jan 2014\n')
|
|
||||||
self.assertEqual(ver, (6, 6, 1))
|
|
||||||
ver = ssh._parse_ssh_version('OpenSSH_7.6p1 Ubuntu-4ubuntu0.3, OpenSSL 1.0.2n 7 Dec 2017\n')
|
|
||||||
self.assertEqual(ver, (7, 6))
|
|
||||||
|
|
||||||
def test_version(self):
|
|
||||||
"""Check version() handling."""
|
|
||||||
with mock.patch('ssh._run_ssh_version', return_value='OpenSSH_1.2\n'):
|
|
||||||
self.assertEqual(ssh.version(), (1, 2))
|
|
||||||
|
|
||||||
def test_context_manager_empty(self):
|
|
||||||
"""Verify context manager with no clients works correctly."""
|
|
||||||
with multiprocessing.Manager() as manager:
|
|
||||||
with ssh.ProxyManager(manager):
|
|
||||||
pass
|
|
||||||
|
|
||||||
def test_context_manager_child_cleanup(self):
|
|
||||||
"""Verify orphaned clients & masters get cleaned up."""
|
|
||||||
with multiprocessing.Manager() as manager:
|
|
||||||
with ssh.ProxyManager(manager) as ssh_proxy:
|
|
||||||
client = subprocess.Popen(['sleep', '964853320'])
|
|
||||||
ssh_proxy.add_client(client)
|
|
||||||
master = subprocess.Popen(['sleep', '964853321'])
|
|
||||||
ssh_proxy.add_master(master)
|
|
||||||
# If the process still exists, these will throw timeout errors.
|
|
||||||
client.wait(0)
|
|
||||||
master.wait(0)
|
|
||||||
|
|
||||||
def test_ssh_sock(self):
|
|
||||||
"""Check sock() function."""
|
|
||||||
manager = multiprocessing.Manager()
|
|
||||||
proxy = ssh.ProxyManager(manager)
|
|
||||||
with mock.patch('tempfile.mkdtemp', return_value='/tmp/foo'):
|
|
||||||
# old ssh version uses port
|
|
||||||
with mock.patch('ssh.version', return_value=(6, 6)):
|
|
||||||
self.assertTrue(proxy.sock().endswith('%p'))
|
|
||||||
|
|
||||||
proxy._sock_path = None
|
|
||||||
# new ssh version uses hash
|
|
||||||
with mock.patch('ssh.version', return_value=(6, 7)):
|
|
||||||
self.assertTrue(proxy.sock().endswith('%C'))
|
|
@ -1,73 +0,0 @@
|
|||||||
# Copyright (C) 2020 The Android Open Source Project
|
|
||||||
#
|
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
|
||||||
# you may not use this file except in compliance with the License.
|
|
||||||
# You may obtain a copy of the License at
|
|
||||||
#
|
|
||||||
# http://www.apache.org/licenses/LICENSE-2.0
|
|
||||||
#
|
|
||||||
# Unless required by applicable law or agreed to in writing, software
|
|
||||||
# distributed under the License is distributed on an "AS IS" BASIS,
|
|
||||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
|
||||||
# See the License for the specific language governing permissions and
|
|
||||||
# limitations under the License.
|
|
||||||
|
|
||||||
"""Unittests for the subcmds module (mostly __init__.py than subcommands)."""
|
|
||||||
|
|
||||||
import optparse
|
|
||||||
import unittest
|
|
||||||
|
|
||||||
import subcmds
|
|
||||||
|
|
||||||
|
|
||||||
class AllCommands(unittest.TestCase):
|
|
||||||
"""Check registered all_commands."""
|
|
||||||
|
|
||||||
def test_required_basic(self):
|
|
||||||
"""Basic checking of registered commands."""
|
|
||||||
# NB: We don't test all subcommands as we want to avoid "change detection"
|
|
||||||
# tests, so we just look for the most common/important ones here that are
|
|
||||||
# unlikely to ever change.
|
|
||||||
for cmd in {'cherry-pick', 'help', 'init', 'start', 'sync', 'upload'}:
|
|
||||||
self.assertIn(cmd, subcmds.all_commands)
|
|
||||||
|
|
||||||
def test_naming(self):
|
|
||||||
"""Verify we don't add things that we shouldn't."""
|
|
||||||
for cmd in subcmds.all_commands:
|
|
||||||
# Reject filename suffixes like "help.py".
|
|
||||||
self.assertNotIn('.', cmd)
|
|
||||||
|
|
||||||
# Make sure all '_' were converted to '-'.
|
|
||||||
self.assertNotIn('_', cmd)
|
|
||||||
|
|
||||||
# Reject internal python paths like "__init__".
|
|
||||||
self.assertFalse(cmd.startswith('__'))
|
|
||||||
|
|
||||||
def test_help_desc_style(self):
|
|
||||||
"""Force some consistency in option descriptions.
|
|
||||||
|
|
||||||
Python's optparse & argparse has a few default options like --help. Their
|
|
||||||
option description text uses lowercase sentence fragments, so enforce our
|
|
||||||
options follow the same style so UI is consistent.
|
|
||||||
|
|
||||||
We enforce:
|
|
||||||
* Text starts with lowercase.
|
|
||||||
* Text doesn't end with period.
|
|
||||||
"""
|
|
||||||
for name, cls in subcmds.all_commands.items():
|
|
||||||
cmd = cls()
|
|
||||||
parser = cmd.OptionParser
|
|
||||||
for option in parser.option_list:
|
|
||||||
if option.help == optparse.SUPPRESS_HELP:
|
|
||||||
continue
|
|
||||||
|
|
||||||
c = option.help[0]
|
|
||||||
self.assertEqual(
|
|
||||||
c.lower(), c,
|
|
||||||
msg=f'subcmds/{name}.py: {option.get_opt_string()}: help text '
|
|
||||||
f'should start with lowercase: "{option.help}"')
|
|
||||||
|
|
||||||
self.assertNotEqual(
|
|
||||||
option.help[-1], '.',
|
|
||||||
msg=f'subcmds/{name}.py: {option.get_opt_string()}: help text '
|
|
||||||
f'should not end in a period: "{option.help}"')
|
|
@ -1,49 +0,0 @@
|
|||||||
# Copyright (C) 2020 The Android Open Source Project
|
|
||||||
#
|
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
|
||||||
# you may not use this file except in compliance with the License.
|
|
||||||
# You may obtain a copy of the License at
|
|
||||||
#
|
|
||||||
# http://www.apache.org/licenses/LICENSE-2.0
|
|
||||||
#
|
|
||||||
# Unless required by applicable law or agreed to in writing, software
|
|
||||||
# distributed under the License is distributed on an "AS IS" BASIS,
|
|
||||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
|
||||||
# See the License for the specific language governing permissions and
|
|
||||||
# limitations under the License.
|
|
||||||
|
|
||||||
"""Unittests for the subcmds/init.py module."""
|
|
||||||
|
|
||||||
import unittest
|
|
||||||
|
|
||||||
from subcmds import init
|
|
||||||
|
|
||||||
|
|
||||||
class InitCommand(unittest.TestCase):
|
|
||||||
"""Check registered all_commands."""
|
|
||||||
|
|
||||||
def setUp(self):
|
|
||||||
self.cmd = init.Init()
|
|
||||||
|
|
||||||
def test_cli_parser_good(self):
|
|
||||||
"""Check valid command line options."""
|
|
||||||
ARGV = (
|
|
||||||
[],
|
|
||||||
)
|
|
||||||
for argv in ARGV:
|
|
||||||
opts, args = self.cmd.OptionParser.parse_args(argv)
|
|
||||||
self.cmd.ValidateOptions(opts, args)
|
|
||||||
|
|
||||||
def test_cli_parser_bad(self):
|
|
||||||
"""Check invalid command line options."""
|
|
||||||
ARGV = (
|
|
||||||
# Too many arguments.
|
|
||||||
['url', 'asdf'],
|
|
||||||
|
|
||||||
# Conflicting options.
|
|
||||||
['--mirror', '--archive'],
|
|
||||||
)
|
|
||||||
for argv in ARGV:
|
|
||||||
opts, args = self.cmd.OptionParser.parse_args(argv)
|
|
||||||
with self.assertRaises(SystemExit):
|
|
||||||
self.cmd.ValidateOptions(opts, args)
|
|
@ -1,3 +1,5 @@
|
|||||||
|
# -*- coding:utf-8 -*-
|
||||||
|
#
|
||||||
# Copyright (C) 2015 The Android Open Source Project
|
# Copyright (C) 2015 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
@ -14,86 +16,26 @@
|
|||||||
|
|
||||||
"""Unittests for the wrapper.py module."""
|
"""Unittests for the wrapper.py module."""
|
||||||
|
|
||||||
import contextlib
|
from __future__ import print_function
|
||||||
from io import StringIO
|
|
||||||
import os
|
import os
|
||||||
import re
|
|
||||||
import shutil
|
|
||||||
import sys
|
|
||||||
import tempfile
|
|
||||||
import unittest
|
import unittest
|
||||||
from unittest import mock
|
|
||||||
|
|
||||||
import git_command
|
|
||||||
import main
|
|
||||||
import platform_utils
|
|
||||||
import wrapper
|
import wrapper
|
||||||
|
|
||||||
|
|
||||||
@contextlib.contextmanager
|
|
||||||
def TemporaryDirectory():
|
|
||||||
"""Create a new empty git checkout for testing."""
|
|
||||||
# TODO(vapier): Convert this to tempfile.TemporaryDirectory once we drop
|
|
||||||
# Python 2 support entirely.
|
|
||||||
try:
|
|
||||||
tempdir = tempfile.mkdtemp(prefix='repo-tests')
|
|
||||||
yield tempdir
|
|
||||||
finally:
|
|
||||||
platform_utils.rmtree(tempdir)
|
|
||||||
|
|
||||||
|
|
||||||
def fixture(*paths):
|
def fixture(*paths):
|
||||||
"""Return a path relative to tests/fixtures.
|
"""Return a path relative to tests/fixtures.
|
||||||
"""
|
"""
|
||||||
return os.path.join(os.path.dirname(__file__), 'fixtures', *paths)
|
return os.path.join(os.path.dirname(__file__), 'fixtures', *paths)
|
||||||
|
|
||||||
|
class RepoWrapperUnitTest(unittest.TestCase):
|
||||||
class RepoWrapperTestCase(unittest.TestCase):
|
|
||||||
"""TestCase for the wrapper module."""
|
|
||||||
|
|
||||||
def setUp(self):
|
|
||||||
"""Load the wrapper module every time."""
|
|
||||||
wrapper._wrapper_module = None
|
|
||||||
self.wrapper = wrapper.Wrapper()
|
|
||||||
|
|
||||||
|
|
||||||
class RepoWrapperUnitTest(RepoWrapperTestCase):
|
|
||||||
"""Tests helper functions in the repo wrapper
|
"""Tests helper functions in the repo wrapper
|
||||||
"""
|
"""
|
||||||
|
def setUp(self):
|
||||||
def test_version(self):
|
"""Load the wrapper module every time
|
||||||
"""Make sure _Version works."""
|
"""
|
||||||
with self.assertRaises(SystemExit) as e:
|
wrapper._wrapper_module = None
|
||||||
with mock.patch('sys.stdout', new_callable=StringIO) as stdout:
|
self.wrapper = wrapper.Wrapper()
|
||||||
with mock.patch('sys.stderr', new_callable=StringIO) as stderr:
|
|
||||||
self.wrapper._Version()
|
|
||||||
self.assertEqual(0, e.exception.code)
|
|
||||||
self.assertEqual('', stderr.getvalue())
|
|
||||||
self.assertIn('repo launcher version', stdout.getvalue())
|
|
||||||
|
|
||||||
def test_python_constraints(self):
|
|
||||||
"""The launcher should never require newer than main.py."""
|
|
||||||
self.assertGreaterEqual(main.MIN_PYTHON_VERSION_HARD,
|
|
||||||
wrapper.MIN_PYTHON_VERSION_HARD)
|
|
||||||
self.assertGreaterEqual(main.MIN_PYTHON_VERSION_SOFT,
|
|
||||||
wrapper.MIN_PYTHON_VERSION_SOFT)
|
|
||||||
# Make sure the versions are themselves in sync.
|
|
||||||
self.assertGreaterEqual(wrapper.MIN_PYTHON_VERSION_SOFT,
|
|
||||||
wrapper.MIN_PYTHON_VERSION_HARD)
|
|
||||||
|
|
||||||
def test_init_parser(self):
|
|
||||||
"""Make sure 'init' GetParser works."""
|
|
||||||
parser = self.wrapper.GetParser(gitc_init=False)
|
|
||||||
opts, args = parser.parse_args([])
|
|
||||||
self.assertEqual([], args)
|
|
||||||
self.assertIsNone(opts.manifest_url)
|
|
||||||
|
|
||||||
def test_gitc_init_parser(self):
|
|
||||||
"""Make sure 'gitc-init' GetParser works."""
|
|
||||||
parser = self.wrapper.GetParser(gitc_init=True)
|
|
||||||
opts, args = parser.parse_args([])
|
|
||||||
self.assertEqual([], args)
|
|
||||||
self.assertIsNone(opts.manifest_file)
|
|
||||||
|
|
||||||
def test_get_gitc_manifest_dir_no_gitc(self):
|
def test_get_gitc_manifest_dir_no_gitc(self):
|
||||||
"""
|
"""
|
||||||
@ -130,442 +72,9 @@ class RepoWrapperUnitTest(RepoWrapperTestCase):
|
|||||||
self.assertEqual(self.wrapper.gitc_parse_clientdir('/gitc/manifest-rw/test/extra'), 'test')
|
self.assertEqual(self.wrapper.gitc_parse_clientdir('/gitc/manifest-rw/test/extra'), 'test')
|
||||||
self.assertEqual(self.wrapper.gitc_parse_clientdir('/test/usr/local/google/gitc/test'), 'test')
|
self.assertEqual(self.wrapper.gitc_parse_clientdir('/test/usr/local/google/gitc/test'), 'test')
|
||||||
self.assertEqual(self.wrapper.gitc_parse_clientdir('/test/usr/local/google/gitc/test/'), 'test')
|
self.assertEqual(self.wrapper.gitc_parse_clientdir('/test/usr/local/google/gitc/test/'), 'test')
|
||||||
self.assertEqual(self.wrapper.gitc_parse_clientdir('/test/usr/local/google/gitc/test/extra'),
|
self.assertEqual(self.wrapper.gitc_parse_clientdir('/test/usr/local/google/gitc/test/extra'), 'test')
|
||||||
'test')
|
|
||||||
self.assertEqual(self.wrapper.gitc_parse_clientdir('/gitc/manifest-rw/'), None)
|
self.assertEqual(self.wrapper.gitc_parse_clientdir('/gitc/manifest-rw/'), None)
|
||||||
self.assertEqual(self.wrapper.gitc_parse_clientdir('/test/usr/local/google/gitc/'), None)
|
self.assertEqual(self.wrapper.gitc_parse_clientdir('/test/usr/local/google/gitc/'), None)
|
||||||
|
|
||||||
|
|
||||||
class SetGitTrace2ParentSid(RepoWrapperTestCase):
|
|
||||||
"""Check SetGitTrace2ParentSid behavior."""
|
|
||||||
|
|
||||||
KEY = 'GIT_TRACE2_PARENT_SID'
|
|
||||||
VALID_FORMAT = re.compile(r'^repo-[0-9]{8}T[0-9]{6}Z-P[0-9a-f]{8}$')
|
|
||||||
|
|
||||||
def test_first_set(self):
|
|
||||||
"""Test env var not yet set."""
|
|
||||||
env = {}
|
|
||||||
self.wrapper.SetGitTrace2ParentSid(env)
|
|
||||||
self.assertIn(self.KEY, env)
|
|
||||||
value = env[self.KEY]
|
|
||||||
self.assertRegex(value, self.VALID_FORMAT)
|
|
||||||
|
|
||||||
def test_append(self):
|
|
||||||
"""Test env var is appended."""
|
|
||||||
env = {self.KEY: 'pfx'}
|
|
||||||
self.wrapper.SetGitTrace2ParentSid(env)
|
|
||||||
self.assertIn(self.KEY, env)
|
|
||||||
value = env[self.KEY]
|
|
||||||
self.assertTrue(value.startswith('pfx/'))
|
|
||||||
self.assertRegex(value[4:], self.VALID_FORMAT)
|
|
||||||
|
|
||||||
def test_global_context(self):
|
|
||||||
"""Check os.environ gets updated by default."""
|
|
||||||
os.environ.pop(self.KEY, None)
|
|
||||||
self.wrapper.SetGitTrace2ParentSid()
|
|
||||||
self.assertIn(self.KEY, os.environ)
|
|
||||||
value = os.environ[self.KEY]
|
|
||||||
self.assertRegex(value, self.VALID_FORMAT)
|
|
||||||
|
|
||||||
|
|
||||||
class RunCommand(RepoWrapperTestCase):
|
|
||||||
"""Check run_command behavior."""
|
|
||||||
|
|
||||||
def test_capture(self):
|
|
||||||
"""Check capture_output handling."""
|
|
||||||
ret = self.wrapper.run_command(['echo', 'hi'], capture_output=True)
|
|
||||||
self.assertEqual(ret.stdout, 'hi\n')
|
|
||||||
|
|
||||||
def test_check(self):
|
|
||||||
"""Check check handling."""
|
|
||||||
self.wrapper.run_command(['true'], check=False)
|
|
||||||
self.wrapper.run_command(['true'], check=True)
|
|
||||||
self.wrapper.run_command(['false'], check=False)
|
|
||||||
with self.assertRaises(self.wrapper.RunError):
|
|
||||||
self.wrapper.run_command(['false'], check=True)
|
|
||||||
|
|
||||||
|
|
||||||
class RunGit(RepoWrapperTestCase):
|
|
||||||
"""Check run_git behavior."""
|
|
||||||
|
|
||||||
def test_capture(self):
|
|
||||||
"""Check capture_output handling."""
|
|
||||||
ret = self.wrapper.run_git('--version')
|
|
||||||
self.assertIn('git', ret.stdout)
|
|
||||||
|
|
||||||
def test_check(self):
|
|
||||||
"""Check check handling."""
|
|
||||||
with self.assertRaises(self.wrapper.CloneFailure):
|
|
||||||
self.wrapper.run_git('--version-asdfasdf')
|
|
||||||
self.wrapper.run_git('--version-asdfasdf', check=False)
|
|
||||||
|
|
||||||
|
|
||||||
class ParseGitVersion(RepoWrapperTestCase):
|
|
||||||
"""Check ParseGitVersion behavior."""
|
|
||||||
|
|
||||||
def test_autoload(self):
|
|
||||||
"""Check we can load the version from the live git."""
|
|
||||||
ret = self.wrapper.ParseGitVersion()
|
|
||||||
self.assertIsNotNone(ret)
|
|
||||||
|
|
||||||
def test_bad_ver(self):
|
|
||||||
"""Check handling of bad git versions."""
|
|
||||||
ret = self.wrapper.ParseGitVersion(ver_str='asdf')
|
|
||||||
self.assertIsNone(ret)
|
|
||||||
|
|
||||||
def test_normal_ver(self):
|
|
||||||
"""Check handling of normal git versions."""
|
|
||||||
ret = self.wrapper.ParseGitVersion(ver_str='git version 2.25.1')
|
|
||||||
self.assertEqual(2, ret.major)
|
|
||||||
self.assertEqual(25, ret.minor)
|
|
||||||
self.assertEqual(1, ret.micro)
|
|
||||||
self.assertEqual('2.25.1', ret.full)
|
|
||||||
|
|
||||||
def test_extended_ver(self):
|
|
||||||
"""Check handling of extended distro git versions."""
|
|
||||||
ret = self.wrapper.ParseGitVersion(
|
|
||||||
ver_str='git version 1.30.50.696.g5e7596f4ac-goog')
|
|
||||||
self.assertEqual(1, ret.major)
|
|
||||||
self.assertEqual(30, ret.minor)
|
|
||||||
self.assertEqual(50, ret.micro)
|
|
||||||
self.assertEqual('1.30.50.696.g5e7596f4ac-goog', ret.full)
|
|
||||||
|
|
||||||
|
|
||||||
class CheckGitVersion(RepoWrapperTestCase):
|
|
||||||
"""Check _CheckGitVersion behavior."""
|
|
||||||
|
|
||||||
def test_unknown(self):
|
|
||||||
"""Unknown versions should abort."""
|
|
||||||
with mock.patch.object(self.wrapper, 'ParseGitVersion', return_value=None):
|
|
||||||
with self.assertRaises(self.wrapper.CloneFailure):
|
|
||||||
self.wrapper._CheckGitVersion()
|
|
||||||
|
|
||||||
def test_old(self):
|
|
||||||
"""Old versions should abort."""
|
|
||||||
with mock.patch.object(
|
|
||||||
self.wrapper, 'ParseGitVersion',
|
|
||||||
return_value=self.wrapper.GitVersion(1, 0, 0, '1.0.0')):
|
|
||||||
with self.assertRaises(self.wrapper.CloneFailure):
|
|
||||||
self.wrapper._CheckGitVersion()
|
|
||||||
|
|
||||||
def test_new(self):
|
|
||||||
"""Newer versions should run fine."""
|
|
||||||
with mock.patch.object(
|
|
||||||
self.wrapper, 'ParseGitVersion',
|
|
||||||
return_value=self.wrapper.GitVersion(100, 0, 0, '100.0.0')):
|
|
||||||
self.wrapper._CheckGitVersion()
|
|
||||||
|
|
||||||
|
|
||||||
class Requirements(RepoWrapperTestCase):
|
|
||||||
"""Check Requirements handling."""
|
|
||||||
|
|
||||||
def test_missing_file(self):
|
|
||||||
"""Don't crash if the file is missing (old version)."""
|
|
||||||
testdir = os.path.dirname(os.path.realpath(__file__))
|
|
||||||
self.assertIsNone(self.wrapper.Requirements.from_dir(testdir))
|
|
||||||
self.assertIsNone(self.wrapper.Requirements.from_file(
|
|
||||||
os.path.join(testdir, 'xxxxxxxxxxxxxxxxxxxxxxxx')))
|
|
||||||
|
|
||||||
def test_corrupt_data(self):
|
|
||||||
"""If the file can't be parsed, don't blow up."""
|
|
||||||
self.assertIsNone(self.wrapper.Requirements.from_file(__file__))
|
|
||||||
self.assertIsNone(self.wrapper.Requirements.from_data(b'x'))
|
|
||||||
|
|
||||||
def test_valid_data(self):
|
|
||||||
"""Make sure we can parse the file we ship."""
|
|
||||||
self.assertIsNotNone(self.wrapper.Requirements.from_data(b'{}'))
|
|
||||||
rootdir = os.path.dirname(os.path.dirname(os.path.realpath(__file__)))
|
|
||||||
self.assertIsNotNone(self.wrapper.Requirements.from_dir(rootdir))
|
|
||||||
self.assertIsNotNone(self.wrapper.Requirements.from_file(os.path.join(
|
|
||||||
rootdir, 'requirements.json')))
|
|
||||||
|
|
||||||
def test_format_ver(self):
|
|
||||||
"""Check format_ver can format."""
|
|
||||||
self.assertEqual('1.2.3', self.wrapper.Requirements._format_ver((1, 2, 3)))
|
|
||||||
self.assertEqual('1', self.wrapper.Requirements._format_ver([1]))
|
|
||||||
|
|
||||||
def test_assert_all_unknown(self):
|
|
||||||
"""Check assert_all works with incompatible file."""
|
|
||||||
reqs = self.wrapper.Requirements({})
|
|
||||||
reqs.assert_all()
|
|
||||||
|
|
||||||
def test_assert_all_new_repo(self):
|
|
||||||
"""Check assert_all accepts new enough repo."""
|
|
||||||
reqs = self.wrapper.Requirements({'repo': {'hard': [1, 0]}})
|
|
||||||
reqs.assert_all()
|
|
||||||
|
|
||||||
def test_assert_all_old_repo(self):
|
|
||||||
"""Check assert_all rejects old repo."""
|
|
||||||
reqs = self.wrapper.Requirements({'repo': {'hard': [99999, 0]}})
|
|
||||||
with self.assertRaises(SystemExit):
|
|
||||||
reqs.assert_all()
|
|
||||||
|
|
||||||
def test_assert_all_new_python(self):
|
|
||||||
"""Check assert_all accepts new enough python."""
|
|
||||||
reqs = self.wrapper.Requirements({'python': {'hard': sys.version_info}})
|
|
||||||
reqs.assert_all()
|
|
||||||
|
|
||||||
def test_assert_all_old_python(self):
|
|
||||||
"""Check assert_all rejects old python."""
|
|
||||||
reqs = self.wrapper.Requirements({'python': {'hard': [99999, 0]}})
|
|
||||||
with self.assertRaises(SystemExit):
|
|
||||||
reqs.assert_all()
|
|
||||||
|
|
||||||
def test_assert_ver_unknown(self):
|
|
||||||
"""Check assert_ver works with incompatible file."""
|
|
||||||
reqs = self.wrapper.Requirements({})
|
|
||||||
reqs.assert_ver('xxx', (1, 0))
|
|
||||||
|
|
||||||
def test_assert_ver_new(self):
|
|
||||||
"""Check assert_ver allows new enough versions."""
|
|
||||||
reqs = self.wrapper.Requirements({'git': {'hard': [1, 0], 'soft': [2, 0]}})
|
|
||||||
reqs.assert_ver('git', (1, 0))
|
|
||||||
reqs.assert_ver('git', (1, 5))
|
|
||||||
reqs.assert_ver('git', (2, 0))
|
|
||||||
reqs.assert_ver('git', (2, 5))
|
|
||||||
|
|
||||||
def test_assert_ver_old(self):
|
|
||||||
"""Check assert_ver rejects old versions."""
|
|
||||||
reqs = self.wrapper.Requirements({'git': {'hard': [1, 0], 'soft': [2, 0]}})
|
|
||||||
with self.assertRaises(SystemExit):
|
|
||||||
reqs.assert_ver('git', (0, 5))
|
|
||||||
|
|
||||||
|
|
||||||
class NeedSetupGnuPG(RepoWrapperTestCase):
|
|
||||||
"""Check NeedSetupGnuPG behavior."""
|
|
||||||
|
|
||||||
def test_missing_dir(self):
|
|
||||||
"""The ~/.repoconfig tree doesn't exist yet."""
|
|
||||||
with TemporaryDirectory() as tempdir:
|
|
||||||
self.wrapper.home_dot_repo = os.path.join(tempdir, 'foo')
|
|
||||||
self.assertTrue(self.wrapper.NeedSetupGnuPG())
|
|
||||||
|
|
||||||
def test_missing_keyring(self):
|
|
||||||
"""The keyring-version file doesn't exist yet."""
|
|
||||||
with TemporaryDirectory() as tempdir:
|
|
||||||
self.wrapper.home_dot_repo = tempdir
|
|
||||||
self.assertTrue(self.wrapper.NeedSetupGnuPG())
|
|
||||||
|
|
||||||
def test_empty_keyring(self):
|
|
||||||
"""The keyring-version file exists, but is empty."""
|
|
||||||
with TemporaryDirectory() as tempdir:
|
|
||||||
self.wrapper.home_dot_repo = tempdir
|
|
||||||
with open(os.path.join(tempdir, 'keyring-version'), 'w'):
|
|
||||||
pass
|
|
||||||
self.assertTrue(self.wrapper.NeedSetupGnuPG())
|
|
||||||
|
|
||||||
def test_old_keyring(self):
|
|
||||||
"""The keyring-version file exists, but it's old."""
|
|
||||||
with TemporaryDirectory() as tempdir:
|
|
||||||
self.wrapper.home_dot_repo = tempdir
|
|
||||||
with open(os.path.join(tempdir, 'keyring-version'), 'w') as fp:
|
|
||||||
fp.write('1.0\n')
|
|
||||||
self.assertTrue(self.wrapper.NeedSetupGnuPG())
|
|
||||||
|
|
||||||
def test_new_keyring(self):
|
|
||||||
"""The keyring-version file exists, and is up-to-date."""
|
|
||||||
with TemporaryDirectory() as tempdir:
|
|
||||||
self.wrapper.home_dot_repo = tempdir
|
|
||||||
with open(os.path.join(tempdir, 'keyring-version'), 'w') as fp:
|
|
||||||
fp.write('1000.0\n')
|
|
||||||
self.assertFalse(self.wrapper.NeedSetupGnuPG())
|
|
||||||
|
|
||||||
|
|
||||||
class SetupGnuPG(RepoWrapperTestCase):
|
|
||||||
"""Check SetupGnuPG behavior."""
|
|
||||||
|
|
||||||
def test_full(self):
|
|
||||||
"""Make sure it works completely."""
|
|
||||||
with TemporaryDirectory() as tempdir:
|
|
||||||
self.wrapper.home_dot_repo = tempdir
|
|
||||||
self.wrapper.gpg_dir = os.path.join(self.wrapper.home_dot_repo, 'gnupg')
|
|
||||||
self.assertTrue(self.wrapper.SetupGnuPG(True))
|
|
||||||
with open(os.path.join(tempdir, 'keyring-version'), 'r') as fp:
|
|
||||||
data = fp.read()
|
|
||||||
self.assertEqual('.'.join(str(x) for x in self.wrapper.KEYRING_VERSION),
|
|
||||||
data.strip())
|
|
||||||
|
|
||||||
|
|
||||||
class VerifyRev(RepoWrapperTestCase):
|
|
||||||
"""Check verify_rev behavior."""
|
|
||||||
|
|
||||||
def test_verify_passes(self):
|
|
||||||
"""Check when we have a valid signed tag."""
|
|
||||||
desc_result = self.wrapper.RunResult(0, 'v1.0\n', '')
|
|
||||||
gpg_result = self.wrapper.RunResult(0, '', '')
|
|
||||||
with mock.patch.object(self.wrapper, 'run_git',
|
|
||||||
side_effect=(desc_result, gpg_result)):
|
|
||||||
ret = self.wrapper.verify_rev('/', 'refs/heads/stable', '1234', True)
|
|
||||||
self.assertEqual('v1.0^0', ret)
|
|
||||||
|
|
||||||
def test_unsigned_commit(self):
|
|
||||||
"""Check we fall back to signed tag when we have an unsigned commit."""
|
|
||||||
desc_result = self.wrapper.RunResult(0, 'v1.0-10-g1234\n', '')
|
|
||||||
gpg_result = self.wrapper.RunResult(0, '', '')
|
|
||||||
with mock.patch.object(self.wrapper, 'run_git',
|
|
||||||
side_effect=(desc_result, gpg_result)):
|
|
||||||
ret = self.wrapper.verify_rev('/', 'refs/heads/stable', '1234', True)
|
|
||||||
self.assertEqual('v1.0^0', ret)
|
|
||||||
|
|
||||||
def test_verify_fails(self):
|
|
||||||
"""Check we fall back to signed tag when we have an unsigned commit."""
|
|
||||||
desc_result = self.wrapper.RunResult(0, 'v1.0-10-g1234\n', '')
|
|
||||||
gpg_result = Exception
|
|
||||||
with mock.patch.object(self.wrapper, 'run_git',
|
|
||||||
side_effect=(desc_result, gpg_result)):
|
|
||||||
with self.assertRaises(Exception):
|
|
||||||
self.wrapper.verify_rev('/', 'refs/heads/stable', '1234', True)
|
|
||||||
|
|
||||||
|
|
||||||
class GitCheckoutTestCase(RepoWrapperTestCase):
|
|
||||||
"""Tests that use a real/small git checkout."""
|
|
||||||
|
|
||||||
GIT_DIR = None
|
|
||||||
REV_LIST = None
|
|
||||||
|
|
||||||
@classmethod
|
|
||||||
def setUpClass(cls):
|
|
||||||
# Create a repo to operate on, but do it once per-class.
|
|
||||||
cls.GIT_DIR = tempfile.mkdtemp(prefix='repo-rev-tests')
|
|
||||||
run_git = wrapper.Wrapper().run_git
|
|
||||||
|
|
||||||
remote = os.path.join(cls.GIT_DIR, 'remote')
|
|
||||||
os.mkdir(remote)
|
|
||||||
|
|
||||||
# Tests need to assume, that main is default branch at init,
|
|
||||||
# which is not supported in config until 2.28.
|
|
||||||
if git_command.git_require((2, 28, 0)):
|
|
||||||
initstr = '--initial-branch=main'
|
|
||||||
else:
|
|
||||||
# Use template dir for init.
|
|
||||||
templatedir = tempfile.mkdtemp(prefix='.test-template')
|
|
||||||
with open(os.path.join(templatedir, 'HEAD'), 'w') as fp:
|
|
||||||
fp.write('ref: refs/heads/main\n')
|
|
||||||
initstr = '--template=' + templatedir
|
|
||||||
|
|
||||||
run_git('init', initstr, cwd=remote)
|
|
||||||
run_git('commit', '--allow-empty', '-minit', cwd=remote)
|
|
||||||
run_git('branch', 'stable', cwd=remote)
|
|
||||||
run_git('tag', 'v1.0', cwd=remote)
|
|
||||||
run_git('commit', '--allow-empty', '-m2nd commit', cwd=remote)
|
|
||||||
cls.REV_LIST = run_git('rev-list', 'HEAD', cwd=remote).stdout.splitlines()
|
|
||||||
|
|
||||||
run_git('init', cwd=cls.GIT_DIR)
|
|
||||||
run_git('fetch', remote, '+refs/heads/*:refs/remotes/origin/*', cwd=cls.GIT_DIR)
|
|
||||||
|
|
||||||
@classmethod
|
|
||||||
def tearDownClass(cls):
|
|
||||||
if not cls.GIT_DIR:
|
|
||||||
return
|
|
||||||
|
|
||||||
shutil.rmtree(cls.GIT_DIR)
|
|
||||||
|
|
||||||
|
|
||||||
class ResolveRepoRev(GitCheckoutTestCase):
|
|
||||||
"""Check resolve_repo_rev behavior."""
|
|
||||||
|
|
||||||
def test_explicit_branch(self):
|
|
||||||
"""Check refs/heads/branch argument."""
|
|
||||||
rrev, lrev = self.wrapper.resolve_repo_rev(self.GIT_DIR, 'refs/heads/stable')
|
|
||||||
self.assertEqual('refs/heads/stable', rrev)
|
|
||||||
self.assertEqual(self.REV_LIST[1], lrev)
|
|
||||||
|
|
||||||
with self.assertRaises(wrapper.CloneFailure):
|
|
||||||
self.wrapper.resolve_repo_rev(self.GIT_DIR, 'refs/heads/unknown')
|
|
||||||
|
|
||||||
def test_explicit_tag(self):
|
|
||||||
"""Check refs/tags/tag argument."""
|
|
||||||
rrev, lrev = self.wrapper.resolve_repo_rev(self.GIT_DIR, 'refs/tags/v1.0')
|
|
||||||
self.assertEqual('refs/tags/v1.0', rrev)
|
|
||||||
self.assertEqual(self.REV_LIST[1], lrev)
|
|
||||||
|
|
||||||
with self.assertRaises(wrapper.CloneFailure):
|
|
||||||
self.wrapper.resolve_repo_rev(self.GIT_DIR, 'refs/tags/unknown')
|
|
||||||
|
|
||||||
def test_branch_name(self):
|
|
||||||
"""Check branch argument."""
|
|
||||||
rrev, lrev = self.wrapper.resolve_repo_rev(self.GIT_DIR, 'stable')
|
|
||||||
self.assertEqual('refs/heads/stable', rrev)
|
|
||||||
self.assertEqual(self.REV_LIST[1], lrev)
|
|
||||||
|
|
||||||
rrev, lrev = self.wrapper.resolve_repo_rev(self.GIT_DIR, 'main')
|
|
||||||
self.assertEqual('refs/heads/main', rrev)
|
|
||||||
self.assertEqual(self.REV_LIST[0], lrev)
|
|
||||||
|
|
||||||
def test_tag_name(self):
|
|
||||||
"""Check tag argument."""
|
|
||||||
rrev, lrev = self.wrapper.resolve_repo_rev(self.GIT_DIR, 'v1.0')
|
|
||||||
self.assertEqual('refs/tags/v1.0', rrev)
|
|
||||||
self.assertEqual(self.REV_LIST[1], lrev)
|
|
||||||
|
|
||||||
def test_full_commit(self):
|
|
||||||
"""Check specific commit argument."""
|
|
||||||
commit = self.REV_LIST[0]
|
|
||||||
rrev, lrev = self.wrapper.resolve_repo_rev(self.GIT_DIR, commit)
|
|
||||||
self.assertEqual(commit, rrev)
|
|
||||||
self.assertEqual(commit, lrev)
|
|
||||||
|
|
||||||
def test_partial_commit(self):
|
|
||||||
"""Check specific (partial) commit argument."""
|
|
||||||
commit = self.REV_LIST[0][0:20]
|
|
||||||
rrev, lrev = self.wrapper.resolve_repo_rev(self.GIT_DIR, commit)
|
|
||||||
self.assertEqual(self.REV_LIST[0], rrev)
|
|
||||||
self.assertEqual(self.REV_LIST[0], lrev)
|
|
||||||
|
|
||||||
def test_unknown(self):
|
|
||||||
"""Check unknown ref/commit argument."""
|
|
||||||
with self.assertRaises(wrapper.CloneFailure):
|
|
||||||
self.wrapper.resolve_repo_rev(self.GIT_DIR, 'boooooooya')
|
|
||||||
|
|
||||||
|
|
||||||
class CheckRepoVerify(RepoWrapperTestCase):
|
|
||||||
"""Check check_repo_verify behavior."""
|
|
||||||
|
|
||||||
def test_no_verify(self):
|
|
||||||
"""Always fail with --no-repo-verify."""
|
|
||||||
self.assertFalse(self.wrapper.check_repo_verify(False))
|
|
||||||
|
|
||||||
def test_gpg_initialized(self):
|
|
||||||
"""Should pass if gpg is setup already."""
|
|
||||||
with mock.patch.object(self.wrapper, 'NeedSetupGnuPG', return_value=False):
|
|
||||||
self.assertTrue(self.wrapper.check_repo_verify(True))
|
|
||||||
|
|
||||||
def test_need_gpg_setup(self):
|
|
||||||
"""Should pass/fail based on gpg setup."""
|
|
||||||
with mock.patch.object(self.wrapper, 'NeedSetupGnuPG', return_value=True):
|
|
||||||
with mock.patch.object(self.wrapper, 'SetupGnuPG') as m:
|
|
||||||
m.return_value = True
|
|
||||||
self.assertTrue(self.wrapper.check_repo_verify(True))
|
|
||||||
|
|
||||||
m.return_value = False
|
|
||||||
self.assertFalse(self.wrapper.check_repo_verify(True))
|
|
||||||
|
|
||||||
|
|
||||||
class CheckRepoRev(GitCheckoutTestCase):
|
|
||||||
"""Check check_repo_rev behavior."""
|
|
||||||
|
|
||||||
def test_verify_works(self):
|
|
||||||
"""Should pass when verification passes."""
|
|
||||||
with mock.patch.object(self.wrapper, 'check_repo_verify', return_value=True):
|
|
||||||
with mock.patch.object(self.wrapper, 'verify_rev', return_value='12345'):
|
|
||||||
rrev, lrev = self.wrapper.check_repo_rev(self.GIT_DIR, 'stable')
|
|
||||||
self.assertEqual('refs/heads/stable', rrev)
|
|
||||||
self.assertEqual('12345', lrev)
|
|
||||||
|
|
||||||
def test_verify_fails(self):
|
|
||||||
"""Should fail when verification fails."""
|
|
||||||
with mock.patch.object(self.wrapper, 'check_repo_verify', return_value=True):
|
|
||||||
with mock.patch.object(self.wrapper, 'verify_rev', side_effect=Exception):
|
|
||||||
with self.assertRaises(Exception):
|
|
||||||
self.wrapper.check_repo_rev(self.GIT_DIR, 'stable')
|
|
||||||
|
|
||||||
def test_verify_ignore(self):
|
|
||||||
"""Should pass when verification is disabled."""
|
|
||||||
with mock.patch.object(self.wrapper, 'verify_rev', side_effect=Exception):
|
|
||||||
rrev, lrev = self.wrapper.check_repo_rev(self.GIT_DIR, 'stable', repo_verify=False)
|
|
||||||
self.assertEqual('refs/heads/stable', rrev)
|
|
||||||
self.assertEqual(self.REV_LIST[1], lrev)
|
|
||||||
|
|
||||||
|
|
||||||
if __name__ == '__main__':
|
if __name__ == '__main__':
|
||||||
unittest.main()
|
unittest.main()
|
||||||
|
16
tox.ini
16
tox.ini
@ -15,20 +15,8 @@
|
|||||||
# https://tox.readthedocs.io/
|
# https://tox.readthedocs.io/
|
||||||
|
|
||||||
[tox]
|
[tox]
|
||||||
envlist = py35, py36, py37, py38, py39
|
envlist = py27, py36, py37, py38
|
||||||
|
|
||||||
[gh-actions]
|
|
||||||
python =
|
|
||||||
3.5: py35
|
|
||||||
3.6: py36
|
|
||||||
3.7: py37
|
|
||||||
3.8: py38
|
|
||||||
3.9: py39
|
|
||||||
|
|
||||||
[testenv]
|
[testenv]
|
||||||
deps = pytest
|
deps = pytest
|
||||||
commands = {envpython} run_tests
|
commands = {toxinidir}/run_tests
|
||||||
setenv =
|
|
||||||
GIT_AUTHOR_NAME = Repo test author
|
|
||||||
GIT_COMMITTER_NAME = Repo test committer
|
|
||||||
EMAIL = repo@gerrit.nodomain
|
|
||||||
|
@ -1,3 +1,5 @@
|
|||||||
|
# -*- coding:utf-8 -*-
|
||||||
|
#
|
||||||
# Copyright (C) 2014 The Android Open Source Project
|
# Copyright (C) 2014 The Android Open Source Project
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
@ -12,6 +14,7 @@
|
|||||||
# See the License for the specific language governing permissions and
|
# See the License for the specific language governing permissions and
|
||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
|
|
||||||
|
from __future__ import print_function
|
||||||
try:
|
try:
|
||||||
from importlib.machinery import SourceFileLoader
|
from importlib.machinery import SourceFileLoader
|
||||||
_loader = lambda *args: SourceFileLoader(*args).load_module()
|
_loader = lambda *args: SourceFileLoader(*args).load_module()
|
||||||
@ -24,10 +27,7 @@ import os
|
|||||||
def WrapperPath():
|
def WrapperPath():
|
||||||
return os.path.join(os.path.dirname(__file__), 'repo')
|
return os.path.join(os.path.dirname(__file__), 'repo')
|
||||||
|
|
||||||
|
|
||||||
_wrapper_module = None
|
_wrapper_module = None
|
||||||
|
|
||||||
|
|
||||||
def Wrapper():
|
def Wrapper():
|
||||||
global _wrapper_module
|
global _wrapper_module
|
||||||
if not _wrapper_module:
|
if not _wrapper_module:
|
||||||
|
Reference in New Issue
Block a user